IL36485A - Organo-phosphorus derivatives of iminothiazolines and their use as pesticides - Google Patents
Organo-phosphorus derivatives of iminothiazolines and their use as pesticidesInfo
- Publication number
- IL36485A IL36485A IL36485A IL3648571A IL36485A IL 36485 A IL36485 A IL 36485A IL 36485 A IL36485 A IL 36485A IL 3648571 A IL3648571 A IL 3648571A IL 36485 A IL36485 A IL 36485A
- Authority
- IL
- Israel
- Prior art keywords
- set forth
- hydrogen
- methoxy
- methyl
- oxygen
- Prior art date
Links
- 239000000575 pesticide Substances 0.000 title description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 47
- 239000001257 hydrogen Substances 0.000 claims description 47
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 39
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 31
- 229910052760 oxygen Inorganic materials 0.000 claims description 31
- 239000001301 oxygen Substances 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 30
- 239000000203 mixture Substances 0.000 claims description 28
- 229910052717 sulfur Inorganic materials 0.000 claims description 26
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 25
- 239000011593 sulfur Substances 0.000 claims description 25
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- -1 dichloropropenyl Chemical group 0.000 claims description 6
- 241000238631 Hexapoda Species 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 43
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 36
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims 22
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 4
- 125000004414 alkyl thio group Chemical group 0.000 claims 4
- 239000000460 chlorine Substances 0.000 claims 4
- 229910052801 chlorine Inorganic materials 0.000 claims 4
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 claims 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 2
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 claims 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- 150000001875 compounds Chemical class 0.000 description 19
- 241000196324 Embryophyta Species 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 231100000167 toxic agent Toxicity 0.000 description 9
- 239000003440 toxic substance Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- 241001425390 Aphis fabae Species 0.000 description 7
- 241001414823 Lygus hesperus Species 0.000 description 7
- 241001454293 Tetranychus urticae Species 0.000 description 7
- 241000257159 Musca domestica Species 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 244000046052 Phaseolus vulgaris Species 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- 241000208241 Tropaeolum Species 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 238000011156 evaluation Methods 0.000 description 4
- 230000009885 systemic effect Effects 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 241000567412 Estigmene acrea Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001351 alkyl iodides Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 235000013601 eggs Nutrition 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 230000000749 insecticidal effect Effects 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- QSLPNSWXUQHVLP-UHFFFAOYSA-N $l^{1}-sulfanylmethane Chemical compound [S]C QSLPNSWXUQHVLP-UHFFFAOYSA-N 0.000 description 2
- 229920000298 Cellophane Polymers 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- STECJAGHUSJQJN-USLFZFAMSA-N LSM-4015 Chemical compound C1([C@@H](CO)C(=O)OC2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-USLFZFAMSA-N 0.000 description 2
- 241000257226 Muscidae Species 0.000 description 2
- 239000000370 acceptor Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 150000007975 iminium salts Chemical class 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000012085 test solution Substances 0.000 description 2
- MYMALJRSNVUBAI-UHFFFAOYSA-N 1,3-thiazol-4-imine Chemical class N=C1CSC=N1 MYMALJRSNVUBAI-UHFFFAOYSA-N 0.000 description 1
- DJQQQCZPDHWBOX-UHFFFAOYSA-N 3-methyl-1,3-thiazol-2-imine;hydroiodide Chemical compound I.CN1C=CSC1=N DJQQQCZPDHWBOX-UHFFFAOYSA-N 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 244000045232 Canavalia ensiformis Species 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 235000004424 Tropaeolum majus Nutrition 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 235000021186 dishes Nutrition 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 235000021332 kidney beans Nutrition 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 231100000057 systemic toxicity Toxicity 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 230000005945 translocation Effects 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6536—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having nitrogen and sulfur atoms with or without oxygen atoms, as the only ring hetero atoms
- C07F9/6539—Five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2305170A | 1970-03-26 | 1970-03-26 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL36485A0 IL36485A0 (en) | 1971-05-26 |
| IL36485A true IL36485A (en) | 1973-08-29 |
Family
ID=21812846
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL36485A IL36485A (en) | 1970-03-26 | 1971-03-24 | Organo-phosphorus derivatives of iminothiazolines and their use as pesticides |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3694451A (ref) |
| AT (1) | AT308468B (ref) |
| AU (1) | AU2480771A (ref) |
| BE (1) | BE764843A (ref) |
| CA (1) | CA941830A (ref) |
| CH (1) | CH545591A (ref) |
| DE (1) | DE2113915A1 (ref) |
| FR (1) | FR2085105A5 (ref) |
| IL (1) | IL36485A (ref) |
| NL (1) | NL7104111A (ref) |
| ZA (1) | ZA711959B (ref) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4188382A (en) * | 1977-02-25 | 1980-02-12 | Vsesojuzny Nauchno, et al. | Thiazolinyl (thiazolyl) phosphonamidates and phosphoramidates pesticidal and herbicidal compositions based thereon |
| US4652296A (en) * | 1983-05-16 | 1987-03-24 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| TWI601716B (zh) * | 2012-02-29 | 2017-10-11 | Meiji Seika Pharma Co Ltd | Nitrogen-containing heterocyclic derivatives having 2-imino group and pest control agent containing the same |
| EP3478655B1 (de) | 2016-06-29 | 2020-09-30 | Evonik Operations GmbH | Verfahren zur herstellung von tensiden |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL269776A (ref) * | 1960-10-01 | |||
| US3428645A (en) * | 1965-10-23 | 1969-02-18 | Stauffer Chemical Co | Phosphorus esters of certain thiazole derivatives |
| US3714176A (en) * | 1970-03-23 | 1973-01-30 | Stauffer Chemical Co | Pesticidal phosphorous-containing imino oxazolidines |
-
1970
- 1970-03-26 US US23051A patent/US3694451A/en not_active Expired - Lifetime
-
1971
- 1971-01-27 CA CA103,784A patent/CA941830A/en not_active Expired
- 1971-01-29 AU AU24807/71A patent/AU2480771A/en not_active Expired
- 1971-03-23 CH CH422571A patent/CH545591A/xx not_active IP Right Cessation
- 1971-03-23 DE DE19712113915 patent/DE2113915A1/de active Pending
- 1971-03-24 IL IL36485A patent/IL36485A/en unknown
- 1971-03-24 FR FR7110450A patent/FR2085105A5/fr not_active Expired
- 1971-03-25 ZA ZA711959A patent/ZA711959B/xx unknown
- 1971-03-25 BE BE764843A patent/BE764843A/xx unknown
- 1971-03-26 AT AT261371A patent/AT308468B/de not_active IP Right Cessation
- 1971-03-26 NL NL7104111A patent/NL7104111A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2113915A1 (de) | 1971-10-14 |
| NL7104111A (ref) | 1971-09-28 |
| AT308468B (de) | 1973-07-10 |
| FR2085105A5 (ref) | 1971-12-17 |
| AU2480771A (en) | 1972-08-03 |
| US3694451A (en) | 1972-09-26 |
| CH545591A (ref) | 1974-02-15 |
| IL36485A0 (en) | 1971-05-26 |
| BE764843A (fr) | 1971-09-27 |
| CA941830A (en) | 1974-02-12 |
| ZA711959B (en) | 1971-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2908605A (en) | New organic phosphorus compounds and process for their manufacture | |
| US3679733A (en) | N-substituted arylcarbamoyl sulfides | |
| US3725514A (en) | O-aryl o-alkyl s-organo phosphorothidates | |
| IL36485A (en) | Organo-phosphorus derivatives of iminothiazolines and their use as pesticides | |
| US3992425A (en) | Organotin miticidal and insecticial compounds | |
| US4215075A (en) | Ketoxime carbamates | |
| NO811720L (no) | Fremgangsmaate for bekjempelse av insekter, midd og nematoder | |
| US3876780A (en) | Certain 2-phosphorylimine-4-thiazolines used as insecticides and acaricides | |
| US3832370A (en) | Organotin miticidal and insecticidal compounds | |
| US3449493A (en) | Method of controlling pests with 2 - dialkoxy-phosphinothioylimino -1,3-dithioles | |
| US4086239A (en) | Thiazole bis-phosphates and phosphonates, intermediates, and insecticidal compositions and methods | |
| US4194029A (en) | Novel 4-chromanone-7-phosphates and phosphonates and the insecticidal use thereof | |
| US4599329A (en) | O,S-dialkyl S-[carbamyloxyalkyl] dithiophosphates and their use as pesticides | |
| US3947481A (en) | Organotin miticidal and insecticidal compounds | |
| US3420918A (en) | N(carbamyl(thiocarbamyl)methyl)phosphorodithio(thio) or phosphonodithio (thio)acetamides | |
| US3763288A (en) | O lower alkyl o substituted phenyl s alkoxyethylphosphorothiolates | |
| US3364230A (en) | Novel phosphorylated 2-imino-1, 3-dithioles | |
| US4020161A (en) | Thiolophosphoramidates and their use as insecticides | |
| US3022215A (en) | Insecticidally and acaricidally active mono-and dithiophosphoric acid esters | |
| US3420919A (en) | Nitrile amide phosphates and phosphonates | |
| US3803312A (en) | Certain phosphorus containing imino oxazolidines,and their utility | |
| US3475452A (en) | Phosphates and phosphonates of cyclic sulfones | |
| CA1037049A (en) | Succinic acid oximidophosphoric esters | |
| US4018917A (en) | Isourea acetylphosphate insecticides | |
| US3984410A (en) | Isourea acetylphosphate insecticides |