IL36485A - Organo-phosphorus derivatives of iminothiazolines and their use as pesticides - Google Patents
Organo-phosphorus derivatives of iminothiazolines and their use as pesticidesInfo
- Publication number
- IL36485A IL36485A IL36485A IL3648571A IL36485A IL 36485 A IL36485 A IL 36485A IL 36485 A IL36485 A IL 36485A IL 3648571 A IL3648571 A IL 3648571A IL 36485 A IL36485 A IL 36485A
- Authority
- IL
- Israel
- Prior art keywords
- set forth
- hydrogen
- methoxy
- methyl
- oxygen
- Prior art date
Links
- 239000000575 pesticide Substances 0.000 title description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 47
- 239000001257 hydrogen Substances 0.000 claims description 47
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 39
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 31
- 229910052760 oxygen Inorganic materials 0.000 claims description 31
- 239000001301 oxygen Substances 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 30
- 239000000203 mixture Substances 0.000 claims description 28
- 229910052717 sulfur Inorganic materials 0.000 claims description 26
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 25
- 239000011593 sulfur Substances 0.000 claims description 25
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- -1 dichloropropenyl Chemical group 0.000 claims description 6
- 241000238631 Hexapoda Species 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 43
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 36
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims 22
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 4
- 125000004414 alkyl thio group Chemical group 0.000 claims 4
- 239000000460 chlorine Substances 0.000 claims 4
- 229910052801 chlorine Inorganic materials 0.000 claims 4
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 claims 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 2
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 claims 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- 150000001875 compounds Chemical class 0.000 description 19
- 241000196324 Embryophyta Species 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 231100000167 toxic agent Toxicity 0.000 description 9
- 239000003440 toxic substance Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- 241001425390 Aphis fabae Species 0.000 description 7
- 241001414823 Lygus hesperus Species 0.000 description 7
- 241001454293 Tetranychus urticae Species 0.000 description 7
- 241000257159 Musca domestica Species 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 244000046052 Phaseolus vulgaris Species 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- 241000208241 Tropaeolum Species 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 238000011156 evaluation Methods 0.000 description 4
- 230000009885 systemic effect Effects 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 241000567412 Estigmene acrea Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001351 alkyl iodides Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 235000013601 eggs Nutrition 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 230000000749 insecticidal effect Effects 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- QSLPNSWXUQHVLP-UHFFFAOYSA-N $l^{1}-sulfanylmethane Chemical compound [S]C QSLPNSWXUQHVLP-UHFFFAOYSA-N 0.000 description 2
- 229920000298 Cellophane Polymers 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- STECJAGHUSJQJN-USLFZFAMSA-N LSM-4015 Chemical compound C1([C@@H](CO)C(=O)OC2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-USLFZFAMSA-N 0.000 description 2
- 241000257226 Muscidae Species 0.000 description 2
- 239000000370 acceptor Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 150000007975 iminium salts Chemical class 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000012085 test solution Substances 0.000 description 2
- MYMALJRSNVUBAI-UHFFFAOYSA-N 1,3-thiazol-4-imine Chemical class N=C1CSC=N1 MYMALJRSNVUBAI-UHFFFAOYSA-N 0.000 description 1
- DJQQQCZPDHWBOX-UHFFFAOYSA-N 3-methyl-1,3-thiazol-2-imine;hydroiodide Chemical compound I.CN1C=CSC1=N DJQQQCZPDHWBOX-UHFFFAOYSA-N 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 244000045232 Canavalia ensiformis Species 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 235000004424 Tropaeolum majus Nutrition 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 235000021186 dishes Nutrition 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 235000021332 kidney beans Nutrition 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 231100000057 systemic toxicity Toxicity 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 230000005945 translocation Effects 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6536—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having nitrogen and sulfur atoms with or without oxygen atoms, as the only ring hetero atoms
- C07F9/6539—Five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2305170A | 1970-03-26 | 1970-03-26 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL36485A0 IL36485A0 (en) | 1971-05-26 |
| IL36485A true IL36485A (en) | 1973-08-29 |
Family
ID=21812846
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL36485A IL36485A (en) | 1970-03-26 | 1971-03-24 | Organo-phosphorus derivatives of iminothiazolines and their use as pesticides |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3694451A (cs) |
| AT (1) | AT308468B (cs) |
| AU (1) | AU2480771A (cs) |
| BE (1) | BE764843A (cs) |
| CA (1) | CA941830A (cs) |
| CH (1) | CH545591A (cs) |
| DE (1) | DE2113915A1 (cs) |
| FR (1) | FR2085105A5 (cs) |
| IL (1) | IL36485A (cs) |
| NL (1) | NL7104111A (cs) |
| ZA (1) | ZA711959B (cs) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4188382A (en) * | 1977-02-25 | 1980-02-12 | Vsesojuzny Nauchno, et al. | Thiazolinyl (thiazolyl) phosphonamidates and phosphoramidates pesticidal and herbicidal compositions based thereon |
| US4652296A (en) * | 1983-05-16 | 1987-03-24 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| JP6236396B2 (ja) * | 2012-02-29 | 2017-11-22 | Meiji Seikaファルマ株式会社 | 2−イミノ基を有する含窒素ヘテロ環誘導体及びそれを含んでなる有害生物防除剤 |
| WO2018001680A1 (de) | 2016-06-29 | 2018-01-04 | Evonik Degussa Gmbh | Verfahren zur herstellung von tensiden |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE608623A (cs) * | 1960-10-01 | |||
| US3428645A (en) * | 1965-10-23 | 1969-02-18 | Stauffer Chemical Co | Phosphorus esters of certain thiazole derivatives |
| US3714176A (en) * | 1970-03-23 | 1973-01-30 | Stauffer Chemical Co | Pesticidal phosphorous-containing imino oxazolidines |
-
1970
- 1970-03-26 US US23051A patent/US3694451A/en not_active Expired - Lifetime
-
1971
- 1971-01-27 CA CA103,784A patent/CA941830A/en not_active Expired
- 1971-01-29 AU AU24807/71A patent/AU2480771A/en not_active Expired
- 1971-03-23 CH CH422571A patent/CH545591A/xx not_active IP Right Cessation
- 1971-03-23 DE DE19712113915 patent/DE2113915A1/de active Pending
- 1971-03-24 FR FR7110450A patent/FR2085105A5/fr not_active Expired
- 1971-03-24 IL IL36485A patent/IL36485A/en unknown
- 1971-03-25 BE BE764843A patent/BE764843A/xx unknown
- 1971-03-25 ZA ZA711959A patent/ZA711959B/xx unknown
- 1971-03-26 AT AT261371A patent/AT308468B/de not_active IP Right Cessation
- 1971-03-26 NL NL7104111A patent/NL7104111A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH545591A (cs) | 1974-02-15 |
| IL36485A0 (en) | 1971-05-26 |
| US3694451A (en) | 1972-09-26 |
| AU2480771A (en) | 1972-08-03 |
| BE764843A (fr) | 1971-09-27 |
| FR2085105A5 (cs) | 1971-12-17 |
| CA941830A (en) | 1974-02-12 |
| DE2113915A1 (de) | 1971-10-14 |
| ZA711959B (en) | 1971-12-29 |
| NL7104111A (cs) | 1971-09-28 |
| AT308468B (de) | 1973-07-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2908605A (en) | New organic phosphorus compounds and process for their manufacture | |
| US3679733A (en) | N-substituted arylcarbamoyl sulfides | |
| US3725514A (en) | O-aryl o-alkyl s-organo phosphorothidates | |
| IL36485A (en) | Organo-phosphorus derivatives of iminothiazolines and their use as pesticides | |
| US4128581A (en) | Ketoxime carbamates | |
| US3992425A (en) | Organotin miticidal and insecticial compounds | |
| US4215075A (en) | Ketoxime carbamates | |
| NO811720L (no) | Fremgangsmaate for bekjempelse av insekter, midd og nematoder | |
| US3876780A (en) | Certain 2-phosphorylimine-4-thiazolines used as insecticides and acaricides | |
| US3832370A (en) | Organotin miticidal and insecticidal compounds | |
| US4086239A (en) | Thiazole bis-phosphates and phosphonates, intermediates, and insecticidal compositions and methods | |
| US4194029A (en) | Novel 4-chromanone-7-phosphates and phosphonates and the insecticidal use thereof | |
| US4599329A (en) | O,S-dialkyl S-[carbamyloxyalkyl] dithiophosphates and their use as pesticides | |
| US3947481A (en) | Organotin miticidal and insecticidal compounds | |
| US3420918A (en) | N(carbamyl(thiocarbamyl)methyl)phosphorodithio(thio) or phosphonodithio (thio)acetamides | |
| US3763288A (en) | O lower alkyl o substituted phenyl s alkoxyethylphosphorothiolates | |
| US3364230A (en) | Novel phosphorylated 2-imino-1, 3-dithioles | |
| US4020161A (en) | Thiolophosphoramidates and their use as insecticides | |
| US3022215A (en) | Insecticidally and acaricidally active mono-and dithiophosphoric acid esters | |
| US3420919A (en) | Nitrile amide phosphates and phosphonates | |
| US3803312A (en) | Certain phosphorus containing imino oxazolidines,and their utility | |
| US3475452A (en) | Phosphates and phosphonates of cyclic sulfones | |
| US4018917A (en) | Isourea acetylphosphate insecticides | |
| US3984410A (en) | Isourea acetylphosphate insecticides | |
| US3433870A (en) | Method of killing pests by application of an o,o-diloweralkyl phosphorodithioyl methyl-substituted mercaptoacetate |