IL36261A - 1-(2-hydroxy-3-methoxy-3-phenylpropyl)-4-(2-methoxy-2-phenylethyl)-piperazine and salts thereof,its preparation and pharmaceutical compositions containing it - Google Patents
1-(2-hydroxy-3-methoxy-3-phenylpropyl)-4-(2-methoxy-2-phenylethyl)-piperazine and salts thereof,its preparation and pharmaceutical compositions containing itInfo
- Publication number
- IL36261A IL36261A IL36261A IL3626171A IL36261A IL 36261 A IL36261 A IL 36261A IL 36261 A IL36261 A IL 36261A IL 3626171 A IL3626171 A IL 3626171A IL 36261 A IL36261 A IL 36261A
- Authority
- IL
- Israel
- Prior art keywords
- methoxy
- phenylpropyl
- phenylethyl
- piperazine
- hydroxy
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
- VSTNNAYSCJQCQI-UHFFFAOYSA-N zipeprol Chemical compound C=1C=CC=CC=1C(OC)CN(CC1)CCN1CC(O)C(OC)C1=CC=CC=C1 VSTNNAYSCJQCQI-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/092—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings with aromatic radicals attached to the chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR707007383A FR2081557B1 (ja) | 1970-03-02 | 1970-03-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL36261A0 IL36261A0 (en) | 1971-04-28 |
| IL36261A true IL36261A (en) | 1974-09-10 |
Family
ID=9051501
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL36261A IL36261A (en) | 1970-03-02 | 1971-02-22 | 1-(2-hydroxy-3-methoxy-3-phenylpropyl)-4-(2-methoxy-2-phenylethyl)-piperazine and salts thereof,its preparation and pharmaceutical compositions containing it |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3718650A (ja) |
| JP (1) | JPS502991B1 (ja) |
| BE (1) | BE763150A (ja) |
| CA (1) | CA966133A (ja) |
| CH (1) | CH530403A (ja) |
| ES (1) | ES388564A1 (ja) |
| FR (1) | FR2081557B1 (ja) |
| GB (1) | GB1316702A (ja) |
| IL (1) | IL36261A (ja) |
| ZA (1) | ZA711081B (ja) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2154493B1 (ja) * | 1971-09-13 | 1975-10-31 | Kali Chemie Ag |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2963483A (en) * | 1958-12-22 | 1960-12-06 | Union Carbide Corp | Nu-glycidylpiperazine and method of making it |
| US3036076A (en) * | 1960-05-18 | 1962-05-22 | Grace W R & Co | Piperazine derivatives |
| US3378553A (en) * | 1965-02-11 | 1968-04-16 | Warner Lambert Pharmaceutical | Substituted 1, 4-bis(beta-phenyl-beta-acyloxyethyl)piperazines and their pharmaceutically acceptable acid addition salts |
| NL143925C (ja) * | 1965-03-09 | |||
| GB1174412A (en) * | 1966-08-23 | 1969-12-17 | Rech S Et D Applic Scient Et M | Improvements in or relating to Piperazine Derivatives |
| GB1171251A (en) * | 1967-07-05 | 1969-11-19 | British Drug Houses Ltd | Preparation of Piperazine Derivatives |
-
1970
- 1970-03-02 FR FR707007383A patent/FR2081557B1/fr not_active Expired
-
1971
- 1971-02-18 BE BE763150A patent/BE763150A/xx not_active IP Right Cessation
- 1971-02-19 ZA ZA711081A patent/ZA711081B/xx unknown
- 1971-02-19 CA CA105,775A patent/CA966133A/en not_active Expired
- 1971-02-22 IL IL36261A patent/IL36261A/xx unknown
- 1971-02-23 US US00118077A patent/US3718650A/en not_active Expired - Lifetime
- 1971-02-24 ES ES388564A patent/ES388564A1/es not_active Expired
- 1971-03-01 JP JP46010346A patent/JPS502991B1/ja active Pending
- 1971-03-01 CH CH292071A patent/CH530403A/fr not_active IP Right Cessation
- 1971-04-19 GB GB2271471A patent/GB1316702A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH530403A (fr) | 1972-11-15 |
| DE2109366A1 (de) | 1971-09-30 |
| FR2081557A1 (ja) | 1971-12-10 |
| JPS502991B1 (ja) | 1975-01-30 |
| US3718650A (en) | 1973-02-27 |
| CA966133A (en) | 1975-04-15 |
| FR2081557B1 (ja) | 1973-08-10 |
| GB1316702A (en) | 1973-05-16 |
| IL36261A0 (en) | 1971-04-28 |
| ES388564A1 (es) | 1974-02-01 |
| ZA711081B (en) | 1971-10-27 |
| BE763150A (fr) | 1971-08-18 |
| DE2109366B2 (de) | 1975-07-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL36237A0 (en) | Substituted benzylimidazolidinones,their preparation and pharmaceutical compositions containing them | |
| IL33508A (en) | 1-phenyl-4-phenoxy or phenyl thiohydrocarbyl piperazines,their preparation and pharmaceutical compositions containing them | |
| IL37492A0 (en) | New azepine derivative,their salts,preparation thereof and pharmaceutical compositions containing them | |
| IL37788A0 (en) | New pyridazinone compounds,their preparation and pharmaceutical compositions containing them | |
| IL37598A0 (en) | Bis-chromonyloxy compounds,their preparation and pharmaceutical compositions containing them | |
| IL36506A0 (en) | New heterocyclic compounds,their preparation and pharmaceutical compositions containing them | |
| IL36345A0 (en) | Benzhydryl-piperazine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL38406A (en) | 4-(3-methyl-1-triazeno)benzamides,their preparation and pharmaceutical compositions containing them | |
| IL36559A0 (en) | Piperidine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL36261A (en) | 1-(2-hydroxy-3-methoxy-3-phenylpropyl)-4-(2-methoxy-2-phenylethyl)-piperazine and salts thereof,its preparation and pharmaceutical compositions containing it | |
| IL35988A0 (en) | Substituted pyrrolidines,their preparation and pharmaceutical compositions containing them | |
| IL36300A0 (en) | Piperazine derivatives,their manufacture and pharmaceutical compositions containing them | |
| IL36743A (en) | Phenylaminoalkanes,their preparation and pharmaceutical compositions containing them | |
| IL38440A0 (en) | Substituted dioxypiperidines,their preparation and pharmaceutical compositions containing them | |
| IL37588A0 (en) | Pyrimidoisoquinolines,their preparation and pharmaceutical compositions containing them | |
| IL37078A0 (en) | New salicoins,their preparation and pharmaceutical and veterinary compositions containing them | |
| IL37146A (en) | Indenopyrrole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL36269A0 (en) | Substituted aminoethanols and salts thereof,their preparation and pharmaceutical compositions containing them | |
| IL36855A0 (en) | Azobis-imidazolium salts,their preparation and pharmaceutical compositions containing them | |
| IL37438A0 (en) | Piperidine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL36827A0 (en) | Tetrahydropyridine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL43566A (en) | Pharmaceutical compositions containing 1-(2-pyridyl)piperazine and levodopa | |
| IL36160A (en) | 7-azido-5-phenyl-dihydro-benzodiazepine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL37601A0 (en) | Pharmaceutical compositions containing 6-membered azacyclic compounds,certain novel such compounds and their preparation | |
| IL35976A0 (en) | Cardenolide-rhamnosides,their preparation and pharmaceutical compositions containing them |