IL35717A0 - Quinoxaline-2-carboxylic acid derivatives,their preparation and pharmaceutical compositions containing them - Google Patents
Quinoxaline-2-carboxylic acid derivatives,their preparation and pharmaceutical compositions containing themInfo
- Publication number
- IL35717A0 IL35717A0 IL35717A IL3571770A IL35717A0 IL 35717 A0 IL35717 A0 IL 35717A0 IL 35717 A IL35717 A IL 35717A IL 3571770 A IL3571770 A IL 3571770A IL 35717 A0 IL35717 A0 IL 35717A0
- Authority
- IL
- Israel
- Prior art keywords
- quinoxaline
- preparation
- carboxylic acid
- pharmaceutical compositions
- compositions containing
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title 1
- UPUZGXILYFKSGE-UHFFFAOYSA-N quinoxaline-2-carboxylic acid Chemical class C1=CC=CC2=NC(C(=O)O)=CN=C21 UPUZGXILYFKSGE-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/50—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to ring nitrogen atoms
- C07D241/52—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1852069A CH538488A (de) | 1969-12-12 | 1969-12-12 | Verfahren zur Herstellung von heterocyclischen Verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL35717A0 true IL35717A0 (en) | 1971-01-28 |
Family
ID=4433547
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL35717A IL35717A0 (en) | 1969-12-12 | 1970-11-24 | Quinoxaline-2-carboxylic acid derivatives,their preparation and pharmaceutical compositions containing them |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3759912A (enExample) |
| AT (1) | AT303733B (enExample) |
| BE (1) | BE760192A (enExample) |
| CH (1) | CH538488A (enExample) |
| DE (1) | DE2059824A1 (enExample) |
| ES (1) | ES386336A1 (enExample) |
| FR (1) | FR2081348B1 (enExample) |
| GB (1) | GB1292551A (enExample) |
| IL (1) | IL35717A0 (enExample) |
| NL (1) | NL7015999A (enExample) |
| ZA (1) | ZA707762B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3818007A (en) * | 1970-03-18 | 1974-06-18 | Pfizer | Hydroxyalkyl esters of quinoxaline-di-n-oxide-2-carboxylic acid |
| US4006142A (en) * | 1973-03-07 | 1977-02-01 | Pfizer Inc. | Preparation of methyl-3-(2-quinoxalinylmethylene)carbazate-N1,N4 -dioxide |
| US4211781A (en) * | 1974-09-23 | 1980-07-08 | Pfizer Inc. | Process for the preparation of dustless quinoxaline-1,4-dioxide animal feed supplement premixes |
| CS195508B1 (en) * | 1977-08-02 | 1980-02-29 | Jaromir Hebky | Cyanacetylhydrazones of 2-formylquinoxalin-1,4-dioxide |
| CN101016267B (zh) * | 2007-01-26 | 2010-08-11 | 华中农业大学 | 3-甲基喹喔啉-2-羧酸的化学合成方法 |
| CN100427474C (zh) * | 2007-01-26 | 2008-10-22 | 华中农业大学 | 一种制备3-甲基喹喔啉-2-羧酸的方法 |
| US8669363B2 (en) | 2011-03-24 | 2014-03-11 | Southern Methodist University | Quinoxaline compounds and derivatives |
| US9493452B2 (en) | 2011-03-24 | 2016-11-15 | Southern Methodist University | Compounds and derivatives of 2H-pyrido (3,2-b)(1, 4) oxazin 3)4H)-ones as raf kinase and LRRK2 inhibitors |
| WO2013142831A1 (en) | 2012-03-23 | 2013-09-26 | Southern Methodist University | Methods of making and using thioxothiazolidine and rhodanine derivatives as hiv-1 and jsp-1 inhibitors |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1410969A (fr) * | 1962-04-12 | 1965-09-17 | Fisons Pest Control Ltd | Composition fongicide à usage agricole |
| GB1134729A (en) * | 1966-11-08 | 1968-11-27 | Research Corp | Quinoxaline-di-n-oxides |
| DE1670936C3 (de) * | 1967-10-04 | 1979-03-22 | Bayer Ag, 5090 Leverkusen | 3-Carbonsäureamido-chinoxalin-di-Nojdde-0,4), ein Verfahren zu ihrer Herstellung und diese enthaltende antibakterielle Mittel |
-
1969
- 1969-12-12 CH CH1852069A patent/CH538488A/de not_active IP Right Cessation
-
1970
- 1970-11-02 NL NL7015999A patent/NL7015999A/xx unknown
- 1970-11-17 ZA ZA707762A patent/ZA707762B/xx unknown
- 1970-11-24 IL IL35717A patent/IL35717A0/xx unknown
- 1970-11-25 US US00092905A patent/US3759912A/en not_active Expired - Lifetime
- 1970-12-04 DE DE19702059824 patent/DE2059824A1/de active Pending
- 1970-12-10 GB GB58719/70A patent/GB1292551A/en not_active Expired
- 1970-12-11 ES ES386336A patent/ES386336A1/es not_active Expired
- 1970-12-11 AT AT1115770A patent/AT303733B/de not_active IP Right Cessation
- 1970-12-11 FR FR7044726A patent/FR2081348B1/fr not_active Expired
- 1970-12-11 BE BE760192A patent/BE760192A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2081348B1 (enExample) | 1974-05-24 |
| US3759912A (en) | 1973-09-18 |
| FR2081348A1 (enExample) | 1971-12-03 |
| BE760192A (fr) | 1971-06-11 |
| ZA707762B (en) | 1971-08-25 |
| AT303733B (de) | 1972-12-11 |
| ES386336A1 (es) | 1973-03-16 |
| GB1292551A (en) | 1972-10-11 |
| NL7015999A (enExample) | 1971-06-15 |
| CH538488A (de) | 1973-06-30 |
| DE2059824A1 (de) | 1971-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL35400A0 (en) | Furoyl and thenoylphenoxy acetic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL33526A (en) | Sulphamyl-benzoic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL33500A0 (en) | Thiazolyl-benzoic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL33846A0 (en) | Derivatives of 1-thiachromone and 4-thionchromone,their preparation and pharmaceutical compositions containing them | |
| IL34195A (en) | Thiocarbamic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL33925A0 (en) | Acetyl-guanidine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL33783A0 (en) | Pteridine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL35717A0 (en) | Quinoxaline-2-carboxylic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL34279A0 (en) | New sulfamyl-anthranilic acids,their preparation and pharmaceutical compositions containing them | |
| IL35656A (en) | Substituted hydroxycrotonic acids and their salts,their preparation and pharmaceutical compositions containing them | |
| IL35490A (en) | 6-amidino-penicillanic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL33626A0 (en) | Benzodiazepine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL34328A (en) | Isoquinoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL34947A0 (en) | Pyridobenzodiazepin-6-one derivatives,their preparation and pharmaceutical compositions containing them | |
| IL35779A (en) | 4-amino-quinazoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL35211A0 (en) | 4-aryl-4-hydroxy-piperidine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL33745A0 (en) | Phenylserine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL33821A0 (en) | New benzodiazepine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL34086A0 (en) | Triazole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL35204A0 (en) | Derivatives of 4-amino-2-methylpyrimidine,their preparation and pharmaceutical compositions containing them | |
| IL34468A0 (en) | Acid addition salts of indenopyridine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL34158A (en) | Adamantylcarboxamidophenylacetic acid and its derivatives, their preparation and pharmaceutical compositions containing them | |
| IL33993A (en) | Aminopropiophenones,their preparation and pharmaceutical compositions containing them | |
| IL34271A0 (en) | Benzodiazepine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL33961A0 (en) | Benzodiazepine derivatives,their preparation and pharmaceutical compositions containing them |