IL33158A - Substituted benzyl thiolcarbamic acid esters,their production and use as herbicides and insecticides - Google Patents
Substituted benzyl thiolcarbamic acid esters,their production and use as herbicides and insecticidesInfo
- Publication number
- IL33158A IL33158A IL33158A IL3315869A IL33158A IL 33158 A IL33158 A IL 33158A IL 33158 A IL33158 A IL 33158A IL 3315869 A IL3315869 A IL 3315869A IL 33158 A IL33158 A IL 33158A
- Authority
- IL
- Israel
- Prior art keywords
- insecticides
- herbicides
- production
- acid esters
- substituted benzyl
- Prior art date
Links
- VEKUDICGPBCNLM-UHFFFAOYSA-N (3-benzylthiophen-2-yl)carbamic acid Chemical class C(C1=CC=CC=C1)C1=C(SC=C1)NC(=O)O VEKUDICGPBCNLM-UHFFFAOYSA-N 0.000 title 1
- 239000004009 herbicide Substances 0.000 title 1
- 239000002917 insecticide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C333/00—Derivatives of thiocarbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C333/02—Monothiocarbamic acids; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8224968 | 1968-11-12 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL33158A0 IL33158A0 (en) | 1969-12-31 |
| IL33158A true IL33158A (en) | 1974-05-16 |
Family
ID=13769143
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL33158A IL33158A (en) | 1968-11-12 | 1969-10-10 | Substituted benzyl thiolcarbamic acid esters,their production and use as herbicides and insecticides |
Country Status (12)
| Country | Link |
|---|---|
| BE (1) | BE741552A (oth) |
| BG (1) | BG17935A3 (oth) |
| CH (1) | CH516906A (oth) |
| CS (1) | CS158256B2 (oth) |
| DE (1) | DE1955892C3 (oth) |
| ES (1) | ES373398A1 (oth) |
| FR (1) | FR2023130A1 (oth) |
| GB (1) | GB1287131A (oth) |
| IL (1) | IL33158A (oth) |
| NL (1) | NL6916857A (oth) |
| PL (1) | PL72713B1 (oth) |
| RO (1) | RO70849A (oth) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3846467A (en) * | 1968-11-12 | 1974-11-05 | Bayer Ag | 2-methoxy-5-fluorobenzyl n,n-dimethyl-thiolcarbamate |
| US4056549A (en) * | 1976-06-07 | 1977-11-01 | Ppg Industries, Inc. | S-3-Methoxyphenyl N-alkylthiolcarbamates and S-3-methylthiophenyl N-alkylthiolcarbamates |
-
1969
- 1969-10-09 CH CH1518669A patent/CH516906A/de not_active IP Right Cessation
- 1969-10-10 IL IL33158A patent/IL33158A/xx unknown
- 1969-10-28 BG BG013259A patent/BG17935A3/xx unknown
- 1969-10-28 GB GB52742/69A patent/GB1287131A/en not_active Expired
- 1969-10-30 RO RO6961413A patent/RO70849A/ro unknown
- 1969-11-06 DE DE1955892A patent/DE1955892C3/de not_active Expired
- 1969-11-06 CS CS733369A patent/CS158256B2/cs unknown
- 1969-11-07 NL NL6916857A patent/NL6916857A/xx not_active Application Discontinuation
- 1969-11-11 ES ES373398A patent/ES373398A1/es not_active Expired
- 1969-11-11 PL PL1969136835A patent/PL72713B1/pl unknown
- 1969-11-12 BE BE741552D patent/BE741552A/xx unknown
- 1969-11-12 FR FR6938860A patent/FR2023130A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| PL72713B1 (oth) | 1974-08-30 |
| IL33158A0 (en) | 1969-12-31 |
| NL6916857A (oth) | 1970-05-14 |
| RO70849A (ro) | 1980-10-30 |
| DE1955892C3 (de) | 1980-05-22 |
| CH516906A (de) | 1971-12-31 |
| CS158256B2 (oth) | 1974-10-15 |
| BG17935A3 (bg) | 1974-03-05 |
| GB1287131A (en) | 1972-08-31 |
| DE1955892A1 (de) | 1970-07-02 |
| BE741552A (oth) | 1970-05-12 |
| ES373398A1 (es) | 1972-04-16 |
| FR2023130A1 (oth) | 1970-08-07 |
| DE1955892B2 (de) | 1979-09-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL30093A0 (en) | Phosphoric acid esters,manufacture thereof and their use as insecticides | |
| IL33726A0 (en) | Amidothionophosphoric acid esters,their preparation and use as herbicides | |
| IL42062A (en) | O-pyrazolo-phosphoric,-thiono-phosphoric,-phosphonic and-thionophosphonic acid esters,their production and their use as insecticides and acaricides | |
| IL41838A (en) | Halogenophenyl-pyridazino-thionophosphoric and thionophosphonic acid esters,their production and their use as insecticides and acaricides | |
| PH9352A (en) | Novel amidothionophosphoric acid esters and their use as herbicides,insecticides,and nematocides | |
| MY7000099A (en) | Dithiophosphoric acid esters, their preparation and use as pesticides | |
| IL32061A (en) | Indanyl-n-methylcarbamic acid esters,their preparation and use for pest control | |
| IL32639A0 (en) | Heterocyclic thiophosphoric acid esters,their manufacture and use as pesticides | |
| IL33158A (en) | Substituted benzyl thiolcarbamic acid esters,their production and use as herbicides and insecticides | |
| IL31640A0 (en) | Thionophosphonic acid esters,their preparation and use for pest control | |
| IL33985A0 (en) | Organophosphoric acid esters,their production and their use as insecticides or fungicides | |
| IL35266A0 (en) | New phosphoric acid esters,their production and their use as pesticides | |
| IL41500A0 (en) | O-alkyl-s-carbamoyloxymethyl-thiophosphoric,thionothiolphosphoric,thiolphosphonic and thionothiolphosphonic acid esters,their production and their use as insecticides and acaricides | |
| IL42084A (en) | Thiolphosphoric acid esters,their manufacture and their use as pesticides | |
| IL41934A (en) | Dithio-and trithiophosphonic acid esters,their production and their use as pesticides | |
| IL32677A0 (en) | O-alkyl-o-phenylthiolphosphoric acid esters,their preparation and use as pesticides | |
| IL33256A0 (en) | Phenoxyacetic acid derivatives,their manufacture and their use as pesticides | |
| IL42433A0 (en) | Substituted benzimidazol-2-yl-carbamic acid ketonoxime esters,their manufacture and their use as fungicides and microbiocides | |
| IL34981A0 (en) | New thiophosphoric acid esters,their production and their use as insecticides and fungicides | |
| IL34100A0 (en) | O-alkyl-o-phenyl-thiono-thiolphosphoric acid esters,their production and their use as insecticides and acaricides | |
| IL33232A0 (en) | N-trihalomethylmercapto n-trifluoromethylaminobenzoic acids,their production and their use as insecticides and acaricides | |
| IL33743A0 (en) | Thiol-or thionothiol-phosphoric and -phosphonic acid esters,their preparation and use as pesticides | |
| IL35356A0 (en) | New o,o-dialkyl-thionophosphoric acid esters and their use as insecticides | |
| IL30205A0 (en) | Phosphoric acid esters,their manufacture and use as insecticides | |
| IL34225A0 (en) | Trithiolphosphoric acid esters,their production and their use as pesticides |