IL32248A0 - 2,5-dimethyl-1,3,4,9b-tetrahydro-2h-indeno(1,2-c)pyridine and its production - Google Patents
2,5-dimethyl-1,3,4,9b-tetrahydro-2h-indeno(1,2-c)pyridine and its productionInfo
- Publication number
- IL32248A0 IL32248A0 IL32248A IL3224869A IL32248A0 IL 32248 A0 IL32248 A0 IL 32248A0 IL 32248 A IL32248 A IL 32248A IL 3224869 A IL3224869 A IL 3224869A IL 32248 A0 IL32248 A0 IL 32248A0
- Authority
- IL
- Israel
- Prior art keywords
- indeno
- tetrahydro
- pyridine
- dimethyl
- production
- Prior art date
Links
- JNDQHYUJKITBRY-UHFFFAOYSA-N 2,5-dimethyl-1,3,4,9b-tetrahydroindeno[1,2-c]pyridine Chemical compound C1=CC=C2C(CN(C)CC3)C3=C(C)C2=C1 JNDQHYUJKITBRY-UHFFFAOYSA-N 0.000 title 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH756168A CH503028A (de) | 1968-05-21 | 1968-05-21 | Verfahren zur Herstellung von 1,3,4,9b-Tetrahydro-2,5-dimethyl-2H-indeno(1,2-c)pyridin |
| CH1765268 | 1968-11-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL32248A0 true IL32248A0 (en) | 1969-07-30 |
Family
ID=25701571
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL32248A IL32248A0 (en) | 1968-05-21 | 1969-05-20 | 2,5-dimethyl-1,3,4,9b-tetrahydro-2h-indeno(1,2-c)pyridine and its production |
Country Status (5)
| Country | Link |
|---|---|
| BG (1) | BG15216A3 (member.php) |
| ES (3) | ES367384A1 (member.php) |
| IL (1) | IL32248A0 (member.php) |
| PL (1) | PL80136B1 (member.php) |
| RO (2) | RO56167A (member.php) |
-
1968
- 1968-05-19 ES ES367384A patent/ES367384A1/es not_active Expired
-
1969
- 1969-04-15 RO RO5974169A patent/RO56167A/ro unknown
- 1969-04-15 RO RO6500369A patent/RO62325A/ro unknown
- 1969-05-19 PL PL13368269A patent/PL80136B1/pl unknown
- 1969-05-20 BG BG012822A patent/BG15216A3/bg unknown
- 1969-05-20 IL IL32248A patent/IL32248A0/xx unknown
-
1970
- 1970-04-14 ES ES378548A patent/ES378548A1/es not_active Expired
- 1970-04-14 ES ES378547A patent/ES378547A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES378548A1 (es) | 1973-02-01 |
| PL80136B1 (member.php) | 1975-08-30 |
| BG15216A3 (bg) | 1975-10-20 |
| ES367384A1 (es) | 1971-04-01 |
| ES378547A1 (es) | 1973-02-01 |
| RO56167A (member.php) | 1974-03-01 |
| RO62325A (member.php) | 1977-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA695648B (en) | 3,4-dihydronaphthalenoneoxy-2-hydroxy-propylamines | |
| IL33350A0 (en) | N-alkyl-1,4-dihydropyridines and their production | |
| IL32288A0 (en) | New penicillins and their production | |
| IL32973A0 (en) | 4,6-dichloro-delta4,6-oestradienes | |
| IE33126B1 (en) | New pyrazolodiazepinone compounds and methods for their production | |
| YU15369A (en) | Kontaktor z izboljsanim elektromagnetskim krmiljenjem | |
| IL33146A0 (en) | Perchlorination process | |
| IL32248A0 (en) | 2,5-dimethyl-1,3,4,9b-tetrahydro-2h-indeno(1,2-c)pyridine and its production | |
| KE2541A (en) | New isothiocyano-diphenylamines their production and compositions containing same | |
| YU161369A (en) | Postupak przenja i preciscavanja hlorinacijom | |
| YU32813B (en) | Akumulator z medcelicnimi zvezami | |
| IL35891A (en) | New thienobenzothiepinopyrrole derivatives and their production | |
| YU160469A (en) | Postupak za dobijanje 1-metil-2,3,5,6-tetrahidro-5-semikarbazida-6-hidroksi-indol-3-sulfonske kiseline | |
| AU440072B2 (en) | 2, 5-DIMETHYL-l, 3, 4, 9b-TETRAHYDRO-2H-INDENO(1, 2-c PYRIDINE | |
| AU5528969A (en) | 2, 5-DIMETHYL-l, 3, 4, 9b-TETRAHYDRO-2H-INDENO(1, 2-c PYRIDINE | |
| CA789022A (en) | Pyridine production | |
| ZA696156B (en) | Spray-cooking process | |
| YU212369A (en) | Postopek za pripravo novih amido-kinoksalin-di-n-oksidov-(1,4)-3-karboksilne kisline | |
| CA955260A (en) | 1,3,4,4a,5,9b-hexahydro-5-phenyl-2h-indeno(1,2-c)-pyridine | |
| CA30779S (en) | Figurine | |
| CA30996S (en) | Figurine | |
| CA30375S (en) | Doll | |
| IE33851B1 (en) | Novel pyridine derivatives | |
| CA796187A (en) | Earth-boring machine | |
| CA794389A (en) | Seco-steroid-guanyl-hydrazones and their production |