IL32107A - Carbamoylphosphonates and their use as plant growth regulants - Google Patents
Carbamoylphosphonates and their use as plant growth regulantsInfo
- Publication number
- IL32107A IL32107A IL32107A IL3210769A IL32107A IL 32107 A IL32107 A IL 32107A IL 32107 A IL32107 A IL 32107A IL 3210769 A IL3210769 A IL 3210769A IL 32107 A IL32107 A IL 32107A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- carbon atoms
- carbamoylphosphonate
- weight percent
- ammonium
- Prior art date
Links
- VNVRRNRPVIZREH-UHFFFAOYSA-N carbamoylphosphonic acid Chemical class NC(=O)P(O)(O)=O VNVRRNRPVIZREH-UHFFFAOYSA-N 0.000 title claims description 32
- 230000008635 plant growth Effects 0.000 title claims description 19
- 239000000203 mixture Substances 0.000 claims description 73
- 150000001875 compounds Chemical class 0.000 claims description 70
- 125000004432 carbon atom Chemical group C* 0.000 claims description 62
- 238000000034 method Methods 0.000 claims description 58
- 241000196324 Embryophyta Species 0.000 claims description 47
- 230000012010 growth Effects 0.000 claims description 33
- 125000000217 alkyl group Chemical group 0.000 claims description 30
- 229910052739 hydrogen Inorganic materials 0.000 claims description 28
- 239000001257 hydrogen Substances 0.000 claims description 28
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 23
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 19
- 239000000080 wetting agent Substances 0.000 claims description 18
- 239000004606 Fillers/Extenders Substances 0.000 claims description 15
- 238000003306 harvesting Methods 0.000 claims description 15
- 125000003342 alkenyl group Chemical group 0.000 claims description 14
- 239000002270 dispersing agent Substances 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 230000000979 retarding effect Effects 0.000 claims description 11
- 239000011734 sodium Chemical group 0.000 claims description 11
- 229910052708 sodium Inorganic materials 0.000 claims description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 10
- 240000000111 Saccharum officinarum Species 0.000 claims description 9
- 235000007201 Saccharum officinarum Nutrition 0.000 claims description 9
- 239000002671 adjuvant Substances 0.000 claims description 8
- 125000000304 alkynyl group Chemical group 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- 239000003607 modifier Substances 0.000 claims description 7
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 claims description 6
- 235000011684 Sorghum saccharatum Nutrition 0.000 claims description 6
- 235000021536 Sugar beet Nutrition 0.000 claims description 6
- 230000000694 effects Effects 0.000 claims description 6
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical group [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 5
- OTSAMNSACVKIOJ-UHFFFAOYSA-N azane;carbamoyl(ethoxy)phosphinic acid Chemical compound [NH4+].CCOP([O-])(=O)C(N)=O OTSAMNSACVKIOJ-UHFFFAOYSA-N 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 5
- 229910052744 lithium Inorganic materials 0.000 claims description 5
- 239000011591 potassium Chemical group 0.000 claims description 5
- 229910052700 potassium Inorganic materials 0.000 claims description 5
- 125000001246 bromo group Chemical group Br* 0.000 claims description 4
- 125000004965 chloroalkyl group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical group [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical group [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- AGWHNFPQDHJLQY-UHFFFAOYSA-N azanium;carbamoyl(propan-2-yloxy)phosphinate Chemical compound [NH4+].CC(C)OP([O-])(=O)C(N)=O AGWHNFPQDHJLQY-UHFFFAOYSA-N 0.000 claims description 3
- 239000011575 calcium Chemical group 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 239000011701 zinc Chemical group 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical group [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- 229910052788 barium Inorganic materials 0.000 claims description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000011777 magnesium Chemical group 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical group [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 6
- 206010053759 Growth retardation Diseases 0.000 claims 3
- 241000209072 Sorghum Species 0.000 claims 3
- 231100000001 growth retardation Toxicity 0.000 claims 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- -1 salt compounds Chemical class 0.000 description 50
- 239000000243 solution Substances 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 34
- 238000009472 formulation Methods 0.000 description 32
- 239000000047 product Substances 0.000 description 28
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 24
- 238000011282 treatment Methods 0.000 description 24
- 239000004094 surface-active agent Substances 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 150000003839 salts Chemical class 0.000 description 18
- 150000001412 amines Chemical class 0.000 description 17
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 16
- 239000004480 active ingredient Substances 0.000 description 15
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 14
- 239000007787 solid Substances 0.000 description 14
- 239000000428 dust Substances 0.000 description 13
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- 229910021529 ammonia Inorganic materials 0.000 description 11
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 11
- 239000000843 powder Substances 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 10
- 239000002253 acid Substances 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000004552 water soluble powder Substances 0.000 description 8
- 239000011149 active material Substances 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 230000007797 corrosion Effects 0.000 description 7
- 238000005260 corrosion Methods 0.000 description 7
- 150000005690 diesters Chemical class 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 239000008187 granular material Substances 0.000 description 7
- 239000003112 inhibitor Substances 0.000 description 7
- 239000000377 silicon dioxide Substances 0.000 description 7
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 7
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 6
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical group OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- 239000000908 ammonium hydroxide Substances 0.000 description 6
- 239000002518 antifoaming agent Substances 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 239000007921 spray Substances 0.000 description 6
- 244000070406 Malus silvestris Species 0.000 description 5
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 230000005094 fruit set Effects 0.000 description 5
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 5
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical group C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000008188 pellet Substances 0.000 description 5
- 239000004563 wettable powder Substances 0.000 description 5
- 230000000274 adsorptive effect Effects 0.000 description 4
- 235000008504 concentrate Nutrition 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- 238000000227 grinding Methods 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 4
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 241000894007 species Species 0.000 description 4
- 238000009736 wetting Methods 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 3
- 229920001213 Polysorbate 20 Polymers 0.000 description 3
- 240000006394 Sorghum bicolor Species 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- 235000021016 apples Nutrition 0.000 description 3
- 229960000892 attapulgite Drugs 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Chemical group 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 239000003599 detergent Substances 0.000 description 3
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 3
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 3
- 230000005059 dormancy Effects 0.000 description 3
- 239000007954 growth retardant Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000012456 homogeneous solution Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- ZHVFLDCFPSRKNE-UHFFFAOYSA-N methyl bis(prop-2-enoxy)phosphorylformate Chemical compound C=CCOP(=O)(C(=O)OC)OCC=C ZHVFLDCFPSRKNE-UHFFFAOYSA-N 0.000 description 3
- 238000003801 milling Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 229910052901 montmorillonite Inorganic materials 0.000 description 3
- 229910052625 palygorskite Inorganic materials 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- OPHVSASGPNDWOP-UHFFFAOYSA-N 4-amino-2-(dimethylamino)-4-oxobutanoic acid Chemical compound CN(C)C(C(O)=O)CC(N)=O OPHVSASGPNDWOP-UHFFFAOYSA-N 0.000 description 2
- 240000004144 Acer rubrum Species 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical group CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000005983 Maleic hydrazide Substances 0.000 description 2
- BGRDGMRNKXEXQD-UHFFFAOYSA-N Maleic hydrazide Chemical compound OC1=CC=C(O)N=N1 BGRDGMRNKXEXQD-UHFFFAOYSA-N 0.000 description 2
- 235000011430 Malus pumila Nutrition 0.000 description 2
- 235000015103 Malus silvestris Nutrition 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- GMLPEGNVJJLDKI-UHFFFAOYSA-L NC(P([O-])(OCC1=CC=CC=C1)=O)=O.NC(P([O-])(OCC1=CC=CC=C1)=O)=O.NC(P(O)(OCC1=CC=CC=C1)=O)=O.NC(P(O)(OCC1=CC=CC=C1)=O)=O.[Ca+2] Chemical compound NC(P([O-])(OCC1=CC=CC=C1)=O)=O.NC(P([O-])(OCC1=CC=CC=C1)=O)=O.NC(P(O)(OCC1=CC=CC=C1)=O)=O.NC(P(O)(OCC1=CC=CC=C1)=O)=O.[Ca+2] GMLPEGNVJJLDKI-UHFFFAOYSA-L 0.000 description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 2
- 241001278079 Salix nigra Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- 208000027418 Wounds and injury Diseases 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 230000003750 conditioning effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- QEOOJTFWHYZFBK-UHFFFAOYSA-N diazanium;phosphonatoformamide Chemical class [NH4+].[NH4+].NC(=O)P([O-])([O-])=O QEOOJTFWHYZFBK-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 208000014674 injury Diseases 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000000391 magnesium silicate Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000005394 methallyl group Chemical group 0.000 description 2
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 2
- LICNWMSRKRFCQG-UHFFFAOYSA-N methyl [methoxy(phenylmethoxy)phosphoryl]formate Chemical compound COC(=O)P(=O)(OC)OCC1=CC=CC=C1 LICNWMSRKRFCQG-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000012764 mineral filler Substances 0.000 description 2
- 231100001184 nonphytotoxic Toxicity 0.000 description 2
- 239000002420 orchard Substances 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 238000009966 trimming Methods 0.000 description 2
- 235000019354 vermiculite Nutrition 0.000 description 2
- QWUWMCYKGHVNAV-UHFFFAOYSA-N 1,2-dihydrostilbene Chemical group C=1C=CC=CC=1CCC1=CC=CC=C1 QWUWMCYKGHVNAV-UHFFFAOYSA-N 0.000 description 1
- HQZTWFWTJUALHV-UHFFFAOYSA-N 1-diethoxyphosphoryl-n-methylformamide Chemical compound CCOP(=O)(OCC)C(=O)NC HQZTWFWTJUALHV-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- DSAYAFZWRDYBQY-UHFFFAOYSA-N 2,5-dimethylhexa-1,5-diene Chemical group CC(=C)CCC(C)=C DSAYAFZWRDYBQY-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical group COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical group CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- CDOUZKKFHVEKRI-UHFFFAOYSA-N 3-bromo-n-[(prop-2-enoylamino)methyl]propanamide Chemical compound BrCCC(=O)NCNC(=O)C=C CDOUZKKFHVEKRI-UHFFFAOYSA-N 0.000 description 1
- 241000208140 Acer Species 0.000 description 1
- 241000208146 Acer platanoides Species 0.000 description 1
- 235000004476 Acer rubrum Nutrition 0.000 description 1
- 235000011772 Acer rubrum var tomentosum Nutrition 0.000 description 1
- 235000009057 Acer rubrum var tridens Nutrition 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 244000144730 Amygdalus persica Species 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000167854 Bourreria succulenta Species 0.000 description 1
- CIFXCCNOJYCZTH-UHFFFAOYSA-N CCCCN1CCOCC1.C1NCCOC1.N Chemical compound CCCCN1CCOCC1.C1NCCOC1.N CIFXCCNOJYCZTH-UHFFFAOYSA-N 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 244000189548 Chrysanthemum x morifolium Species 0.000 description 1
- 235000014493 Crataegus Nutrition 0.000 description 1
- 241001092040 Crataegus Species 0.000 description 1
- 235000009917 Crataegus X brevipes Nutrition 0.000 description 1
- 235000013204 Crataegus X haemacarpa Nutrition 0.000 description 1
- 235000009685 Crataegus X maligna Nutrition 0.000 description 1
- 235000009444 Crataegus X rubrocarnea Nutrition 0.000 description 1
- 235000009486 Crataegus bullatus Nutrition 0.000 description 1
- 235000017181 Crataegus chrysocarpa Nutrition 0.000 description 1
- 235000009682 Crataegus limnophila Nutrition 0.000 description 1
- 235000004423 Crataegus monogyna Nutrition 0.000 description 1
- 240000000171 Crataegus monogyna Species 0.000 description 1
- 235000002313 Crataegus paludosa Nutrition 0.000 description 1
- 235000009840 Crataegus x incaedua Nutrition 0.000 description 1
- NOQGZXFMHARMLW-UHFFFAOYSA-N Daminozide Chemical compound CN(C)NC(=O)CCC(O)=O NOQGZXFMHARMLW-UHFFFAOYSA-N 0.000 description 1
- RHUYHJGZWVXEHW-UHFFFAOYSA-N Dimazine Natural products CN(C)N RHUYHJGZWVXEHW-UHFFFAOYSA-N 0.000 description 1
- UCHDFLNGIZUADY-UHFFFAOYSA-N Fosamine Chemical compound CCOP(O)(=O)C(N)=O UCHDFLNGIZUADY-UHFFFAOYSA-N 0.000 description 1
- 101000606741 Homo sapiens Phosphoribosylglycinamide formyltransferase Proteins 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 241000735234 Ligustrum Species 0.000 description 1
- 241000576411 Ligustrum ovalifolium Species 0.000 description 1
- 241000208682 Liquidambar Species 0.000 description 1
- 235000006552 Liquidambar styraciflua Nutrition 0.000 description 1
- 241000218314 Liriodendron tulipifera Species 0.000 description 1
- 241000218212 Maclura pomifera Species 0.000 description 1
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 1
- YXHXDEBLSQQHQE-UHFFFAOYSA-N N.N.OP(O)=O Chemical compound N.N.OP(O)=O YXHXDEBLSQQHQE-UHFFFAOYSA-N 0.000 description 1
- CDXRGXUDSDPCOI-UHFFFAOYSA-N N.OP(O)=O Chemical compound N.OP(O)=O CDXRGXUDSDPCOI-UHFFFAOYSA-N 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- NMNFDTCOWIDEAV-UHFFFAOYSA-N OP(O)=O.OP(O)=O Chemical compound OP(O)=O.OP(O)=O NMNFDTCOWIDEAV-UHFFFAOYSA-N 0.000 description 1
- 102100039654 Phosphoribosylglycinamide formyltransferase Human genes 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 241000209049 Poa pratensis Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000219000 Populus Species 0.000 description 1
- 235000006040 Prunus persica var persica Nutrition 0.000 description 1
- 241000208422 Rhododendron Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 244000152045 Themeda triandra Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- DHOCGIHFPKXZJB-UHFFFAOYSA-N [Cl+].N[H] Chemical compound [Cl+].N[H] DHOCGIHFPKXZJB-UHFFFAOYSA-N 0.000 description 1
- GEEGCDFVPDDQBP-UHFFFAOYSA-N [OH-].C(C)[Ba].[NH4+] Chemical compound [OH-].C(C)[Ba].[NH4+] GEEGCDFVPDDQBP-UHFFFAOYSA-N 0.000 description 1
- QFSSZZFDVQLSKN-UHFFFAOYSA-N [OH-].C(C1=CC=CC=C1)[Ca].[NH4+] Chemical compound [OH-].C(C1=CC=CC=C1)[Ca].[NH4+] QFSSZZFDVQLSKN-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- QUDNPOBFFHXNIS-UHFFFAOYSA-N azane methanamine N-methylmethanamine Chemical compound CNC.CN.N QUDNPOBFFHXNIS-UHFFFAOYSA-N 0.000 description 1
- SKEZSUQXIGKYLZ-UHFFFAOYSA-N azanium;butoxy(carbamoyl)phosphinate;ethyl dibutoxyphosphorylformate Chemical compound [NH4+].CCCCOP([O-])(=O)C(N)=O.CCCCOP(=O)(C(=O)OCC)OCCCC SKEZSUQXIGKYLZ-UHFFFAOYSA-N 0.000 description 1
- CQLVYPKJFWXYLX-UHFFFAOYSA-N azanium;carbamoyl(2,3-dibromopropoxy)phosphinate Chemical compound [NH4+].NC(=O)P([O-])(=O)OCC(Br)CBr CQLVYPKJFWXYLX-UHFFFAOYSA-N 0.000 description 1
- JQJOOXBNECPJRP-UHFFFAOYSA-N azanium;carbamoyl(2-methylpropoxy)phosphinate Chemical compound [NH4+].CC(C)COP([O-])(=O)C(N)=O JQJOOXBNECPJRP-UHFFFAOYSA-N 0.000 description 1
- AMGKUGKTBXBWTR-UHFFFAOYSA-N azanium;carbamoyl(ethoxy)phosphinate;methyl diethoxyphosphorylformate Chemical compound [NH4+].CCOP([O-])(=O)C(N)=O.CCOP(=O)(OCC)C(=O)OC AMGKUGKTBXBWTR-UHFFFAOYSA-N 0.000 description 1
- VUIWKZORDTZXRI-UHFFFAOYSA-N azanium;carbamoyl(hexoxy)phosphinate;methyl dihexoxyphosphorylformate Chemical compound [NH4+].CCCCCCOP([O-])(=O)C(N)=O.CCCCCCOP(=O)(C(=O)OC)OCCCCCC VUIWKZORDTZXRI-UHFFFAOYSA-N 0.000 description 1
- VKJWDAILADSFJG-UHFFFAOYSA-N azanium;carbamoyl(methoxy)phosphinate Chemical compound [NH4+].COP([O-])(=O)C(N)=O VKJWDAILADSFJG-UHFFFAOYSA-N 0.000 description 1
- BFCUBUDVMPPLIG-UHFFFAOYSA-N azanium;carbamoyl(propoxy)phosphinate;propyl dipropoxyphosphorylformate Chemical compound [NH4+].CCCOP([O-])(=O)C(N)=O.CCCOC(=O)P(=O)(OCCC)OCCC BFCUBUDVMPPLIG-UHFFFAOYSA-N 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 229960003655 bromfenac Drugs 0.000 description 1
- PPOSVVJOVKVBPW-UHFFFAOYSA-L bromfenac sodium salt sesquihydrate Chemical compound O.O.O.[Na+].[Na+].NC1=C(CC([O-])=O)C=CC=C1C(=O)C1=CC=C(Br)C=C1.NC1=C(CC([O-])=O)C=CC=C1C(=O)C1=CC=C(Br)C=C1 PPOSVVJOVKVBPW-UHFFFAOYSA-L 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- 125000006487 butyl benzyl group Chemical group 0.000 description 1
- DFFDSQBEGQFJJU-UHFFFAOYSA-N butyl hydrogen carbonate Chemical compound CCCCOC(O)=O DFFDSQBEGQFJJU-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- PASHVRUKOFIRIK-UHFFFAOYSA-L calcium sulfate dihydrate Chemical compound O.O.[Ca+2].[O-]S([O-])(=O)=O PASHVRUKOFIRIK-UHFFFAOYSA-L 0.000 description 1
- 230000023852 carbohydrate metabolic process Effects 0.000 description 1
- 235000021256 carbohydrate metabolism Nutrition 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 235000019693 cherries Nutrition 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000000378 dietary effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- FRXNIQXHOZNMJM-UHFFFAOYSA-N diethoxyphosphorylformamide Chemical compound CCOP(=O)(C(N)=O)OCC FRXNIQXHOZNMJM-UHFFFAOYSA-N 0.000 description 1
- UZBQIPPOMKBLAS-UHFFFAOYSA-N diethylazanide Chemical compound CC[N-]CC UZBQIPPOMKBLAS-UHFFFAOYSA-N 0.000 description 1
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 1
- RPSQGTMQKRWJDZ-UHFFFAOYSA-L dipotassium;n-(2-methylpropyl)-1-phosphonatoformamide Chemical compound [K+].[K+].CC(C)CNC(=O)P([O-])([O-])=O RPSQGTMQKRWJDZ-UHFFFAOYSA-L 0.000 description 1
- JMGZBMRVDHKMKB-UHFFFAOYSA-L disodium;2-sulfobutanedioate Chemical compound [Na+].[Na+].OS(=O)(=O)C(C([O-])=O)CC([O-])=O JMGZBMRVDHKMKB-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- IZWWUWVUAGTWGV-UHFFFAOYSA-N ethylcarbamoylphosphonic acid Chemical compound CCNC(=O)P(O)(O)=O IZWWUWVUAGTWGV-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 239000013022 formulation composition Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- XCOBTUNSZUJCDH-UHFFFAOYSA-B lithium magnesium sodium silicate Chemical compound [Li+].[Li+].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Na+].[Na+].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3 XCOBTUNSZUJCDH-UHFFFAOYSA-B 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000012243 magnesium silicates Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- UHAAXBHTQCDUGV-UHFFFAOYSA-N methoxy(methylcarbamoyl)phosphinic acid Chemical compound CNC(=O)P(O)(=O)OC UHAAXBHTQCDUGV-UHFFFAOYSA-N 0.000 description 1
- MLJVWFGPQCOELH-UHFFFAOYSA-N methyl diethoxyphosphorylformate Chemical compound CCOP(=O)(OCC)C(=O)OC MLJVWFGPQCOELH-UHFFFAOYSA-N 0.000 description 1
- NABUNQKETJPCKI-UHFFFAOYSA-N methyl-morpholin-4-yl-di(propan-2-yl)azanium Chemical compound C(C)(C)[N+](C)(N1CCOCC1)C(C)C NABUNQKETJPCKI-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- FOFDCYHWLJEICQ-UHFFFAOYSA-N morpholine-4-carbonyl(propan-2-yloxy)phosphinic acid Chemical compound CC(C)OP(O)(=O)C(=O)N1CCOCC1 FOFDCYHWLJEICQ-UHFFFAOYSA-N 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-O morpholinium Chemical compound [H+].C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-O 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical group CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 235000014571 nuts Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000019629 palatability Nutrition 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 239000003208 petroleum Chemical class 0.000 description 1
- 230000008288 physiological mechanism Effects 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 235000020374 simple syrup Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229940077386 sodium benzenesulfonate Drugs 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical group [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 1
- 229940045998 sodium isethionate Drugs 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- LADXKQRVAFSPTR-UHFFFAOYSA-M sodium;2-hydroxyethanesulfonate Chemical compound [Na+].OCCS([O-])(=O)=O LADXKQRVAFSPTR-UHFFFAOYSA-M 0.000 description 1
- MZSDGDXXBZSFTG-UHFFFAOYSA-M sodium;benzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=CC=C1 MZSDGDXXBZSFTG-UHFFFAOYSA-M 0.000 description 1
- HIEHAIZHJZLEPQ-UHFFFAOYSA-M sodium;naphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 HIEHAIZHJZLEPQ-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- PGNGVFSZMOYXEM-UHFFFAOYSA-N triethyl(tridecyl)azanium Chemical compound CCCCCCCCCCCCC[N+](CC)(CC)CC PGNGVFSZMOYXEM-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 230000009105 vegetative growth Effects 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US73173268A | 1968-05-24 | 1968-05-24 | |
| US80396269A | 1969-03-03 | 1969-03-03 | |
| US81239869A | 1969-04-01 | 1969-04-01 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL32107A0 IL32107A0 (en) | 1969-06-25 |
| IL32107A true IL32107A (en) | 1972-12-29 |
Family
ID=27419159
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL32107A IL32107A (en) | 1968-05-24 | 1969-04-29 | Carbamoylphosphonates and their use as plant growth regulants |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS5523801B1 (enExample) |
| DK (1) | DK127510B (enExample) |
| ES (1) | ES367559A1 (enExample) |
| IE (1) | IE33100B1 (enExample) |
| IL (1) | IL32107A (enExample) |
| MY (1) | MY7300147A (enExample) |
| NO (1) | NO132669C (enExample) |
-
1969
- 1969-04-29 IL IL32107A patent/IL32107A/en unknown
- 1969-05-05 NO NO184069A patent/NO132669C/no unknown
- 1969-05-19 JP JP3806769A patent/JPS5523801B1/ja active Pending
- 1969-05-22 ES ES367559A patent/ES367559A1/es not_active Expired
- 1969-05-22 IE IE70869A patent/IE33100B1/xx unknown
- 1969-05-23 DK DK282869A patent/DK127510B/da not_active IP Right Cessation
-
1973
- 1973-12-30 MY MY7300147A patent/MY7300147A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE33100B1 (en) | 1974-03-20 |
| NO132669B (enExample) | 1975-09-08 |
| IE33100L (en) | 1969-11-24 |
| IL32107A0 (en) | 1969-06-25 |
| ES367559A1 (es) | 1971-06-16 |
| JPS5523801B1 (enExample) | 1980-06-25 |
| MY7300147A (en) | 1973-12-31 |
| DK127510B (da) | 1973-11-19 |
| NO132669C (enExample) | 1975-12-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0053871B1 (en) | Trialkylsulfoxonium salts of n-phosphonomethylglycine, production thereof, their use as plant growth regulators and herbicides and compositions containing them | |
| US4067719A (en) | O-Aryl N-phosphonomethylglycinonitriles and the herbicidal use thereof | |
| EP0109314A1 (en) | Aluminum N-phosphonomethylglycine and its use as a herbicide | |
| EP0054382B1 (en) | Triethylsulfonium salts of n-phosphonomethylglycine, production thereof, their use as plant growth regulators, herbicides and compositions containing them | |
| EP0073574B1 (en) | Phosphonium salts of n-phosphonomethylglycine, preparation and compositions thereof and the use thereof as herbicides and plant growth regulants | |
| US3627507A (en) | Plant growth regulant carbamoylphosphonates | |
| US4341549A (en) | Phosphonium salts of N-phosphonomethylglycine and their use as herbicides and plant growth regulants | |
| US3846512A (en) | Carbamoylphosphonates | |
| CS244939B2 (en) | Preparation method of n-phosphonomethylglycine | |
| US3619166A (en) | Method of increasing sugar content of crops | |
| US3819353A (en) | Plant growth regulant carbamoylphosphonates | |
| WO1983003608A1 (en) | Tetra-substituted ammonium salt of n-phosphonomethylglycine and their uses as herbicides and plant growth regulants | |
| KR910000725B1 (ko) | 아세트산의 인 함유 작용성 유도체의 제조방법 | |
| EP0014555B1 (en) | Amine salts of substituted n-phosphonomethylureas, process for production thereof, compositions containing them and their use as plant growth regulators | |
| IL32107A (en) | Carbamoylphosphonates and their use as plant growth regulants | |
| US3952074A (en) | Carbamoylphosphonates | |
| US4048156A (en) | Carbamoylphosphonates | |
| US3997544A (en) | Plant growth regulant carbamoylphosphonates | |
| US3712936A (en) | Alkyl carbamoyl-n,n-dialkylphosphonamidates | |
| US4126440A (en) | Hydroxamic acid derivatives for regulating plant growth | |
| US3981870A (en) | Plant growth regulant carbamoylphosphonates | |
| US3975464A (en) | Carbamoylphosphonates | |
| EP0057317B1 (en) | Trialkylsulf(ox)onium salts of n-phosphonomethylglycine, production thereof, their use as plant growth regulators and herbicides and compositions containing them | |
| US4106923A (en) | Phosphonomethyl glycine ester anhydrides, herbicidal composition containing same and use thereof | |
| US4328027A (en) | Di-triethylamine salt of N,N'-bis-carboethoxymethyl-N,N'-bis-phosphonomethylurea and its use as a plant growth regulator |