IL30280A0 - 5-benzylamino-1,3,4-oxathiazole-3,3-dioxides and their production - Google Patents
5-benzylamino-1,3,4-oxathiazole-3,3-dioxides and their productionInfo
- Publication number
- IL30280A0 IL30280A0 IL30280A IL3028068A IL30280A0 IL 30280 A0 IL30280 A0 IL 30280A0 IL 30280 A IL30280 A IL 30280A IL 3028068 A IL3028068 A IL 3028068A IL 30280 A0 IL30280 A0 IL 30280A0
- Authority
- IL
- Israel
- Prior art keywords
- oxathiazole
- dioxides
- benzylamino
- production
- Prior art date
Links
- NHNUIHVGYRHTTC-UHFFFAOYSA-N N-benzyl-3,3-dioxo-1,3,4-oxathiazolidin-5-imine Chemical class C(C1=CC=CC=C1)NC1=NS(CO1)(=O)=O NHNUIHVGYRHTTC-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D291/00—Heterocyclic compounds containing rings having nitrogen, oxygen and sulfur atoms as the only ring hetero atoms
- C07D291/02—Heterocyclic compounds containing rings having nitrogen, oxygen and sulfur atoms as the only ring hetero atoms not condensed with other rings
- C07D291/04—Five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0052869 | 1967-07-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL30280A0 true IL30280A0 (en) | 1968-09-26 |
Family
ID=7105803
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL30280A IL30280A0 (en) | 1967-07-06 | 1968-07-01 | 5-benzylamino-1,3,4-oxathiazole-3,3-dioxides and their production |
Country Status (6)
| Country | Link |
|---|---|
| AT (1) | AT277238B (enExample) |
| BE (1) | BE717708A (enExample) |
| ES (1) | ES355824A1 (enExample) |
| GB (1) | GB1178786A (enExample) |
| IL (1) | IL30280A0 (enExample) |
| NL (1) | NL6809567A (enExample) |
-
1968
- 1968-07-01 IL IL30280A patent/IL30280A0/xx unknown
- 1968-07-04 AT AT641268A patent/AT277238B/de not_active IP Right Cessation
- 1968-07-05 BE BE717708D patent/BE717708A/xx unknown
- 1968-07-05 GB GB32264/68A patent/GB1178786A/en not_active Expired
- 1968-07-05 NL NL6809567A patent/NL6809567A/xx unknown
- 1968-07-06 ES ES355824A patent/ES355824A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES355824A1 (es) | 1970-01-01 |
| GB1178786A (en) | 1970-01-21 |
| BE717708A (enExample) | 1969-01-06 |
| AT277238B (de) | 1969-12-10 |
| NL6809567A (enExample) | 1969-01-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL30326A0 (en) | 1,2,4-triazine-5-ones and their preparation | |
| YU32926B (en) | Postopek za pripravo 1,4-dihidropiridinov | |
| IL30429A (en) | Isothiocyanatobenzazoles and processes for the production thereof | |
| YU216968A (en) | Postopek za pripravo 1,2,4-tiadiazolil-secnin | |
| YU32378B (en) | Postupak za dobijanje novih 1, 3, 4-tiadiazola | |
| MY7300227A (en) | New 1,2-nitraniines and their production | |
| YU32938B (en) | Postopek za pripravo amido-kinoksalin-di-n-oksid-(1,4)-halogenidov 2-izotiuronijeve-3-karboksilne kisline | |
| YU32464B (en) | Postopek za pripravo derivatov 1,4-dihidropiridina | |
| CA946391A (en) | N-trityl-imidazoles and their production | |
| GB1208487A (en) | Basic dyes, their production and application | |
| YU18468A (en) | Postupak za dobijanje 3,6-disupstituisanog piridazina | |
| IL30280A0 (en) | 5-benzylamino-1,3,4-oxathiazole-3,3-dioxides and their production | |
| IL31269A0 (en) | New 22,25-epoxysteroids and process for their production | |
| IL31063A0 (en) | 3-imino-1,2-benzisothiazolines and their production | |
| IE32759B1 (en) | 3-imino-1,2-benzisothiazolines and production thereof | |
| YU32939B (en) | Postopek za pripravo amido-kinoksilin-di-n-oksidov-(1,4)-3-karbokislne kisline | |
| YU141768A (en) | Postupak za proizvodnju novih derivata 1, 2, 3, 4,- tetrahidrokvinazolina | |
| IL25998A (en) | 2,4-diaminoquinazolines and production thereof | |
| CA769037A (en) | N,n'-diethylene-n"-1,3,4-thiadiazolylphosphoramide compounds and their production | |
| AU423757B2 (en) | Arylsulphonyl-semicarbazides and their production | |
| CA751442A (en) | 3-hydroxy-benzisoxazoles and their production | |
| AU421891B2 (en) | 2-cylcloalkylamino-oxazolines and their production | |
| CA956957A (en) | 1-isopropyl-7-methyl-4-phenyl-quinazolinone and production thereof | |
| CA755618A (en) | 12-acylaminosteroid and production thereof | |
| CA764322A (en) | Polylactams and the production thereof |