IL29445A - Phenoxyisoalkyl imidazolines and their preparation - Google Patents
Phenoxyisoalkyl imidazolines and their preparationInfo
- Publication number
- IL29445A IL29445A IL2944568A IL2944568A IL29445A IL 29445 A IL29445 A IL 29445A IL 2944568 A IL2944568 A IL 2944568A IL 2944568 A IL2944568 A IL 2944568A IL 29445 A IL29445 A IL 29445A
- Authority
- IL
- Israel
- Prior art keywords
- acid
- imidazoline
- reacted
- converted
- ethylene
- Prior art date
Links
- 150000002462 imidazolines Chemical class 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 7
- 239000002253 acid Substances 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 19
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 8
- 229940083254 peripheral vasodilators imidazoline derivative Drugs 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 239000012458 free base Substances 0.000 claims description 5
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 4
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000002585 base Substances 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 2
- 241001508691 Martes zibellina Species 0.000 claims 1
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- -1 methylene dioxy Chemical group 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 125000004494 ethyl ester group Chemical group 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 239000000812 cholinergic antagonist Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000029058 respiratory gaseous exchange Effects 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 230000002048 spasmolytic effect Effects 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 2
- UFQDKRWQSFLPQY-UHFFFAOYSA-N 4,5-dihydro-1h-imidazol-3-ium;chloride Chemical compound Cl.C1CN=CN1 UFQDKRWQSFLPQY-UHFFFAOYSA-N 0.000 description 1
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Natural products OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 230000002153 concerted effect Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- MEKDPHXPVMKCON-UHFFFAOYSA-N ethane;methane Chemical compound C.CC MEKDPHXPVMKCON-UHFFFAOYSA-N 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- DKQVJMREABFYNT-UHFFFAOYSA-N ethene Chemical group C=C.C=C DKQVJMREABFYNT-UHFFFAOYSA-N 0.000 description 1
- LBAQSKZHMLAFHH-UHFFFAOYSA-N ethoxyethane;hydron;chloride Chemical compound Cl.CCOCC LBAQSKZHMLAFHH-UHFFFAOYSA-N 0.000 description 1
- YVPJCJLMRRTDMQ-UHFFFAOYSA-N ethyl diazoacetate Chemical compound CCOC(=O)C=[N+]=[N-] YVPJCJLMRRTDMQ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 229960001867 guaiacol Drugs 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 206010022000 influenza Diseases 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- TYQCGQRIZGCHNB-JLAZNSOCSA-N l-ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(O)=C(O)C1=O TYQCGQRIZGCHNB-JLAZNSOCSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 229940100662 nasal drops Drugs 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- QIIPQYDSKRYMFG-UHFFFAOYSA-N phenyl hydrogen carbonate Chemical compound OC(=O)OC1=CC=CC=C1 QIIPQYDSKRYMFG-UHFFFAOYSA-N 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 230000001975 sympathomimetic effect Effects 0.000 description 1
- 230000002227 vasoactive effect Effects 0.000 description 1
- 239000005526 vasoconstrictor agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/20—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D233/22—Radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEN0030055 | 1967-02-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL29445A true IL29445A (en) | 1971-08-25 |
Family
ID=7345361
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL2944568A IL29445A (en) | 1967-02-23 | 1968-02-09 | Phenoxyisoalkyl imidazolines and their preparation |
Country Status (15)
| Country | Link |
|---|---|
| AT (1) | AT280277B (enExample) |
| BE (1) | BE711062A (enExample) |
| CH (1) | CH529766A (enExample) |
| DK (1) | DK127331B (enExample) |
| ES (1) | ES350523A1 (enExample) |
| FI (1) | FI49612C (enExample) |
| FR (2) | FR1555168A (enExample) |
| GB (1) | GB1181356A (enExample) |
| IL (1) | IL29445A (enExample) |
| IT (1) | IT1062055B (enExample) |
| LU (1) | LU55443A1 (enExample) |
| NL (1) | NL156691B (enExample) |
| NO (1) | NO122530B (enExample) |
| SE (1) | SE341631B (enExample) |
| YU (1) | YU32924B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ186028A (en) * | 1976-12-20 | 1980-08-26 | Wellcome Found | Imidazoline derivatives and pesticidal compositions |
| US4226876A (en) * | 1976-12-20 | 1980-10-07 | Burroughs Wellcome Co. | Arthropodicidal imidazoline derivatives |
| ZA787351B (en) * | 1978-06-19 | 1980-08-27 | Wellcome Found | Imidazolines,their preparation,intermediates therefor,and pesticidal formulations and use of the imidazolines |
| EP0011596B1 (de) | 1978-10-09 | 1981-12-30 | Ciba-Geigy Ag | Neue 2-(alpha-Phenoxy-alkyl)-imidazoline und ihre Salze, deren Herstellung und Verwendung sowie sie enthaltende Mittel zur Bekämpfung von pflanzenschädlichen und tierparasitären Milben |
| JP2010531837A (ja) * | 2007-07-02 | 2010-09-30 | エフ.ホフマン−ラ ロシュ アーゲー | 微量アミン関連レセプター(taar)に対して良好な親和性を有する2−イミダゾリン |
-
1968
- 1968-02-07 CH CH178368A patent/CH529766A/de not_active IP Right Cessation
- 1968-02-08 SE SE165668A patent/SE341631B/xx unknown
- 1968-02-09 IL IL2944568A patent/IL29445A/en unknown
- 1968-02-09 LU LU55443D patent/LU55443A1/xx unknown
- 1968-02-14 AT AT140068A patent/AT280277B/de not_active IP Right Cessation
- 1968-02-15 ES ES350523A patent/ES350523A1/es not_active Expired
- 1968-02-17 NO NO60868A patent/NO122530B/no unknown
- 1968-02-20 YU YU38368A patent/YU32924B/xx unknown
- 1968-02-20 FI FI44768A patent/FI49612C/fi active
- 1968-02-21 BE BE711062D patent/BE711062A/xx not_active IP Right Cessation
- 1968-02-22 IT IT1308368A patent/IT1062055B/it active
- 1968-02-22 DK DK69668A patent/DK127331B/da not_active IP Right Cessation
- 1968-02-23 FR FR1555168D patent/FR1555168A/fr not_active Expired
- 1968-02-23 NL NL6802611A patent/NL156691B/xx unknown
- 1968-02-23 FR FR141118A patent/FR7361M/fr not_active Expired
- 1968-02-23 GB GB887568A patent/GB1181356A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI49612B (enExample) | 1975-04-30 |
| YU38368A (en) | 1975-06-30 |
| FR7361M (enExample) | 1969-10-20 |
| LU55443A1 (enExample) | 1968-04-16 |
| FI49612C (fi) | 1975-08-11 |
| SE341631B (enExample) | 1972-01-10 |
| DK127331B (da) | 1973-10-22 |
| NL156691B (nl) | 1978-05-16 |
| IT1062055B (it) | 1983-06-25 |
| FR1555168A (enExample) | 1969-01-24 |
| NL6802611A (enExample) | 1968-08-26 |
| AT280277B (de) | 1970-04-10 |
| BE711062A (enExample) | 1968-07-01 |
| GB1181356A (en) | 1970-02-18 |
| NO122530B (enExample) | 1971-07-12 |
| CH529766A (de) | 1972-10-31 |
| YU32924B (en) | 1975-12-31 |
| ES350523A1 (es) | 1969-05-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK169333B1 (da) | Fremgangsmåde til fremstilling af optisk aktive S(-)-carbazolderivater, nye S(-)-carbazolderivater, samt lægemidler, der indeholder disse forbindelser | |
| US3974158A (en) | 2-(Substituted anilino)methylmorpholines | |
| JPS5849366A (ja) | 3,4−ジヒドロカルボスチリル誘導体 | |
| DE2724948A1 (de) | Hydantoinderivate, verfahren zu ihrer herstellung und ihre verwendung in pharmazeutischen zubereitungen | |
| US2184279A (en) | Amino-aliphatic sulphonamides and process for preparing them | |
| DE1545575C2 (de) | N, N'-Bis- eckige Klammer auf 3"(3', 4', 5'-trimethoxybenzoyloxy)-propyl eckige Klammer zu -homopiperazin | |
| DE1913199C3 (de) | Mannichbasen aus alpha-Tetralon bzw. dessen Derivaten und Arylalkylaminen und deren Salze | |
| IL29445A (en) | Phenoxyisoalkyl imidazolines and their preparation | |
| US3105854A (en) | Meta-substituted phenoxyethylamines | |
| DE69105786T2 (de) | Harnstoffderivate, deren Herstellung sowie diese enthaltende pharmazeutische Zusammensetzungen. | |
| DE1110159B (de) | Verfahren zur Herstellung analeptisch wirksamer N-substituierter Aminonorcamphanderivate bzw. von deren Saeureadditionssalzen und quaternaeren Ammoniumverbindungen | |
| DE1212090B (de) | Verfahren zur Herstellung von 10-(Piperazinopropyl)-3-trifluormethyl-phenothiazinverbindungen und ihren Salzen | |
| US3179665A (en) | 9-(n-ethyl and n-propyl piperidyl-3'-methyl)-thioxanthenes | |
| CH637109A5 (en) | Process for preparing novel 1-aryloxy-2-hydroxy-3-aminopropanes | |
| EP0050072B1 (fr) | Nouvelles cyclopropylméthyl pipérazines, leur procédé de préparation et leur application en thérapeutique | |
| US2742481A (en) | Dialkylaminoimidazoline compounds and their preparation | |
| US3213140A (en) | 2-phenyl-4, 6-dichlorophenoxyethylamine and salts thereof | |
| EP0005091B1 (fr) | Nouvelles pipérazines monosubstituées, leurs procédés de préparation et les compositions pharmaceutiques les renfermant | |
| US2838516A (en) | 2-(thienyl methyl) piperidines | |
| US2725399A (en) | Tertiary dialkylamino propanols | |
| US2774787A (en) | Polyhydrophthalamic acid visceral smooth muscle relaxants | |
| US2490834A (en) | Benzhydryl beta hydroxy alkyl amines | |
| US2879294A (en) | 1, 1-diaryl-2-aminoalkanols | |
| US3758527A (en) | Esters of 1-aminoalkyl-cycloalkanols | |
| US2620341A (en) | N,n-dialkyl-quinoline-4-carboxamidines |