IL29143A - 4-methyl-1-(5-nitrofurfurylidene-amino)-2-imidazolidinone - Google Patents
4-methyl-1-(5-nitrofurfurylidene-amino)-2-imidazolidinoneInfo
- Publication number
- IL29143A IL29143A IL29143A IL2914367A IL29143A IL 29143 A IL29143 A IL 29143A IL 29143 A IL29143 A IL 29143A IL 2914367 A IL2914367 A IL 2914367A IL 29143 A IL29143 A IL 29143A
- Authority
- IL
- Israel
- Prior art keywords
- nitrofurfurylidene
- imidazolidinone
- amino
- methyl
- Prior art date
Links
- BJUPUKIYTMVLCW-WMZJFQQLSA-N 4-methyl-1-[(z)-(5-nitrofuran-2-yl)methylideneamino]imidazolidin-2-one Chemical compound O=C1NC(C)CN1\N=C/C1=CC=C([N+]([O-])=O)O1 BJUPUKIYTMVLCW-WMZJFQQLSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US627605A US3407195A (en) | 1967-04-03 | 1967-04-03 | 4-methyl-1-(5-nitrofurfurylideneamino)-2-imidazolidinone |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL29143A true IL29143A (en) | 1971-05-26 |
Family
ID=24515344
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL29143A IL29143A (en) | 1967-04-03 | 1967-12-15 | 4-methyl-1-(5-nitrofurfurylidene-amino)-2-imidazolidinone |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3407195A (enFirst) |
| AT (1) | AT280254B (enFirst) |
| BE (1) | BE713168A (enFirst) |
| DK (1) | DK118824B (enFirst) |
| ES (1) | ES352179A1 (enFirst) |
| FR (2) | FR7598M (enFirst) |
| GB (1) | GB1153119A (enFirst) |
| GR (1) | GR34840B (enFirst) |
| IL (1) | IL29143A (enFirst) |
| NL (1) | NL6804368A (enFirst) |
| NO (1) | NO120193B (enFirst) |
| SE (1) | SE344330B (enFirst) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL128591C (enFirst) * | 1965-07-02 | |||
| US3914220A (en) * | 1973-08-24 | 1975-10-21 | Morton Norwich Products Inc | 1-{8 5-nitrofurfurylidene)amino{9 -4(and 5)-phenyl-2-imidazolidinone |
| DK0598046T3 (da) * | 1991-08-14 | 1999-05-25 | Procter & Gamble Pharma | Hidtil ukendte urinstoffer egnede som antiarrytmi- og antifibrilleringsmidler |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2746960A (en) * | 1955-05-26 | 1956-05-22 | Norwith Pharmacal Company | New chemotherapeutic nitrofurans |
| BE55077A (enFirst) * | 1955-09-08 | |||
| US2776979A (en) * | 1956-04-05 | 1957-01-08 | Norwich Pharma Co | 1-nitroso-2-imidazolidone and process |
-
1967
- 1967-04-03 US US627605A patent/US3407195A/en not_active Expired - Lifetime
- 1967-12-15 IL IL29143A patent/IL29143A/xx unknown
- 1967-12-18 GR GR670134840A patent/GR34840B/el unknown
-
1968
- 1968-01-15 SE SE466/68A patent/SE344330B/xx unknown
- 1968-01-17 DK DK16168AA patent/DK118824B/da unknown
- 1968-01-18 NO NO0215/68A patent/NO120193B/no unknown
- 1968-03-11 GB GB11836/68A patent/GB1153119A/en not_active Expired
- 1968-03-28 NL NL6804368A patent/NL6804368A/xx unknown
- 1968-03-29 ES ES352179A patent/ES352179A1/es not_active Expired
- 1968-03-29 FR FR146339A patent/FR7598M/fr not_active Expired
- 1968-03-29 FR FR1579545D patent/FR1579545A/fr not_active Expired
- 1968-04-02 AT AT320568A patent/AT280254B/de not_active IP Right Cessation
- 1968-04-03 BE BE713168D patent/BE713168A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO120193B (enFirst) | 1970-09-14 |
| US3407195A (en) | 1968-10-22 |
| DK118824B (da) | 1970-10-12 |
| FR1579545A (enFirst) | 1969-08-29 |
| NL6804368A (enFirst) | 1968-10-04 |
| GR34840B (el) | 1968-07-04 |
| GB1153119A (en) | 1969-05-21 |
| ES352179A1 (es) | 1970-02-01 |
| BE713168A (enFirst) | 1968-10-03 |
| SE344330B (enFirst) | 1972-04-10 |
| FR7598M (enFirst) | 1970-01-12 |
| AT280254B (de) | 1970-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| YU31808B (en) | Destilacioni uredaj | |
| IL31026A (en) | Anilinomethylenemalononitriles | |
| GB1165990A (en) | Track-Set | |
| IL29822A0 (en) | 3-oh-or 3-or-pyrazinamido-guanidines | |
| IE32269L (en) | 11 - halogenosteroids | |
| YU31975B (en) | Pogon elektricne lokomotive | |
| YU303768A (en) | Naprava s katodno cevjo | |
| IL29143A (en) | 4-methyl-1-(5-nitrofurfurylidene-amino)-2-imidazolidinone | |
| IL29828A0 (en) | 4-aryl-4-aminoalkoxy-piperidines | |
| YU249468A (en) | Igracka u vidu pruge | |
| IL30059A (en) | Harmonograph | |
| YU32603B (en) | Poboljsanja u procesu elektroliticke proizvodnje natrijum hlorata | |
| IE31041L (en) | 3-amino-2-cyanoacrylamide | |
| YU11867A (en) | Postupak dobijanja eksplozivnog peroksidikarbonata | |
| IE30947L (en) | Hydroxy-cyclohexylamines | |
| IE30836L (en) | 4-chloro-steroids | |
| IE30782L (en) | 2-aminopyrimidinyl-6-carbamates | |
| IE31016L (en) | Propionamidines | |
| YU68667A (en) | Postupak galvanskog izdvajanja sjajnih paladijumovih prevlaka | |
| YU31993B (en) | Ukljucivac pomoju bregova | |
| IE31025L (en) | 4-oxa-steroids | |
| IE31027L (en) | Xerosin | |
| IE31093L (en) | Diarylcyclopropanes | |
| IE31241L (en) | Tetrahydroindazoles | |
| IL30027A0 (en) | Hydroxyalkylcarbamylalkyl-phosphonates |