IL28917A - 9-(amino-but-2-enyl)-carbazole derivatives and their preparation - Google Patents
9-(amino-but-2-enyl)-carbazole derivatives and their preparationInfo
- Publication number
- IL28917A IL28917A IL28917A IL2891767A IL28917A IL 28917 A IL28917 A IL 28917A IL 28917 A IL28917 A IL 28917A IL 2891767 A IL2891767 A IL 2891767A IL 28917 A IL28917 A IL 28917A
- Authority
- IL
- Israel
- Prior art keywords
- enyl
- amino
- preparation
- carbazole derivatives
- carbazole
- Prior art date
Links
- PFYSWUQNIZAFAY-UHFFFAOYSA-N 4-carbazol-9-ylbut-2-en-1-amine Chemical class C1=CC=C2N(CC=CCN)C3=CC=CC=C3C2=C1 PFYSWUQNIZAFAY-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/80—[b, c]- or [b, d]-condensed
- C07D209/82—Carbazoles; Hydrogenated carbazoles
- C07D209/86—Carbazoles; Hydrogenated carbazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the ring system
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1646166A CH475982A (de) | 1966-11-16 | 1966-11-16 | Verfahren zur Herstellung von Carbazolderivaten |
| CH786567A CH477439A (de) | 1966-11-16 | 1967-06-02 | Verfahren zur Herstellung von Carbazolderivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL28917A true IL28917A (en) | 1971-05-26 |
Family
ID=25702363
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL28917A IL28917A (en) | 1966-11-16 | 1967-11-10 | 9-(amino-but-2-enyl)-carbazole derivatives and their preparation |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3541088A (de) |
| AT (1) | AT277998B (de) |
| BE (1) | BE706600A (de) |
| CH (2) | CH475982A (de) |
| DE (1) | DE1720028A1 (de) |
| DK (1) | DK114774B (de) |
| ES (1) | ES347146A1 (de) |
| FR (1) | FR7181M (de) |
| GB (1) | GB1170468A (de) |
| GR (1) | GR38358B (de) |
| IL (1) | IL28917A (de) |
| NL (1) | NL6715370A (de) |
| SE (1) | SE312557B (de) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4868190A (en) * | 1988-12-27 | 1989-09-19 | Hoechst-Roussel Pharmaceuticals, Inc. | N-pyridinyl-9H-carbazol-9-amines |
-
1966
- 1966-11-16 CH CH1646166A patent/CH475982A/de not_active IP Right Cessation
-
1967
- 1967-06-02 CH CH786567A patent/CH477439A/de not_active IP Right Cessation
- 1967-10-25 DE DE19671720028 patent/DE1720028A1/de active Pending
- 1967-11-10 SE SE15470/67A patent/SE312557B/xx unknown
- 1967-11-10 IL IL28917A patent/IL28917A/xx unknown
- 1967-11-13 NL NL6715370A patent/NL6715370A/xx unknown
- 1967-11-13 US US682637A patent/US3541088A/en not_active Expired - Lifetime
- 1967-11-13 FR FR127918A patent/FR7181M/fr not_active Expired
- 1967-11-14 ES ES347146A patent/ES347146A1/es not_active Expired
- 1967-11-14 GR GR670138358A patent/GR38358B/el unknown
- 1967-11-15 AT AT1029867A patent/AT277998B/de not_active IP Right Cessation
- 1967-11-15 GB GB51911/67A patent/GB1170468A/en not_active Expired
- 1967-11-15 DK DK571067AA patent/DK114774B/da unknown
- 1967-11-16 BE BE706600D patent/BE706600A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GR38358B (el) | 1969-10-30 |
| CH475982A (de) | 1969-07-31 |
| FR7181M (de) | 1969-08-11 |
| NL6715370A (de) | 1968-05-17 |
| SE312557B (de) | 1969-07-21 |
| DK114774B (da) | 1969-08-04 |
| ES347146A1 (es) | 1969-05-16 |
| AT277998B (de) | 1970-01-12 |
| GB1170468A (en) | 1969-11-12 |
| US3541088A (en) | 1970-11-17 |
| BE706600A (de) | 1968-05-16 |
| CH477439A (de) | 1969-08-31 |
| DE1720028A1 (de) | 1971-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CY713A (en) | Phenylaminoethanol derivatives | |
| HK27876A (en) | Homopyrimidazole derivatives | |
| IL27311A (en) | Norscopolamine derivatives | |
| IL29367A (en) | 2-acyl-3-aminoalkoxy indoles and their preparation | |
| IL28777A (en) | 25-desacetyl-rifamycin derivatives and process for their preparation | |
| MY7300103A (en) | Nitrofuryl-oxadiazole derivatives | |
| IL27277A (en) | Diphenylcyclopropane derivatives | |
| GB1173492A (en) | Acylamino-Adamantane Derivatives | |
| IL25265A (en) | Estrane derivatives and their preparation | |
| IL28346A (en) | Benzylidenecycloalkylamine derivatives | |
| IL28917A (en) | 9-(amino-but-2-enyl)-carbazole derivatives and their preparation | |
| IL37775A (en) | 2-amino-delta1-pyrroline derivatives and their preparation | |
| IL27886A (en) | 3-dialkylaminopropanol derivatives | |
| IL25976A (en) | Dibenzocycloheptatriene derivatives and their preparation | |
| IL27674A (en) | 1-sulphanilyl-2-imino-imidazolidine derivatives and their preparation | |
| GB1176419A (en) | Ribofuranosylindole Derivatives | |
| GB1132516A (en) | Morphanthridine derivatives | |
| IL25527A (en) | Indole derivatives and their preparation | |
| IL28258A (en) | 16-methyl-4-pregnen-3beta-ol-20-ones and their preparation | |
| IL31020A0 (en) | Hexahydrobenzo(b)quinolizines and their preparation | |
| IL27024A (en) | Hexahydro-11bh-benzo(a)quinolizine derivatives and preparation thereof | |
| AU412849B2 (en) | Dibenzocycloheptadiene derivatives and their preparation | |
| AU415314B2 (en) | Dibenzocyloheptatriene derivatives and their preparation | |
| CA725172A (en) | Triaminopteridine derivatives and their preparation | |
| CA727631A (en) | Phosphorus-containing indole derivatives and preparation thereof |