IL28623A - 6-chloro-2-(-5-nitro-2-furyl)-cinchoninic acid - Google Patents
6-chloro-2-(-5-nitro-2-furyl)-cinchoninic acidInfo
- Publication number
- IL28623A IL28623A IL28623A IL2862367A IL28623A IL 28623 A IL28623 A IL 28623A IL 28623 A IL28623 A IL 28623A IL 2862367 A IL2862367 A IL 2862367A IL 28623 A IL28623 A IL 28623A
- Authority
- IL
- Israel
- Prior art keywords
- furyl
- nitro
- chloro
- cinchoninic acid
- cinchoninic
- Prior art date
Links
- HCOZNPZJMDOFFS-UHFFFAOYSA-N 6-chloro-2-(5-nitrofuran-2-yl)quinoline-4-carboxylic acid Chemical compound ClC=1C=C2C(=CC(=NC2=CC1)C=1OC(=CC1)[N+](=O)[O-])C(=O)O HCOZNPZJMDOFFS-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US596826A US3374239A (en) | 1966-11-25 | 1966-11-25 | 6-chloro-2-(5-nitro-2-furyl) cinchoninic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL28623A true IL28623A (en) | 1971-04-28 |
Family
ID=24388875
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL28623A IL28623A (en) | 1966-11-25 | 1967-09-12 | 6-chloro-2-(-5-nitro-2-furyl)-cinchoninic acid |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3374239A (de) |
| AT (1) | AT269126B (de) |
| BE (1) | BE707054A (de) |
| CH (1) | CH484187A (de) |
| DE (1) | DE1695575A1 (de) |
| DK (1) | DK120388B (de) |
| ES (1) | ES346192A1 (de) |
| FR (1) | FR6742M (de) |
| GB (1) | GB1133080A (de) |
| IL (1) | IL28623A (de) |
| NL (1) | NL6716021A (de) |
| SE (1) | SE312336B (de) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4217456A (en) * | 1966-06-23 | 1980-08-12 | Haber Raphael R G | Nitrofuryl quinaldinic derivatives and preparation thereof |
| IL26022A (en) * | 1966-06-23 | 1971-06-23 | Haber R | Nitrofuryl quinoline derivatives |
| US3870712A (en) * | 1972-03-17 | 1975-03-11 | Lilly Co Eli | Cinchoninic acid derivatives |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3272828A (en) * | 1963-10-09 | 1966-09-13 | Abbott Lab | 5-nitro-2-furoylamidoximes |
-
1966
- 1966-11-25 US US596826A patent/US3374239A/en not_active Expired - Lifetime
-
1967
- 1967-09-12 IL IL28623A patent/IL28623A/xx unknown
- 1967-10-18 ES ES346192A patent/ES346192A1/es not_active Expired
- 1967-10-18 DE DE19671695575 patent/DE1695575A1/de active Pending
- 1967-11-16 SE SE15728/67A patent/SE312336B/xx unknown
- 1967-11-20 GB GB52761/67A patent/GB1133080A/en not_active Expired
- 1967-11-23 FR FR129349A patent/FR6742M/fr not_active Expired
- 1967-11-24 DK DK591167AA patent/DK120388B/da unknown
- 1967-11-24 CH CH1654667A patent/CH484187A/de not_active IP Right Cessation
- 1967-11-24 BE BE707054D patent/BE707054A/xx unknown
- 1967-11-24 NL NL6716021A patent/NL6716021A/xx unknown
- 1967-11-24 AT AT1064267A patent/AT269126B/de active
Also Published As
| Publication number | Publication date |
|---|---|
| CH484187A (de) | 1970-01-15 |
| FR6742M (de) | 1969-02-24 |
| DE1695575A1 (de) | 1971-04-22 |
| ES346192A1 (es) | 1969-01-01 |
| AT269126B (de) | 1969-03-10 |
| SE312336B (de) | 1969-07-14 |
| NL6716021A (de) | 1968-05-27 |
| US3374239A (en) | 1968-03-19 |
| GB1133080A (en) | 1968-11-06 |
| DK120388B (da) | 1971-05-24 |
| BE707054A (de) | 1968-05-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| YU31655B (en) | Kartonska kutija | |
| YU114067A (en) | Elektromagneta obrtna masina | |
| YU33208B (en) | Postupak ekstrahovanje pomocu rastvaraca | |
| YU128867A (en) | Postupak ostrenja helikoidnih burgija | |
| CA1002523B (en) | Quinoxaline-di-n-oxides | |
| IL28623A (en) | 6-chloro-2-(-5-nitro-2-furyl)-cinchoninic acid | |
| CY631A (en) | Substituted 2-aminobenzimidazoles | |
| IL29154A (en) | Guanidino-alkyl-cyclomines | |
| CA28561S (en) | Seceteurs | |
| CA726756A (en) | Acetoxydecanoic acid | |
| IE28942L (en) | Trans - 4 - aminomethylcyclohexane - 1 - carboxylic acid | |
| IE30166L (en) | 6-acylaminopenicillanic acids | |
| IL27795A (en) | Chromanyl-n-methyl-carbamic acid esters | |
| IE31312L (en) | Phosphoric acid | |
| IE30173L (en) | Sulphonyl-ureas and-semicarbazides | |
| IE30478L (en) | 2-amino-5-benzyl-pyrimidines | |
| IE30064L (en) | Benzenesulphonyl-ureas | |
| IE30065L (en) | Benzenesulphonyl-ureas | |
| IE30083L (en) | 2-halogenomethyl-benzoxazoles | |
| IE30110L (en) | Phenyl-acetonitriles | |
| IE30141L (en) | Pentacosapeptide | |
| IE29987L (en) | Formyl-oestratrienes | |
| IE30275L (en) | Sulpheramides | |
| IE30279L (en) | 5a-h-keto-steroids | |
| IE30280L (en) | 5ß-H-6-KETO-STEROIDS |