IL28124A - Chlorobenzene disulphonamides and their preparation - Google Patents
Chlorobenzene disulphonamides and their preparationInfo
- Publication number
- IL28124A IL28124A IL28124A IL2812467A IL28124A IL 28124 A IL28124 A IL 28124A IL 28124 A IL28124 A IL 28124A IL 2812467 A IL2812467 A IL 2812467A IL 28124 A IL28124 A IL 28124A
- Authority
- IL
- Israel
- Prior art keywords
- disulphonamides
- chlorobenzene
- preparation
- chlorobenzene disulphonamides
- Prior art date
Links
- RCHQGOQOYVPIOO-UHFFFAOYSA-N 3-chlorobenzene-1,2-disulfonamide Chemical class ClC1=C(C(=CC=C1)S(=O)(=O)N)S(=O)(=O)N RCHQGOQOYVPIOO-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/26—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D307/30—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/32—Oxygen atoms
- C07D307/33—Oxygen atoms in position 2, the oxygen atom being in its keto or unsubstituted enol form
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0049487 | 1966-06-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL28124A true IL28124A (en) | 1971-10-20 |
Family
ID=7103058
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL28124A IL28124A (en) | 1966-06-16 | 1967-06-09 | Chlorobenzene disulphonamides and their preparation |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US3499005A (de) |
| AT (2) | AT273948B (de) |
| CH (1) | CH484880A (de) |
| DE (1) | DE1543602C3 (de) |
| DK (1) | DK122389B (de) |
| FR (1) | FR7196M (de) |
| GB (1) | GB1137446A (de) |
| IL (1) | IL28124A (de) |
| SE (1) | SE350967B (de) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2718871C3 (de) | 1977-04-28 | 1980-07-17 | Hoechst Ag, 6000 Frankfurt | N-(2-Furylmethyl)-5-sulfamoylorthanilsäuren und deren physiologisch verträgliche Salze und Verfahren zu ihrer Herstellung und ihre Verwendung bei der Bekämpfung von Oedemkrankheiten und Bluthochdruck |
-
1966
- 1966-06-16 DE DE1543602A patent/DE1543602C3/de not_active Expired
-
1967
- 1967-05-17 CH CH696967A patent/CH484880A/de not_active IP Right Cessation
- 1967-06-06 US US643822A patent/US3499005A/en not_active Expired - Lifetime
- 1967-06-09 IL IL28124A patent/IL28124A/xx unknown
- 1967-06-15 SE SE08465/67A patent/SE350967B/xx unknown
- 1967-06-15 DK DK311667AA patent/DK122389B/da unknown
- 1967-06-15 GB GB27708/67A patent/GB1137446A/en not_active Expired
- 1967-06-16 AT AT445268A patent/AT273948B/de active
- 1967-06-16 AT AT560867A patent/AT270628B/de active
- 1967-09-15 FR FR121249A patent/FR7196M/fr not_active Expired
-
1969
- 1969-05-29 US US829123A patent/US3629442A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1543602A1 (de) | 1969-07-31 |
| CH484880A (de) | 1970-01-31 |
| AT273948B (de) | 1969-08-25 |
| DK122389B (da) | 1972-02-28 |
| DE1543602C3 (de) | 1974-09-26 |
| FR7196M (de) | 1969-08-18 |
| SE350967B (de) | 1972-11-13 |
| US3499005A (en) | 1970-03-03 |
| AT270628B (de) | 1969-05-12 |
| DE1543602B2 (de) | 1974-02-14 |
| US3629442A (en) | 1971-12-21 |
| GB1137446A (en) | 1968-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL24787A (en) | 4-aryl-isoflavanoids and their preparation | |
| YU124367A (en) | Masina s puzevima | |
| IL28433A (en) | 2-phenylhydrazino-imidazolines and processes for their preparation | |
| IL30267A (en) | Ketonitriles and their preparation | |
| CY622A (en) | 3-(piperazinoalkyl)-pyrazoles and their preparation | |
| CA1002523B (en) | Quinoxaline-di-n-oxides | |
| IL29008A (en) | Novel substituted s-triazines and their preparation | |
| IL28950A (en) | Substituted s-triazines and their preparation | |
| IL26015A (en) | N11-substituted pyridobenzodiazepines and their preparation | |
| IL28124A (en) | Chlorobenzene disulphonamides and their preparation | |
| IL32335A (en) | 6-amino-1-vinyl-1-tetralols and their preparation | |
| IL39118A (en) | 2-allyloxy-3-methoxybenzamides and their preparation | |
| IL26806A (en) | Episulfides and their preparation | |
| IL28258A (en) | 16-methyl-4-pregnen-3beta-ol-20-ones and their preparation | |
| IL30022A0 (en) | Ethinyl-substituted 1-phenoxy-2-hydroxy-3-alkylaminopropanes and their preparation | |
| IL27674A (en) | 1-sulphanilyl-2-imino-imidazolidine derivatives and their preparation | |
| IL27609A (en) | Alpha-4-dimethylamino-and 4-phyrrolidinyl-1,2-diphenyl-3-methyl-2-cyclopropane-carbonyloxybutane and their preparation | |
| IL28214A (en) | (2-aminophenyl)-tetrahydroisoquinolines and their preparation | |
| IL28615A (en) | Novel oxadiazolidines,their preparation and use | |
| IL28196A (en) | Piperideides and their production | |
| CA745604A (en) | 3-aminosteroids and their preparation | |
| CA729621A (en) | 6-dehydroprogesterones and their preparation | |
| AU409437B2 (en) | 16-methylene-19-nor-progesterone aerivatives and their preparation | |
| CA737954A (en) | 2-phthalimido-acylamido-benzophenones and their preparation | |
| CA735460A (en) | 2-phthalimido-acylamido-benzophenones and their preparation |