DK122389B - Analogifremgangsmåde til fremstilling af chlorbenzen-2,4-disulfonamider. - Google Patents
Analogifremgangsmåde til fremstilling af chlorbenzen-2,4-disulfonamider.Info
- Publication number
- DK122389B DK122389B DK311667AA DK311667A DK122389B DK 122389 B DK122389 B DK 122389B DK 311667A A DK311667A A DK 311667AA DK 311667 A DK311667 A DK 311667A DK 122389 B DK122389 B DK 122389B
- Authority
- DK
- Denmark
- Prior art keywords
- disulfonamides
- chlorobenzene
- preparation
- analogous process
- analogous
- Prior art date
Links
- NENBAISIHCWPKP-UHFFFAOYSA-N Clofenamide Chemical class NS(=O)(=O)C1=CC=C(Cl)C(S(N)(=O)=O)=C1 NENBAISIHCWPKP-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/26—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D307/30—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/32—Oxygen atoms
- C07D307/33—Oxygen atoms in position 2, the oxygen atom being in its keto or unsubstituted enol form
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0049487 | 1966-06-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK122389B true DK122389B (da) | 1972-02-28 |
Family
ID=7103058
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK311667AA DK122389B (da) | 1966-06-16 | 1967-06-15 | Analogifremgangsmåde til fremstilling af chlorbenzen-2,4-disulfonamider. |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US3499005A (da) |
| AT (2) | AT273948B (da) |
| CH (1) | CH484880A (da) |
| DE (1) | DE1543602C3 (da) |
| DK (1) | DK122389B (da) |
| FR (1) | FR7196M (da) |
| GB (1) | GB1137446A (da) |
| IL (1) | IL28124A (da) |
| SE (1) | SE350967B (da) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2718871C3 (de) | 1977-04-28 | 1980-07-17 | Hoechst Ag, 6000 Frankfurt | N-(2-Furylmethyl)-5-sulfamoylorthanilsäuren und deren physiologisch verträgliche Salze und Verfahren zu ihrer Herstellung und ihre Verwendung bei der Bekämpfung von Oedemkrankheiten und Bluthochdruck |
-
1966
- 1966-06-16 DE DE1543602A patent/DE1543602C3/de not_active Expired
-
1967
- 1967-05-17 CH CH696967A patent/CH484880A/de not_active IP Right Cessation
- 1967-06-06 US US643822A patent/US3499005A/en not_active Expired - Lifetime
- 1967-06-09 IL IL28124A patent/IL28124A/xx unknown
- 1967-06-15 DK DK311667AA patent/DK122389B/da unknown
- 1967-06-15 GB GB27708/67A patent/GB1137446A/en not_active Expired
- 1967-06-15 SE SE08465/67A patent/SE350967B/xx unknown
- 1967-06-16 AT AT445268A patent/AT273948B/de active
- 1967-06-16 AT AT560867A patent/AT270628B/de active
- 1967-09-15 FR FR121249A patent/FR7196M/fr not_active Expired
-
1969
- 1969-05-29 US US829123A patent/US3629442A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IL28124A (en) | 1971-10-20 |
| DE1543602A1 (de) | 1969-07-31 |
| US3499005A (en) | 1970-03-03 |
| CH484880A (de) | 1970-01-31 |
| DE1543602C3 (de) | 1974-09-26 |
| AT273948B (de) | 1969-08-25 |
| DE1543602B2 (de) | 1974-02-14 |
| GB1137446A (en) | 1968-12-18 |
| SE350967B (da) | 1972-11-13 |
| FR7196M (da) | 1969-08-18 |
| US3629442A (en) | 1971-12-21 |
| AT270628B (de) | 1969-05-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK133618B (da) | Analogifremgangsmåde til fremstilling af 1-hydroxyaryl-2-aminoalkanoler. | |
| DK127415B (da) | Fremgangsmåde til fremstilling af α-benzyl-β,β-dialkoxypropionitriler. | |
| DK111568B (da) | Fremgangsmåde til fremstilling af N-alkyl-3,1-benzoxazin-2-oner. | |
| DK119005B (da) | Fremgangsmåde til fremstilling af 3-alkoxy-13-alkylgona-1,3,5(10),8,14-penten-17-oner. | |
| DK124886B (da) | Fremgangsnmåde til fremstilling af 1-hydroxy-benzimidazol-N-oxider. | |
| DK117954B (da) | Fremgangsmåde til fremstilling af 3-amino-2-cyanoacrylamid. | |
| DK121759B (da) | Analogifremgangsmåde til fremstilling af 3-oxo-7α-methylgona-4,9-diener. | |
| DK128279B (da) | Fremgangsmåde til fremstilling af α,ω-alkylendiaminer. | |
| DK114556B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepin-2-on-4-oxider. | |
| DK116357B (da) | Fremgangsmåde til fremstilling af 1,1,1,2,2-pentafluor-3-chlorpropan. | |
| DK115551B (da) | Fremgangsmåde til fremstilling af 6-aminouracil-5-carbonamid-N-sulfonamider. | |
| DK116736B (da) | Fremgangsmåde til fremstilling af 5-chlor-2,3-pyridindiol. | |
| DK120131B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkylgona-4,9,11-triener. | |
| DK115622B (da) | Fremgangsmåde til fremstilling af 3-oxogona-4,9,11-triener. | |
| DK127418B (da) | Fremgangsmåde til fremstilling af 13-alkyl-gona-1,3,5(10),6,8,14-hexaener. | |
| DK120344B (da) | Fremgangsmåde til fremstilling af 5-benzyl-pyrimidiner. | |
| DK114063B (da) | Fremgangsmåde til fremstilling af 1-methyl-2-isopropyl-5-nitro-imidazol. | |
| DK130307B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkyl-17β-hydroxy-17α-ethynylgona-4,9-diener. | |
| DK126378B (da) | Analogifremgangsmåde til fremstilling af 17α-acyloxy-9α-chlor-11β-hydroxy-progesteroner. | |
| DK119830B (da) | Analogifremgangsmåde til fremstilling af arylsulfonylsemicarbazider. | |
| DK114626B (da) | Fremgangsmåde til fremstilling af 2-substitueret-4-amino-5-acylamidometylpyrimidin. | |
| DK129842B (da) | Fremgangsmåde til fremstilling af 3-imino-1,2-benzisothiazoliner. | |
| DK117956B (da) | Fremgangsmåde til fremstilling af 3-oxogona-4,9-diener. | |
| DK114204B (da) | Fremgangsmåde til fremstilling af carboxamidoalkyl-1,3-benzoxaziner. | |
| DK122389B (da) | Analogifremgangsmåde til fremstilling af chlorbenzen-2,4-disulfonamider. |