IL27690A - Process for the preparation of tricyclohexilbedil hydroxide - Google Patents
Process for the preparation of tricyclohexilbedil hydroxideInfo
- Publication number
- IL27690A IL27690A IL27690A IL2769067A IL27690A IL 27690 A IL27690 A IL 27690A IL 27690 A IL27690 A IL 27690A IL 2769067 A IL2769067 A IL 2769067A IL 27690 A IL27690 A IL 27690A
- Authority
- IL
- Israel
- Prior art keywords
- tin
- reaction
- reaction mixture
- organic layer
- hydroxide
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 14
- WCMMILVIRZAPLE-UHFFFAOYSA-M cyhexatin Chemical compound C1CCCCC1[Sn](C1CCCCC1)(O)C1CCCCC1 WCMMILVIRZAPLE-UHFFFAOYSA-M 0.000 title description 4
- 238000002360 preparation method Methods 0.000 title description 4
- 238000006243 chemical reaction Methods 0.000 claims description 18
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 15
- 239000011541 reaction mixture Substances 0.000 claims description 13
- 239000004215 Carbon black (E152) Substances 0.000 claims description 12
- 229930195733 hydrocarbon Natural products 0.000 claims description 12
- 150000002430 hydrocarbons Chemical class 0.000 claims description 12
- 239000012044 organic layer Substances 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 9
- -1 tricyclohexyltin halide Chemical class 0.000 claims description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 6
- 239000010410 layer Substances 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- RNVJQUPAEIQUTC-UHFFFAOYSA-N tricyclohexyltin Chemical compound C1CCCCC1[Sn](C1CCCCC1)C1CCCCC1 RNVJQUPAEIQUTC-UHFFFAOYSA-N 0.000 claims description 4
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 3
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 claims description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 229910001629 magnesium chloride Inorganic materials 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 238000001556 precipitation Methods 0.000 claims description 2
- 238000011084 recovery Methods 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 239000003153 chemical reaction reagent Substances 0.000 claims 2
- VKAAGRLEXPKJAI-UHFFFAOYSA-N cyclohexyltin Chemical compound [Sn]C1CCCCC1 VKAAGRLEXPKJAI-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 5
- 239000011777 magnesium Substances 0.000 description 5
- 229910052749 magnesium Inorganic materials 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 239000007818 Grignard reagent Substances 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- QULMZVWEGVTWJY-UHFFFAOYSA-N dicyclohexyl(oxo)tin Chemical compound C1CCCCC1[Sn](=O)C1CCCCC1 QULMZVWEGVTWJY-UHFFFAOYSA-N 0.000 description 3
- 150000004795 grignard reagents Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000004292 cyclic ethers Chemical class 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000006053 organic reaction Methods 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- WCTXJBYIXVVFCF-UHFFFAOYSA-M chlorotin Chemical compound [Sn]Cl WCTXJBYIXVVFCF-UHFFFAOYSA-M 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- INRBXCUGOSNRNI-UHFFFAOYSA-K cyclohexyltin(3+);trihydroxide Chemical compound [OH-].[OH-].[OH-].[Sn+3]C1CCCCC1 INRBXCUGOSNRNI-UHFFFAOYSA-K 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- BRCGUTSVMPKEKH-UHFFFAOYSA-N dicyclohexyltin Chemical compound C1CCCCC1[Sn]C1CCCCC1 BRCGUTSVMPKEKH-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005007 materials handling Methods 0.000 description 1
- UNFUYWDGSFDHCW-UHFFFAOYSA-N monochlorocyclohexane Chemical compound ClC1CCCCC1 UNFUYWDGSFDHCW-UHFFFAOYSA-N 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/22—Tin compounds
- C07F7/2224—Compounds having one or more tin-oxygen linkages
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US538219A US3402189A (en) | 1966-03-29 | 1966-03-29 | Process for preparing tricyclohexyl tin hydroxide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL27690A true IL27690A (en) | 1971-06-23 |
Family
ID=24145992
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL27690A IL27690A (en) | 1966-03-29 | 1967-03-26 | Process for the preparation of tricyclohexilbedil hydroxide |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3402189A (de) |
| AT (1) | AT275551B (de) |
| CH (1) | CH507989A (de) |
| DE (1) | DE1618677A1 (de) |
| DK (1) | DK129941B (de) |
| ES (1) | ES338558A1 (de) |
| FR (1) | FR1515649A (de) |
| GB (1) | GB1136534A (de) |
| IL (1) | IL27690A (de) |
| NL (1) | NL6704497A (de) |
| SE (1) | SE338774B (de) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL42501A (en) * | 1972-06-24 | 1976-12-31 | Oxon Italia Spa | Process for preparing tricyclohexyltin derivatives |
| US4174346A (en) * | 1976-01-30 | 1979-11-13 | Albright & Wilson Limited | Process for preparing organotin compounds |
| US4113758A (en) * | 1976-03-30 | 1978-09-12 | Albright & Wilson Ltd. | Process for preparing organotin halides |
| US4222950A (en) * | 1978-08-10 | 1980-09-16 | M&T Chemicals Inc. | Method for preparing triorganotin halide |
| IT1121958B (it) * | 1979-06-27 | 1986-04-23 | Oxon Italia Spa | Procedimento per ottenere tricicloesilstagno idrossido di elevata purezza con alte rese |
| DE3435717A1 (de) * | 1984-09-28 | 1986-04-10 | Lentia GmbH Chem. u. pharm. Erzeugnisse - Industriebedarf, 8000 München | Verfahren zur herstellung von tricyclohexylzinnhydroxid |
| EP0346506A1 (de) * | 1988-06-14 | 1989-12-20 | Yoshitomi Pharmaceutical Industries, Ltd. | Verfahren zu fraktionierter Herstellung von Organozinn-Verbindungen |
| US4923068A (en) * | 1989-02-07 | 1990-05-08 | Cdp Product Development Corporation | Automatic filter system |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3082236A (en) * | 1959-04-29 | 1963-03-19 | Wallace & Tiernan Inc | Peroxy esters of p-menthane hydroperoxides |
| GB1084076A (de) * | 1964-04-08 | 1900-01-01 |
-
1966
- 1966-03-29 US US538219A patent/US3402189A/en not_active Expired - Lifetime
-
1967
- 1967-03-26 IL IL27690A patent/IL27690A/en unknown
- 1967-03-28 ES ES338558A patent/ES338558A1/es not_active Expired
- 1967-03-28 DK DK160267AA patent/DK129941B/da not_active IP Right Cessation
- 1967-03-28 FR FR100377A patent/FR1515649A/fr not_active Expired
- 1967-03-29 AT AT299367A patent/AT275551B/de active
- 1967-03-29 DE DE19671618677 patent/DE1618677A1/de active Pending
- 1967-03-29 SE SE04288/67A patent/SE338774B/xx unknown
- 1967-03-29 NL NL6704497A patent/NL6704497A/xx unknown
- 1967-03-29 GB GB14352/67A patent/GB1136534A/en not_active Expired
- 1967-03-29 CH CH434767A patent/CH507989A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DK129941C (de) | 1975-05-12 |
| FR1515649A (fr) | 1968-03-01 |
| NL6704497A (de) | 1967-10-02 |
| US3402189A (en) | 1968-09-17 |
| CH507989A (de) | 1971-05-31 |
| DK129941B (da) | 1974-12-02 |
| ES338558A1 (es) | 1968-04-16 |
| AT275551B (de) | 1969-10-27 |
| GB1136534A (en) | 1968-12-11 |
| DE1618677A1 (de) | 1971-02-25 |
| SE338774B (de) | 1971-09-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3182088A (en) | Method of making a tetrabromobisphenol | |
| US4112242A (en) | Process for production of 4,4-isopropylidene-bis-2,6-dibromo/phenol | |
| IL27690A (en) | Process for the preparation of tricyclohexilbedil hydroxide | |
| US2861084A (en) | Process for the production of | |
| US2056822A (en) | Preparation of phenyl-magnesium chloride | |
| US2868820A (en) | Preparation of hexaorganodistannoxane and triorganotin hydroxide | |
| DE3220105A1 (de) | Verfahren zur herstellung in (alpha)-stellung chlorierten stickstoff-heterocyclen | |
| DE3883394T2 (de) | Verfahren zur herstellung von dialkyltellur und dialkylselen. | |
| US3711592A (en) | Method for separation of tungsten chloride from a mixture of metal chlorides | |
| US4354983A (en) | Process for the purification of O,O-dialkylthionophosphoric acid chlorides | |
| US2824112A (en) | Production of alpha chlorostyrene oxide | |
| US2431718A (en) | Unsaturated ketone epoxides and process for producing same | |
| US3000909A (en) | Process of preparing butylene oxide from butylene chlorohydrin | |
| US3492312A (en) | Manufacture of 6,7,8,9,10,10-hexahalo- 1,5,5alpha,6,9,9alpha - hexahydro - 6,9-methano-2,4,3-benzodioxathiepin-3-oxide | |
| US2293214A (en) | Purifying tetraethyl lead | |
| US3405155A (en) | Process for the preparation of diphenylsilanediol | |
| US1079916A (en) | Proecss of producing pinacones. | |
| US3296311A (en) | Process for the nuclear bromination of thiophenols | |
| US2737528A (en) | Process for preparation of acetyl acetone | |
| KR930006194B1 (ko) | α-클로로아세토아세트산 모노메틸아미드의 제조방법 | |
| US487205A (en) | Fritz ach | |
| US3644526A (en) | Oxidation of cyclohexane | |
| US2862015A (en) | Method for producing trichloro-methylpropene and chlorosulfinate thereof | |
| US2718522A (en) | Recovery of organotin compounds | |
| US3096378A (en) | Chlorination of nitroethane |