IL27374A - Preparation of organic boron derivatives - Google Patents
Preparation of organic boron derivativesInfo
- Publication number
- IL27374A IL27374A IL27374A IL2737467A IL27374A IL 27374 A IL27374 A IL 27374A IL 27374 A IL27374 A IL 27374A IL 2737467 A IL2737467 A IL 2737467A IL 27374 A IL27374 A IL 27374A
- Authority
- IL
- Israel
- Prior art keywords
- boron
- general formula
- preparation
- organic
- ether
- Prior art date
Links
- 150000001638 boron Chemical class 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 16
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 15
- 150000001639 boron compounds Chemical class 0.000 claims description 14
- 229910052749 magnesium Inorganic materials 0.000 claims description 14
- 239000011777 magnesium Substances 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 12
- 239000000725 suspension Substances 0.000 claims description 11
- 239000002904 solvent Substances 0.000 claims description 7
- 239000004215 Carbon black (E152) Substances 0.000 claims description 6
- 229930195733 hydrocarbon Natural products 0.000 claims description 6
- 150000002430 hydrocarbons Chemical class 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 230000003197 catalytic effect Effects 0.000 claims description 5
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229910052740 iodine Chemical group 0.000 claims description 2
- 230000004048 modification Effects 0.000 claims description 2
- 238000012986 modification Methods 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N 1,2-diethylbenzene Chemical compound CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 26
- 229910052796 boron Inorganic materials 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 10
- 229960004132 diethyl ether Drugs 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- -1 boron halide Chemical class 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- LALRXNPLTWZJIJ-UHFFFAOYSA-N triethylborane Chemical compound CCB(CC)CC LALRXNPLTWZJIJ-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 229960002645 boric acid Drugs 0.000 description 2
- 235000010338 boric acid Nutrition 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229960003750 ethyl chloride Drugs 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- UNFUYWDGSFDHCW-UHFFFAOYSA-N monochlorocyclohexane Chemical compound ClC1CCCCC1 UNFUYWDGSFDHCW-UHFFFAOYSA-N 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- RKLSGKOUKYOIRM-UHFFFAOYSA-N butylboron Chemical compound [B]CCCC RKLSGKOUKYOIRM-UHFFFAOYSA-N 0.000 description 1
- MEYBRJQJBOJHPQ-UHFFFAOYSA-N chlorobenzene;chloromethylbenzene Chemical compound ClC1=CC=CC=C1.ClCC1=CC=CC=C1 MEYBRJQJBOJHPQ-UHFFFAOYSA-N 0.000 description 1
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000011017 operating method Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- SYOKIDBDQMKNDQ-XWTIBIIYSA-N vildagliptin Chemical compound C1C(O)(C2)CC(C3)CC1CC32NCC(=O)N1CCC[C@H]1C#N SYOKIDBDQMKNDQ-XWTIBIIYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F5/00—Compounds containing elements of Groups 3 or 13 of the Periodic Table
- C07F5/02—Boron compounds
- C07F5/027—Organoboranes and organoborohydrides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT229666 | 1966-02-03 | ||
| IT1409166 | 1966-02-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL27374A true IL27374A (en) | 1970-11-30 |
Family
ID=26325233
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL27374A IL27374A (en) | 1966-02-03 | 1967-02-01 | Preparation of organic boron derivatives |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US3502729A (en:Method) |
| BE (1) | BE693650A (en:Method) |
| CH (1) | CH477477A (en:Method) |
| DE (1) | DE1618645A1 (en:Method) |
| ES (1) | ES336839A1 (en:Method) |
| FR (1) | FR1517893A (en:Method) |
| GB (1) | GB1169603A (en:Method) |
| IL (1) | IL27374A (en:Method) |
| NL (1) | NL6701488A (en:Method) |
| SE (1) | SE331995B (en:Method) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN109232224B (zh) * | 2018-10-26 | 2021-02-19 | 西安凯立新材料股份有限公司 | 一种2-苯基丙酸的制备方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2880243A (en) * | 1956-05-09 | 1959-03-31 | Olin Mathieson | Manufacture of trisubstituted boranes |
| US3090801A (en) * | 1956-07-06 | 1963-05-21 | American Potash & Chem Corp | Aryl polyboronic acids and esters and process for their preparation |
| US2939885A (en) * | 1957-07-29 | 1960-06-07 | Olin Mathieson | Production of trialkylboranes |
| US2862952A (en) * | 1957-08-26 | 1958-12-02 | American Cyanamid Co | Method of preparing b-hydrocarbonsubstituted boron compounds |
| US3345418A (en) * | 1957-08-29 | 1967-10-03 | Herbert C Brown | Catalytic process for preparing organoboron compounds from diborane |
| US3100181A (en) * | 1961-02-16 | 1963-08-06 | Nalco Chemical Co | Preparation of organoboranes |
| US3405179A (en) * | 1963-11-08 | 1968-10-08 | M & T Chemicals Inc | Method of preparing arylborane compounds |
| NL6415119A (en:Method) * | 1964-01-02 | 1965-07-05 |
-
1967
- 1967-01-31 NL NL6701488A patent/NL6701488A/xx unknown
- 1967-02-01 FR FR93298A patent/FR1517893A/fr not_active Expired
- 1967-02-01 ES ES336839A patent/ES336839A1/es not_active Expired
- 1967-02-01 IL IL27374A patent/IL27374A/en unknown
- 1967-02-01 DE DE19671618645 patent/DE1618645A1/de active Pending
- 1967-02-02 GB GB5185/67A patent/GB1169603A/en not_active Expired
- 1967-02-02 CH CH151867A patent/CH477477A/de not_active IP Right Cessation
- 1967-02-02 US US613416A patent/US3502729A/en not_active Expired - Lifetime
- 1967-02-02 SE SE01530/67A patent/SE331995B/xx unknown
- 1967-02-03 BE BE693650D patent/BE693650A/xx unknown
-
1969
- 1969-09-30 US US862464A patent/US3594426A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US3502729A (en) | 1970-03-24 |
| DE1618645A1 (de) | 1971-04-01 |
| GB1169603A (en) | 1969-11-05 |
| CH477477A (de) | 1969-08-31 |
| US3594426A (en) | 1971-07-20 |
| FR1517893A (fr) | 1968-03-22 |
| ES336839A1 (es) | 1968-02-16 |
| BE693650A (en:Method) | 1967-08-03 |
| SE331995B (en:Method) | 1971-01-25 |
| NL6701488A (en:Method) | 1967-08-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4379766A (en) | Silyl esters of carboxylic acids by phase transfer catalysts | |
| Baldwin et al. | Radical reactions in synthesis: carbon–carbon bond formation from 2-substituted allyl trialkyl stannanes | |
| US2787627A (en) | Process of preparing trialkylhalogenosilanes | |
| US5399780A (en) | Method of producing triarylborane | |
| US2380057A (en) | Dialkylated silicon esters and method of making them | |
| US3072694A (en) | Process for making tetramethyl lead | |
| US3448129A (en) | Pi-allyldinitrosyliron complexes of germanium,tin and lead | |
| NO118977B (en:Method) | ||
| US4342708A (en) | Hydrocarbon-soluble diorganomagnesium compounds, hydrocarbon solutions containing the same and processes for preparation thereof | |
| US3907849A (en) | Chromium tris-diorgano-orthophosphates and their preparation | |
| US3095460A (en) | Preparation of stabilized magnesium alkyls | |
| US3293313A (en) | Method of making organic lithium compounds | |
| US3576860A (en) | Preparation of chloroacetyl chloride | |
| US3646087A (en) | Preparation of aminophenyltrialkoxy silanes | |
| US3475496A (en) | Process for preparing br3-type organoboron compounds | |
| US3397241A (en) | Process for the economical preparation of br3 organoboron compounds | |
| GB933722A (en) | Manufacture of tetramethyllead | |
| US3594426A (en) | Process for the preparation of tri-organo-boron compounds | |
| CA1037963A (en) | Nickel bis-diorgano-orthophosphates, their preparation and use | |
| US20070187847A1 (en) | Process for the preparation of pure aryllithium compounds and their use | |
| US2859228A (en) | Manufacture of organolead compounds | |
| GB1402738A (en) | Process for preparing a supported olefin polymerization catalyst | |
| US2535192A (en) | Manufacture of alkyllead compounds | |
| US2347000A (en) | Process of preparing monochloromonobromomethane and dibromomethane | |
| US2859229A (en) | Manufacture of organolead compounds |