IL27119A - Omega-cyanopolymethylene tin mercaptides and esters - Google Patents
Omega-cyanopolymethylene tin mercaptides and estersInfo
- Publication number
- IL27119A IL27119A IL27119A IL2711966A IL27119A IL 27119 A IL27119 A IL 27119A IL 27119 A IL27119 A IL 27119A IL 2711966 A IL2711966 A IL 2711966A IL 27119 A IL27119 A IL 27119A
- Authority
- IL
- Israel
- Prior art keywords
- formula
- organotin
- general
- compounds
- compound
- Prior art date
Links
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 title description 2
- 150000002148 esters Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 6
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 239000000376 reactant Substances 0.000 claims description 3
- 125000004450 alkenylene group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000000047 product Substances 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 5
- 150000001735 carboxylic acids Chemical class 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- IUNVCWLKOOCPIT-UHFFFAOYSA-N 6-methylheptylsulfanyl 2-hydroxyacetate Chemical compound CC(C)CCCCCSOC(=O)CO IUNVCWLKOOCPIT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000003139 biocide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000005017 substituted alkenyl group Chemical group 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/22—Tin compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US51803166A | 1966-01-03 | 1966-01-03 | |
| US51800166A | 1966-01-03 | 1966-01-03 | |
| US51802566A | 1966-01-03 | 1966-01-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL27119A true IL27119A (en) | 1972-01-27 |
Family
ID=27414682
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL27117A IL27117A (en) | 1966-01-03 | 1966-12-22 | A method for the preparation of organotin mercaptides |
| IL27119A IL27119A (en) | 1966-01-03 | 1966-12-22 | Omega-cyanopolymethylene tin mercaptides and esters |
| IL27120A IL27120A (en) | 1966-01-03 | 1966-12-22 | A method for the preparation of(omega-cyanopolymethylene)tin esters |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL27117A IL27117A (en) | 1966-01-03 | 1966-12-22 | A method for the preparation of organotin mercaptides |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL27120A IL27120A (en) | 1966-01-03 | 1966-12-22 | A method for the preparation of(omega-cyanopolymethylene)tin esters |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US3471538A (it) |
| AT (1) | AT264540B (it) |
| BE (1) | BE692123A (it) |
| ES (1) | ES334908A1 (it) |
| FR (1) | FR1510255A (it) |
| GB (1) | GB1167304A (it) |
| IL (3) | IL27117A (it) |
| NL (1) | NL6700013A (it) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4327016A (en) * | 1979-05-07 | 1982-04-27 | Ciba-Geigy Corporation | Organotin compounds, and their use |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2570686A (en) * | 1948-05-04 | 1951-10-09 | Metal & Thermit Corp | Process for making tin hydrocarbons |
| US2560034A (en) * | 1949-03-17 | 1951-07-10 | Firestone Tire & Rubber Co | Preparation of alkyltin carboxylates |
| US2832750A (en) * | 1951-06-21 | 1958-04-29 | Metal & Thermit Corp | Organo tin compounds, method of making same, and mixtures thereof with halogen-containing resins |
| US2759906A (en) * | 1952-05-20 | 1956-08-21 | Argus Chemical Lab Inc | Vinyl chloride resin stabilized with a tetravalent tin xanthate compound |
| US2684973A (en) * | 1952-10-08 | 1954-07-27 | Advance Solvents & Chemical Co | Stannanediol derivatives |
| US2789102A (en) * | 1953-06-02 | 1957-04-16 | Metal & Thermit Corp | Rubber compositions |
| US2786813A (en) * | 1953-09-21 | 1957-03-26 | Exxon Research Engineering Co | Tin-containing thioxanthate compounds and lubricants containing them |
| US2977379A (en) * | 1955-12-31 | 1961-03-28 | Hoechst Ag | Oxyalkylated organo-tin carboxylates |
| US3015644A (en) * | 1958-01-31 | 1962-01-02 | Argus Chem | Stabilizing polypropylene with organictin-mercapto compounds |
| US3053870A (en) * | 1958-05-01 | 1962-09-11 | Union Carbide Corp | Stabilization of resins |
| NL283509A (it) * | 1961-09-22 | 1900-01-01 | ||
| US3332970A (en) * | 1964-10-28 | 1967-07-25 | Shell Oil Co | Per (beta and gamma substituted alkylene)mono-and di-tin compounds and the preparation thereof |
-
1966
- 1966-01-03 US US518025A patent/US3471538A/en not_active Expired - Lifetime
- 1966-01-03 US US518031A patent/US3475474A/en not_active Expired - Lifetime
- 1966-12-22 IL IL27117A patent/IL27117A/xx unknown
- 1966-12-22 IL IL27119A patent/IL27119A/en unknown
- 1966-12-22 IL IL27120A patent/IL27120A/en unknown
- 1966-12-24 ES ES334908A patent/ES334908A1/es not_active Expired
- 1966-12-29 FR FR89300A patent/FR1510255A/fr not_active Expired
-
1967
- 1967-01-02 NL NL6700013A patent/NL6700013A/xx unknown
- 1967-01-03 AT AT6667A patent/AT264540B/de active
- 1967-01-03 GB GB342/67A patent/GB1167304A/en not_active Expired
- 1967-01-03 BE BE692123D patent/BE692123A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3471538A (en) | 1969-10-07 |
| ES334908A1 (es) | 1968-03-01 |
| GB1167304A (en) | 1969-10-15 |
| NL6700013A (it) | 1967-07-04 |
| IL27117A (en) | 1972-01-27 |
| AT264540B (de) | 1968-09-10 |
| IL27120A (en) | 1972-01-27 |
| US3475474A (en) | 1969-10-28 |
| BE692123A (it) | 1967-06-16 |
| FR1510255A (fr) | 1968-01-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2613221A (en) | Preparing polyhalogenoalkenyl compounds | |
| US3211768A (en) | Chemical process for preparing a salt of a metal of groups (iv)a and (v)a and salt | |
| CS209884B2 (en) | Method of preparation of the organo-stannate derivatives of the mercapto-alcanole esters | |
| US4390723A (en) | Process for producing hydroxyphenyl aliphatic acid derivatives | |
| US4260422A (en) | Novel phosphonocarboxylic acid compounds | |
| IL27119A (en) | Omega-cyanopolymethylene tin mercaptides and esters | |
| GB878393A (en) | Process for the production of 3, 5, 3-5-tetra-substituted 4, 4-dihydroxy-diphenylmethyl carboxylic acids | |
| US2832752A (en) | Hydrocarbon monomercaptoesters and vinyl halide resin stabilized therewith | |
| US2608577A (en) | Process for producing di(alkyl glycolyl) esters of aliphatic dicarboxylic acids | |
| US2170996A (en) | Ethylene glycol di-(aryloxyacetates) | |
| US2288863A (en) | Process for the manufacture of substituted amides of 3,5-dimethylisoxazole-4-carboxylic acid | |
| DE3130628C2 (it) | ||
| EP0026736B1 (de) | Verfahren zur Herstellung von 2,3,5-Trichlorpyridin sowie Ammoniumsalze des Methanphosphonsäuremonomethylesters und deren Herstellung | |
| US5623082A (en) | Preparation of acyl chlorides | |
| US3317586A (en) | Dialkoxycyclobutane carboxylic acid esters and their preparation | |
| DE2749083A1 (de) | Verfahren zur herstellung von organozinnverbindungen | |
| US3636144A (en) | Dithiophosphoric acid salts and process for making same | |
| US2653157A (en) | p-amino-salicylic acid derivatives and their production | |
| US2112129A (en) | Method of preparing organic mercury compounds | |
| EP0507738B1 (de) | Verfahren zur Herstellung von sterisch gehinderten Hydroxybenzylphosphonaten | |
| US3308142A (en) | Production of organotin-phosphorus compounds | |
| SU502895A1 (ru) | Способ получени перекисных соединений, содержащих металлорганические группировки | |
| SU461100A1 (ru) | Способ получени производных имидазола | |
| US2980724A (en) | Preparation of dialkyl phosphoric acids | |
| SU516706A1 (ru) | Эпоксидное соединение |