IL26949A - 3-nitro-4-halophenol derivatives and their preparation - Google Patents
3-nitro-4-halophenol derivatives and their preparationInfo
- Publication number
- IL26949A IL26949A IL26949A IL2694966A IL26949A IL 26949 A IL26949 A IL 26949A IL 26949 A IL26949 A IL 26949A IL 2694966 A IL2694966 A IL 2694966A IL 26949 A IL26949 A IL 26949A
- Authority
- IL
- Israel
- Prior art keywords
- preparation
- derivatives
- nitro
- halophenol
- acid
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 5
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 claims description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000012954 diazonium Substances 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 230000003474 anti-emetic effect Effects 0.000 description 1
- 239000002111 antiemetic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 230000007721 medicinal effect Effects 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- -1 sodium potassium magnesium calcium barium nickel copper mercury silver Chemical compound 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/13—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups
- C07C205/26—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups and being further substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/12—Preparation of nitro compounds by reactions not involving the formation of nitro groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/59—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C205/60—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms in ortho-position to the carboxyl group, e.g. nitro-salicylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7794565 | 1965-12-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL26949A true IL26949A (en) | 1971-04-28 |
Family
ID=13648165
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL26949A IL26949A (en) | 1965-12-17 | 1966-11-25 | 3-nitro-4-halophenol derivatives and their preparation |
Country Status (11)
| Country | Link |
|---|---|
| BE (1) | BE690479A (online.php) |
| BR (1) | BR6685259D0 (online.php) |
| CH (1) | CH470341A (online.php) |
| ES (1) | ES334953A1 (online.php) |
| FI (1) | FI48065C (online.php) |
| FR (1) | FR1504228A (online.php) |
| GB (1) | GB1100219A (online.php) |
| IL (1) | IL26949A (online.php) |
| NO (1) | NO132930C (online.php) |
| OA (1) | OA02687A (online.php) |
| SE (1) | SE350964B (online.php) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3914325A (en) * | 1973-06-21 | 1975-10-21 | Olin Corp | Method for preparing phenol compounds using mixed acid system |
| DE3524329A1 (de) * | 1985-07-08 | 1987-01-08 | Henkel Kgaa | Neue aminophenole und deren verwendung in oxidationshaarfaerbemitteln |
| DE3731527A1 (de) * | 1987-09-18 | 1989-03-30 | Bayer Ag | Neue 2-methyl-4-fluor-phenole und deren herstellung |
| US4943666A (en) * | 1988-04-27 | 1990-07-24 | Takeda Chemical Industries, Ltd. | Process for producing nitrophenol compound |
| DE3816839A1 (de) * | 1988-05-18 | 1989-11-30 | Wella Ag | Verfahren zur herstellung von 4-chlor-2-methyl-5-nitro-phenol |
-
1966
- 1966-11-25 IL IL26949A patent/IL26949A/en unknown
- 1966-11-30 BE BE690479D patent/BE690479A/xx not_active IP Right Cessation
- 1966-12-02 FI FI663200A patent/FI48065C/fi active
- 1966-12-08 FR FR86770A patent/FR1504228A/fr not_active Expired
- 1966-12-09 BR BR185259/66A patent/BR6685259D0/pt unknown
- 1966-12-09 ES ES334953A patent/ES334953A1/es not_active Expired
- 1966-12-13 OA OA52693A patent/OA02687A/xx unknown
- 1966-12-15 SE SE17201/66A patent/SE350964B/xx unknown
- 1966-12-16 CH CH1803766A patent/CH470341A/fr not_active IP Right Cessation
- 1966-12-16 GB GB56482/66A patent/GB1100219A/en not_active Expired
- 1966-12-16 NO NO166026A patent/NO132930C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI48065C (fi) | 1974-06-10 |
| BE690479A (online.php) | 1967-05-30 |
| NO132930B (online.php) | 1975-10-27 |
| SE350964B (online.php) | 1972-11-13 |
| CH470341A (fr) | 1969-03-31 |
| FR1504228A (fr) | 1967-12-01 |
| FI48065B (online.php) | 1974-02-28 |
| GB1100219A (en) | 1968-01-24 |
| OA02687A (fr) | 1970-12-15 |
| BR6685259D0 (pt) | 1973-12-26 |
| NO132930C (online.php) | 1976-02-04 |
| ES334953A1 (es) | 1968-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4762844A (en) | Antibacterially active alkyl-1-cyclopropyl-1,4-dihydro-4-oxo-3-quinolinecarboxylic acids | |
| Schubert | The Interaction of Thiols and Quinones1 | |
| US3895028A (en) | Alpha-(2-phenylbenzothiazol-5-yl)propionic acid | |
| Hodgson et al. | 382. The diazotisation of aromatic nitro-amines and the prevention of diaryl formation in the Sandmeyer reaction | |
| EP0000200A1 (en) | New N-amidino-3,5-diamino-6-substituted-2-pyrazinecarboxamides and process for preparing same | |
| IL26949A (en) | 3-nitro-4-halophenol derivatives and their preparation | |
| SU619098A3 (ru) | Способ получени карбоновых кислот или их минеральных,или органических солей,или сложных эфиров | |
| DE1695702C3 (de) | Verfahren zur Herstellung von 1-Acyl-2-carboxy-3-indolylessigsäuren | |
| CA1130307A (en) | Pharmaceutical n-(indanon-7-yl) oxaminic acid derivatives | |
| US4264500A (en) | Process of making 6-chloro-α-methyl-carbazole-2-acetic acid | |
| US3412146A (en) | Process for preparation of diphenyl alkanoic acids | |
| US3703597A (en) | Preparation of benzilic acid compounds | |
| US2430006A (en) | 4-methyl-5-imidazolone-(2)-caproic acid and esters thereof | |
| US2032263A (en) | Arsenic derivatives of sugars | |
| KR860001312B1 (ko) | 말론산 유도체의 제조방법 | |
| US2633470A (en) | Aromatic hydroxy acid compounds and methods for producing the same | |
| AT316744B (de) | Verfahren zur Herstellung neuer Acyloxyalkylester von 6-(α-Aminophenylacetamido)-penicillansäure, 7-(α-Aminophenylacetamido)-desacetoxycephalosporansäure und 7-(α-Aminophenylacetamido)-cephalosporansäure | |
| US2906779A (en) | Preparation of 3-nitro-4 (4'-methoxyphenoxy)-benzaldehyde | |
| KLEMME et al. | SYNTHESIS OF IODOHIPPURIC ACIDS. II. 2, 3, 5-AND 3, 4, 5-TRIIODOHIPPURIC ACIDS1 | |
| Cheney et al. | Some Tetrahydrothiophene β-Keto Ester Derivatives | |
| US2512518A (en) | Halogenated acenaphthoyl alkanoic acids | |
| KR810000816B1 (ko) | 4-벤조일피라졸 유도체 및 그의 알루미늄염의 제법 | |
| HU193454B (en) | Process for producing 3-phenyl-butyraldehyde derivatives | |
| Hammick et al. | 190. A new synthesis of 1-amino-4-methylthioxanthone and of miracil D | |
| US2475929A (en) | N-allyl-2-pyridone-5-carboxylic acid |