IL26285A - Preparations regulate the growth of plants that include the conversion of converted acid - Google Patents
Preparations regulate the growth of plants that include the conversion of converted acidInfo
- Publication number
- IL26285A IL26285A IL26285A IL2628566A IL26285A IL 26285 A IL26285 A IL 26285A IL 26285 A IL26285 A IL 26285A IL 2628566 A IL2628566 A IL 2628566A IL 26285 A IL26285 A IL 26285A
- Authority
- IL
- Israel
- Prior art keywords
- derivative
- elaiaed
- claias
- aethod
- vhereia
- Prior art date
Links
- FSQQTNAZHBEJLS-OWOJBTEDSA-N (e)-4-amino-4-oxobut-2-enoic acid Chemical class NC(=O)\C=C\C(O)=O FSQQTNAZHBEJLS-OWOJBTEDSA-N 0.000 title description 13
- 230000008635 plant growth Effects 0.000 title description 6
- 239000002253 acid Substances 0.000 claims description 25
- 150000003839 salts Chemical class 0.000 claims description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 9
- 150000002148 esters Chemical class 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 230000001105 regulatory effect Effects 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical group [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000004094 surface-active agent Substances 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- 239000002689 soil Substances 0.000 claims 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 13
- FSQQTNAZHBEJLS-UHFFFAOYSA-N Monoamide-Fumaric acid Natural products NC(=O)C=CC(O)=O FSQQTNAZHBEJLS-UHFFFAOYSA-N 0.000 description 12
- 239000000126 substance Substances 0.000 description 12
- 241000196324 Embryophyta Species 0.000 description 11
- 150000007513 acids Chemical class 0.000 description 10
- FSQQTNAZHBEJLS-OWOJBTEDSA-M (e)-4-amino-4-oxobut-2-enoate Chemical compound NC(=O)\C=C\C([O-])=O FSQQTNAZHBEJLS-OWOJBTEDSA-M 0.000 description 8
- 230000012010 growth Effects 0.000 description 8
- 239000000243 solution Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N EtOH Substances CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- 244000105624 Arachis hypogaea Species 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- FSQQTNAZHBEJLS-UPHRSURJSA-N maleamic acid Chemical compound NC(=O)\C=C/C(O)=O FSQQTNAZHBEJLS-UPHRSURJSA-N 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 208000027418 Wounds and injury Diseases 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 230000007812 deficiency Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 208000014674 injury Diseases 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- ACVHHVCLERJENS-ARJAWSKDSA-N (z)-4-(2,2-dimethylhydrazinyl)-4-oxobut-2-enoic acid Chemical compound CN(C)NC(=O)\C=C/C(O)=O ACVHHVCLERJENS-ARJAWSKDSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 240000008564 Boehmeria nivea Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-O Methylammonium ion Chemical compound [NH3+]C BAVYZALUXZFZLV-UHFFFAOYSA-O 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229920004890 Triton X-100 Polymers 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- WZEMSIKSCALWJZ-UHFFFAOYSA-N azane;ethanol Chemical compound N.CCO.CCO WZEMSIKSCALWJZ-UHFFFAOYSA-N 0.000 description 1
- ZXVOCOLRQJZVBW-UHFFFAOYSA-N azane;ethanol Chemical compound N.CCO ZXVOCOLRQJZVBW-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000012612 commercial material Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-O ethylaminium Chemical compound CC[NH3+] QUSNBJAOOMFDIB-UHFFFAOYSA-O 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- -1 i.e. Chemical class 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Cultivation Of Plants (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US53527066A | 1966-01-28 | 1966-01-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL26285A true IL26285A (en) | 1970-07-19 |
Family
ID=24133517
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL26285A IL26285A (en) | 1966-01-28 | 1966-08-07 | Preparations regulate the growth of plants that include the conversion of converted acid |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3458304A (enExample) |
| BE (1) | BE688275A (enExample) |
| BR (1) | BR6682672D0 (enExample) |
| DE (1) | DE1567213A1 (enExample) |
| GB (1) | GB1117036A (enExample) |
| IL (1) | IL26285A (enExample) |
| LU (1) | LU52196A1 (enExample) |
| NL (1) | NL6700635A (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5146812B1 (enExample) * | 1971-04-15 | 1976-12-11 | ||
| US3775089A (en) * | 1971-11-02 | 1973-11-27 | A Donnell | Methylated muconic acid hydrazides |
| US4125398A (en) * | 1975-11-07 | 1978-11-14 | Ciba-Geigy Corporation | N-Phenyl-maleic acid amides for regulating the growth and development of plants |
| US4216238A (en) * | 1979-02-13 | 1980-08-05 | Stauffer Chemical Company | Dialkyl amino ethyl amides, their salts and their use as anti-ripening agents |
| US5214196A (en) * | 1987-09-04 | 1993-05-25 | Dexter Chemical Corporation | Diethyl ester of di-glycyl fumaramide |
| US5242905A (en) * | 1987-09-04 | 1993-09-07 | Dexter Chemical Corporation | Pharmaceutical compositions for the treatment of psoriasis |
| US4906280A (en) * | 1987-10-14 | 1990-03-06 | Pennwalt Corporation | Tertiary butylhydrazides as plant growth regulators |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2835703A (en) * | 1956-04-18 | 1958-05-20 | Eastman Kodak Co | Hydrazides of allyloxamic acid |
| US3084036A (en) * | 1959-02-05 | 1963-04-02 | Dow Chemical Co | Herbicidal composition and method employing allyl hydrazine |
| US3318677A (en) * | 1961-02-16 | 1967-05-09 | Us Rubber Co | Plant dwarfing composition and method |
| US3240799A (en) * | 1961-02-16 | 1966-03-15 | Us Rubber Co | N-disubstituted amino amic acids |
| US3278597A (en) * | 1963-05-08 | 1966-10-11 | Gulf Oil Corp | Substituted tiglanilide herbicides |
| US3305347A (en) * | 1964-11-12 | 1967-02-21 | Tenneco Chem | Benzylidene hydrazine pesticides |
-
1966
- 1966-01-28 US US535270A patent/US3458304A/en not_active Expired - Lifetime
- 1966-08-07 IL IL26285A patent/IL26285A/en unknown
- 1966-08-12 GB GB36112/66A patent/GB1117036A/en not_active Expired
- 1966-09-06 BR BR182672/66A patent/BR6682672D0/pt unknown
- 1966-09-16 DE DE19661567213 patent/DE1567213A1/de active Pending
- 1966-10-14 BE BE688275D patent/BE688275A/xx unknown
- 1966-10-18 LU LU52196A patent/LU52196A1/xx unknown
-
1967
- 1967-01-16 NL NL6700635A patent/NL6700635A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1567213A1 (de) | 1970-05-21 |
| BR6682672D0 (pt) | 1973-08-09 |
| NL6700635A (enExample) | 1967-07-31 |
| US3458304A (en) | 1969-07-29 |
| LU52196A1 (enExample) | 1966-12-19 |
| GB1117036A (en) | 1968-06-12 |
| BE688275A (enExample) | 1967-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4229313A (en) | Alkali metal hypochlorite bleaching and cleaning compositions thickened with branch chain amine oxides | |
| IL26285A (en) | Preparations regulate the growth of plants that include the conversion of converted acid | |
| PT91596A (pt) | Process for preparing aqueous formulations containing for example furathiocarb | |
| US3142554A (en) | Controlling vegetation with aryl thioalkylamines | |
| US2614916A (en) | Agricultural chemical compositions comprising 1,2 - dihydropyridazine-3,6-dione and its salts | |
| CN120570802B (zh) | 一种抑菌多肽及其制备宠物沐浴露的应用 | |
| US3046189A (en) | Nematocidal agents | |
| US3081222A (en) | Fungicides | |
| US3645715A (en) | Algicidal agents | |
| US3471560A (en) | Symmetrical halo-substituted aromatic diquaternary ammonium compounds | |
| US3892786A (en) | Bromoacetanilides and their utility as biocides | |
| US2978480A (en) | Bis-(alkyl sulfonyl and sulfoxyl) aliphatic acid derivatives | |
| US3497343A (en) | Method of stunting plant growth with substituted hydrazonium salts | |
| US3370079A (en) | 4-isopropyl-diphenyl-amine-n-carboxylic acid beta-(dimethylamino)propyl thioester | |
| US2785195A (en) | Nu-(3-methylcyclopentyl)-sulfamic acid and salts thereof | |
| US2398706A (en) | Riboflavin derivatives and process of preparing the same | |
| US3636001A (en) | Amine salts of nitraminotriazoles | |
| RU2072781C1 (ru) | Гербицидный состав | |
| US4426393A (en) | Method of protecting useful plants and formulations for use in said method | |
| GB1090282A (en) | 2-amino-2,3-dihydro-3-substituted-5-benzofuranols | |
| US3227541A (en) | Herbicidal composition and method | |
| US4028089A (en) | Plant growth influencers | |
| US3295949A (en) | Method for the control of undesirable plant growth | |
| GB808187A (en) | Weedkilling compositions | |
| GB798680A (en) | Improvements in or relating to the preparation of pharmaceutical compositions |