IL25573A - Substituted benzimidazole-1-carboxylic and thiocarboxylic acid esters,their preparation and use - Google Patents
Substituted benzimidazole-1-carboxylic and thiocarboxylic acid esters,their preparation and useInfo
- Publication number
- IL25573A IL25573A IL25573A IL2557366A IL25573A IL 25573 A IL25573 A IL 25573A IL 25573 A IL25573 A IL 25573A IL 2557366 A IL2557366 A IL 2557366A IL 25573 A IL25573 A IL 25573A
- Authority
- IL
- Israel
- Prior art keywords
- acid
- substituted
- benzimidazole
- ester
- compound
- Prior art date
Links
- -1 thiocarboxylic acid esters Chemical class 0.000 title claims description 20
- 238000002360 preparation method Methods 0.000 title claims description 8
- MJABXZWILYUAEB-UHFFFAOYSA-N benzimidazole-1-carboxylic acid Chemical class C1=CC=C2N(C(=O)O)C=NC2=C1 MJABXZWILYUAEB-UHFFFAOYSA-N 0.000 title description 11
- 239000002253 acid Substances 0.000 claims description 40
- 150000001875 compounds Chemical class 0.000 claims description 32
- 238000000034 method Methods 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 150000002148 esters Chemical class 0.000 claims description 14
- 239000000460 chlorine Substances 0.000 claims description 12
- 229910052783 alkali metal Inorganic materials 0.000 claims description 11
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 7
- 235000013601 eggs Nutrition 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 239000005864 Sulphur Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims 3
- 241000239223 Arachnida Species 0.000 claims 2
- 239000004480 active ingredient Substances 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 1
- 150000004985 diamines Chemical class 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims 1
- 230000008635 plant growth Effects 0.000 claims 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 claims 1
- 230000000694 effects Effects 0.000 description 19
- 239000004009 herbicide Substances 0.000 description 13
- 239000002917 insecticide Substances 0.000 description 12
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical class C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 10
- 241000196324 Embryophyta Species 0.000 description 10
- 230000002363 herbicidal effect Effects 0.000 description 10
- 150000001556 benzimidazoles Chemical class 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 230000008018 melting Effects 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 241001454293 Tetranychus urticae Species 0.000 description 6
- 238000005804 alkylation reaction Methods 0.000 description 6
- 241000238876 Acari Species 0.000 description 5
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 230000029936 alkylation Effects 0.000 description 5
- 238000005507 spraying Methods 0.000 description 5
- 238000003419 tautomerization reaction Methods 0.000 description 5
- 244000152970 Digitaria sanguinalis Species 0.000 description 4
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 4
- 244000046052 Phaseolus vulgaris Species 0.000 description 4
- 239000013256 coordination polymer Substances 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 230000001988 toxicity Effects 0.000 description 4
- 231100000419 toxicity Toxicity 0.000 description 4
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 3
- BXCSXZJKEJQDKS-UHFFFAOYSA-N 4,5,6-trichloro-2-(trifluoromethyl)-1h-benzimidazole Chemical compound ClC1=C(Cl)C=C2NC(C(F)(F)F)=NC2=C1Cl BXCSXZJKEJQDKS-UHFFFAOYSA-N 0.000 description 3
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 3
- 244000055702 Amaranthus viridis Species 0.000 description 3
- 235000004135 Amaranthus viridis Nutrition 0.000 description 3
- 235000009344 Chenopodium album Nutrition 0.000 description 3
- 235000005484 Chenopodium berlandieri Nutrition 0.000 description 3
- 235000009332 Chenopodium rubrum Nutrition 0.000 description 3
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 3
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 3
- 235000005476 Digitaria cruciata Nutrition 0.000 description 3
- 235000006830 Digitaria didactyla Nutrition 0.000 description 3
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 3
- 235000014716 Eleusine indica Nutrition 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 3
- 241000500437 Plutella xylostella Species 0.000 description 3
- DFBKLUNHFCTMDC-GKRDHZSOSA-N endrin Chemical compound C([C@@H]1[C@H]2[C@@]3(Cl)C(Cl)=C([C@]([C@H]22)(Cl)C3(Cl)Cl)Cl)[C@@H]2[C@H]2[C@@H]1O2 DFBKLUNHFCTMDC-GKRDHZSOSA-N 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 230000003151 ovacidal effect Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- MXFMPTXDHSDMTI-UHFFFAOYSA-N 2-(trifluoromethyl)-1h-benzimidazole Chemical compound C1=CC=C2NC(C(F)(F)F)=NC2=C1 MXFMPTXDHSDMTI-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 240000008100 Brassica rapa Species 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- 244000211187 Lepidium sativum Species 0.000 description 2
- 235000007849 Lepidium sativum Nutrition 0.000 description 2
- 241000209082 Lolium Species 0.000 description 2
- 241000358455 Phacelia tanacetifolia Species 0.000 description 2
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 230000035784 germination Effects 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 230000000749 insecticidal effect Effects 0.000 description 2
- MGUJLJPUQIWMFE-UHFFFAOYSA-N methyl 4,5,6-trichloro-2-(trifluoromethyl)benzimidazole-1-carboxylate Chemical compound ClC1=C(Cl)C=C2N(C(=O)OC)C(C(F)(F)F)=NC2=C1Cl MGUJLJPUQIWMFE-UHFFFAOYSA-N 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 150000002903 organophosphorus compounds Chemical class 0.000 description 2
- RLBIQVVOMOPOHC-UHFFFAOYSA-N parathion-methyl Chemical compound COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C=C1 RLBIQVVOMOPOHC-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- ZAKUPYLPTSMSJE-UHFFFAOYSA-N 1,2,6-trimethylbenzimidazole Chemical class C1=C(C)C=C2N(C)C(C)=NC2=C1 ZAKUPYLPTSMSJE-UHFFFAOYSA-N 0.000 description 1
- FARSPAVQUKTXLF-UHFFFAOYSA-N 1h-benzimidazol-1-ium;chloride Chemical compound Cl.C1=CC=C2NC=NC2=C1 FARSPAVQUKTXLF-UHFFFAOYSA-N 0.000 description 1
- JQULGDSPPLTYIF-UHFFFAOYSA-N 4,5,6-trichloro-2-(trifluoromethyl)benzimidazole-1-carboxylic acid Chemical compound ClC1=C(C(=CC=2N(C(=NC21)C(F)(F)F)C(=O)O)Cl)Cl JQULGDSPPLTYIF-UHFFFAOYSA-N 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- 235000011293 Brassica napus Nutrition 0.000 description 1
- 235000011292 Brassica rapa Nutrition 0.000 description 1
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 1
- NVQQVRAFZNRHES-UHFFFAOYSA-N C(CC(C)C)OC(=O)N1C(=NC2=C1C=C(C(=C2Cl)Cl)Cl)C(F)(F)F Chemical compound C(CC(C)C)OC(=O)N1C(=NC2=C1C=C(C(=C2Cl)Cl)Cl)C(F)(F)F NVQQVRAFZNRHES-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical class [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- ZAKOWWREFLAJOT-CEFNRUSXSA-N D-alpha-tocopherylacetate Chemical compound CC(=O)OC1=C(C)C(C)=C2O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C ZAKOWWREFLAJOT-CEFNRUSXSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 240000000982 Malva neglecta Species 0.000 description 1
- 235000000060 Malva neglecta Nutrition 0.000 description 1
- 235000002263 Malva nicaeensis Nutrition 0.000 description 1
- 241001547152 Malva nicaeensis Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000015225 Panicum colonum Nutrition 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 241000500439 Plutella Species 0.000 description 1
- 241000500441 Plutellidae Species 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical class [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 241001454294 Tetranychus Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical class [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- SESHIEADFRFNSG-UHFFFAOYSA-L [Br-].[Mg+2].N1=CNC2=C1C=CC=C2.[Br-] Chemical compound [Br-].[Mg+2].N1=CNC2=C1C=CC=C2.[Br-] SESHIEADFRFNSG-UHFFFAOYSA-L 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 238000007083 alkoxycarbonylation reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 239000003181 biological factor Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical class [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 238000006835 carbomethoxylation reaction Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Chemical class 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical class OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- DLDYYQLMBMSQTM-UHFFFAOYSA-N ethyl 2-chloro-5-nitrobenzimidazole-1-carboxylate Chemical compound [O-][N+](=O)C1=CC=C2N(C(=O)OCC)C(Cl)=NC2=C1 DLDYYQLMBMSQTM-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000002316 fumigant Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- OPXLLQIJSORQAM-UHFFFAOYSA-N mebendazole Chemical compound C=1C=C2NC(NC(=O)OC)=NC2=CC=1C(=O)C1=CC=CC=C1 OPXLLQIJSORQAM-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 230000017448 oviposition Effects 0.000 description 1
- 230000010627 oxidative phosphorylation Effects 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- LCCNCVORNKJIRZ-UHFFFAOYSA-N parathion Chemical compound CCOP(=S)(OCC)OC1=CC=C([N+]([O-])=O)C=C1 LCCNCVORNKJIRZ-UHFFFAOYSA-N 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000013074 reference sample Substances 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- MLGCXEBRWGEOQX-UHFFFAOYSA-N tetradifon Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)C1=CC(Cl)=C(Cl)C=C1Cl MLGCXEBRWGEOQX-UHFFFAOYSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Chemical class 0.000 description 1
- 239000011701 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D235/10—Radicals substituted by halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US44824365A | 1965-04-15 | 1965-04-15 | |
| DES0096569 | 1965-04-15 | ||
| DES96570A DE1297400B (de) | 1965-04-15 | 1965-04-15 | Schaedlingsbekaempfungsmittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL25573A true IL25573A (en) | 1970-04-20 |
Family
ID=27212933
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL25573A IL25573A (en) | 1965-04-15 | 1966-04-13 | Substituted benzimidazole-1-carboxylic and thiocarboxylic acid esters,their preparation and use |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3884933A (enExample) |
| BE (1) | BE679607A (enExample) |
| BR (1) | BR6678696D0 (enExample) |
| CH (1) | CH480794A (enExample) |
| DE (3) | DE1620264A1 (enExample) |
| DK (1) | DK129316B (enExample) |
| GB (1) | GB1114943A (enExample) |
| IL (1) | IL25573A (enExample) |
| NL (1) | NL6605140A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BR9609888A (pt) | 1995-08-10 | 1999-05-25 | Bayer Ag | Halogenobenzimidazóis |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2933502A (en) * | 1958-02-12 | 1960-04-19 | Du Pont | Benzimidazolone derivatives |
| US2933504A (en) * | 1959-08-10 | 1960-04-19 | Du Pont | Derivatives of polyalkoxycarbonyl imine |
-
1965
- 1965-04-15 DE DE19651620264 patent/DE1620264A1/de active Pending
- 1965-04-15 DE DES96570A patent/DE1297400B/de active Pending
-
1966
- 1966-04-13 GB GB16182/66A patent/GB1114943A/en not_active Expired
- 1966-04-13 CH CH535966A patent/CH480794A/de not_active IP Right Cessation
- 1966-04-13 DE DE19661567132 patent/DE1567132A1/de active Pending
- 1966-04-13 IL IL25573A patent/IL25573A/en unknown
- 1966-04-13 US US542204A patent/US3884933A/en not_active Expired - Lifetime
- 1966-04-13 BR BR178696/66A patent/BR6678696D0/pt unknown
- 1966-04-13 DK DK189466AA patent/DK129316B/da unknown
- 1966-04-15 NL NL6605140A patent/NL6605140A/xx unknown
- 1966-04-15 BE BE679607D patent/BE679607A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1567132A1 (de) | 1970-07-23 |
| DE1620264A1 (de) | 1970-02-12 |
| US3884933A (en) | 1975-05-20 |
| GB1114943A (en) | 1968-05-22 |
| DK129316B (da) | 1974-09-30 |
| DE1297400B (de) | 1969-06-12 |
| BR6678696D0 (pt) | 1973-10-23 |
| NL6605140A (enExample) | 1966-10-17 |
| BE679607A (enExample) | 1966-10-17 |
| DK129316C (enExample) | 1975-04-14 |
| CH480794A (de) | 1969-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3937840A (en) | Compositions and methods of combatting bacteria and fungi using 2-methylbenzanilide derivatives | |
| US4309562A (en) | Herbicidal compound, herbicidal composition containing the same, and method of use thereof | |
| US3957852A (en) | Diphenyl ether compounds | |
| US3965107A (en) | Isothiazolopyridinones | |
| US3108927A (en) | Phenolic pesticide | |
| US4551171A (en) | 2-Nitro-5-(substituted-phenoxy) phenylalkanone oxime and imine derivatives as herbicides | |
| US3931202A (en) | Pyridyl phenyl-carbamate rodenticides | |
| US3988465A (en) | Benzimidazole insecticides | |
| EP0101288A2 (en) | Aryl(aryloxy or arylthio)azolomethanes, their preparation and their use | |
| IL25573A (en) | Substituted benzimidazole-1-carboxylic and thiocarboxylic acid esters,their preparation and use | |
| US3985804A (en) | Agricultural substituted 2-methylbenzanilide germicide | |
| JP3186067B2 (ja) | 新規なヒドラジンカルボン酸エステル殺ダニ剤および殺虫剤 | |
| US4097512A (en) | N-tetrachlorofluoroethylthio-halo-benzoyl anilides and their use as fungicides | |
| IE54195B1 (en) | Triazole and imidazole derivatives and compositions containing the same | |
| US3227759A (en) | N-(substituted phenyl)-aralkyl amines | |
| US3683031A (en) | Substituted methyl ethers of 2-branched-alkyl-4,6-dinitrophenols | |
| US3860589A (en) | Tetrazine herbicides | |
| US3860588A (en) | Dihydrotetrazine herbicides | |
| US4011341A (en) | Ring-substituted n-(2,2-difluoroalkanoyl)-o-phenylenediamine insecticides | |
| US3907892A (en) | Ring-substituted N-(2,2-difluoroalkanoyl)-o-phenylenediamine compounds | |
| US4340417A (en) | Herbicidal 1-(5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl)-3-isopropyl-2,1,3-benzothiadiazin-4-one,2,2-dioxide | |
| US4382948A (en) | 1,3,4-Trisubstituted-2-pyrazolin-5-one fungicides | |
| US4291061A (en) | 1H-inden-1-one derivatives, processes for producing them, their use in microbicidal compositions, and for combating microorganisms | |
| US4074059A (en) | Substituted-1-phenol-4-sulfonamides | |
| USRE29508E (en) | Ring-substituted N-(2,2-difluoroalkanoyl)-o-phenylenediamine compounds |