IL25144A - Method of preparing 2,3-dihydro-2,2-dimethyl-7-benzofuranol - Google Patents
Method of preparing 2,3-dihydro-2,2-dimethyl-7-benzofuranolInfo
- Publication number
- IL25144A IL25144A IL25144A IL2514466A IL25144A IL 25144 A IL25144 A IL 25144A IL 25144 A IL25144 A IL 25144A IL 2514466 A IL2514466 A IL 2514466A IL 25144 A IL25144 A IL 25144A
- Authority
- IL
- Israel
- Prior art keywords
- benzofuranol
- dihydro
- dimethyl
- preparing
- Prior art date
Links
- WJGPNUBJBMCRQH-UHFFFAOYSA-N 2,2-dimethyl-2,3-dihydro-1-benzofuran-7-ol Chemical compound C1=CC(O)=C2OC(C)(C)CC2=C1 WJGPNUBJBMCRQH-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/13—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups
- C07C205/20—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups and hydroxy groups bound to carbon atoms of six-membered aromatic rings
- C07C205/21—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups and hydroxy groups bound to carbon atoms of six-membered aromatic rings having nitro groups and hydroxy groups bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C205/22—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups and hydroxy groups bound to carbon atoms of six-membered aromatic rings having nitro groups and hydroxy groups bound to carbon atoms of the same non-condensed six-membered aromatic ring having one nitro groups bound to the ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/37—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/86—Benzo [b] furans; Hydrogenated benzo [b] furans with an oxygen atom directly attached in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US436279A US3320286A (en) | 1965-03-01 | 1965-03-01 | Synthesis of 2, 2-dimethyl-7-benzofuranol |
| US436169A US3412110A (en) | 1965-03-01 | 1965-03-01 | 2, 3-dihydro-2, 2-dimethyl-7-nitrobenzofuran |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL25144A true IL25144A (en) | 1970-01-29 |
Family
ID=27030834
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL25144A IL25144A (en) | 1965-03-01 | 1966-02-09 | Method of preparing 2,3-dihydro-2,2-dimethyl-7-benzofuranol |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US3320286A (index.php) |
| BE (1) | BE677004A (index.php) |
| BR (1) | BR6677437D0 (index.php) |
| CH (1) | CH476718A (index.php) |
| DE (1) | DE1543573B1 (index.php) |
| DK (1) | DK118885B (index.php) |
| GB (3) | GB1140360A (index.php) |
| IL (1) | IL25144A (index.php) |
| NL (2) | NL6602601A (index.php) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3723472A (en) * | 1970-11-27 | 1973-03-27 | Fmc Corp | Synthesis of 2,2-dimethyl-7-benzofuranol |
| JPS525486B2 (index.php) * | 1973-02-13 | 1977-02-14 | ||
| US4118400A (en) * | 1977-09-22 | 1978-10-03 | Fmc Corporation | Process for preparing 2,3-dihydro-7-benzofuranols and benzodioxole intermediate therefor |
| FR2461708A1 (fr) * | 1979-07-18 | 1981-02-06 | Rhone Poulenc Agrochimie | Preparation de dihydrodimethylhydroxy-7 benzofurane |
| US4463184A (en) * | 1981-07-31 | 1984-07-31 | Union Carbide Corporation | Process for the preparation of carbofuran |
| US4380654A (en) * | 1982-02-18 | 1983-04-19 | Fmc Corporation | Process for preparation of 2,3-dihydro-2,2-dimethyl-7-hydroxybenzofuran |
| US4576632A (en) * | 1982-06-15 | 1986-03-18 | E. I. Du Pont De Nemours And Company | Benzofuran sulfamates |
| JPS6133183A (ja) * | 1984-07-25 | 1986-02-17 | Mitsubishi Chem Ind Ltd | 2,3−ジヒドロ−7−アミノベンゾフランの製造法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2312801A (en) * | 1940-06-28 | 1943-03-02 | Rohm & Haas | Insecticide |
| US2383264A (en) * | 1943-12-10 | 1945-08-21 | American Cyanamid Co | Azo dyestuffs from 5-amino coumaran |
| US3213112A (en) * | 1956-02-17 | 1965-10-19 | Air Reduction | Tetrahydrofurans |
| US2894993A (en) * | 1957-04-26 | 1959-07-14 | Universal Oil Prod Co | Insecticides and preparation thereof |
| NL131921C (index.php) * | 1963-06-28 |
-
0
- NL NL130299D patent/NL130299C/xx active
-
1965
- 1965-03-01 US US436279A patent/US3320286A/en not_active Expired - Lifetime
- 1965-03-01 US US436169A patent/US3412110A/en not_active Expired - Lifetime
-
1966
- 1966-02-09 IL IL25144A patent/IL25144A/xx unknown
- 1966-02-24 BE BE677004D patent/BE677004A/xx not_active IP Right Cessation
- 1966-02-25 DK DK101266AA patent/DK118885B/da unknown
- 1966-02-28 GB GB50305/67A patent/GB1140360A/en not_active Expired
- 1966-02-28 GB GB8602/66A patent/GB1140358A/en not_active Expired
- 1966-02-28 NL NL6602601A patent/NL6602601A/xx unknown
- 1966-02-28 GB GB50304/67A patent/GB1140359A/en not_active Expired
- 1966-03-01 DE DE19661543573 patent/DE1543573B1/de active Pending
- 1966-03-01 BR BR177437/66A patent/BR6677437D0/pt unknown
- 1966-03-01 CH CH290866A patent/CH476718A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US3320286A (en) | 1967-05-16 |
| BE677004A (index.php) | 1966-08-24 |
| GB1140358A (en) | 1969-01-15 |
| DE1543573B1 (de) | 1971-07-29 |
| DK118885B (da) | 1970-10-19 |
| NL130299C (index.php) | |
| GB1140359A (en) | 1969-01-15 |
| NL6602601A (index.php) | 1966-09-02 |
| BR6677437D0 (pt) | 1973-09-18 |
| GB1140360A (en) | 1969-01-15 |
| US3412110A (en) | 1968-11-19 |
| CH476718A (de) | 1969-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL30842A (en) | Furan derivatives and process for their preparation | |
| CS178810B2 (en) | Method of hydrocarbonsconversion | |
| IL25144A (en) | Method of preparing 2,3-dihydro-2,2-dimethyl-7-benzofuranol | |
| IL25034A (en) | Method of preparing 2,3-dihydro-2,2-dimethyl-7-benzofuranyl n-methyl carbamate | |
| IL27333A (en) | Method of preparing 2,3-dihydro-2,2-dimethyl-7-benzofuranol | |
| MY6700139A (en) | New nitrofuran derivatives | |
| MY7000066A (en) | Heterocyclic compounds and mes of preparing the same | |
| IL22428A (en) | Benzofuran derivatives and process for their production | |
| IL22290A (en) | 9,10-ethanoanthracene derivatives | |
| IL36946A (en) | 7alpha-methyl-17alpha-ethynyl-17beta-hydroxy-estra-5(10),9(11)-dienes and process of preparing same | |
| IL21674A (en) | Substituted 1,2,3,4-tetrahydroisoquinoline derivatives | |
| CY468A (en) | New nitrofuryl derivatives | |
| DK116368B (da) | Fremgangsmåde til fremstilling af 2,3-dihydro-2,2,4-trimethyl-7-benzofuranol. | |
| IL25650A (en) | Benzofuran derivatives and process for the manufacture thereof | |
| CS222201B2 (en) | Method of making the new n-fenylisopropalakylamine | |
| FR1472283A (fr) | Préparation du 2, 3-dihydro-2, 2-diméthyl-7-benzofuranol | |
| IL24403A (en) | Derivatives of 5-aminomethyl-4,5,6,7-tetrahydro-4-oxoindole | |
| CA842269A (en) | 2,3-dihydro-2,2-dimethyl-7-benzofuranol | |
| AU401777B2 (en) | Method of preparing 1,2-dichloroethane | |
| CS181192B2 (en) | Method of preparing 1,2,5-thiadiazoles | |
| IE28686L (en) | Nitrofuran derivatives | |
| IE28687L (en) | Nitrofuran derivatives | |
| IE27261L (en) | Nitrofuran derivatives | |
| IE27277L (en) | Nitrofuran derivatives | |
| IL21455A (en) | Derivatives of 5,10-epoxy-dibenzocycloheptenes |