IL24490A - Process for the production of organic nitrogen compounds containing an imidochloride grouping - Google Patents
Process for the production of organic nitrogen compounds containing an imidochloride groupingInfo
- Publication number
- IL24490A IL24490A IL6524490A IL2449065A IL24490A IL 24490 A IL24490 A IL 24490A IL 6524490 A IL6524490 A IL 6524490A IL 2449065 A IL2449065 A IL 2449065A IL 24490 A IL24490 A IL 24490A
- Authority
- IL
- Israel
- Prior art keywords
- atoms
- carbon atoms
- chlorine
- nitrogen
- dinuclear
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 6
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 150000002897 organic nitrogen compounds Chemical class 0.000 title claims 2
- 238000005660 chlorination reaction Methods 0.000 claims description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 229910052801 chlorine Inorganic materials 0.000 claims description 12
- 239000000460 chlorine Substances 0.000 claims description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 10
- -1 chlorosulphonyl Chemical group 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 150000003840 hydrochlorides Chemical class 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 claims description 3
- 150000003335 secondary amines Chemical class 0.000 claims description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000004008 6 membered carbocyclic group Chemical group 0.000 claims 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- 239000005864 Sulphur Substances 0.000 claims 1
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000003282 alkyl amino group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 229910052731 fluorine Inorganic materials 0.000 claims 1
- 239000011737 fluorine Substances 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 239000003701 inert diluent Substances 0.000 claims 1
- 238000002844 melting Methods 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 26
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 239000002253 acid Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 150000003949 imides Chemical class 0.000 description 8
- PVFOMCVHYWHZJE-UHFFFAOYSA-N trichloroacetyl chloride Chemical compound ClC(=O)C(Cl)(Cl)Cl PVFOMCVHYWHZJE-UHFFFAOYSA-N 0.000 description 8
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- BCCCFAMZWBDOKK-UHFFFAOYSA-N 2,2,3,3,3-pentachloropropanoyl chloride Chemical compound ClC(=O)C(Cl)(Cl)C(Cl)(Cl)Cl BCCCFAMZWBDOKK-UHFFFAOYSA-N 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- MTVIFDMVZHUZOV-UHFFFAOYSA-N 2,2,3,3,3-pentachloropropanoic acid Chemical compound OC(=O)C(Cl)(Cl)C(Cl)(Cl)Cl MTVIFDMVZHUZOV-UHFFFAOYSA-N 0.000 description 1
- DLOOKZXVYJHDIY-UHFFFAOYSA-N 2,3,4,5-tetrachloropyridine Chemical compound ClC1=CN=C(Cl)C(Cl)=C1Cl DLOOKZXVYJHDIY-UHFFFAOYSA-N 0.000 description 1
- VMHZXXPDUOVTHD-UHFFFAOYSA-N 2,3,4-trichloropyridine Chemical compound ClC1=CC=NC(Cl)=C1Cl VMHZXXPDUOVTHD-UHFFFAOYSA-N 0.000 description 1
- OEOOQMSPHMFXJL-UHFFFAOYSA-N 4-chlorobutan-1-amine Chemical compound NCCCCCl OEOOQMSPHMFXJL-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000725101 Clea Species 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 238000005899 aromatization reaction Methods 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000000262 haloalkenyl group Chemical group 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- FBAFATDZDUQKNH-UHFFFAOYSA-M iron chloride Chemical compound [Cl-].[Fe] FBAFATDZDUQKNH-UHFFFAOYSA-M 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 125000001477 organic nitrogen group Chemical group 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- SAEMKKTVBSCOFX-UHFFFAOYSA-N quinoxalin-1-ium;chloride Chemical compound Cl.N1=CC=NC2=CC=CC=C21 SAEMKKTVBSCOFX-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000010517 secondary reaction Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/48—Two nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/38—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with only hydrogen or carbon atoms directly attached to the ring nitrogen atoms
- C07D241/40—Benzopyrazines
- C07D241/44—Benzopyrazines with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF44766A DE1222918B (de) | 1964-12-21 | 1964-12-21 | Verfahren zur Herstellung chlorhaltiger organischer Stickstoffverbindungen, welche die Imidchloridgruppierungí¬N = CCl - ein- oder mehrmals enthalten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL24490A true IL24490A (en) | 1969-11-12 |
Family
ID=7100174
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL6524490A IL24490A (en) | 1964-12-21 | 1965-10-20 | Process for the production of organic nitrogen compounds containing an imidochloride grouping |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3541091A (de) |
| AT (1) | AT262250B (de) |
| BE (1) | BE674020A (de) |
| CH (1) | CH471085A (de) |
| DE (1) | DE1222918B (de) |
| FR (1) | FR1477466A (de) |
| GB (1) | GB1124078A (de) |
| IL (1) | IL24490A (de) |
| NL (1) | NL6516622A (de) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2428027A1 (fr) * | 1978-06-08 | 1980-01-04 | Anvar | Nouveaux intermediaires de synthese perfluores et leur preparation |
-
1964
- 1964-12-21 DE DEF44766A patent/DE1222918B/de active Granted
-
1965
- 1965-10-19 CH CH1443465A patent/CH471085A/de not_active IP Right Cessation
- 1965-10-20 IL IL6524490A patent/IL24490A/en unknown
- 1965-12-03 FR FR40936A patent/FR1477466A/fr not_active Expired
- 1965-12-14 GB GB53062/65A patent/GB1124078A/en not_active Expired
- 1965-12-20 BE BE674020D patent/BE674020A/xx unknown
- 1965-12-21 NL NL6516622A patent/NL6516622A/xx unknown
- 1965-12-21 AT AT1147965A patent/AT262250B/de active
-
1967
- 1967-12-28 US US694094A patent/US3541091A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH471085A (de) | 1969-04-15 |
| DE1222918B (de) | 1966-08-18 |
| AT262250B (de) | 1968-06-10 |
| NL6516622A (de) | 1966-06-22 |
| US3541091A (en) | 1970-11-17 |
| FR1477466A (fr) | 1967-04-21 |
| GB1124078A (en) | 1968-08-21 |
| DE1222918C2 (de) | 1967-03-23 |
| BE674020A (de) | 1966-06-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3107261A (en) | Process for the production of phenyl cyanates and phenyl cyanates | |
| US5334724A (en) | Preparation of substituted 2-chloropyridines | |
| US4764309A (en) | Preparation of chlorocarboxylic acid chlorides | |
| CA3160699A1 (en) | Process for the preparation of lasmiditan and of a synthesis intermediate | |
| Lamb et al. | Polymerization of aromatic nuclei. XXIII. Investigation of oligomer and pyrrole red from pyrrole and trichloroacetic acid | |
| US2280578A (en) | Amides of aliphatic polycarbothionic acids and their preparation | |
| IL24490A (en) | Process for the production of organic nitrogen compounds containing an imidochloride grouping | |
| US3819683A (en) | N-acyl carbamate production | |
| US4421694A (en) | Process for the preparation of nitroanilines | |
| US3470172A (en) | Process for producing certain amino substituted nitro pyridines | |
| US3951996A (en) | Process for making nicotinic acid hydrazides | |
| Ohta et al. | ETHYLATION OF PYRAZINES USING ALKYLMETALS. SUCH AS TRIETHYL-ALUMINUM, DIETHYLZINC. AND TRIETHYLBORANE | |
| US3311654A (en) | Process for the preparation of organic isocyanates | |
| US3911012A (en) | Method of preparing 4-chloro-derivatives of phenylformamidine and salts thereof | |
| US3576804A (en) | Fluorotriazine compounds | |
| JP4041881B2 (ja) | 新規なｎ−チオ置換複素環化合物およびその製造方法 | |
| US4169852A (en) | Process for the preparation of n-(chloroaryl)-n',n'-dialkylamidines | |
| US3691184A (en) | Certain 2-alkoxymethyl-3-chloro-delta 3-1,2,4-thiadiazolin-5-ones and their preparation | |
| GB863550A (en) | 3-mercapto-phenthiazines | |
| US3818050A (en) | Process for the manufacture of dimethylmaleic anhydride | |
| US3843652A (en) | Process for preparing quinazolines | |
| US3268512A (en) | Reaction of cyanogen azide with benzenoid compounds and selected azepines made thereby | |
| US3658805A (en) | Cyclic nitrile oxalate compounds | |
| US3501523A (en) | Secondary carbamyl chlorides | |
| US4010160A (en) | Process for the manufacture of 1,3-bis-(β-ethylhexyl)-5-amino-5-methyl-hexahydropyrimidine |