IL23384A - Substituted benzamides and process for the manufacture thereof - Google Patents
Substituted benzamides and process for the manufacture thereofInfo
- Publication number
- IL23384A IL23384A IL23384A IL2338465A IL23384A IL 23384 A IL23384 A IL 23384A IL 23384 A IL23384 A IL 23384A IL 2338465 A IL2338465 A IL 2338465A IL 23384 A IL23384 A IL 23384A
- Authority
- IL
- Israel
- Prior art keywords
- formula
- compound
- mole
- reacted
- acid addition
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 68
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 229940054066 benzamide antipsychotics Drugs 0.000 title claims description 4
- 150000003936 benzamides Chemical class 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 87
- -1 salts compounds Chemical class 0.000 claims description 30
- 239000000203 mixture Substances 0.000 claims description 27
- 239000001257 hydrogen Substances 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 18
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 17
- 239000003054 catalyst Substances 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 229910021529 ammonia Inorganic materials 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 4
- 238000005984 hydrogenation reaction Methods 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 2
- 230000003474 anti-emetic effect Effects 0.000 claims description 2
- 239000002111 antiemetic agent Substances 0.000 claims description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims 1
- 239000005977 Ethylene Substances 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 65
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 60
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 58
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 56
- 239000000243 solution Substances 0.000 description 52
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 48
- 238000002844 melting Methods 0.000 description 46
- 230000008018 melting Effects 0.000 description 46
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 39
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 38
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 30
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 20
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 16
- 239000003921 oil Substances 0.000 description 16
- 235000019198 oils Nutrition 0.000 description 16
- 239000003208 petroleum Substances 0.000 description 16
- 238000010992 reflux Methods 0.000 description 14
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- OLPIVHQXWIKOMC-UHFFFAOYSA-N n-(2-chloroethyl)-2-phenylethanamine Chemical compound ClCCNCCC1=CC=CC=C1 OLPIVHQXWIKOMC-UHFFFAOYSA-N 0.000 description 5
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- GANYMSDHMBJFIL-UHFFFAOYSA-N acetonitrile;ethoxyethane Chemical compound CC#N.CCOCC GANYMSDHMBJFIL-UHFFFAOYSA-N 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- MQANBIVNPQKVAO-UHFFFAOYSA-N n-benzyl-2-chloro-n-methylpropan-1-amine;hydrochloride Chemical compound Cl.CC(Cl)CN(C)CC1=CC=CC=C1 MQANBIVNPQKVAO-UHFFFAOYSA-N 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000012258 stirred mixture Substances 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical class CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 125000003282 alkyl amino group Chemical group 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 238000006266 etherification reaction Methods 0.000 description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- STYDBERWROZGHV-UHFFFAOYSA-N n-(2-chloroethyl)-2-phenylethanamine;hydrochloride Chemical compound Cl.ClCCNCCC1=CC=CC=C1 STYDBERWROZGHV-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 3
- 235000009518 sodium iodide Nutrition 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- GRYWYYFCYBZIGN-UHFFFAOYSA-N 3,4-diethoxy-N-[(4-hydroxyphenyl)methyl]benzamide Chemical compound C(C)OC=1C=C(C(=O)NCC2=CC=C(C=C2)O)C=CC1OCC GRYWYYFCYBZIGN-UHFFFAOYSA-N 0.000 description 2
- IZKSBKIVEJBRSO-UHFFFAOYSA-N 3,4-diethoxy-n-[[4-[2-(methylamino)ethoxy]phenyl]methyl]benzamide Chemical compound C1=C(OCC)C(OCC)=CC=C1C(=O)NCC1=CC=C(OCCNC)C=C1 IZKSBKIVEJBRSO-UHFFFAOYSA-N 0.000 description 2
- VVKCVAPLTRZJHH-UHFFFAOYSA-N 3,4-diethoxybenzoic acid Chemical compound CCOC1=CC=C(C(O)=O)C=C1OCC VVKCVAPLTRZJHH-UHFFFAOYSA-N 0.000 description 2
- CFNNQXOPPGQFHV-UHFFFAOYSA-N 3,4-diethoxybenzoyl chloride Chemical compound CCOC1=CC=C(C(Cl)=O)C=C1OCC CFNNQXOPPGQFHV-UHFFFAOYSA-N 0.000 description 2
- AYCWODLBKTWJQM-UHFFFAOYSA-N 4-(aminomethyl)phenol;hydrochloride Chemical compound Cl.NCC1=CC=C(O)C=C1 AYCWODLBKTWJQM-UHFFFAOYSA-N 0.000 description 2
- RQJDUEKERVZLLU-UHFFFAOYSA-N 4-Hydroxybenzylamine Chemical compound NCC1=CC=C(O)C=C1 RQJDUEKERVZLLU-UHFFFAOYSA-N 0.000 description 2
- WNDLUNKOBBVIPK-UHFFFAOYSA-N 4-[2-(2-phenylethylamino)ethoxy]benzaldehyde Chemical compound C1=CC(C=O)=CC=C1OCCNCCC1=CC=CC=C1 WNDLUNKOBBVIPK-UHFFFAOYSA-N 0.000 description 2
- LBYKODYNFRCBIR-UHFFFAOYSA-N 4-ethoxy-3-methoxybenzoic acid Chemical compound CCOC1=CC=C(C(O)=O)C=C1OC LBYKODYNFRCBIR-UHFFFAOYSA-N 0.000 description 2
- OQGTYVGUCWWYNK-UHFFFAOYSA-N 4-methoxy-3-propoxybenzaldehyde Chemical compound CCCOC1=CC(C=O)=CC=C1OC OQGTYVGUCWWYNK-UHFFFAOYSA-N 0.000 description 2
- PGFBXGVRMFTYGX-UHFFFAOYSA-N 4-methoxy-3-propoxybenzoic acid Chemical compound CCCOC1=CC(C(O)=O)=CC=C1OC PGFBXGVRMFTYGX-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000006286 aqueous extract Substances 0.000 description 2
- 150000003935 benzaldehydes Chemical class 0.000 description 2
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- UINUBLPJQXWAJZ-UHFFFAOYSA-N carbonic acid;phenylmethanamine Chemical compound OC(O)=O.NCC1=CC=CC=C1 UINUBLPJQXWAJZ-UHFFFAOYSA-N 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 2
- XLPFLCTZNRMTQB-UHFFFAOYSA-N ethyl n-ethyl-n-methylcarbamate Chemical compound CCOC(=O)N(C)CC XLPFLCTZNRMTQB-UHFFFAOYSA-N 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- JVTZFYYHCGSXJV-UHFFFAOYSA-N isovanillin Chemical compound COC1=CC=C(C=O)C=C1O JVTZFYYHCGSXJV-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- LVSDBWHFLHHZEH-UHFFFAOYSA-N n-benzyl-2-chloro-n-methylpropan-1-amine Chemical compound CC(Cl)CN(C)CC1=CC=CC=C1 LVSDBWHFLHHZEH-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- PLAQCTQHPKVDAY-UHFFFAOYSA-N phenylmethanamine;dihydrochloride Chemical compound Cl.Cl.NCC1=CC=CC=C1 PLAQCTQHPKVDAY-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000005245 sintering Methods 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- GBBZLMLLFVFKJM-UHFFFAOYSA-N 1,2-diiodoethane Chemical compound ICCI GBBZLMLLFVFKJM-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- GLUPJFHPBAJZJS-UHFFFAOYSA-N 2,3-diethoxybenzoic acid Chemical compound CCOC1=CC=CC(C(O)=O)=C1OCC GLUPJFHPBAJZJS-UHFFFAOYSA-N 0.000 description 1
- FKOKUHFZNIUSLW-UHFFFAOYSA-N 2-Hydroxypropyl stearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(C)O FKOKUHFZNIUSLW-UHFFFAOYSA-N 0.000 description 1
- ZXNMIUJDTOMBPV-UHFFFAOYSA-N 2-chloroethyl 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCCCl)C=C1 ZXNMIUJDTOMBPV-UHFFFAOYSA-N 0.000 description 1
- DAUAQNGYDSHRET-UHFFFAOYSA-N 3,4-dimethoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1OC DAUAQNGYDSHRET-UHFFFAOYSA-N 0.000 description 1
- KVGLIDHZBWTUQL-UHFFFAOYSA-N 3,4-dipropoxybenzoic acid Chemical compound CCCOC1=CC=C(C(O)=O)C=C1OCCC KVGLIDHZBWTUQL-UHFFFAOYSA-N 0.000 description 1
- PYAZCFCEURLPSU-UHFFFAOYSA-N 3-methoxy-4-propoxybenzoic acid Chemical compound CCCOC1=CC=C(C(O)=O)C=C1OC PYAZCFCEURLPSU-UHFFFAOYSA-N 0.000 description 1
- YOSIMWRSPAHNQH-UHFFFAOYSA-N 3-methoxy-4-propoxybenzoyl chloride Chemical compound CCCOC1=CC=C(C(Cl)=O)C=C1OC YOSIMWRSPAHNQH-UHFFFAOYSA-N 0.000 description 1
- OOBKLOHBEVKOBB-UHFFFAOYSA-N 4-ethoxy-3-methoxybenzoyl chloride Chemical compound CCOC1=CC=C(C(Cl)=O)C=C1OC OOBKLOHBEVKOBB-UHFFFAOYSA-N 0.000 description 1
- WALVZQKZSYBWQZ-UHFFFAOYSA-N 4-ethoxy-N-[(4-hydroxyphenyl)methyl]-3-methoxybenzamide Chemical compound C(C)OC1=C(C=C(C(=O)NCC2=CC=C(C=C2)O)C=C1)OC WALVZQKZSYBWQZ-UHFFFAOYSA-N 0.000 description 1
- 101100086716 Caenorhabditis elegans ran-3 gene Proteins 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical group ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- GZBQKSPDWQZQBO-UHFFFAOYSA-N Cl.C(CCC)NCCOC1=CC=C(CNC(C2=CC(=C(C=C2)OCC)OCC)=O)C=C1 Chemical compound Cl.C(CCC)NCCOC1=CC=C(CNC(C2=CC(=C(C=C2)OCC)OCC)=O)C=C1 GZBQKSPDWQZQBO-UHFFFAOYSA-N 0.000 description 1
- XLTOPFZJJOGXGC-UHFFFAOYSA-N Cl.CCCOC1=C(OCCC)C=C(C=C1)C(=O)NCC1=CC=C(OCCNC)C=C1 Chemical compound Cl.CCCOC1=C(OCCC)C=C(C=C1)C(=O)NCC1=CC=C(OCCNC)C=C1 XLTOPFZJJOGXGC-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 208000018522 Gastrointestinal disease Diseases 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- BRNPGPKBZDBAGB-UHFFFAOYSA-N N-[[4-[2-(2-phenylethylamino)ethoxy]phenyl]methyl]-3,4-dipropoxybenzamide Chemical compound C(C1=CC=CC=C1)CNCCOC1=CC=C(CNC(C2=CC(=C(C=C2)OCCC)OCCC)=O)C=C1 BRNPGPKBZDBAGB-UHFFFAOYSA-N 0.000 description 1
- VEHOUEIJXMHLCP-UHFFFAOYSA-N N-benzyl-2-chloro-N-ethylpropan-1-amine Chemical compound C(C1=CC=CC=C1)N(CC)CC(C)Cl VEHOUEIJXMHLCP-UHFFFAOYSA-N 0.000 description 1
- JYKVTBAQLOLQPX-UHFFFAOYSA-N N-benzyl-2-chloro-N-ethylpropan-1-amine hydrochloride Chemical compound Cl.C(C1=CC=CC=C1)N(CC)CC(C)Cl JYKVTBAQLOLQPX-UHFFFAOYSA-N 0.000 description 1
- 206010028813 Nausea Diseases 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- GPVDHNVGGIAOQT-UHFFFAOYSA-N Veratric acid Natural products COC1=CC=C(C(O)=O)C(OC)=C1 GPVDHNVGGIAOQT-UHFFFAOYSA-N 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940125683 antiemetic agent Drugs 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229960005274 benzocaine Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000007963 capsule composition Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 239000007765 cera alba Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 1
- XTLNYNMNUCLWEZ-UHFFFAOYSA-N ethanol;propan-2-one Chemical compound CCO.CC(C)=O XTLNYNMNUCLWEZ-UHFFFAOYSA-N 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000005165 hydroxybenzoic acids Chemical class 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229940080428 lactose 200 mg Drugs 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 201000003152 motion sickness Diseases 0.000 description 1
- GSDHXIYEJRUVTM-UHFFFAOYSA-N n-(2-chloroethyl)-n-methylacetamide Chemical compound CC(=O)N(C)CCCl GSDHXIYEJRUVTM-UHFFFAOYSA-N 0.000 description 1
- NNZXNCWCKPWZNT-UHFFFAOYSA-N n-[hydroxy(phenyl)methyl]benzamide Chemical class C=1C=CC=CC=1C(O)NC(=O)C1=CC=CC=C1 NNZXNCWCKPWZNT-UHFFFAOYSA-N 0.000 description 1
- FMNADMXUDLQLET-UHFFFAOYSA-N n-benzyl-n-(2-chloroethyl)butan-1-amine Chemical compound CCCCN(CCCl)CC1=CC=CC=C1 FMNADMXUDLQLET-UHFFFAOYSA-N 0.000 description 1
- 230000008693 nausea Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- RLXDCJUIXHSXQD-UHFFFAOYSA-N oxalic acid;hydrate Chemical compound O.OC(=O)C(O)=O.OC(=O)C(O)=O RLXDCJUIXHSXQD-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 230000035935 pregnancy Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940093625 propylene glycol monostearate Drugs 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000007916 tablet composition Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/16—Amides, e.g. hydroxamic acids
- A61K31/165—Amides, e.g. hydroxamic acids having aromatic rings, e.g. colchicine, atenolol, progabide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/12—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/16—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US36583864A | 1964-05-07 | 1964-05-07 | |
| US389516A US3362993A (en) | 1964-05-07 | 1964-08-10 | Substituted benzamides and methods for their preparation |
| US682661A US3407234A (en) | 1964-05-07 | 1967-11-13 | 4-(2-benzylalkylaminoalkoxy)-benzylamines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL23384A true IL23384A (en) | 1969-01-29 |
Family
ID=27408721
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL30977A IL30977A (en) | 1964-05-07 | 1965-04-19 | Substituted aminoalkoxybenzenes and process for the manufacture thereof |
| IL23384A IL23384A (en) | 1964-05-07 | 1965-04-19 | Substituted benzamides and process for the manufacture thereof |
| IL30976A IL30976A (en) | 1964-05-07 | 1965-04-19 | Transformed benzamides and the process for their production |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL30977A IL30977A (en) | 1964-05-07 | 1965-04-19 | Substituted aminoalkoxybenzenes and process for the manufacture thereof |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL30976A IL30976A (en) | 1964-05-07 | 1965-04-19 | Transformed benzamides and the process for their production |
Country Status (13)
| Country | Link |
|---|---|
| US (2) | US3362993A (da) |
| BE (1) | BE663456A (da) |
| BR (1) | BR6569369D0 (da) |
| CH (1) | CH461530A (da) |
| CY (1) | CY442A (da) |
| DE (1) | DE1493828A1 (da) |
| DK (2) | DK115395B (da) |
| FR (2) | FR1437793A (da) |
| GB (1) | GB1032880A (da) |
| IL (3) | IL30977A (da) |
| MY (1) | MY6900036A (da) |
| NL (2) | NL6505819A (da) |
| SE (1) | SE330688B (da) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL130752C (da) * | 1964-05-07 | |||
| YU46706B (sh) * | 1987-09-05 | 1994-04-05 | Hokuriku Pharmaceutical Co. Ltd. | Postupak za dobijanje amidnih jedinjenja |
| US20090177008A1 (en) * | 2005-12-28 | 2009-07-09 | Cadila Pharmaceuticals Ltd. | Novel process for synthesis of itopride and its novel intermediate n-(4-hydroxybenzyl)- 3,4-dimethoxybenzamide |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1894375A (en) * | 1933-01-17 | Basic product and process of making it | ||
| US2906777A (en) * | 1955-07-08 | 1959-09-29 | Geigy Chem Corp | N-acylated hydroxybenzylamino phenols |
| DE1079622B (de) * | 1956-12-07 | 1960-04-14 | Thomae Gmbh Dr K | Verfahren zur Herstellung von antipyretisch und antiphlogistisch wirksamen, ungesaettigten 2-Acyl-4-amino-phenolaethern |
| US2879293A (en) * | 1957-02-19 | 1959-03-24 | Hoffmann La Roche | Benzylamine derivatives |
| US3139456A (en) * | 1960-07-27 | 1964-06-30 | Searle & Co | Nu-(substituted phenoxyalkyl)-aralkylamines |
| NL130752C (da) * | 1964-05-07 |
-
0
- NL NL130752D patent/NL130752C/xx active
-
1964
- 1964-08-10 US US389516A patent/US3362993A/en not_active Expired - Lifetime
-
1965
- 1965-04-14 CH CH89368A patent/CH461530A/de unknown
- 1965-04-19 IL IL30977A patent/IL30977A/xx unknown
- 1965-04-19 IL IL23384A patent/IL23384A/en unknown
- 1965-04-19 IL IL30976A patent/IL30976A/en unknown
- 1965-04-22 DE DE19651493828 patent/DE1493828A1/de active Pending
- 1965-05-04 BR BR169369/65A patent/BR6569369D0/pt unknown
- 1965-05-05 GB GB18917/65A patent/GB1032880A/en not_active Expired
- 1965-05-05 FR FR15799A patent/FR1437793A/fr not_active Expired
- 1965-05-05 BE BE663456D patent/BE663456A/xx unknown
- 1965-05-05 FR FR15800A patent/FR4507M/fr not_active Expired
- 1965-05-07 NL NL6505819A patent/NL6505819A/xx unknown
- 1965-05-07 DK DK234065AA patent/DK115395B/da unknown
- 1965-05-07 SE SE05999/65A patent/SE330688B/xx unknown
-
1966
- 1966-03-11 DK DK127966AA patent/DK112952B/da unknown
-
1967
- 1967-11-13 US US682661A patent/US3407234A/en not_active Expired - Lifetime
-
1968
- 1968-06-18 CY CY44268A patent/CY442A/xx unknown
-
1969
- 1969-12-31 MY MY196936A patent/MY6900036A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK112952B (da) | 1969-02-03 |
| IL30976A (en) | 1969-01-29 |
| NL130752C (da) | |
| CH461530A (de) | 1968-08-31 |
| DE1493828A1 (de) | 1969-02-27 |
| NL6505819A (da) | 1965-11-08 |
| MY6900036A (en) | 1969-12-31 |
| GB1032880A (en) | 1966-06-15 |
| US3362993A (en) | 1968-01-09 |
| CY442A (en) | 1968-06-18 |
| FR1437793A (fr) | 1966-05-06 |
| IL30977A (en) | 1969-01-29 |
| US3407234A (en) | 1968-10-22 |
| BE663456A (da) | 1965-11-05 |
| SE330688B (da) | 1970-11-30 |
| BR6569369D0 (pt) | 1973-08-02 |
| DK115395B (da) | 1969-10-06 |
| FR4507M (da) | 1966-10-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1148547A (en) | Amino-ether oxides | |
| EP0541798B1 (en) | New diamine compound and brain protecting agent containing the same | |
| IL23384A (en) | Substituted benzamides and process for the manufacture thereof | |
| US2483998A (en) | Nu-(pyrrolidylalkyl)-phenothiazines | |
| US3481980A (en) | Process and intermediates for n-(4-(2-alkylaminoalkoxy) - benzyl) - 3,4-dialkoxy benzamides | |
| LT3798B (en) | Method for the preparation of n,n'-bis(alkoxyalkyl)-pyrimidine-2,4-dicarboxylic acids diamides and use thereof | |
| JPH0660152B2 (ja) | 新規オキサルル酸誘導体及び該化合物を含有する血糖低下剤 | |
| JPS5940140B2 (ja) | アミノアルコ−ル誘導体及びその製造方法 | |
| US3096244A (en) | Substituted butyric acid amide and analgesia | |
| US4218477A (en) | Primary aminoacylanilides, methods of making the same and use as antiarrhythmic drugs | |
| CA1203540A (en) | Pyrrolidinylmethyl benzamide derivatives | |
| US4117160A (en) | Phenoxy compounds and compositions | |
| CA1094070A (en) | 1-phenyl-piperazine derivatives | |
| US2985653A (en) | New piperazinyl-alkyl-phenthiazines and their preparation | |
| US3647877A (en) | Aminopropionanilides | |
| US3262978A (en) | O-arylamino-and-aralkyl-amino-alkylhydroxyl-amines | |
| US4161532A (en) | N-(1'-ethyl-2'-oxo-5'-pyrrolidinylmethyl) benzamide compounds and derivatives, method of preparation and pharmaceutical preparations | |
| US4237068A (en) | Primary aminoacylanilides | |
| US3161650A (en) | 2-amino-5-aryloxazoline products | |
| GB1565021A (en) | Pharmaceutical compositions containing alkylamine deratives | |
| US3465002A (en) | (succinimidoaryloxy)alkanoic acids,esters and amides thereof | |
| US3562280A (en) | Substituted 1,2,3,4-tetrahydroisoquinolines | |
| US2650230A (en) | Xanthene-9-carboxylic acid esters of nuclearly alkylated 4-piperidinols and salts thereof | |
| US2491473A (en) | N-dialkyl alkoxynaphthamidines | |
| JPH0354951B2 (da) |