IL23259A - Process for preparing dihydrocarbyl antimony carboxylates and mercaptides - Google Patents
Process for preparing dihydrocarbyl antimony carboxylates and mercaptidesInfo
- Publication number
- IL23259A IL23259A IL23259A IL2325965A IL23259A IL 23259 A IL23259 A IL 23259A IL 23259 A IL23259 A IL 23259A IL 2325965 A IL2325965 A IL 2325965A IL 23259 A IL23259 A IL 23259A
- Authority
- IL
- Israel
- Prior art keywords
- process according
- mercaptides
- compounds
- reaction
- product
- Prior art date
Links
- -1 antimony carboxylates Chemical class 0.000 title description 7
- 229910052787 antimony Inorganic materials 0.000 title description 5
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 11
- 238000009835 boiling Methods 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 239000000376 reactant Substances 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 10
- 239000003960 organic solvent Substances 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 4
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- WQGPPBHFCXJZLP-UHFFFAOYSA-N diphenylstibane Chemical compound C=1C=CC=CC=1[SbH]C1=CC=CC=C1 WQGPPBHFCXJZLP-UHFFFAOYSA-N 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N dodecane Chemical compound CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- BHMLFPOTZYRDKA-IRXDYDNUSA-N (2s)-2-[(s)-(2-iodophenoxy)-phenylmethyl]morpholine Chemical group IC1=CC=CC=C1O[C@@H](C=1C=CC=CC=1)[C@H]1OCCNC1 BHMLFPOTZYRDKA-IRXDYDNUSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- XTKHFZWYYBIFNJ-UHFFFAOYSA-N C(CCC)(=O)O.C(CC)(=O)O.C(C)(=O)O.C(C)(=O)O Chemical class C(CCC)(=O)O.C(CC)(=O)O.C(C)(=O)O.C(C)(=O)O XTKHFZWYYBIFNJ-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 101100326757 Drosophila melanogaster Capr gene Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/90—Antimony compounds
- C07F9/92—Aromatic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US362465A US3340285A (en) | 1964-04-24 | 1964-04-24 | Process for preparing diorgano antimony(iii) carboxylates and mercaptides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL23259A true IL23259A (en) | 1968-12-26 |
Family
ID=23426223
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL23259A IL23259A (en) | 1964-04-24 | 1965-03-30 | Process for preparing dihydrocarbyl antimony carboxylates and mercaptides |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3340285A (da) |
| CH (1) | CH478153A (da) |
| DE (2) | DE1279017B (da) |
| DK (1) | DK118018B (da) |
| ES (1) | ES312158A1 (da) |
| FR (1) | FR1455091A (da) |
| GB (1) | GB1074402A (da) |
| IL (1) | IL23259A (da) |
| NL (1) | NL6505217A (da) |
| SE (1) | SE323664B (da) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3919168A (en) * | 1974-04-19 | 1975-11-11 | Dart Ind Inc | Vinyl halide resin stabilizer compositions of organotin or antimony organic sulfur-containing compounds and tri-alkali metal phosphates |
| US4287118A (en) * | 1978-08-23 | 1981-09-01 | Associated Lead Inc. | Antimony (V) mercaptides as processing stabilizers for vinyl halide resins and method of manufacturing same |
| US4269731A (en) * | 1979-08-27 | 1981-05-26 | Argus Chemical Corporation | Antimony mercaptocarboxylic acid ester stabilizers for polyvinyl chloride resin compositions and process |
| US4440674A (en) * | 1980-08-08 | 1984-04-03 | Dart Industries Inc. | Synergistic vinyl halide stabilizer compositions of antimony organic sulfur-containing compounds, alkaline earth carboxylates and alkali metal carbonates |
| US4417015A (en) * | 1981-02-06 | 1983-11-22 | Dart Industries Inc. | Low toxic polyvinylchloride stabilizers |
| US4391757A (en) * | 1981-11-27 | 1983-07-05 | Carstab Corporation | Organic antimony containing stabilizer compositions for halogenated polymers |
| US4394325A (en) * | 1981-11-27 | 1983-07-19 | Carstab Corporation | Elemental sulfur-stablized organic antimony compound composition |
| US4806270A (en) * | 1987-02-06 | 1989-02-21 | Synthetic Products Company | Stain-resistant antimony organic sulfur-containing compounds and vinyl halide resins containing same |
| AU9199698A (en) * | 1997-08-21 | 1999-03-08 | Henkel Corporation | Beta-hydroxy mercaptans as costabilizers for halogenated resins |
| CN101775037B (zh) * | 2009-12-31 | 2012-06-13 | 浙江海普顿新材料股份有限公司 | 一种有机锑化合物及其制备方法和应用 |
-
1964
- 1964-04-24 US US362465A patent/US3340285A/en not_active Expired - Lifetime
-
1965
- 1965-03-30 IL IL23259A patent/IL23259A/en unknown
- 1965-04-15 DE DEM64902A patent/DE1279017B/de active Pending
- 1965-04-15 DE DE19651668425 patent/DE1668425A1/de active Pending
- 1965-04-22 CH CH556565A patent/CH478153A/de not_active IP Right Cessation
- 1965-04-22 FR FR14134A patent/FR1455091A/fr not_active Expired
- 1965-04-23 DK DK207265AA patent/DK118018B/da unknown
- 1965-04-23 SE SE5334/65A patent/SE323664B/xx unknown
- 1965-04-23 GB GB17287/65A patent/GB1074402A/en not_active Expired
- 1965-04-23 NL NL6505217A patent/NL6505217A/xx unknown
- 1965-04-23 ES ES0312158A patent/ES312158A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1074402A (en) | 1967-07-05 |
| SE323664B (da) | 1970-05-11 |
| US3340285A (en) | 1967-09-05 |
| DK118018B (da) | 1970-06-29 |
| FR1455091A (fr) | 1966-04-01 |
| DE1668425A1 (de) | 1971-08-05 |
| DE1279017B (de) | 1968-10-03 |
| NL6505217A (da) | 1965-10-25 |
| CH478153A (de) | 1969-09-15 |
| ES312158A1 (es) | 1965-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0105673B1 (en) | Synthesis of hydrophilic phenol ester derivatives | |
| US3091632A (en) | Process for the production of glycol monoesters from aldehydes | |
| US2642453A (en) | Preparation of borates of tertiary alcohols | |
| SAREL et al. | Organic carbonates. IV. 1a, b, c factors affecting formation of homologous cyclic carbonates | |
| US2212895A (en) | Process for the preparation of acyl sulphides and products resulting therefrom | |
| IL23259A (en) | Process for preparing dihydrocarbyl antimony carboxylates and mercaptides | |
| US2871259A (en) | Method of producing carbamate esters | |
| US4855488A (en) | Process for the preparation of dicyclopentenol esters | |
| US2776985A (en) | Aromatic phosphonic acid esterification catalysts | |
| US4889950A (en) | Preparation of carboxylic esters | |
| US2471274A (en) | Nitroalkyl sulfites and process for preparing them | |
| US3037049A (en) | Process for esterifying benzene dicarboxylic acids | |
| US3529002A (en) | Production of glycol monoesters of carboxylic acids | |
| EP0226110B1 (en) | Improved process for preparing bis(dialkylphenyl)pentaerythritol diphosphites | |
| US2708203A (en) | Preparation of polymeric titanium organic compounds | |
| US2531172A (en) | Preparation of isophthalic acid | |
| US3383395A (en) | Stabilization of organic materials with biphenyltriols | |
| US2312298A (en) | Process of preparing esters of | |
| EP0108540B1 (en) | Preparation of phenyl esters in the presence of boric anhydride | |
| US3313843A (en) | Preparation of cinnamate esters | |
| US2164356A (en) | Esters of 1, 4-dioxanediol-2,3 | |
| US2916508A (en) | Method of preparation of 2, 2-dimethyl-1, 3-propanediol cyclic hydrogen phosphite | |
| US5545762A (en) | Process for preparing 1-cyclopropylalkane-1,3-diones | |
| JPS62178541A (ja) | グリオキシル酸エステルの半アセタ−ルおよびグリオキシル酸エステルの単離方法 | |
| US5155231A (en) | Process for preparation of 3,4,5,6- tetrahydrophthalimide |