IE58419B1 - Process for preparing substituted oxazolines - Google Patents
Process for preparing substituted oxazolinesInfo
- Publication number
- IE58419B1 IE58419B1 IE114785A IE114785A IE58419B1 IE 58419 B1 IE58419 B1 IE 58419B1 IE 114785 A IE114785 A IE 114785A IE 114785 A IE114785 A IE 114785A IE 58419 B1 IE58419 B1 IE 58419B1
- Authority
- IE
- Ireland
- Prior art keywords
- stannous
- catalyst
- process according
- parts
- salt
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title abstract description 4
- 150000002918 oxazolines Chemical class 0.000 title description 3
- 150000003839 salts Chemical class 0.000 claims abstract description 16
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims abstract description 3
- 239000003054 catalyst Substances 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 18
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- ZXKINMCYCKHYFR-UHFFFAOYSA-N aminooxidanide Chemical compound [O-]N ZXKINMCYCKHYFR-UHFFFAOYSA-N 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- GQKLTNAIFDFUDN-UHFFFAOYSA-N n-(2-hydroxyethyl)propanamide Chemical compound CCC(=O)NCCO GQKLTNAIFDFUDN-UHFFFAOYSA-N 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- PVCJKHHOXFKFRP-UHFFFAOYSA-N N-acetylethanolamine Chemical group CC(=O)NCCO PVCJKHHOXFKFRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000005599 alkyl carboxylate group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 125000005474 octanoate group Chemical group 0.000 claims description 2
- 150000000376 2-oxazolines Chemical class 0.000 abstract description 4
- 239000003814 drug Substances 0.000 abstract description 2
- 239000012450 pharmaceutical intermediate Substances 0.000 abstract description 2
- 229920005989 resin Polymers 0.000 abstract description 2
- 239000011347 resin Substances 0.000 abstract description 2
- 239000003381 stabilizer Substances 0.000 abstract 1
- 239000000047 product Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 239000000203 mixture Substances 0.000 description 12
- 239000007858 starting material Substances 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 8
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 6
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical class ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- KSBAEPSJVUENNK-UHFFFAOYSA-L tin(ii) 2-ethylhexanoate Chemical compound [Sn+2].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O KSBAEPSJVUENNK-UHFFFAOYSA-L 0.000 description 5
- 238000005194 fractionation Methods 0.000 description 4
- 238000001030 gas--liquid chromatography Methods 0.000 description 4
- -1 2-ethyl Chemical group 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 238000006210 cyclodehydration reaction Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 238000012552 review Methods 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- OQBLGYCUQGDOOR-UHFFFAOYSA-L 1,3,2$l^{2}-dioxastannolane-4,5-dione Chemical compound O=C1O[Sn]OC1=O OQBLGYCUQGDOOR-UHFFFAOYSA-L 0.000 description 1
- GUXJXWKCUUWCLX-UHFFFAOYSA-N 2-methyl-2-oxazoline Chemical compound CC1=NCCO1 GUXJXWKCUUWCLX-UHFFFAOYSA-N 0.000 description 1
- ZXTHWIZHGLNEPG-UHFFFAOYSA-N 2-phenyl-4,5-dihydro-1,3-oxazole Chemical compound O1CCN=C1C1=CC=CC=C1 ZXTHWIZHGLNEPG-UHFFFAOYSA-N 0.000 description 1
- VSJYEDQJQFGGRM-UHFFFAOYSA-N 4-hydroxy-2-phenylbutanamide Chemical compound OCCC(C(=O)N)C1=CC=CC=C1 VSJYEDQJQFGGRM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 241000233805 Phoenix Species 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- PNOXNTGLSKTMQO-UHFFFAOYSA-L diacetyloxytin Chemical compound CC(=O)O[Sn]OC(C)=O PNOXNTGLSKTMQO-UHFFFAOYSA-L 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- INCAHTRUJOJBBB-UHFFFAOYSA-N n-(2-hydroxypropyl)propanamide Chemical compound CCC(=O)NCC(C)O INCAHTRUJOJBBB-UHFFFAOYSA-N 0.000 description 1
- FBUKVWPVBMHYJY-UHFFFAOYSA-N nonanoic acid Chemical compound CCCCCCCCC(O)=O FBUKVWPVBMHYJY-UHFFFAOYSA-N 0.000 description 1
- CYCFYXLDTSNTGP-UHFFFAOYSA-L octadecanoate;tin(2+) Chemical compound [Sn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CYCFYXLDTSNTGP-UHFFFAOYSA-L 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical class [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/08—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D263/10—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D263/12—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with radicals containing only hydrogen and carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB848411928A GB8411928D0 (en) | 1984-05-10 | 1984-05-10 | Preparing substituted oxazolines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE851147L IE851147L (en) | 1985-11-10 |
| IE58419B1 true IE58419B1 (en) | 1993-09-22 |
Family
ID=10560728
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE114785A IE58419B1 (en) | 1984-05-10 | 1985-05-09 | Process for preparing substituted oxazolines |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4673748A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0164219B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS60246378A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE45572T1 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1246588A (cg-RX-API-DMAC7.html) |
| DE (1) | DE3572356D1 (cg-RX-API-DMAC7.html) |
| ES (1) | ES542956A0 (cg-RX-API-DMAC7.html) |
| GB (1) | GB8411928D0 (cg-RX-API-DMAC7.html) |
| IE (1) | IE58419B1 (cg-RX-API-DMAC7.html) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3824982A1 (de) * | 1987-11-10 | 1989-05-18 | Henkel Kgaa | 2-(11-hydroxy-8-heptadecenyl- oder 11,8- bzw. 11,9-heptadecadienyl)oxazolin, sowie verfahren zur herstellung gegebenenfalls substituierter hoeherer 2-(alkyl- bzw. alkenyl)-oxazoline |
| US20040077605A1 (en) * | 2001-06-20 | 2004-04-22 | Salvati Mark E. | Fused heterocyclic succinimide compounds and analogs thereof, modulators of nuclear hormone receptor function |
| US7001911B2 (en) * | 2000-06-28 | 2006-02-21 | Bristol-Myers Squibb Company | Fused cyclic modulators of nuclear hormone receptor function |
| JP2004509072A (ja) * | 2000-06-28 | 2004-03-25 | ブリストル−マイヤーズ スクイブ カンパニー | 選択的アンドロゲン受容体モジュレーター並びにその同定、設計及び使用方法 |
| EP1854798A3 (en) * | 2000-09-19 | 2007-11-28 | Bristol-Myers Squibb Company | Fused heterocyclic succinimide compounds and analogs thereof, modulators of nuclear hormone receptor function |
| US6953679B2 (en) | 2000-09-19 | 2005-10-11 | Bristol-Myers Squibb Company | Method for the preparation of fused heterocyclic succinimide compounds and analogs thereof |
| US20040087548A1 (en) | 2001-02-27 | 2004-05-06 | Salvati Mark E. | Fused cyclic succinimide compounds and analogs thereof, modulators of nuclear hormone receptor function |
| EP1467979B1 (en) * | 2001-12-19 | 2008-08-13 | Bristol-Myers Squibb Company | Fused heterocyclic compounds and analogs thereof modulators of nuclear hormone receptor function |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1263007B (de) * | 1964-05-23 | 1968-03-14 | Huels Chemische Werke Ag | Verfahren zur Herstellung von substituierten delta 2-Oxazolinen |
| US3312714A (en) * | 1965-05-13 | 1967-04-04 | Allied Chem | Preparation of 2-oxazolines from n-(2-hydroxyethyl)amides |
| US3636157A (en) * | 1970-01-09 | 1972-01-18 | Gulf Research Development Co | Preparation of tolualdehydes |
| US3681329A (en) * | 1970-05-04 | 1972-08-01 | Allied Chem | Process for the preparation of cyclic iminoethers |
| US4203900A (en) * | 1977-01-03 | 1980-05-20 | The Dow Chemical Company | Process for preparing 2-oxazolines |
| US4353029A (en) * | 1978-02-13 | 1982-10-05 | Ade Corporation | Self inverting gauging system |
| US4354029A (en) * | 1981-11-30 | 1982-10-12 | The Dow Chemical Company | Preparation of 2-substituted-2-oxazolines with organic zinc salt catalysts |
-
1984
- 1984-05-10 GB GB848411928A patent/GB8411928D0/en active Pending
-
1985
- 1985-04-30 US US06/728,892 patent/US4673748A/en not_active Expired - Lifetime
- 1985-05-06 CA CA000480804A patent/CA1246588A/en not_active Expired
- 1985-05-08 DE DE8585303244T patent/DE3572356D1/de not_active Expired
- 1985-05-08 EP EP85303244A patent/EP0164219B1/en not_active Expired
- 1985-05-08 AT AT85303244T patent/ATE45572T1/de not_active IP Right Cessation
- 1985-05-09 ES ES542956A patent/ES542956A0/es active Granted
- 1985-05-09 IE IE114785A patent/IE58419B1/en unknown
- 1985-05-10 JP JP60100369A patent/JPS60246378A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0164219B1 (en) | 1989-08-16 |
| EP0164219A1 (en) | 1985-12-11 |
| JPS60246378A (ja) | 1985-12-06 |
| GB8411928D0 (en) | 1984-06-13 |
| ES8603843A1 (es) | 1986-01-01 |
| ES542956A0 (es) | 1986-01-01 |
| CA1246588A (en) | 1988-12-13 |
| US4673748A (en) | 1987-06-16 |
| IE851147L (en) | 1985-11-10 |
| JPH0511113B2 (cg-RX-API-DMAC7.html) | 1993-02-12 |
| DE3572356D1 (en) | 1989-09-21 |
| ATE45572T1 (de) | 1989-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5294740A (en) | Preparation of formic acid by thermal cleavage of quaternary ammonium formates | |
| US2766285A (en) | Substituted aminopropynes and process for their preparation | |
| EP0164219B1 (en) | Process for preparing substituted oxazolines | |
| US4203900A (en) | Process for preparing 2-oxazolines | |
| US5034536A (en) | Process for preparing 2-isopropenyl oxazoline | |
| US4385904A (en) | Novel corrosion inhibitor for alcohol fuels | |
| US5336815A (en) | Preparation of vinyl glycols | |
| US4673761A (en) | Process for preparing anti-inflammatory cycloalkylidenemethylphenylacetic acid derivatives | |
| US4379928A (en) | Synthesis of amides | |
| US2817663A (en) | Preparation of 2-methyl oxazolidines and tetrahydro-1, 3-oxazines | |
| US4256665A (en) | Preparation of β-aminopropionamides | |
| US4092326A (en) | Process for production of substituted oxazolines | |
| EP3887346A1 (en) | An efficient and environment friendly process for chloromethylation of substituted benzenes | |
| US4609756A (en) | Process for the preparation of optionally substituted cinnamic acid in the presence of a catalyst | |
| US5101044A (en) | Preparation of n-substituted pyrrolidin-2-ones | |
| EP0266878B1 (en) | Substituted dioxanones, method for preparing same and use thereof | |
| US2956051A (en) | Process for preparing cyclic amides | |
| US3326929A (en) | Process for the purification of delta2-oxazolines | |
| US4935534A (en) | 1-(N-formylamino)-2,4-dicyanobutane and a process for its production | |
| US3821275A (en) | Method of producing 1,3-bis(cyanomethyl)adamantane | |
| US3953511A (en) | Preparation of 2-methyl-1,5-diaminopentane | |
| EP0033752B1 (en) | Preparation of 2-oxazolines by cyclodehydration process employing inorganic iron salts as catalysts | |
| US2868791A (en) | Process for the production of substituted piperazines | |
| US5136035A (en) | Catalytic synthesis of alkyl morpholinones | |
| US5144040A (en) | Process for the preparation of 1-(acylaminoalkyl)-2-imidazolines substituted in the 2 position |