IE52770B1 - Water-in-oil emulsion blasting agent - Google Patents
Water-in-oil emulsion blasting agentInfo
- Publication number
- IE52770B1 IE52770B1 IE610/82A IE61082A IE52770B1 IE 52770 B1 IE52770 B1 IE 52770B1 IE 610/82 A IE610/82 A IE 610/82A IE 61082 A IE61082 A IE 61082A IE 52770 B1 IE52770 B1 IE 52770B1
- Authority
- IE
- Ireland
- Prior art keywords
- water
- blasting agent
- blasting
- agent according
- liquid organic
- Prior art date
Links
- 239000003795 chemical substances by application Substances 0.000 title claims abstract description 31
- 238000005422 blasting Methods 0.000 title claims abstract description 28
- 239000007762 w/o emulsion Substances 0.000 title claims abstract description 9
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 claims abstract description 58
- 239000007788 liquid Substances 0.000 claims abstract description 27
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims abstract description 20
- 239000003995 emulsifying agent Substances 0.000 claims abstract description 12
- 239000003638 chemical reducing agent Substances 0.000 claims abstract description 9
- 239000007800 oxidant agent Substances 0.000 claims abstract description 9
- 239000012266 salt solution Substances 0.000 claims abstract description 8
- 239000000203 mixture Substances 0.000 claims description 32
- 239000000446 fuel Substances 0.000 claims description 26
- 150000003839 salts Chemical class 0.000 claims description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 239000002480 mineral oil Substances 0.000 claims description 5
- 235000010446 mineral oil Nutrition 0.000 claims description 5
- -1 sorbitan fatty acid esters Chemical class 0.000 claims description 5
- QXJJQWWVWRCVQT-UHFFFAOYSA-K calcium;sodium;phosphate Chemical compound [Na+].[Ca+2].[O-]P([O-])([O-])=O QXJJQWWVWRCVQT-UHFFFAOYSA-K 0.000 claims description 3
- 239000002360 explosive Substances 0.000 claims description 3
- 150000002334 glycols Chemical class 0.000 claims description 3
- 239000003209 petroleum derivative Substances 0.000 claims description 3
- 239000000243 solution Substances 0.000 claims description 3
- 150000003973 alkyl amines Chemical class 0.000 claims description 2
- 239000002283 diesel fuel Substances 0.000 claims description 2
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 2
- 239000000194 fatty acid Substances 0.000 claims description 2
- 229930195729 fatty acid Natural products 0.000 claims description 2
- 239000003502 gasoline Substances 0.000 claims description 2
- 239000003350 kerosene Substances 0.000 claims description 2
- 150000002918 oxazolines Chemical class 0.000 claims description 2
- 239000001993 wax Substances 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims 1
- 238000005187 foaming Methods 0.000 claims 1
- 239000011521 glass Substances 0.000 claims 1
- 239000010451 perlite Substances 0.000 claims 1
- 235000019362 perlite Nutrition 0.000 claims 1
- 239000004033 plastic Substances 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 239000012074 organic phase Substances 0.000 abstract 1
- 239000012071 phase Substances 0.000 abstract 1
- 238000005474 detonation Methods 0.000 description 6
- 230000035945 sensitivity Effects 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000004411 aluminium Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- HZTVIZREFBBQMG-UHFFFAOYSA-N 2-methyl-1,3,5-trinitrobenzene;[3-nitrooxy-2,2-bis(nitrooxymethyl)propyl] nitrate Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O.[O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O HZTVIZREFBBQMG-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical class OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- PMKWOEMFPKQBRI-UHFFFAOYSA-N [2-heptadec-8-enyl-4-(hydroxymethyl)-5h-1,3-oxazol-4-yl]methanol Chemical compound CCCCCCCCC=CCCCCCCCC1=NC(CO)(CO)CO1 PMKWOEMFPKQBRI-UHFFFAOYSA-N 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001963 alkali metal nitrate Inorganic materials 0.000 description 1
- 229910001964 alkaline earth metal nitrate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000003575 carbonaceous material Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000010743 number 2 fuel oil Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 235000019809 paraffin wax Nutrition 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 235000013580 sausages Nutrition 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000004449 solid propellant Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
- C06B47/145—Water in oil emulsion type explosives in which a carbonaceous fuel forms the continuous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Chemistry (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Colloid Chemistry (AREA)
- Emulsifying, Dispersing, Foam-Producing Or Wetting Agents (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
- Air Bags (AREA)
- Manufacturing Of Micro-Capsules (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/246,763 US4356044A (en) | 1981-03-23 | 1981-03-23 | Emulsion explosives containing high concentrations of calcium nitrate |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE820610L IE820610L (en) | 1982-09-23 |
| IE52770B1 true IE52770B1 (en) | 1988-02-17 |
Family
ID=22932092
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE610/82A IE52770B1 (en) | 1981-03-23 | 1982-03-16 | Water-in-oil emulsion blasting agent |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4356044A (enExample) |
| JP (1) | JPS57170889A (enExample) |
| AU (1) | AU553945B2 (enExample) |
| CA (1) | CA1166016A (enExample) |
| DE (1) | DE3210273A1 (enExample) |
| GB (1) | GB2096590B (enExample) |
| IE (1) | IE52770B1 (enExample) |
| IN (1) | IN155266B (enExample) |
| NO (1) | NO153964C (enExample) |
| PH (1) | PH20186A (enExample) |
| SE (1) | SE457640B (enExample) |
| ZA (1) | ZA821082B (enExample) |
| ZW (1) | ZW5082A1 (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6028796B2 (ja) * | 1982-01-27 | 1985-07-06 | 日本油脂株式会社 | 油中水型エマルシヨン爆薬の製造法 |
| CA1162744A (en) * | 1982-02-02 | 1984-02-28 | Howard A. Bampfield | Emulsion explosive compositions and method of preparation |
| US4526633A (en) * | 1982-11-08 | 1985-07-02 | Ireco Incorporated | Formulating and delivery system for emulsion blasting |
| US4409044A (en) * | 1982-11-18 | 1983-10-11 | Indian Explosives Limited | Water-in-oil emulsion explosives and a method for the preparation of the same |
| US4609415A (en) * | 1984-01-19 | 1986-09-02 | Hercules Incorporated | Enhancement of emulsification rate using combined surfactant composition |
| US4525225A (en) * | 1984-03-05 | 1985-06-25 | Atlas Powder Company | Solid water-in-oil emulsion explosives compositions and processes |
| US4555276A (en) * | 1984-10-29 | 1985-11-26 | Hercules Incorporated | High density pressure resistant invert blasting emulsions |
| SE459419B (sv) * | 1985-05-08 | 1989-07-03 | Nitro Nobel Ab | Foerfarande foer framstaellning av ett emulsionsspraengaemne av typen vatten-i-olja, en braenslefas foer anvaendning vid saadant foerfarande samt ett spraengaemnessystem |
| JPH0717473B2 (ja) * | 1986-01-14 | 1995-03-01 | 三洋化成工業株式会社 | 油中水滴型エマルジヨン爆薬 |
| US4940497A (en) * | 1988-12-14 | 1990-07-10 | Atlas Powder Company | Emulsion explosive composition containing expanded perlite |
| GB8907992D0 (en) * | 1989-04-10 | 1989-05-24 | Ici Plc | Emulsion explosive |
| TW197428B (enExample) | 1991-01-04 | 1993-01-01 | Hoechst Ag | |
| DE4109071C1 (de) * | 1991-03-20 | 1996-08-22 | Daimler Benz Aerospace Ag | Splitter-Gefechtskopf |
| AU637310B3 (en) * | 1993-02-03 | 1993-05-20 | Dyno Wesfarmers Limited | Improvements in and relating to emulsion explosives |
| DE19651170A1 (de) * | 1996-12-10 | 1998-06-18 | Diehl Gmbh & Co | Zünderloses, ballistisches Sprenggeschoß |
| PL2396288T3 (pl) * | 2009-11-12 | 2014-04-30 | Ael Mining Services Ltd | Zastosowanie kompozycji uczulającej do środka wybuchowego |
| EP2800732A4 (en) * | 2012-01-05 | 2015-09-02 | Rechargeable Battery Corp | POROUS OXYGEN-ACTIVATED HEATING DEVICE |
| GB201202402D0 (en) * | 2012-02-10 | 2012-03-28 | Maxam Dantex South Africa Proprietary Ltd | Oxidizer solution |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3899374A (en) * | 1974-03-29 | 1975-08-12 | Dow Chemical Co | Calcium nitrate explosive composition |
| US4141767A (en) * | 1978-03-03 | 1979-02-27 | Ireco Chemicals | Emulsion blasting agent |
| JPS5814397B2 (ja) * | 1978-12-20 | 1983-03-18 | 日本油脂株式会社 | 油中水型エマルシヨン含水爆薬組成物 |
| US4216040A (en) * | 1979-01-19 | 1980-08-05 | Ireco Chemicals | Emulsion blasting composition |
-
1981
- 1981-03-23 US US06/246,763 patent/US4356044A/en not_active Expired - Lifetime
-
1982
- 1982-02-18 AU AU80606/82A patent/AU553945B2/en not_active Expired
- 1982-02-18 ZA ZA821082A patent/ZA821082B/xx unknown
- 1982-02-19 IN IN193/CAL/82A patent/IN155266B/en unknown
- 1982-02-26 PH PH26924A patent/PH20186A/en unknown
- 1982-03-09 CA CA000397911A patent/CA1166016A/en not_active Expired
- 1982-03-16 GB GB8207595A patent/GB2096590B/en not_active Expired
- 1982-03-16 IE IE610/82A patent/IE52770B1/en not_active IP Right Cessation
- 1982-03-17 ZW ZW50/82A patent/ZW5082A1/xx unknown
- 1982-03-17 SE SE8201697A patent/SE457640B/sv not_active IP Right Cessation
- 1982-03-19 JP JP57044449A patent/JPS57170889A/ja active Granted
- 1982-03-20 DE DE19823210273 patent/DE3210273A1/de active Granted
- 1982-03-22 NO NO820939A patent/NO153964C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE3210273C2 (enExample) | 1989-12-14 |
| IN155266B (enExample) | 1985-01-12 |
| IE820610L (en) | 1982-09-23 |
| NO153964C (no) | 1986-06-25 |
| PH20186A (en) | 1986-10-16 |
| AU8060682A (en) | 1982-09-30 |
| NO820939L (no) | 1982-09-24 |
| SE8201697L (sv) | 1982-09-24 |
| NO153964B (no) | 1986-03-17 |
| AU553945B2 (en) | 1986-07-31 |
| ZA821082B (en) | 1983-01-26 |
| JPH0319196B2 (enExample) | 1991-03-14 |
| ZW5082A1 (en) | 1982-08-25 |
| JPS57170889A (en) | 1982-10-21 |
| DE3210273A1 (de) | 1982-10-21 |
| SE457640B (sv) | 1989-01-16 |
| GB2096590B (en) | 1984-08-01 |
| CA1166016A (en) | 1984-04-24 |
| GB2096590A (en) | 1982-10-20 |
| US4356044A (en) | 1982-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0019458B1 (en) | Blasting composition | |
| US4391659A (en) | Explosive | |
| US4356044A (en) | Emulsion explosives containing high concentrations of calcium nitrate | |
| EP0028908B1 (en) | Emulsion explosive composition | |
| US4149917A (en) | Cap sensitive emulsions without any sensitizer other than occluded air | |
| CA1209340A (en) | Emulsion explosive | |
| GB2042495A (en) | Emulsion blasting composition | |
| US4149916A (en) | Cap sensitive emulsions containing perchlorates and occluded air and method | |
| EP0320183B1 (en) | Emulsion explosive containing an emulsifier | |
| CA2043369C (en) | Emulsion that is compatible with reactive sulfide/pyrite ores | |
| EP0131471B1 (en) | Explosives | |
| US4428784A (en) | Blasting compositions containing sodium nitrate | |
| CA1325724C (en) | Aromatic hydrocarbon-based emulsion explosive composition | |
| AU615595B2 (en) | Nitroalkane-based emulsion explosive composition | |
| CA1096173A (en) | Water-in -oil emulsion blasting agent | |
| US5017251A (en) | Shock-resistant, low density emulsion explosive | |
| CA2016453C (en) | High emulsifier content explosives | |
| NZ200238A (en) | Water-in-oil emulsion blasting agent containing ca(no3)2 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |