IE52091B1 - Electrode for use in electrolytic cell - Google Patents
Electrode for use in electrolytic cellInfo
- Publication number
- IE52091B1 IE52091B1 IE1625/81A IE162581A IE52091B1 IE 52091 B1 IE52091 B1 IE 52091B1 IE 1625/81 A IE1625/81 A IE 1625/81A IE 162581 A IE162581 A IE 162581A IE 52091 B1 IE52091 B1 IE 52091B1
- Authority
- IE
- Ireland
- Prior art keywords
- electrode
- cell
- frame
- strips
- plane
- Prior art date
Links
- 238000005868 electrolysis reaction Methods 0.000 claims description 35
- 239000003792 electrolyte Substances 0.000 claims description 17
- 239000012777 electrically insulating material Substances 0.000 claims description 13
- 229910052751 metal Inorganic materials 0.000 claims description 13
- 239000002184 metal Substances 0.000 claims description 13
- 239000000463 material Substances 0.000 claims description 10
- 238000000576 coating method Methods 0.000 claims description 9
- 238000004891 communication Methods 0.000 claims description 8
- 239000011248 coating agent Substances 0.000 claims description 7
- 239000011149 active material Substances 0.000 claims description 3
- 229910045601 alloy Inorganic materials 0.000 claims description 3
- 239000000956 alloy Substances 0.000 claims description 3
- 239000000243 solution Substances 0.000 description 39
- 239000012528 membrane Substances 0.000 description 32
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 239000011780 sodium chloride Substances 0.000 description 10
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 8
- 238000005341 cation exchange Methods 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 8
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- 239000001257 hydrogen Substances 0.000 description 7
- -1 platinum group metals Chemical class 0.000 description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 6
- 239000012530 fluid Substances 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 125000006850 spacer group Chemical group 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 4
- 239000004810 polytetrafluoroethylene Substances 0.000 description 4
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 3
- 229910001508 alkali metal halide Inorganic materials 0.000 description 3
- 150000008045 alkali metal halides Chemical class 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical group [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 3
- 239000010936 titanium Substances 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- 238000003466 welding Methods 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 229920002943 EPDM rubber Polymers 0.000 description 2
- 239000004812 Fluorinated ethylene propylene Substances 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 229910001413 alkali metal ion Inorganic materials 0.000 description 2
- 238000005219 brazing Methods 0.000 description 2
- 125000002843 carboxylic acid group Chemical group 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 238000010292 electrical insulation Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229920009441 perflouroethylene propylene Polymers 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- RRZIJNVZMJUGTK-UHFFFAOYSA-N 1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene Chemical compound FC(F)=C(F)OC(F)=C(F)F RRZIJNVZMJUGTK-UHFFFAOYSA-N 0.000 description 1
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002033 PVDF binder Substances 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910001902 chlorine oxide Inorganic materials 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N phosphonic acid group Chemical group P(O)(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920005597 polymer membrane Polymers 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B11/00—Electrodes; Manufacture thereof not otherwise provided for
- C25B11/02—Electrodes; Manufacture thereof not otherwise provided for characterised by shape or form
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Electrodes For Compound Or Non-Metal Manufacture (AREA)
- Secondary Cells (AREA)
- Battery Electrode And Active Subsutance (AREA)
- Electric Double-Layer Capacitors Or The Like (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8024922 | 1980-07-30 | ||
| GB8030230 | 1980-09-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE811625L IE811625L (en) | 1982-01-30 |
| IE52091B1 true IE52091B1 (en) | 1987-06-10 |
Family
ID=26276396
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1625/81A IE52091B1 (en) | 1980-07-30 | 1981-07-17 | Electrode for use in electrolytic cell |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4464243A (index.php) |
| EP (1) | EP0045148B1 (index.php) |
| KR (1) | KR860000562B1 (index.php) |
| AU (1) | AU538823B2 (index.php) |
| CA (1) | CA1189022A (index.php) |
| DD (1) | DD201628A5 (index.php) |
| DE (1) | DE3170397D1 (index.php) |
| ES (1) | ES8204479A1 (index.php) |
| FI (1) | FI70054C (index.php) |
| IE (1) | IE52091B1 (index.php) |
| IL (1) | IL63420A (index.php) |
| IN (1) | IN157163B (index.php) |
| MY (1) | MY8600486A (index.php) |
| NO (1) | NO159735C (index.php) |
| NZ (1) | NZ197740A (index.php) |
| PL (1) | PL128858B1 (index.php) |
| PT (1) | PT73447B (index.php) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4605482A (en) * | 1981-04-28 | 1986-08-12 | Asahi Glass Company, Ltd. | Filter press type electrolytic cell |
| DE3219704A1 (de) * | 1982-05-26 | 1983-12-01 | Uhde Gmbh, 4600 Dortmund | Membran-elektrolysezelle |
| DE3247390A1 (de) * | 1982-12-22 | 1984-06-28 | Krupp-Koppers Gmbh, 4300 Essen | Verfahren und vorrichtung zur beseitigung des bei der kuehlung von koksofengas anfallenden dickteeres |
| GB8330322D0 (en) * | 1983-11-14 | 1983-12-21 | Ici Plc | Electrolysis aqueous alkali metal chloride solution |
| SE8400459L (sv) * | 1984-01-30 | 1985-07-31 | Kema Nord Ab | Elektrod for elektrolysorer |
| GB8407871D0 (en) * | 1984-03-27 | 1984-05-02 | Ici Plc | Electrode and electrolytic cell |
| US4654136A (en) * | 1984-12-17 | 1987-03-31 | The Dow Chemical Company | Monopolar or bipolar electrochemical terminal unit having a novel electric current transmission element |
| DE3519573A1 (de) * | 1985-05-31 | 1986-12-04 | Conradty GmbH & Co Metallelektroden KG, 8505 Röthenbach | Elektrode fuer die membran-elektrolyse |
| GB8526054D0 (en) * | 1985-10-22 | 1985-11-27 | Ici Plc | Electrolytic cell |
| GB8626629D0 (en) * | 1986-11-07 | 1986-12-10 | Ici Plc | Electrolytic cell |
| US5322604A (en) * | 1992-11-02 | 1994-06-21 | Olin Corporation | Electrolytic cell and electrodes therefor |
| US5340457A (en) * | 1993-04-29 | 1994-08-23 | Olin Corporation | Electrolytic cell |
| ES2258170T3 (es) * | 2002-10-14 | 2006-08-16 | Aluminium Pechiney | Limitador de escape de una celula de electrolisis. |
| EP2772469A1 (de) * | 2013-02-27 | 2014-09-03 | Bayer Technology Services GmbH | Mikro-Lamellenelektrodenzelle sowie deren Verwendung |
| EP2913306A1 (de) * | 2014-02-27 | 2015-09-02 | Bayer Technology Services GmbH | Verfahren zur Reinigung von Feldspritzgeräten von Pflanzenschutzmittelrückständen |
| KR102274879B1 (ko) * | 2020-08-19 | 2021-07-08 | (주)테크윈 | 전기분해조용 전극구조체 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US857910A (en) * | 1904-09-28 | 1907-06-25 | Alfred O Tate | Apparatus for treating liquids electrolytically. |
| US961549A (en) * | 1909-01-26 | 1910-06-14 | Hooker Electro Chemical Company | Cathode. |
| US1448208A (en) * | 1922-07-15 | 1923-03-13 | Electro Chemical Company | Electrode for electrolytic cells |
| US1907812A (en) * | 1929-02-05 | 1933-05-09 | Ig Farbenindustrie Ag | Electrolytic cell |
| NL156233B (nl) * | 1949-10-24 | Societe Anonyme, Societe Industrielle Pour La Diffusion D'equipement Et De Materiel "Sidemat", Parijs. | Aansluitinrichting voor apparatuur op een brandstofhouder. | |
| GB1324427A (en) * | 1969-12-06 | 1973-07-25 | Nippon Soda Co | Electrode assembly for electrolysis cells |
| SE377140B (index.php) * | 1973-08-20 | 1975-06-23 | Kema Nord Ab | |
| US4013525A (en) * | 1973-09-24 | 1977-03-22 | Imperial Chemical Industries Limited | Electrolytic cells |
| FR2303093A1 (fr) * | 1975-03-06 | 1976-10-01 | Rhone Poulenc Ind | Cellule d'electrolyse sans diaphragme, notamment pour l'obtention de chlorates de metaux alcalins |
| GB1581347A (en) * | 1976-08-04 | 1980-12-10 | Ici Ltd | Resilient anodes |
| GB1581348A (en) * | 1976-08-04 | 1980-12-10 | Ici Ltd | Bipolar unit for electrolytic cell |
| GB1595183A (en) * | 1977-03-04 | 1981-08-12 | Ici Ltd | Diaphragm cell |
| GB1595193A (en) * | 1977-03-04 | 1981-08-12 | Ici Ltd | Diaphragm cell |
| JPS5460278A (en) * | 1977-10-21 | 1979-05-15 | Kureha Chem Ind Co Ltd | Diaphragm type electrolytic bath |
| US4255246A (en) * | 1979-01-29 | 1981-03-10 | Davis David W | Electrolytic cell for chlorine production |
-
1981
- 1981-07-10 EP EP81303175A patent/EP0045148B1/en not_active Expired
- 1981-07-10 DE DE8181303175T patent/DE3170397D1/de not_active Expired
- 1981-07-14 IN IN455/DEL/81A patent/IN157163B/en unknown
- 1981-07-16 NZ NZ197740A patent/NZ197740A/en unknown
- 1981-07-17 IE IE1625/81A patent/IE52091B1/en not_active IP Right Cessation
- 1981-07-20 US US06/284,946 patent/US4464243A/en not_active Expired - Lifetime
- 1981-07-20 AU AU73127/81A patent/AU538823B2/en not_active Expired
- 1981-07-27 IL IL63420A patent/IL63420A/xx not_active IP Right Cessation
- 1981-07-27 FI FI812342A patent/FI70054C/fi not_active IP Right Cessation
- 1981-07-29 ES ES504402A patent/ES8204479A1/es not_active Expired
- 1981-07-29 PL PL1981232403A patent/PL128858B1/pl unknown
- 1981-07-29 KR KR1019810002757A patent/KR860000562B1/ko not_active Expired
- 1981-07-29 PT PT73447A patent/PT73447B/pt unknown
- 1981-07-29 NO NO812592A patent/NO159735C/no unknown
- 1981-07-29 DD DD81232186A patent/DD201628A5/de unknown
- 1981-07-30 CA CA000382874A patent/CA1189022A/en not_active Expired
-
1986
- 1986-12-30 MY MY486/86A patent/MY8600486A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL63420A0 (en) | 1981-10-30 |
| EP0045148B1 (en) | 1985-05-08 |
| ES504402A0 (es) | 1982-05-01 |
| DE3170397D1 (en) | 1985-06-13 |
| IN157163B (index.php) | 1986-02-01 |
| FI812342L (fi) | 1982-01-31 |
| NO159735C (no) | 1989-02-01 |
| KR830006471A (ko) | 1983-09-24 |
| KR860000562B1 (ko) | 1986-05-14 |
| EP0045148A1 (en) | 1982-02-03 |
| FI70054B (fi) | 1986-01-31 |
| AU538823B2 (en) | 1984-08-30 |
| MY8600486A (en) | 1986-12-31 |
| NO159735B (no) | 1988-10-24 |
| IE811625L (en) | 1982-01-30 |
| US4464243A (en) | 1984-08-07 |
| PL128858B1 (en) | 1984-03-31 |
| NZ197740A (en) | 1984-11-09 |
| PT73447B (en) | 1982-10-15 |
| DD201628A5 (de) | 1983-07-27 |
| CA1189022A (en) | 1985-06-18 |
| PL232403A1 (index.php) | 1982-02-15 |
| AU7312781A (en) | 1982-02-04 |
| IL63420A (en) | 1984-03-30 |
| PT73447A (en) | 1981-08-01 |
| NO812592L (no) | 1982-02-01 |
| FI70054C (fi) | 1986-09-12 |
| ES8204479A1 (es) | 1982-05-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4464242A (en) | Electrode structure for use in electrolytic cell | |
| US4464243A (en) | Electrode for use in electrolytic cell | |
| EP0094772B1 (en) | Electrolytic cell and gasket for electrolytic cell | |
| CA1161394A (en) | Monopolar electrolytic cell of the filter press type | |
| EP0080287B1 (en) | Electrolytic cell of the filter press type | |
| US4784741A (en) | Electrolytic cell and gasket | |
| US4608144A (en) | Electrode and electrolytic cell | |
| US4648953A (en) | Electrolytic cell | |
| US4729822A (en) | Electrolytic cell | |
| US4537672A (en) | Electrolytic cell | |
| US4484998A (en) | Electrolytic cell | |
| JPH0112837B2 (index.php) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK9A | Patent expired |