IE45275B1 - 2-(2-(2-amino-4-pyrimidinyl)ethenyl-quinoxaline)-1,4-dioxides - Google Patents
2-(2-(2-amino-4-pyrimidinyl)ethenyl-quinoxaline)-1,4-dioxidesInfo
- Publication number
- IE45275B1 IE45275B1 IE674/77A IE67477A IE45275B1 IE 45275 B1 IE45275 B1 IE 45275B1 IE 674/77 A IE674/77 A IE 674/77A IE 67477 A IE67477 A IE 67477A IE 45275 B1 IE45275 B1 IE 45275B1
- Authority
- IE
- Ireland
- Prior art keywords
- quinoxaline
- acid
- cholera
- substituted
- compound
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 20
- 206010008631 Cholera Diseases 0.000 claims abstract description 18
- 150000003252 quinoxalines Chemical class 0.000 claims abstract description 8
- -1 e.g. Chemical group 0.000 claims abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 4
- 239000001257 hydrogen Substances 0.000 claims abstract description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 4
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract 2
- 238000000034 method Methods 0.000 claims description 13
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 7
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 6
- 230000000069 prophylactic effect Effects 0.000 claims description 6
- 239000007858 starting material Substances 0.000 claims description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical group COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 3
- 241000607598 Vibrio Species 0.000 claims description 3
- 235000019253 formic acid Nutrition 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 2
- 239000003377 acid catalyst Substances 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 claims 1
- KPGXESDIFJXCJJ-UHFFFAOYSA-N 4-[2-(1-oxido-4-oxoquinoxalin-4-ium-2-yl)ethenyl]pyrimidin-2-amine Chemical group NC1=NC=CC(C=CC=2[N+](=C3C=CC=CC3=[N+]([O-])C=2)[O-])=N1 KPGXESDIFJXCJJ-UHFFFAOYSA-N 0.000 claims 1
- 239000000376 reactant Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 4
- 125000004432 carbon atom Chemical group C* 0.000 abstract description 3
- 238000004519 manufacturing process Methods 0.000 abstract description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 abstract 1
- BAWFJGJZGIEFAR-NNYOXOHSSA-N NAD zwitterion Chemical compound NC(=O)C1=CC=C[N+]([C@H]2[C@@H]([C@H](O)[C@@H](COP([O-])(=O)OP(O)(=O)OC[C@@H]3[C@H]([C@@H](O)[C@@H](O3)N3C4=NC=NC(N)=C4N=C3)O)O2)O)=C1 BAWFJGJZGIEFAR-NNYOXOHSSA-N 0.000 description 18
- 239000010865 sewage Substances 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 8
- 238000011282 treatment Methods 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 239000003981 vehicle Substances 0.000 description 6
- 241000699670 Mus sp. Species 0.000 description 5
- 241000700159 Rattus Species 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 230000007059 acute toxicity Effects 0.000 description 4
- 231100000403 acute toxicity Toxicity 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 241000607626 Vibrio cholerae Species 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000007665 chronic toxicity Effects 0.000 description 3
- 231100000160 chronic toxicity Toxicity 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 230000002496 gastric effect Effects 0.000 description 3
- 238000003304 gavage Methods 0.000 description 3
- 210000003734 kidney Anatomy 0.000 description 3
- 210000004185 liver Anatomy 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 231100000419 toxicity Toxicity 0.000 description 3
- 230000001988 toxicity Effects 0.000 description 3
- 210000002700 urine Anatomy 0.000 description 3
- 229940118696 vibrio cholerae Drugs 0.000 description 3
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 2
- 108010082126 Alanine transaminase Proteins 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- CKIHZSGJPSDCNC-UHFFFAOYSA-N Quindoxin Chemical compound C1=CC=C2N([O-])C=C[N+](=O)C2=C1 CKIHZSGJPSDCNC-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000003745 diagnosis Methods 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 210000003238 esophagus Anatomy 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 238000011886 postmortem examination Methods 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 231100000456 subacute toxicity Toxicity 0.000 description 2
- JZJFIUXMPBVEFS-UHFFFAOYSA-N 1-oxido-4-oxoquinoxalin-4-ium-2-carbaldehyde Chemical compound C1=CC=C2N([O-])C(C=O)=C[N+](=O)C2=C1 JZJFIUXMPBVEFS-UHFFFAOYSA-N 0.000 description 1
- IDQNBVFPZMCDDN-UHFFFAOYSA-N 2-Amino-4,6-dimethylpyrimidine Chemical compound CC1=CC(C)=NC(N)=N1 IDQNBVFPZMCDDN-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- 108010003415 Aspartate Aminotransferases Proteins 0.000 description 1
- 102000004625 Aspartate Aminotransferases Human genes 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- GVGLGOZIDCSQPN-PVHGPHFFSA-N Heroin Chemical compound O([C@H]1[C@H](C=C[C@H]23)OC(C)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4OC(C)=O GVGLGOZIDCSQPN-PVHGPHFFSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 231100000369 acute toxicity data Toxicity 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000036244 malformation Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
Classifications
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02A—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE
- Y02A50/00—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE in human health protection, e.g. against extreme weather
- Y02A50/30—Against vector-borne diseases, e.g. mosquito-borne, fly-borne, tick-borne or waterborne diseases whose impact is exacerbated by climate change
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US67212376A | 1976-03-31 | 1976-03-31 | |
| US05/771,118 US4076815A (en) | 1976-03-31 | 1977-02-23 | Quinoxaline compound and composition, process for preparing compound, and method of combatting cholera therewith |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE45275L IE45275L (en) | 1977-09-30 |
| IE45275B1 true IE45275B1 (en) | 1982-07-28 |
Family
ID=27100689
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE674/77A IE45275B1 (en) | 1976-03-31 | 1977-03-30 | 2-(2-(2-amino-4-pyrimidinyl)ethenyl-quinoxaline)-1,4-dioxides |
Country Status (14)
-
1977
- 1977-03-16 NZ NZ183626A patent/NZ183626A/xx unknown
- 1977-03-17 IN IN394/CAL/77A patent/IN144232B/en unknown
- 1977-03-18 GB GB11688/77A patent/GB1536393A/en not_active Expired
- 1977-03-24 MX MX775574U patent/MX4659E/es unknown
- 1977-03-25 BE BE176150A patent/BE852913A/xx not_active IP Right Cessation
- 1977-03-25 AR AR266981A patent/AR212615A1/es active
- 1977-03-29 CA CA275,024A patent/CA1069899A/en not_active Expired
- 1977-03-30 DE DE19772714157 patent/DE2714157A1/de not_active Withdrawn
- 1977-03-30 DK DK140377A patent/DK143701C/da not_active IP Right Cessation
- 1977-03-30 IE IE674/77A patent/IE45275B1/en unknown
- 1977-03-30 ES ES457359A patent/ES457359A1/es not_active Expired
- 1977-03-30 NL NL7703465A patent/NL7703465A/xx not_active Application Discontinuation
- 1977-03-31 JP JP3742177A patent/JPS52139087A/ja active Granted
- 1977-03-31 PH PH19616A patent/PH12676A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2714157A1 (de) | 1977-10-27 |
| DK140377A (da) | 1977-10-01 |
| NL7703465A (nl) | 1977-10-04 |
| IN144232B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1978-04-08 |
| NZ183626A (en) | 1978-11-13 |
| CA1069899A (en) | 1980-01-15 |
| AR212615A1 (es) | 1978-08-15 |
| JPS5437154B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1979-11-13 |
| PH12676A (en) | 1979-07-11 |
| GB1536393A (en) | 1978-12-20 |
| ES457359A1 (es) | 1978-06-16 |
| JPS52139087A (en) | 1977-11-19 |
| DK143701B (da) | 1981-09-28 |
| IE45275L (en) | 1977-09-30 |
| BE852913A (fr) | 1977-09-26 |
| DK143701C (da) | 1982-04-05 |
| MX4659E (es) | 1982-07-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB2057439A (en) | Quinazolinones | |
| US6465476B1 (en) | Immuno-modulator exhibiting antimicrobial and anti-mycrobacterial activities, method for producing the same and pharmaceutical preparation | |
| UA48122C2 (uk) | АЛКОКСІАЛКІЛКАРБАМАТИ ІМІДАЗО[1,2-а]ПІРИДИНІВ, СПОСІБ ЇХ ОДЕРЖАННЯ ТА ЛІКАРСЬКИЙ ЗАСІБ НА ЇХ ОСНОВІ | |
| JPH0419996B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| WO1991016338A1 (en) | S-(lower fatty acid)-substituted glutathione derivative | |
| US5281578A (en) | Gallium compounds | |
| RU2043994C1 (ru) | Глутатионалкиловые эфиры окисленного типа и способ их получения | |
| JPH03112933A (ja) | 抗腫瘍剤 | |
| US4076815A (en) | Quinoxaline compound and composition, process for preparing compound, and method of combatting cholera therewith | |
| CY1274A (en) | 3-indolyl-tertiary butylaminopropanols | |
| JPH0526782B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| IE45275B1 (en) | 2-(2-(2-amino-4-pyrimidinyl)ethenyl-quinoxaline)-1,4-dioxides | |
| CA1173852A (en) | 2-amino-3-(halobenzoyl)-methylphenylacetic acids, esters and salts thereof | |
| CN1128999A (zh) | 杂环化合物 | |
| US3923996A (en) | 3-Substituted-oxindoles in compositions and methods of treating obesity | |
| CS212264B2 (en) | Method of making the 5-m-tolyloxyuracile | |
| US3463861A (en) | Compositions and method of treating mycobacterium tuberculosis with 2,2'-(ethylenediimino)-di-1-butanols | |
| US4092426A (en) | Novel aminobenzoic acid derivatives, process for preparing the same and pharmaceutical composition containing the same | |
| JP6421873B2 (ja) | テノホビルジソプロキシルの新規塩 | |
| US4423053A (en) | Derivatives of 2-amino-5-(o-sulphamidophenyl)-1,3,4-thiadiazol as antiviral agents and a process for the preparation thereof | |
| US5475028A (en) | 2-aminoethanesulfonic acid zinc complex | |
| IE50293B1 (en) | 2-amino-3-(alkylthiobenzoyl)phenylacetic acids | |
| Hughes et al. | Metabolism of various 8-aminoquinolines in rhesus monkey. | |
| SU1213726A1 (ru) | 3-Диметиламинопропиламид бензтиазино[2,3-в]фенотиазин-6-карбоновой кислоты, обладающий противоопухолевой активностью | |
| JPH0372480A (ja) | キサンチン誘導体及びそれらを有効成分とする気管支拡張剤 |