IE43928B1 - 1-(1-acylamino-2,2,3-trichloropropyl)-imidazole or 1-2,4-triazole derivatives and their use in fungicidal compositions - Google Patents
1-(1-acylamino-2,2,3-trichloropropyl)-imidazole or 1-2,4-triazole derivatives and their use in fungicidal compositionsInfo
- Publication number
- IE43928B1 IE43928B1 IE1674/76A IE167476A IE43928B1 IE 43928 B1 IE43928 B1 IE 43928B1 IE 1674/76 A IE1674/76 A IE 1674/76A IE 167476 A IE167476 A IE 167476A IE 43928 B1 IE43928 B1 IE 43928B1
- Authority
- IE
- Ireland
- Prior art keywords
- group
- compound
- alkyl
- formula
- substituted
- Prior art date
Links
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 title claims description 105
- 239000000203 mixture Substances 0.000 title claims description 22
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical class N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 title claims description 15
- 230000000855 fungicidal effect Effects 0.000 title claims description 12
- 150000001875 compounds Chemical class 0.000 claims abstract description 60
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 37
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 20
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 11
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims abstract description 11
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 7
- 125000002541 furyl group Chemical group 0.000 claims abstract description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 3
- 238000000034 method Methods 0.000 claims description 36
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical group CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 21
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 claims description 17
- 241000233866 Fungi Species 0.000 claims description 14
- 239000004480 active ingredient Substances 0.000 claims description 14
- 238000002360 preparation method Methods 0.000 claims description 14
- 230000003032 phytopathogenic effect Effects 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 10
- 239000000843 powder Substances 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 239000012141 concentrate Substances 0.000 claims description 5
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 5
- 206010061217 Infestation Diseases 0.000 claims description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical group [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 4
- 239000000443 aerosol Substances 0.000 claims description 4
- 230000002401 inhibitory effect Effects 0.000 claims description 4
- 230000009885 systemic effect Effects 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 3
- 238000010410 dusting Methods 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 230000035755 proliferation Effects 0.000 claims description 3
- 150000003512 tertiary amines Chemical class 0.000 claims description 3
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 238000001246 colloidal dispersion Methods 0.000 claims description 2
- 239000004495 emulsifiable concentrate Substances 0.000 claims description 2
- 239000008187 granular material Substances 0.000 claims description 2
- 239000003701 inert diluent Substances 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Chemical group 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 239000012895 dilution Substances 0.000 claims 1
- 238000010790 dilution Methods 0.000 claims 1
- POJFTPJUVYMPGA-UHFFFAOYSA-N n-(2,2,3-trichloro-1-imidazol-1-ylpropyl)acetamide Chemical compound CC(=O)NC(C(Cl)(Cl)CCl)N1C=CN=C1 POJFTPJUVYMPGA-UHFFFAOYSA-N 0.000 claims 1
- GNPNMDYMNNTJQC-UHFFFAOYSA-N n-(2,2,3-trichloro-1-imidazol-1-ylpropyl)formamide Chemical compound ClCC(Cl)(Cl)C(NC=O)N1C=CN=C1 GNPNMDYMNNTJQC-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 claims 1
- 125000005059 halophenyl group Chemical group 0.000 abstract 2
- PIEXCQIOSMOEOU-UHFFFAOYSA-N 1-bromo-3-chloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Br)C(=O)N(Cl)C1=O PIEXCQIOSMOEOU-UHFFFAOYSA-N 0.000 abstract 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 abstract 1
- 125000005037 alkyl phenyl group Chemical group 0.000 abstract 1
- 239000000417 fungicide Substances 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 abstract 1
- 125000006501 nitrophenyl group Chemical group 0.000 abstract 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 38
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- -1 for example Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 150000002460 imidazoles Chemical class 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 150000001408 amides Chemical class 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 150000007514 bases Chemical class 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- TWWNLDITIRCJDN-UHFFFAOYSA-N 1,2-bis(2-methylpropyl)naphthalene;sodium Chemical compound [Na].C1=CC=CC2=C(CC(C)C)C(CC(C)C)=CC=C21 TWWNLDITIRCJDN-UHFFFAOYSA-N 0.000 description 2
- VMVQOWJGWBIGEU-UHFFFAOYSA-N 2,2,3-trichloropropanal Chemical compound ClCC(Cl)(Cl)C=O VMVQOWJGWBIGEU-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical compound FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- RYAGRZNBULDMBW-UHFFFAOYSA-L calcium;3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Ca+2].COC1=CC=CC(CC(CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O RYAGRZNBULDMBW-UHFFFAOYSA-L 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- PGGUJQWYRLAFBA-UHFFFAOYSA-N n-(2,2,3-trichloro-1-hydroxypropyl)acetamide Chemical compound CC(=O)NC(O)C(Cl)(Cl)CCl PGGUJQWYRLAFBA-UHFFFAOYSA-N 0.000 description 2
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- NBMBHRRRMRHJDV-UHFFFAOYSA-N 2,2-dimethyl-n-(2,2,3-trichloro-1-hydroxypropyl)propanamide Chemical compound CC(C)(C)C(=O)NC(O)C(Cl)(Cl)CCl NBMBHRRRMRHJDV-UHFFFAOYSA-N 0.000 description 1
- IKRAAURAKVRNCG-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)-n-(2,2,3-trichloro-1-hydroxypropyl)acetamide Chemical compound ClCC(Cl)(Cl)C(O)NC(=O)COC1=CC=C(Cl)C=C1Cl IKRAAURAKVRNCG-UHFFFAOYSA-N 0.000 description 1
- NPXVTMWOMABISW-UHFFFAOYSA-N 2-chloro-n-(2,2,3-trichloro-1-imidazol-1-ylpropyl)benzamide Chemical compound C1=CN=CN1C(C(Cl)(Cl)CCl)NC(=O)C1=CC=CC=C1Cl NPXVTMWOMABISW-UHFFFAOYSA-N 0.000 description 1
- PNHWNIGLQZXERK-UHFFFAOYSA-N 2-methoxy-n-(2,2,3-trichloro-1-imidazol-1-ylpropyl)benzamide Chemical compound COC1=CC=CC=C1C(=O)NC(C(Cl)(Cl)CCl)N1C=NC=C1 PNHWNIGLQZXERK-UHFFFAOYSA-N 0.000 description 1
- RUHGGUQZCUFINN-UHFFFAOYSA-N 2-methyl-n-(2,2,3-trichloro-1-hydroxypropyl)propanamide Chemical compound CC(C)C(=O)NC(O)C(Cl)(Cl)CCl RUHGGUQZCUFINN-UHFFFAOYSA-N 0.000 description 1
- NBVVRNULAQQAFN-UHFFFAOYSA-N 3-phenoxy-n-(2,2,3-trichloro-1-hydroxypropyl)propanamide Chemical compound ClCC(Cl)(Cl)C(O)NC(=O)CCOC1=CC=CC=C1 NBVVRNULAQQAFN-UHFFFAOYSA-N 0.000 description 1
- OZCCMFGIRFPDRE-UHFFFAOYSA-N 3-phenoxy-n-(2,2,3-trichloro-1-imidazol-1-ylpropyl)propanamide Chemical compound C1=CN=CN1C(C(Cl)(Cl)CCl)NC(=O)CCOC1=CC=CC=C1 OZCCMFGIRFPDRE-UHFFFAOYSA-N 0.000 description 1
- LXDDKWRAFLGXKT-UHFFFAOYSA-N 3-phenyl-n-(2,2,3-trichloro-1-hydroxypropyl)propanamide Chemical compound ClCC(Cl)(Cl)C(O)NC(=O)CCC1=CC=CC=C1 LXDDKWRAFLGXKT-UHFFFAOYSA-N 0.000 description 1
- NLTDPWMLJZIPOJ-UHFFFAOYSA-N 3-phenyl-n-[2,2,3-trichloro-1-(1,2,4-triazol-1-yl)propyl]prop-2-enamide Chemical compound C1=NC=NN1C(C(Cl)(Cl)CCl)NC(=O)C=CC1=CC=CC=C1 NLTDPWMLJZIPOJ-UHFFFAOYSA-N 0.000 description 1
- GLUWNNHJSABZRY-UHFFFAOYSA-N 4-chloro-n-(2,2,3-trichloro-1-hydroxypropyl)benzamide Chemical compound ClCC(Cl)(Cl)C(O)NC(=O)C1=CC=C(Cl)C=C1 GLUWNNHJSABZRY-UHFFFAOYSA-N 0.000 description 1
- ANLQIDQLXHRHDT-UHFFFAOYSA-N 4-chloro-n-[2,2,3-trichloro-1-(1,2,4-triazol-1-yl)propyl]butanamide Chemical compound ClCCCC(=O)NC(C(Cl)(Cl)CCl)N1C=NC=N1 ANLQIDQLXHRHDT-UHFFFAOYSA-N 0.000 description 1
- OKGYDPBIYMJHPW-UHFFFAOYSA-N 4-nitro-n-(2,2,3-trichloro-1-imidazol-1-ylpropyl)benzamide Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)NC(C(Cl)(Cl)CCl)N1C=NC=C1 OKGYDPBIYMJHPW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241001480061 Blumeria graminis Species 0.000 description 1
- BJKJAANBEXJJGQ-UHFFFAOYSA-N C(=O)(C(=C)C)NC(C(CCl)(Cl)Cl)N1N=CN=C1 Chemical compound C(=O)(C(=C)C)NC(C(CCl)(Cl)Cl)N1N=CN=C1 BJKJAANBEXJJGQ-UHFFFAOYSA-N 0.000 description 1
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241000896246 Golovinomyces cichoracearum Species 0.000 description 1
- 206010021118 Hypotonia Diseases 0.000 description 1
- 239000005574 MCPA Substances 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- UACOQEQOBAQRDQ-UHFFFAOYSA-N etebenecid Chemical compound CCN(CC)S(=O)(=O)C1=CC=C(C(O)=O)C=C1 UACOQEQOBAQRDQ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- FPVUZQOOXYYCIH-UHFFFAOYSA-N n,n-diethylethanamine;2-dodecylbenzenesulfonic acid Chemical compound CCN(CC)CC.CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O FPVUZQOOXYYCIH-UHFFFAOYSA-N 0.000 description 1
- SYGRAGOZHBIFQE-UHFFFAOYSA-N n-(1,2,2,3-tetrachloropropyl)acetamide Chemical compound CC(=O)NC(Cl)C(Cl)(Cl)CCl SYGRAGOZHBIFQE-UHFFFAOYSA-N 0.000 description 1
- CPOVQQRTRUHZAG-UHFFFAOYSA-N n-(1,2,2,3-tetrachloropropyl)formamide Chemical compound ClCC(Cl)(Cl)C(Cl)NC=O CPOVQQRTRUHZAG-UHFFFAOYSA-N 0.000 description 1
- SKYLPDQUPRFKGK-UHFFFAOYSA-N n-(1,2,2,3-tetrachloropropyl)propanamide Chemical compound CCC(=O)NC(Cl)C(Cl)(Cl)CCl SKYLPDQUPRFKGK-UHFFFAOYSA-N 0.000 description 1
- XJURVJRJBRYKDR-UHFFFAOYSA-N n-(2,2,3-trichloro-1-hydroxypropyl)butanamide Chemical compound CCCC(=O)NC(O)C(Cl)(Cl)CCl XJURVJRJBRYKDR-UHFFFAOYSA-N 0.000 description 1
- BPDSLDNCMNPUMM-UHFFFAOYSA-N n-(2,2,3-trichloro-1-hydroxypropyl)dodecanamide Chemical compound CCCCCCCCCCCC(=O)NC(O)C(Cl)(Cl)CCl BPDSLDNCMNPUMM-UHFFFAOYSA-N 0.000 description 1
- WXONLNYETLRAEF-UHFFFAOYSA-N n-(2,2,3-trichloro-1-hydroxypropyl)formamide Chemical compound O=CNC(O)C(Cl)(Cl)CCl WXONLNYETLRAEF-UHFFFAOYSA-N 0.000 description 1
- KGTXLSBMMATLFP-UHFFFAOYSA-N n-(2,2,3-trichloro-1-hydroxypropyl)furan-2-carboxamide Chemical compound ClCC(Cl)(Cl)C(O)NC(=O)C1=CC=CO1 KGTXLSBMMATLFP-UHFFFAOYSA-N 0.000 description 1
- LOYXGCONUWIPSX-UHFFFAOYSA-N n-(2,2,3-trichloro-1-hydroxypropyl)heptanamide Chemical compound CCCCCCC(=O)NC(O)C(Cl)(Cl)CCl LOYXGCONUWIPSX-UHFFFAOYSA-N 0.000 description 1
- LVPSZXWQCNGESK-UHFFFAOYSA-N n-(2,2,3-trichloro-1-hydroxypropyl)prop-2-enamide Chemical compound ClCC(Cl)(Cl)C(O)NC(=O)C=C LVPSZXWQCNGESK-UHFFFAOYSA-N 0.000 description 1
- IMHOEVRGUTYGSE-UHFFFAOYSA-N n-(2,2,3-trichloro-1-hydroxypropyl)propanamide Chemical compound CCC(=O)NC(O)C(Cl)(Cl)CCl IMHOEVRGUTYGSE-UHFFFAOYSA-N 0.000 description 1
- HYBOAYZBBPKVOG-UHFFFAOYSA-N n-(2,2,3-trichloro-1-imidazol-1-ylpropyl)but-2-en-1-amine Chemical compound CC=CCNC(C(Cl)(Cl)CCl)N1C=CN=C1 HYBOAYZBBPKVOG-UHFFFAOYSA-N 0.000 description 1
- DZNSCIPWEVPUCW-UHFFFAOYSA-N n-(2,2,3-trichloro-1-imidazol-1-ylpropyl)propanamide Chemical compound CCC(=O)NC(C(Cl)(Cl)CCl)N1C=CN=C1 DZNSCIPWEVPUCW-UHFFFAOYSA-N 0.000 description 1
- WJIZJLGPCDHDBN-UHFFFAOYSA-N n-[2,2,3-trichloro-1-(1,2,4-triazol-1-yl)propyl]butanamide Chemical compound CCCC(=O)NC(C(Cl)(Cl)CCl)N1C=NC=N1 WJIZJLGPCDHDBN-UHFFFAOYSA-N 0.000 description 1
- GIQIYCWWROFFTR-UHFFFAOYSA-N n-[2,2,3-trichloro-1-(1,2,4-triazol-1-yl)propyl]formamide Chemical compound ClCC(Cl)(Cl)C(NC=O)N1C=NC=N1 GIQIYCWWROFFTR-UHFFFAOYSA-N 0.000 description 1
- UXEMDWPMZYLLIT-UHFFFAOYSA-N n-[2,2,3-trichloro-1-(1,2,4-triazol-1-yl)propyl]heptanamide Chemical compound CCCCCCC(=O)NC(C(Cl)(Cl)CCl)N1C=NC=N1 UXEMDWPMZYLLIT-UHFFFAOYSA-N 0.000 description 1
- QXHHLGLHCZBZST-UHFFFAOYSA-N n-[2,2,3-trichloro-1-(1,2,4-triazol-1-yl)propyl]propanamide Chemical compound CCC(=O)NC(C(Cl)(Cl)CCl)N1C=NC=N1 QXHHLGLHCZBZST-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 229940088417 precipitated calcium carbonate Drugs 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752533792 DE2533792A1 (de) | 1975-07-29 | 1975-07-29 | Imidazolderivate |
| DE19762602739 DE2602739A1 (de) | 1976-01-26 | 1976-01-26 | Neue 1,2,4-triazolderivate |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE43928L IE43928L (en) | 1977-01-29 |
| IE43928B1 true IE43928B1 (en) | 1981-07-01 |
Family
ID=25769207
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1674/76A IE43928B1 (en) | 1975-07-29 | 1976-07-28 | 1-(1-acylamino-2,2,3-trichloropropyl)-imidazole or 1-2,4-triazole derivatives and their use in fungicidal compositions |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4087533A (enExample) |
| JP (1) | JPS5217473A (enExample) |
| AR (1) | AR217059A1 (enExample) |
| AT (1) | AT352119B (enExample) |
| AU (1) | AU500190B2 (enExample) |
| CA (1) | CA1068283A (enExample) |
| CH (1) | CH624274A5 (enExample) |
| DK (1) | DK339676A (enExample) |
| ES (2) | ES450218A1 (enExample) |
| FR (1) | FR2319633A1 (enExample) |
| GB (1) | GB1519914A (enExample) |
| IE (1) | IE43928B1 (enExample) |
| IL (1) | IL50158A (enExample) |
| IT (1) | IT1192147B (enExample) |
| LU (1) | LU75473A1 (enExample) |
| NL (1) | NL7608362A (enExample) |
| NZ (1) | NZ181598A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE602004019814D1 (de) * | 2003-12-02 | 2009-04-16 | Ucb Pharma Sa | Imidazolderivate, verfahren zu deren herstellung und deren anwendungen |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE756062A (fr) * | 1969-09-11 | 1971-03-11 | Boehringer Sohn Ingelheim | Derives de 1,1,1-trichlorethane leurs procedes de fabrication et leur utilisation en tant que substances biocides |
-
1976
- 1976-07-12 AT AT509076A patent/AT352119B/de not_active IP Right Cessation
- 1976-07-26 US US05/708,883 patent/US4087533A/en not_active Expired - Lifetime
- 1976-07-27 IT IT50620/76A patent/IT1192147B/it active
- 1976-07-27 LU LU75473A patent/LU75473A1/xx unknown
- 1976-07-28 CA CA258,012A patent/CA1068283A/en not_active Expired
- 1976-07-28 AR AR264097A patent/AR217059A1/es active
- 1976-07-28 IE IE1674/76A patent/IE43928B1/en unknown
- 1976-07-28 IL IL50158A patent/IL50158A/xx unknown
- 1976-07-28 NL NL7608362A patent/NL7608362A/xx not_active Application Discontinuation
- 1976-07-28 GB GB31495/76A patent/GB1519914A/en not_active Expired
- 1976-07-28 NZ NZ181598A patent/NZ181598A/xx unknown
- 1976-07-28 CH CH967176A patent/CH624274A5/de not_active IP Right Cessation
- 1976-07-28 JP JP51090101A patent/JPS5217473A/ja active Pending
- 1976-07-28 AU AU16332/76A patent/AU500190B2/en not_active Expired
- 1976-07-28 DK DK339676A patent/DK339676A/da not_active Application Discontinuation
- 1976-07-28 ES ES450218A patent/ES450218A1/es not_active Expired
- 1976-07-29 FR FR7623266A patent/FR2319633A1/fr active Granted
-
1977
- 1977-08-31 ES ES462004A patent/ES462004A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1068283A (en) | 1979-12-18 |
| AR217059A1 (es) | 1980-02-29 |
| ATA509076A (de) | 1979-02-15 |
| ES462004A1 (es) | 1978-06-01 |
| FR2319633B1 (enExample) | 1980-06-27 |
| LU75473A1 (enExample) | 1977-08-09 |
| IT1192147B (it) | 1988-03-31 |
| NZ181598A (en) | 1978-09-25 |
| DK339676A (da) | 1977-01-30 |
| AU1633276A (en) | 1978-02-02 |
| IL50158A (en) | 1980-05-30 |
| IE43928L (en) | 1977-01-29 |
| CH624274A5 (enExample) | 1981-07-31 |
| US4087533A (en) | 1978-05-02 |
| AT352119B (de) | 1979-09-10 |
| AU500190B2 (en) | 1979-05-10 |
| FR2319633A1 (fr) | 1977-02-25 |
| JPS5217473A (en) | 1977-02-09 |
| ES450218A1 (es) | 1977-11-16 |
| NL7608362A (nl) | 1977-02-01 |
| GB1519914A (en) | 1978-08-02 |
| IL50158A0 (en) | 1976-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4463011A (en) | Bis-imidazolyl-bis-phenylmethane derivatives and their use as fungicides | |
| US4151299A (en) | Certain aniline derivatives as microbicidal agents | |
| US4349550A (en) | Fungicidal N-(pyridazinoacetyl)-anilines | |
| US4331674A (en) | Combating fungi with 4-phenoxy-4-(azolyl-1-yl)-butanoic acid derivatives | |
| US4359470A (en) | Acylated triazolyl-γ-fluoropinacolyl derivatives and their use as fungicides | |
| WO1995029901A1 (en) | Fungicidal azole derivatives | |
| HK111793A (en) | Amine derivatives, processes for preparing the same and fungicides containing the same | |
| US4145428A (en) | Fungicidally active 2-acyloxy-1-phenoxy-1-(1,2,4-triazolyl)-3,3-dimethyl-butanes | |
| US4394380A (en) | 2-(2-Alkoxyalkyl)-1,2,4-triazole compounds and their use as fungicides | |
| US4503063A (en) | N-Acyl 3-aryl-3-hydroxy-4-(1H-1,2,4-triazol-1-yl)-butyramide antifungal agents | |
| US4094990A (en) | Certain phytofungicidal n-furanyl carbonyl and tetrahydrofuranyl carbonyl, n-(substituted)phenyl alanines | |
| US4098894A (en) | Triphenyl-1,2,3-triazolyl-(1)-methanes, and compositions and methods for combating fungi and bacteria employing them | |
| US4297364A (en) | α-Azolyl-α-phenylacetic acid derivatives | |
| US4428948A (en) | Novel heterocyclic compounds | |
| US4780471A (en) | Fungicidal azole derivatives | |
| US5047548A (en) | 3-aryl-3-hydroxy-4-(1H-1,2,4-triazol-1-yl)butyramide and derivatives as antifungal agents | |
| US4151295A (en) | Microbicides for controlling plant diseases | |
| IE43928B1 (en) | 1-(1-acylamino-2,2,3-trichloropropyl)-imidazole or 1-2,4-triazole derivatives and their use in fungicidal compositions | |
| US4584008A (en) | Aldol adducts containing triazole groups | |
| US4636519A (en) | Ketene S,S-acetal derivative, a process for manufacturing thereof and a method for curing mycosis by administering it | |
| US4378357A (en) | Novel heterocyclic compounds | |
| US4738976A (en) | Antimycotic agent and fungicidal agent | |
| US4829063A (en) | Saccharine salts of substituted amines | |
| JPS6363670A (ja) | ド−パミン−β−ヒドロキシラ−ゼ抑制剤 | |
| US5116838A (en) | Guanidine derivatives and fungicides for agriculture and horticulture containing the same |