IE42818B1 - Polymeric (2-aryloxyethyl)-phosphates - Google Patents
Polymeric (2-aryloxyethyl)-phosphatesInfo
- Publication number
- IE42818B1 IE42818B1 IE1063/76A IE106376A IE42818B1 IE 42818 B1 IE42818 B1 IE 42818B1 IE 1063/76 A IE1063/76 A IE 1063/76A IE 106376 A IE106376 A IE 106376A IE 42818 B1 IE42818 B1 IE 42818B1
- Authority
- IE
- Ireland
- Prior art keywords
- phosphate
- tris
- polymeric compound
- reaction
- polymeric
- Prior art date
Links
- 229910019142 PO4 Inorganic materials 0.000 title claims abstract description 13
- 229920000642 polymer Polymers 0.000 claims abstract description 14
- 239000010452 phosphate Substances 0.000 claims abstract description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 5
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 3
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 229960001760 dimethyl sulfoxide Drugs 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000002798 polar solvent Substances 0.000 claims description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 2
- 229940113088 dimethylacetamide Drugs 0.000 claims description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical group NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims 2
- 239000002671 adjuvant Substances 0.000 claims 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 abstract description 9
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical class OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 abstract description 8
- 229930185605 Bisphenol Natural products 0.000 abstract description 7
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 abstract description 7
- HQUQLFOMPYWACS-UHFFFAOYSA-N tris(2-chloroethyl) phosphate Chemical compound ClCCOP(=O)(OCCCl)OCCCl HQUQLFOMPYWACS-UHFFFAOYSA-N 0.000 abstract description 7
- -1 methallyl sulphonate Chemical compound 0.000 abstract description 5
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 abstract description 4
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical class C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 abstract description 3
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical class C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 abstract description 3
- 239000007983 Tris buffer Substances 0.000 abstract description 3
- 150000003839 salts Chemical class 0.000 abstract description 3
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 abstract description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 abstract description 2
- 229920001577 copolymer Polymers 0.000 abstract 1
- 239000002184 metal Substances 0.000 abstract 1
- 150000003018 phosphorus compounds Chemical class 0.000 abstract 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 229910001508 alkali metal halide Inorganic materials 0.000 description 3
- 150000008045 alkali metal halides Chemical class 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- FRASJONUBLZVQX-UHFFFAOYSA-N 1,4-dioxonaphthalene Natural products C1=CC=C2C(=O)C=CC(=O)C2=C1 FRASJONUBLZVQX-UHFFFAOYSA-N 0.000 description 1
- BOKGTLAJQHTOKE-UHFFFAOYSA-N 1,5-dihydroxynaphthalene Chemical compound C1=CC=C2C(O)=CC=CC2=C1O BOKGTLAJQHTOKE-UHFFFAOYSA-N 0.000 description 1
- ANHAEBWRQNIPEV-UHFFFAOYSA-N 2-chloroethyl dihydrogen phosphate Chemical compound OP(O)(=O)OCCCl ANHAEBWRQNIPEV-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- MDNWOSOZYLHTCG-UHFFFAOYSA-N Dichlorophen Chemical compound OC1=CC=C(Cl)C=C1CC1=CC(Cl)=CC=C1O MDNWOSOZYLHTCG-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 229920002821 Modacrylic Polymers 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G79/00—Macromolecular compounds obtained by reactions forming a linkage containing atoms other than silicon, sulfur, nitrogen, oxygen, and carbon with or without the latter elements in the main chain of the macromolecule
- C08G79/02—Macromolecular compounds obtained by reactions forming a linkage containing atoms other than silicon, sulfur, nitrogen, oxygen, and carbon with or without the latter elements in the main chain of the macromolecule a linkage containing phosphorus
- C08G79/04—Phosphorus linked to oxygen or to oxygen and carbon
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L85/00—Compositions of macromolecular compounds obtained by reactions forming a linkage in the main chain of the macromolecule containing atoms other than silicon, sulfur, nitrogen, oxygen and carbon; Compositions of derivatives of such polymers
- C08L85/02—Compositions of macromolecular compounds obtained by reactions forming a linkage in the main chain of the macromolecule containing atoms other than silicon, sulfur, nitrogen, oxygen and carbon; Compositions of derivatives of such polymers containing phosphorus
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Fireproofing Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752522539 DE2522539A1 (de) | 1975-05-21 | 1975-05-21 | Polymere (2-aryloxi-aethyl)-phosphate |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE42818L IE42818L (en) | 1976-11-21 |
| IE42818B1 true IE42818B1 (en) | 1980-10-22 |
Family
ID=5947084
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1063/76A IE42818B1 (en) | 1975-05-21 | 1976-05-20 | Polymeric (2-aryloxyethyl)-phosphates |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS51143100A (Direct) |
| BE (1) | BE841976A (Direct) |
| DE (1) | DE2522539A1 (Direct) |
| DK (1) | DK222876A (Direct) |
| FR (1) | FR2311791A1 (Direct) |
| GB (1) | GB1533790A (Direct) |
| IE (1) | IE42818B1 (Direct) |
| LU (1) | LU74978A1 (Direct) |
| NL (1) | NL7605342A (Direct) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4246169A (en) * | 1978-04-19 | 1981-01-20 | Fmc Corporation | Flammable plastics containing a flame retardant amount of polyarylphosphates and the polyarylphosphates |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB706410A (en) * | 1950-01-20 | 1954-03-31 | Metallgesellschaft Ag | Method of producing poly-condensed phosphoric acid esters |
| US3761543A (en) * | 1972-07-14 | 1973-09-25 | Dow Chemical Co | Polyphosphorus esters |
-
1975
- 1975-05-21 DE DE19752522539 patent/DE2522539A1/de not_active Withdrawn
-
1976
- 1976-05-14 GB GB19969/76A patent/GB1533790A/en not_active Expired
- 1976-05-19 LU LU74978A patent/LU74978A1/xx unknown
- 1976-05-19 NL NL7605342A patent/NL7605342A/xx not_active Application Discontinuation
- 1976-05-19 BE BE167144A patent/BE841976A/xx unknown
- 1976-05-20 DK DK222876A patent/DK222876A/da unknown
- 1976-05-20 JP JP51057343A patent/JPS51143100A/ja active Pending
- 1976-05-20 IE IE1063/76A patent/IE42818B1/en unknown
- 1976-05-21 FR FR7615546A patent/FR2311791A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| BE841976A (fr) | 1976-11-19 |
| NL7605342A (nl) | 1976-11-23 |
| LU74978A1 (Direct) | 1977-02-14 |
| FR2311791A1 (fr) | 1976-12-17 |
| DE2522539A1 (de) | 1976-12-09 |
| FR2311791B1 (Direct) | 1979-07-13 |
| GB1533790A (en) | 1978-11-29 |
| DK222876A (da) | 1976-11-22 |
| IE42818L (en) | 1976-11-21 |
| JPS51143100A (en) | 1976-12-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3932566A (en) | Phosphonate polymers | |
| IE42818B1 (en) | Polymeric (2-aryloxyethyl)-phosphates | |
| NO831043L (no) | 2-acrylamido-2-metyl-propanfosfonsyre og dens salter, fremgangsmaate til dens fremstilling og dens anvendelse til fremstilling av kopolymere | |
| US5026804A (en) | Polymerization of halo aryl olefin | |
| US4806322A (en) | Process for the production of linear polyphosphazenes | |
| US5138008A (en) | Process for the production of linear polyphosphazenes | |
| US3179522A (en) | Organic phosphorus esters and polyesters | |
| IE42819B1 (en) | Polymeric (2-aryloxyethyl)-phosphites | |
| CA1299200C (en) | Preparation of diaryl sulfones | |
| US3830890A (en) | Method of making esters of 1,4-diphosphonyl butene | |
| JPH0569843B2 (Direct) | ||
| US5164477A (en) | Polyfunctional polymerization initiator | |
| Gravalos | Synthesis and flammability of copolyisophthalamides. I. With phosphorus groups in the main chain | |
| US4039512A (en) | Polymers of benzene phosphorus oxydichloride, 4,4'-thiodiphenol and POCl3 | |
| US4088677A (en) | Carboxyphenyl-alkylphosphinic acids, their esters and process for their preparation | |
| CN110845529B (zh) | 一种含磷多乙烯多胺阻燃剂及其制备方法 | |
| US4206296A (en) | Polyester composition containing a benzene phosphorus oxydichloride, a diphenol and POCl3 | |
| US5382644A (en) | Linear polyphosphazenes and a process for their production | |
| US4080402A (en) | Polymers of benzene phosphorus oxydichloride and 4,4'-thiodiphenol | |
| US5246901A (en) | Polysulfonic acids | |
| Kricheldorf et al. | New polymer syntheses. 13. Synthesis of aromatic polyphosphates from silylated bisphenol A or tetrachlorohydroquinone | |
| US3170913A (en) | Azo-bis-alkylphosphonates and corresponding acids | |
| US4442268A (en) | N-(Substituted phosphinyl) polyamides | |
| US4369260A (en) | Phosphorus-containing alternating copolymers | |
| CA1080398A (en) | Process for recovery of a polymer formed by reacting organo-phosphonic dihalides and dihydroxy aromatic compounds |