IE42644B1 - (indolin-1-yl)-guanidines - Google Patents
(indolin-1-yl)-guanidinesInfo
- Publication number
- IE42644B1 IE42644B1 IE371/76A IE37176A IE42644B1 IE 42644 B1 IE42644 B1 IE 42644B1 IE 371/76 A IE371/76 A IE 371/76A IE 37176 A IE37176 A IE 37176A IE 42644 B1 IE42644 B1 IE 42644B1
- Authority
- IE
- Ireland
- Prior art keywords
- compound
- carbon atoms
- alkyl
- hydrogen
- formula
- Prior art date
Links
- BRSYLRPPQIAFQU-UHFFFAOYSA-N 2-(2,3-dihydroindol-1-yl)guanidine Chemical class C1=CC=C2N(NC(=N)N)CCC2=C1 BRSYLRPPQIAFQU-UHFFFAOYSA-N 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 56
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 33
- 239000002253 acid Substances 0.000 claims abstract description 13
- 238000000034 method Methods 0.000 claims abstract description 10
- 150000003839 salts Chemical class 0.000 claims abstract description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 48
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- 239000001257 hydrogen Substances 0.000 claims description 22
- 150000002367 halogens Chemical class 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000002431 hydrogen Chemical class 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000000304 alkynyl group Chemical group 0.000 claims description 5
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 5
- 239000012458 free base Substances 0.000 claims description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 125000004036 acetal group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- -1 dimethylaminoethyl Chemical group 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- 125000005359 phenoxyalkyl group Chemical group 0.000 claims description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims 4
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims 2
- VNWKTOKETHGBQD-YPZZEJLDSA-N carbane Chemical group [10CH4] VNWKTOKETHGBQD-YPZZEJLDSA-N 0.000 claims 1
- 125000004981 cycloalkylmethyl group Chemical group 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 230000003276 anti-hypertensive effect Effects 0.000 abstract description 2
- 125000001424 substituent group Chemical group 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 3
- HJKLEAOXCZIMPI-UHFFFAOYSA-N 2,2-diethoxyethanamine Chemical compound CCOC(CN)OCC HJKLEAOXCZIMPI-UHFFFAOYSA-N 0.000 description 2
- FWWOWPGPERBCNJ-UHFFFAOYSA-N 2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid Chemical compound OCCOC(=O)CC(O)C(O)=O FWWOWPGPERBCNJ-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical group 0.000 description 2
- CPEKAXYCDKETEN-UHFFFAOYSA-N benzoyl isothiocyanate Chemical compound S=C=NC(=O)C1=CC=CC=C1 CPEKAXYCDKETEN-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- WKMJCQCRQLPLNH-UHFFFAOYSA-N methyl n'-(5-chloro-2,3-dihydroindol-1-yl)carbamimidothioate;hydrochloride Chemical compound Cl.ClC1=CC=C2N(NC(=N)SC)CCC2=C1 WKMJCQCRQLPLNH-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- LDUCDHHSTPRPKF-UHFFFAOYSA-N (5-chloro-2,3-dihydroindol-1-yl)thiourea Chemical compound ClC1=CC=C2N(NC(=S)N)CCC2=C1 LDUCDHHSTPRPKF-UHFFFAOYSA-N 0.000 description 1
- QZQJVPGOPWBQDO-UHFFFAOYSA-N 2-(2,3-dihydroindol-1-yl)-1-hydroxyguanidine Chemical compound C1=CC=C2N(NC(=N)NO)CCC2=C1 QZQJVPGOPWBQDO-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- UMGDCJDMYOKAJW-UHFFFAOYSA-N aminothiocarboxamide Natural products NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-M fumarate(1-) Chemical compound OC(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-M 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000011876 fused mixture Substances 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- DQMWMUMCNOJLSI-UHFFFAOYSA-N n-carbamothioylbenzamide Chemical compound NC(=S)NC(=O)C1=CC=CC=C1 DQMWMUMCNOJLSI-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000054 salidiuretic effect Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Peptides Or Proteins (AREA)
- Plural Heterocyclic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CH244075A CH613691A5 (en) | 1975-02-26 | 1975-02-26 | Process for the preparation of novel 1-indolinylguanidine derivatives |
Publications (2)
Publication Number | Publication Date |
---|---|
IE42644L IE42644L (en) | 1976-08-26 |
IE42644B1 true IE42644B1 (en) | 1980-09-24 |
Family
ID=4233860
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
IE371/76A IE42644B1 (en) | 1975-02-26 | 1976-02-25 | (indolin-1-yl)-guanidines |
Country Status (23)
Families Citing this family (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2737064A1 (de) * | 1976-08-27 | 1978-03-09 | Sandoz Ag | Indolin-1-ylguanidin-derivate, ihre verwendung und herstellung |
JP4943715B2 (ja) * | 2006-02-27 | 2012-05-30 | 株式会社タダノ | 移動式クレーンのカウンタウエイト装置 |
-
1975
- 1975-02-26 CH CH244075A patent/CH613691A5/xx not_active IP Right Cessation
-
1976
- 1976-02-14 DE DE19762605981 patent/DE2605981A1/de not_active Ceased
- 1976-02-17 FI FI760385A patent/FI760385A/fi not_active Application Discontinuation
- 1976-02-17 DK DK62676*#A patent/DK62676A/da not_active Application Discontinuation
- 1976-02-18 NO NO760537A patent/NO760537L/no unknown
- 1976-02-19 SE SE7602000A patent/SE411119B/xx unknown
- 1976-02-20 NL NL7601728A patent/NL7601728A/xx unknown
- 1976-02-23 GB GB7002/76A patent/GB1531611A/en not_active Expired
- 1976-02-24 IL IL49097A patent/IL49097A/xx unknown
- 1976-02-24 BE BE164609A patent/BE838903A/xx unknown
- 1976-02-24 PT PT64838A patent/PT64838B/pt unknown
- 1976-02-24 ES ES445477A patent/ES445477A1/es not_active Expired
- 1976-02-24 NZ NZ180109A patent/NZ180109A/xx unknown
- 1976-02-24 CA CA246,492A patent/CA1071640A/en not_active Expired
- 1976-02-24 FR FR7605036A patent/FR2302090A1/fr active Granted
- 1976-02-24 DD DD191457A patent/DD123883A5/xx unknown
- 1976-02-25 IE IE371/76A patent/IE42644B1/en unknown
- 1976-02-25 AT AT136476A patent/AT358062B/de not_active IP Right Cessation
- 1976-02-25 YU YU00470/76A patent/YU47076A/xx unknown
- 1976-02-25 SU SU762324510A patent/SU655307A3/ru active
- 1976-02-25 JP JP51019038A patent/JPS51110562A/ja active Pending
- 1976-02-26 AU AU11461/76A patent/AU505134B2/en not_active Expired
- 1976-02-26 ZA ZA761155A patent/ZA761155B/xx unknown
Also Published As
Publication number | Publication date |
---|---|
AU505134B2 (en) | 1979-11-08 |
DE2605981A1 (de) | 1976-09-09 |
YU47076A (en) | 1982-02-28 |
DK62676A (da) | 1976-08-27 |
CA1071640A (en) | 1980-02-12 |
IL49097A (en) | 1979-01-31 |
JPS51110562A (US20010021848A1-20010913-M00008.png) | 1976-09-30 |
PT64838A (pt) | 1976-03-01 |
FR2302090A1 (fr) | 1976-09-24 |
NZ180109A (en) | 1978-06-20 |
GB1531611A (en) | 1978-11-08 |
SU655307A3 (ru) | 1979-03-30 |
FR2302090B1 (US20010021848A1-20010913-M00008.png) | 1979-09-21 |
SE411119B (sv) | 1979-12-03 |
ATA136476A (de) | 1980-01-15 |
ES445477A1 (es) | 1977-10-16 |
IL49097A0 (en) | 1976-04-30 |
NL7601728A (nl) | 1976-08-30 |
AT358062B (de) | 1980-08-25 |
NO760537L (US20010021848A1-20010913-M00008.png) | 1976-08-27 |
IE42644L (en) | 1976-08-26 |
BE838903A (fr) | 1976-08-24 |
DD123883A5 (US20010021848A1-20010913-M00008.png) | 1977-01-19 |
AU1146176A (en) | 1977-09-01 |
ZA761155B (en) | 1977-09-28 |
CH613691A5 (en) | 1979-10-15 |
SE7602000L (sv) | 1976-08-27 |
PT64838B (fr) | 1977-09-06 |
FI760385A (US20010021848A1-20010913-M00008.png) | 1976-08-27 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US5091387A (en) | Spirocyclic oxytocin antagonists | |
EP0345808B1 (en) | 1-Indolylalkyl-4-(substituted-pyridinyl)piperazines | |
US3654287A (en) | Spiroindanylpiperidines | |
US4261895A (en) | Alkanoyl-proline derivatives and homologues thereof | |
CA2037287A1 (en) | Spirocyclic oxytocin antagonists | |
EP0444945A2 (en) | Use of spirocyclic compounds as oxytocin antagonists | |
US3699123A (en) | 4-(3-amino-2-hydroxy-propoxy) indole derivatives | |
GB1563989A (en) | Sulfonamides | |
CA1098909A (en) | Indolyloxy-aminopropanol derivatives | |
GB1571781A (en) | Pyridobenzodiazepines | |
GB1564327A (en) | Indazole derivates | |
GB1569251A (en) | Pyridobenzodiazepines | |
JPH089580B2 (ja) | アミノアルコ−ル、その製造法およびその用途 | |
US4057560A (en) | 1,2,2A,3,4,5 Hexahydrobenz[c,d]indol-1-yl-2-guanidines | |
US4126613A (en) | Substituted cycloalkyl lactamimides | |
IE42644B1 (en) | (indolin-1-yl)-guanidines | |
US4126621A (en) | Substituted cycloalkyl lactamimides | |
US4235921A (en) | Treating muscular spasms and convulsions with 3-azabicyclo[3.1.0]hexanes | |
US3758502A (en) | Organic compounds | |
US4130652A (en) | 2-(Iminoethylidene)-pyrrolidines and tautomeric 2-(aminoethenyl)-1-pyrrolines | |
CA1094553A (en) | 1-amino substituted indoline derivatives as vasoconstricting agents | |
IL31570A (en) | Laevorotatory indole derivatives,their production and pharmaceutical compositions containing them | |
US3576811A (en) | 1-alkyl-1-(beta-piperidino-ethyl)-1,2,3,4- tetrahydronaphthalen-2-ones | |
MXPA01012328A (es) | Polimorfos de un citrato de (2-benzhidril- 1-azabiciclo(2.2.2) oct-3-il- (5-iso- propil-2- metoxibencil) -amina como antagonistas del receptor de nk-1. | |
US4113877A (en) | Substituted 2-aminomethylphenyl sulfamates |