IE42014B1 - Unsaturated trans-epoxy alcohols and process for their preparation - Google Patents
Unsaturated trans-epoxy alcohols and process for their preparationInfo
- Publication number
- IE42014B1 IE42014B1 IE2045/75A IE204575A IE42014B1 IE 42014 B1 IE42014 B1 IE 42014B1 IE 2045/75 A IE2045/75 A IE 2045/75A IE 204575 A IE204575 A IE 204575A IE 42014 B1 IE42014 B1 IE 42014B1
- Authority
- IE
- Ireland
- Prior art keywords
- epoxy
- trans
- compound
- formula
- reacting
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 37
- 239000004593 Epoxy Substances 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title claims description 13
- 150000001298 alcohols Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 34
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 16
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 claims abstract description 13
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052700 potassium Inorganic materials 0.000 claims abstract description 7
- 239000011591 potassium Substances 0.000 claims abstract description 7
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical group CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 claims abstract description 6
- 150000002901 organomagnesium compounds Chemical class 0.000 claims abstract description 6
- 150000001408 amides Chemical class 0.000 claims abstract description 3
- 150000004678 hydrides Chemical class 0.000 claims abstract description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract 2
- 150000001340 alkali metals Chemical class 0.000 claims abstract 2
- 150000003112 potassium compounds Chemical class 0.000 claims abstract 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 15
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 claims description 14
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical group [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 11
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims description 10
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 claims description 10
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims description 10
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 claims description 9
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 7
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 7
- 239000012312 sodium hydride Substances 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052763 palladium Inorganic materials 0.000 claims description 5
- OIYLHWTUZKUZMO-UHFFFAOYSA-N 5-chlorodec-2-yne-1,4-diol Chemical compound CCCCCC(Cl)C(O)C#CCO OIYLHWTUZKUZMO-UHFFFAOYSA-N 0.000 claims description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- 229910001623 magnesium bromide Inorganic materials 0.000 claims description 3
- YCCXQARVHOPWFJ-UHFFFAOYSA-M magnesium;ethane;chloride Chemical compound [Mg+2].[Cl-].[CH2-]C YCCXQARVHOPWFJ-UHFFFAOYSA-M 0.000 claims description 3
- BSVFHYAKJFPWMT-UHFFFAOYSA-N 2-chloroheptanal Chemical compound CCCCCC(Cl)C=O BSVFHYAKJFPWMT-UHFFFAOYSA-N 0.000 claims description 2
- LYAGMSWTYFYCLR-UHFFFAOYSA-N 3-(3-pentyloxiran-2-yl)prop-2-yn-1-ol Chemical compound CCCCCC1OC1C#CCO LYAGMSWTYFYCLR-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- -1 alkyl radical Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 claims description 2
- 238000005984 hydrogenation reaction Methods 0.000 claims description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- AHNJTQYTRPXLLG-UHFFFAOYSA-N lithium;diethylazanide Chemical compound [Li+].CC[N-]CC AHNJTQYTRPXLLG-UHFFFAOYSA-N 0.000 claims description 2
- 150000002680 magnesium Chemical class 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 claims description 2
- 125000000962 organic group Chemical group 0.000 claims description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical group [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 claims 2
- 125000001979 organolithium group Chemical group 0.000 claims 2
- PQGAHNJECSVDEI-UHFFFAOYSA-N [CH2]CCCCC Chemical compound [CH2]CCCCC PQGAHNJECSVDEI-UHFFFAOYSA-N 0.000 claims 1
- 150000001336 alkenes Chemical class 0.000 claims 1
- 239000003863 metallic catalyst Substances 0.000 claims 1
- GPTFURBXHJWNHR-UHFFFAOYSA-N protopine Chemical compound C1=C2C(=O)CC3=CC=C4OCOC4=C3CN(C)CCC2=CC2=C1OCO2 GPTFURBXHJWNHR-UHFFFAOYSA-N 0.000 claims 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 abstract description 2
- 229910052744 lithium Inorganic materials 0.000 abstract description 2
- 229910052708 sodium Inorganic materials 0.000 abstract description 2
- 239000011734 sodium Substances 0.000 abstract description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 abstract 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 abstract 1
- 150000002440 hydroxy compounds Chemical class 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 7
- 239000000377 silicon dioxide Substances 0.000 description 7
- 239000003921 oil Substances 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 3
- 235000019799 monosodium phosphate Nutrition 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 3
- 239000001488 sodium phosphate Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 150000003180 prostaglandins Chemical class 0.000 description 2
- JEOFAMWBXAAEEH-UHFFFAOYSA-N 2-pentyl-3-prop-1-ynyloxirane Chemical compound CCCCCC1OC1C#CC JEOFAMWBXAAEEH-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- GPWHDDKQSYOYBF-UHFFFAOYSA-N ac1l2u0q Chemical compound Br[Br-]Br GPWHDDKQSYOYBF-UHFFFAOYSA-N 0.000 description 1
- PBGGNZZGJIKBMJ-UHFFFAOYSA-N di(propan-2-yl)azanide Chemical compound CC(C)[N-]C(C)C PBGGNZZGJIKBMJ-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940046892 lead acetate Drugs 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/38—Compounds containing oxirane rings with hydrocarbon radicals, substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D303/40—Compounds containing oxirane rings with hydrocarbon radicals, substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals by ester radicals
- C07D303/42—Acyclic compounds having a chain of seven or more carbon atoms, e.g. epoxidised fats
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Epoxy Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7431500A FR2285384A1 (fr) | 1974-09-18 | 1974-09-18 | Nouveau procede de preparation de trans-epoxy cis-alcenes substitues |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE42014L IE42014L (en) | 1976-03-18 |
| IE42014B1 true IE42014B1 (en) | 1980-05-21 |
Family
ID=9143194
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2045/75A IE42014B1 (en) | 1974-09-18 | 1975-09-17 | Unsaturated trans-epoxy alcohols and process for their preparation |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3984442A (enExample) |
| JP (1) | JPS5152123A (enExample) |
| AT (1) | AT343669B (enExample) |
| BE (1) | BE833416A (enExample) |
| CA (1) | CA1072570A (enExample) |
| CH (1) | CH602690A5 (enExample) |
| DD (1) | DD122246A5 (enExample) |
| DE (1) | DE2541711A1 (enExample) |
| DK (1) | DK415075A (enExample) |
| ES (1) | ES440941A1 (enExample) |
| FR (1) | FR2285384A1 (enExample) |
| GB (2) | GB1475027A (enExample) |
| HU (1) | HU173002B (enExample) |
| IE (1) | IE42014B1 (enExample) |
| IL (1) | IL47821A (enExample) |
| LU (1) | LU73397A1 (enExample) |
| NL (1) | NL7511039A (enExample) |
| SE (1) | SE411043B (enExample) |
| SU (1) | SU730304A3 (enExample) |
| ZA (1) | ZA754906B (enExample) |
-
1974
- 1974-09-18 FR FR7431500A patent/FR2285384A1/fr active Granted
-
1975
- 1975-07-10 SU SU752151516A patent/SU730304A3/ru active
- 1975-07-11 HU HU75RO00000845A patent/HU173002B/hu unknown
- 1975-07-22 SE SE7508333A patent/SE411043B/xx unknown
- 1975-07-25 IL IL47821A patent/IL47821A/xx unknown
- 1975-07-30 ZA ZA00754906A patent/ZA754906B/xx unknown
- 1975-08-15 US US05/605,159 patent/US3984442A/en not_active Expired - Lifetime
- 1975-09-11 JP JP50109526A patent/JPS5152123A/ja active Pending
- 1975-09-15 BE BE160041A patent/BE833416A/xx unknown
- 1975-09-15 ES ES440941A patent/ES440941A1/es not_active Expired
- 1975-09-15 LU LU73397A patent/LU73397A1/xx unknown
- 1975-09-16 DD DD188368A patent/DD122246A5/xx unknown
- 1975-09-17 GB GB3823575A patent/GB1475027A/en not_active Expired
- 1975-09-17 IE IE2045/75A patent/IE42014B1/en unknown
- 1975-09-17 CA CA235,670A patent/CA1072570A/en not_active Expired
- 1975-09-17 DK DK415075A patent/DK415075A/da not_active Application Discontinuation
- 1975-09-17 CH CH1205475A patent/CH602690A5/xx not_active IP Right Cessation
- 1975-09-17 GB GB1563876A patent/GB1475028A/en not_active Expired
- 1975-09-18 AT AT717475A patent/AT343669B/de not_active IP Right Cessation
- 1975-09-18 NL NL7511039A patent/NL7511039A/xx not_active Application Discontinuation
- 1975-09-18 DE DE19752541711 patent/DE2541711A1/de not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| ATA717475A (de) | 1977-10-15 |
| CA1072570A (en) | 1980-02-26 |
| DK415075A (da) | 1976-03-19 |
| JPS5152123A (en) | 1976-05-08 |
| LU73397A1 (enExample) | 1976-04-13 |
| ZA754906B (en) | 1976-09-29 |
| ES440941A1 (es) | 1977-06-01 |
| SE411043B (sv) | 1979-11-26 |
| SE7508333L (sv) | 1976-03-19 |
| US3984442A (en) | 1976-10-05 |
| FR2285384B1 (enExample) | 1978-12-29 |
| HU173002B (hu) | 1979-01-28 |
| AU8322875A (en) | 1977-02-17 |
| SU730304A3 (ru) | 1980-04-25 |
| NL7511039A (nl) | 1976-03-22 |
| IE42014L (en) | 1976-03-18 |
| IL47821A0 (en) | 1975-10-15 |
| FR2285384A1 (fr) | 1976-04-16 |
| AT343669B (de) | 1978-06-12 |
| CH602690A5 (enExample) | 1978-07-31 |
| IL47821A (en) | 1979-07-25 |
| BE833416A (fr) | 1976-03-15 |
| DD122246A5 (enExample) | 1976-09-20 |
| DE2541711A1 (de) | 1976-04-08 |
| GB1475027A (en) | 1977-06-01 |
| GB1475028A (en) | 1977-06-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Meyers et al. | Oxazolines. IX. Synthesis of homologated acetic acids and esters | |
| Ksander et al. | A method for the synthesis of unsaturated carbonyl compounds | |
| White et al. | Stereoselective synthesis of trisporic acids A and B, their methyl esters, and trisporols A and B, hormones and prohormones of mucoraceous fungi | |
| Reist et al. | Synthesis of trans-and cis-Sphingosine | |
| Rautenstrauch | Controlled allylic transformations via the meisenheimer rearrangement | |
| US3736319A (en) | Novel cyclopentanone-2-carboxylates | |
| US4062878A (en) | Preparation of novel keto-esters | |
| US4157345A (en) | 2,6,6-Trimethyl-3-alkoxy-cyclohex-2-en-1-ones | |
| Nore et al. | A new synthesis of methoxalen | |
| IE42014B1 (en) | Unsaturated trans-epoxy alcohols and process for their preparation | |
| US4014919A (en) | Process for preparing methyl jasmonate and related compounds | |
| US3816536A (en) | 2-2-disubstituted cycloalkane-1,3-diones | |
| JPS63258487A (ja) | 17α−エチニル−17β−ヒドロキシ−18−メチル−4,15−エストラジエン−3−オンの製造方法、及びこの方法の中間生成物 | |
| JP4176201B2 (ja) | 5−ハロゲノ−2−置換ピリジンの製造方法 | |
| US4045476A (en) | 1-(2,6,6-Trimethyl-3-hydroxy or lower alkanoyloxycyclohexen-1-yl)-3-methyl-4-penten-1-yn-3-ol compound | |
| US4933461A (en) | Preparation of a piperidinylcyclopentylheptenoic acid derivative | |
| Miyano et al. | Convenient preparation of alkanoylmethylenetriphenylphosphoranes | |
| Vingiello et al. | 7-Phenyldibenz [a, h] anthracene and Benzo [e] naphtho [1, 2-b] pyrene1, 2 | |
| US4153805A (en) | Preparation of food coloring agents | |
| CA1098126A (en) | Process for the preparation of 9,11,15-trihydroxy-13, 14-dehydro-prostaglandins and new prost-5-en-13-ynoic acid derivatives | |
| US4124648A (en) | Process for the preparation of norpatchoulenol and intermediates therefor | |
| US3281469A (en) | Process for preparing 5-hydroxy-5-(3-aminoalkynyl) dibenzo [a, d] cyclohepta [1, 4] denes | |
| US4227022A (en) | Acetylenic diols and monoethers thereof | |
| US3868402A (en) | Novel cyclopentanone-2-carboxylates | |
| Harding et al. | Cationic. pi. cyclizations. Alkenes vs. alkynes as the. pi. participant |