IE41516B1 - Propargyl ethers - Google Patents
Propargyl ethersInfo
- Publication number
- IE41516B1 IE41516B1 IE1845/75A IE184575A IE41516B1 IE 41516 B1 IE41516 B1 IE 41516B1 IE 1845/75 A IE1845/75 A IE 1845/75A IE 184575 A IE184575 A IE 184575A IE 41516 B1 IE41516 B1 IE 41516B1
- Authority
- IE
- Ireland
- Prior art keywords
- bis
- propynyloxy
- propargyl
- formula
- compound
- Prior art date
Links
- HRDCVMSNCBAMAM-UHFFFAOYSA-N 3-prop-2-ynoxyprop-1-yne Chemical class C#CCOCC#C HRDCVMSNCBAMAM-UHFFFAOYSA-N 0.000 title claims abstract description 29
- 150000001875 compounds Chemical class 0.000 claims abstract description 14
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 6
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims abstract description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 3
- 239000000460 chlorine Substances 0.000 claims abstract description 3
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 3
- 229910052740 iodine Inorganic materials 0.000 claims abstract description 3
- 125000005905 mesyloxy group Chemical group 0.000 claims abstract description 3
- 239000003960 organic solvent Substances 0.000 claims abstract description 3
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 claims abstract description 3
- 239000000203 mixture Substances 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 17
- 230000000749 insecticidal effect Effects 0.000 claims description 16
- 241000238631 Hexapoda Species 0.000 claims description 8
- MYIBYIWEBWRIFF-UHFFFAOYSA-N 1,10-bis(prop-2-ynoxy)decane Chemical compound C#CCOCCCCCCCCCCOCC#C MYIBYIWEBWRIFF-UHFFFAOYSA-N 0.000 claims description 6
- 239000012876 carrier material Substances 0.000 claims description 4
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 2
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- RLXZKPJBOMBAPF-UHFFFAOYSA-N 1,11-bis(prop-2-ynoxy)undecane Chemical compound C#CCOCCCCCCCCCCCOCC#C RLXZKPJBOMBAPF-UHFFFAOYSA-N 0.000 claims 2
- XBEPJIKPUYJXFA-UHFFFAOYSA-N 1,12-bis(prop-2-ynoxy)dodecane Chemical compound C#CCOCCCCCCCCCCCCOCC#C XBEPJIKPUYJXFA-UHFFFAOYSA-N 0.000 claims 2
- QGSHAMAHIOROLP-UHFFFAOYSA-N 1,8-bis(prop-2-ynoxy)octane Chemical compound C#CCOCCCCCCCCOCC#C QGSHAMAHIOROLP-UHFFFAOYSA-N 0.000 claims 2
- KWDBJDVTWBCIOU-UHFFFAOYSA-N 1,9-bis(prop-2-ynoxy)nonane Chemical compound C#CCOCCCCCCCCCOCC#C KWDBJDVTWBCIOU-UHFFFAOYSA-N 0.000 claims 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 abstract description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 abstract description 8
- 238000006243 chemical reaction Methods 0.000 abstract description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 abstract description 4
- 229910052783 alkali metal Inorganic materials 0.000 abstract description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract description 3
- 150000001342 alkaline earth metals Chemical class 0.000 abstract description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 abstract description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 abstract description 2
- 150000001408 amides Chemical class 0.000 abstract description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 abstract description 2
- 150000004678 hydrides Chemical class 0.000 abstract description 2
- 229910052751 metal Inorganic materials 0.000 abstract 2
- 239000002184 metal Substances 0.000 abstract 2
- 101000653791 Bos taurus Protein S100-A12 Proteins 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 abstract 1
- 238000011065 in-situ storage Methods 0.000 abstract 1
- 239000002917 insecticide Substances 0.000 abstract 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- 239000012141 concentrate Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- -1 polyethylene Polymers 0.000 description 4
- 235000013601 eggs Nutrition 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 241000018137 Trialeurodes vaporariorum Species 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- GHLKSLMMWAKNBM-UHFFFAOYSA-N dodecane-1,12-diol Chemical compound OCCCCCCCCCCCCO GHLKSLMMWAKNBM-UHFFFAOYSA-N 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- 239000002035 hexane extract Substances 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- GTQHJCOHNAFHRE-UHFFFAOYSA-N 1,10-dibromodecane Chemical compound BrCCCCCCCCCCBr GTQHJCOHNAFHRE-UHFFFAOYSA-N 0.000 description 1
- YFDKVXNMRLLVSL-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid;sodium Chemical compound [Na].CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O YFDKVXNMRLLVSL-UHFFFAOYSA-N 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 241001425390 Aphis fabae Species 0.000 description 1
- 241000238421 Arthropoda Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 241000258937 Hemiptera Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000721621 Myzus persicae Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241001454295 Tetranychidae Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- SMLHHBQGIJMAIM-UHFFFAOYSA-N calcium;2-dodecylbenzenesulfonic acid Chemical compound [Ca].CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O SMLHHBQGIJMAIM-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- DMSZORWOGDLWGN-UHFFFAOYSA-N ctk1a3526 Chemical compound NP(N)(N)=O DMSZORWOGDLWGN-UHFFFAOYSA-N 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 230000003054 hormonal effect Effects 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000010815 organic waste Substances 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1183474A CH602007A5 (member.php) | 1974-08-30 | 1974-08-30 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE41516L IE41516L (en) | 1976-02-29 |
| IE41516B1 true IE41516B1 (en) | 1980-01-16 |
Family
ID=4377352
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1845/75A IE41516B1 (en) | 1974-08-30 | 1975-08-22 | Propargyl ethers |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS5152109A (member.php) |
| BE (1) | BE832883A (member.php) |
| CH (1) | CH602007A5 (member.php) |
| DE (1) | DE2536141A1 (member.php) |
| DK (1) | DK390175A (member.php) |
| FR (1) | FR2283117A1 (member.php) |
| GB (1) | GB1472839A (member.php) |
| IE (1) | IE41516B1 (member.php) |
| IT (1) | IT1044003B (member.php) |
| LU (1) | LU73269A1 (member.php) |
| NL (1) | NL7508899A (member.php) |
| SE (1) | SE7509536L (member.php) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0005710A3 (de) * | 1978-05-31 | 1980-04-16 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Propinyloxymethyl-derivat, Herstellung dieser Verbindung sowie Schädlingsbekämpfungsmittel, die diese Verbindung beziehungsweise ein Analoges enthalten und die Verwendung beider Verbindungen als Schädlingsbekämpfungsmittel |
-
1974
- 1974-08-30 CH CH1183474A patent/CH602007A5/xx not_active IP Right Cessation
-
1975
- 1975-07-16 IT IT25466/75A patent/IT1044003B/it active
- 1975-07-25 NL NL7508899A patent/NL7508899A/xx not_active Application Discontinuation
- 1975-08-13 DE DE19752536141 patent/DE2536141A1/de not_active Withdrawn
- 1975-08-22 IE IE1845/75A patent/IE41516B1/en unknown
- 1975-08-27 SE SE7509536A patent/SE7509536L/xx unknown
- 1975-08-28 JP JP50104487A patent/JPS5152109A/ja active Pending
- 1975-08-28 FR FR7526510A patent/FR2283117A1/fr active Granted
- 1975-08-28 LU LU73269A patent/LU73269A1/xx unknown
- 1975-08-29 GB GB3574275A patent/GB1472839A/en not_active Expired
- 1975-08-29 DK DK390175A patent/DK390175A/da unknown
- 1975-08-29 BE BE159577A patent/BE832883A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH602007A5 (member.php) | 1978-07-14 |
| IE41516L (en) | 1976-02-29 |
| DK390175A (da) | 1976-03-01 |
| FR2283117B1 (member.php) | 1978-12-08 |
| SE7509536L (sv) | 1976-03-01 |
| FR2283117A1 (fr) | 1976-03-26 |
| DE2536141A1 (de) | 1976-03-11 |
| LU73269A1 (member.php) | 1977-04-20 |
| JPS5152109A (member.php) | 1976-05-08 |
| BE832883A (fr) | 1976-03-01 |
| NL7508899A (nl) | 1976-03-02 |
| GB1472839A (en) | 1977-05-11 |
| IT1044003B (it) | 1980-02-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0360417A2 (en) | Derivatives of 4-fluoroanthranilic acid and their use as fungicides | |
| US4238405A (en) | Fungicidal 1,2-dichlorocyanovinyl compounds | |
| RO112869B1 (ro) | Derivati de triazolopirimidine, procedeu pentru preparare, compozitii si metoda de combatere a fungilor | |
| GB2173791A (en) | Fungicidal cyano oximes | |
| IE41516B1 (en) | Propargyl ethers | |
| DE2202016A1 (de) | Neue aliphatische diolefinische Verbindungen und Verfahren zu ihrer Herstellung und Verwendung | |
| GB2081700A (en) | Method of regulating plant growth | |
| US4486220A (en) | 6-Oxatricyclo[3.2.1.13,8 ]nonan-4-ol ethers and compositions and methods for the regulation of plant growth | |
| US2818425A (en) | 4-(chlorophenoxy) valeric acids | |
| HU176584B (en) | Herbicide preparation containing of active mateirals of two types | |
| US3562292A (en) | N-substituted phthalimides | |
| US4137329A (en) | Insecticidal propargyl ethers | |
| US3705177A (en) | Substituted propiolophenone compounds | |
| US4992471A (en) | Molluscicides | |
| EP0001292B1 (de) | Halogenalkyldithiophosphorsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung in Schädlingsbekämpfungsmitteln | |
| US3637800A (en) | Polychloro- or bromomucononitrile | |
| US4512995A (en) | Phenoxyalkenylpyridine derivatives and fungicidal methods of use | |
| US3538229A (en) | Fungicidal composition and method containing alpha-halosulfonium ylids and alpha-halosulfonium salts | |
| US3737457A (en) | Process for making compounds containing the sulfonyl cyanide group | |
| US3452016A (en) | Substituted trihalopyrazines | |
| US4382948A (en) | 1,3,4-Trisubstituted-2-pyrazolin-5-one fungicides | |
| US3557150A (en) | Benzopyranyl carbamates | |
| US4162328A (en) | Cyclopropane carboxylic acid esters | |
| EP0066771B1 (de) | 1-Iod-1-propin-3-ole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Pflanzenschutzmittel | |
| US3415883A (en) | alpha-halosulfonium ylids and alpha-halosulfonium salts |