IE41173B1 - Fungicidal agent - Google Patents
Fungicidal agentInfo
- Publication number
- IE41173B1 IE41173B1 IE1428/75A IE142875A IE41173B1 IE 41173 B1 IE41173 B1 IE 41173B1 IE 1428/75 A IE1428/75 A IE 1428/75A IE 142875 A IE142875 A IE 142875A IE 41173 B1 IE41173 B1 IE 41173B1
- Authority
- IE
- Ireland
- Prior art keywords
- dimethylbutan
- phenylphenoxy
- triazolyl
- phenoxy
- phenyl
- Prior art date
Links
- 239000000417 fungicide Substances 0.000 title 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 abstract 3
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical group C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 abstract 2
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 abstract 1
- ULSAJQMHTGKPIY-UHFFFAOYSA-N 1-chloro-3,3-dimethylbutan-2-one Chemical compound CC(C)(C)C(=O)CCl ULSAJQMHTGKPIY-UHFFFAOYSA-N 0.000 abstract 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 239000012043 crude product Substances 0.000 abstract 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/02—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings
- C07D275/03—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/20—Unsaturated compounds containing keto groups bound to acyclic carbon atoms
- C07C49/255—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D327/00—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms
- C07D327/02—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms one oxygen atom and one sulfur atom
- C07D327/04—Five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2431073A DE2431073A1 (de) | 1974-06-28 | 1974-06-28 | Fungizides mittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE41173L IE41173L (en) | 1975-12-28 |
| IE41173B1 true IE41173B1 (en) | 1979-11-07 |
Family
ID=5919183
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1428/75A IE41173B1 (en) | 1974-06-28 | 1975-06-27 | Fungicidal agent |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4053616A (enExample) |
| JP (1) | JPS5119128A (enExample) |
| BE (1) | BE830661A (enExample) |
| BR (1) | BR7503992A (enExample) |
| CH (1) | CH578301A5 (enExample) |
| CS (1) | CS175397B2 (enExample) |
| DD (1) | DD121262A5 (enExample) |
| DE (1) | DE2431073A1 (enExample) |
| DK (1) | DK136842C (enExample) |
| FR (1) | FR2275997A1 (enExample) |
| GB (1) | GB1448974A (enExample) |
| IE (1) | IE41173B1 (enExample) |
| IL (1) | IL47562A0 (enExample) |
| KE (1) | KE2711A (enExample) |
| LU (1) | LU72834A1 (enExample) |
| MY (1) | MY7700257A (enExample) |
| NO (1) | NO752113L (enExample) |
| OA (1) | OA05040A (enExample) |
| SE (1) | SE7507347L (enExample) |
| TR (1) | TR18507A (enExample) |
| ZA (1) | ZA754112B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4178383A (en) | 1976-05-28 | 1979-12-11 | Bayer Aktiengesellschaft | Fungicidally active oxime-ethers of isonitrosocyanoacetamides |
| DE2713777C3 (de) * | 1977-03-29 | 1979-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von l-Azolyl-33-dimethyl-l-phenoxy-butan-2-onen |
| DE2745827A1 (de) * | 1977-10-12 | 1979-04-26 | Basf Ag | Phenylazophenyloxy-triazolylverbindungen |
| DE2832234A1 (de) * | 1978-07-21 | 1980-01-31 | Bayer Ag | Alpha -azolyl-keto-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| EP0007707A1 (en) * | 1978-07-27 | 1980-02-06 | Imperial Chemical Industries Plc | 1,3-Diazol- and 1,2,4-triazol-derivatives, processes for their preparation, pesticidal compositions containing them and methods of combating pests |
| DE2846038A1 (de) * | 1978-10-23 | 1980-05-08 | Basf Ag | 1,2,4-triazolderivate, ihre herstellung und verwendung |
| DE3019049A1 (de) * | 1980-05-19 | 1981-12-03 | Basf Ag, 6700 Ludwigshafen | Neue azolverbindungen |
| DE3208142A1 (de) * | 1982-03-06 | 1983-09-08 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
| US4642385A (en) * | 1985-11-19 | 1987-02-10 | Mobay Corporation | Preparation of monochloropinacolone |
| WO1988007813A1 (en) * | 1987-04-14 | 1988-10-20 | Greencare Pty. Limited | Soil spreader |
| RU2363157C1 (ru) * | 2008-03-24 | 2009-08-10 | Федеральное государственное образовательное учреждение высшего профессионального образования "Горский государственный аграрный университет" | Способ защиты зерна от болезней при хранении |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3912752A (en) * | 1972-01-11 | 1975-10-14 | Bayer Ag | 1-Substituted-1,2,4-triazoles |
-
1974
- 1974-06-28 DE DE2431073A patent/DE2431073A1/de active Pending
-
1975
- 1975-05-22 GB GB2226875A patent/GB1448974A/en not_active Expired
- 1975-06-06 SE SE7507347A patent/SE7507347L/xx unknown
- 1975-06-11 US US05/586,122 patent/US4053616A/en not_active Expired - Lifetime
- 1975-06-13 NO NO752113A patent/NO752113L/no unknown
- 1975-06-19 CS CS4359A patent/CS175397B2/cs unknown
- 1975-06-25 IL IL47562A patent/IL47562A0/xx unknown
- 1975-06-26 CH CH832275A patent/CH578301A5/xx not_active IP Right Cessation
- 1975-06-26 BE BE157696A patent/BE830661A/xx unknown
- 1975-06-26 BR BR5135/75D patent/BR7503992A/pt unknown
- 1975-06-26 LU LU72834A patent/LU72834A1/xx unknown
- 1975-06-26 TR TR18507A patent/TR18507A/xx unknown
- 1975-06-27 FR FR7520316A patent/FR2275997A1/fr not_active Withdrawn
- 1975-06-27 ZA ZA00754112A patent/ZA754112B/xx unknown
- 1975-06-27 JP JP50079480A patent/JPS5119128A/ja active Pending
- 1975-06-27 DK DK293975A patent/DK136842C/da active
- 1975-06-27 IE IE1428/75A patent/IE41173B1/xx unknown
- 1975-06-27 OA OA55539A patent/OA05040A/xx unknown
- 1975-06-27 DD DD186943A patent/DD121262A5/xx unknown
-
1977
- 1977-03-15 KE KE2711A patent/KE2711A/xx unknown
- 1977-12-30 MY MY257/77A patent/MY7700257A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| TR18507A (tr) | 1977-03-04 |
| DE2431073A1 (de) | 1976-01-15 |
| DK136842C (da) | 1978-07-03 |
| AU8256275A (en) | 1977-01-06 |
| IE41173L (en) | 1975-12-28 |
| KE2711A (en) | 1977-04-01 |
| BE830661A (fr) | 1975-12-29 |
| BR7503992A (pt) | 1976-06-29 |
| ZA754112B (en) | 1976-06-30 |
| DD121262A5 (enExample) | 1976-07-20 |
| LU72834A1 (enExample) | 1976-04-13 |
| CH578301A5 (enExample) | 1976-08-13 |
| DK136842B (da) | 1977-12-05 |
| DK293975A (da) | 1975-12-29 |
| SE7507347L (sv) | 1975-12-29 |
| FR2275997A1 (fr) | 1976-01-23 |
| NO752113L (enExample) | 1975-12-30 |
| CS175397B2 (enExample) | 1977-05-31 |
| IL47562A0 (en) | 1975-08-31 |
| GB1448974A (en) | 1976-09-08 |
| OA05040A (fr) | 1980-12-31 |
| MY7700257A (en) | 1977-12-31 |
| JPS5119128A (enExample) | 1976-02-16 |
| US4053616A (en) | 1977-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES8307004A1 (es) | Procedimiento para la obtencion de fenoxifenil-azol-metilcetonas y-carbinoles. | |
| IE42064L (en) | Triazole derivatives | |
| IE41173B1 (en) | Fungicidal agent | |
| GB1330546A (en) | Benzyl-azoles their production and their use as medicines | |
| US3870726A (en) | Derivatives of 3-azolylpropyne and processes for their preparation and use | |
| IE39237L (en) | Azolyl - amidines | |
| GB1437930A (en) | 1-propyl-1,2-4-triazolyl derivatives and their salts their prepa ration and their use as fungicides | |
| KR840005719A (ko) | 트리아졸 유도체의 제조방법 | |
| IE791407L (en) | 1-(2-aryl-1,3-dioxan-2-ylmethyl)-1h-imidazoles and¹1h-1,2,4-triazoles | |
| GB1334348A (en) | Fungicidal or bactericidal composition and method | |
| ZA985405B (en) | The preparation of substituted pyrazoles. | |
| GB1369148A (en) | Insecticidal and acaricidal organotin compounds | |
| KR840000529A (ko) | 인돌 유도체의 제조방법 | |
| US4489085A (en) | Antimicrobial agents and their use employing imidazolyl-enal ethers | |
| GB1475858A (en) | Diaryloxytriazolyl-o,n-acetals and their use as fungicides | |
| AU562814B2 (en) | 1,1-diaryl-2-triazol-1-yl (diazol-1-yl)-ethanes | |
| GB1466020A (en) | Imidazolyl-1-ether ketone and its salts a process for their preparation and their use as medicaments | |
| GB1432816A (en) | Pharmaceutical antimycotic compositions medicaments and method | |
| ATE6367T1 (de) | Verfahren zur herstellung von 1h-1,2,4-triazol. | |
| GB1564371A (en) | Antimicrobial agents containing imidazole derivatives | |
| GB1529573A (en) | Photographic silver halide material containing 2-equivalent yellow coupler | |
| US3987180A (en) | 1-propyl-imidazolyl antimycotic compositions and methods of treating mycoses | |
| KE2991A (en) | An ether of 1-(2-hydroxyethyl)-3-methyl-pyrazolin-5-one processes for its preparation and its use as an antithrombotic agent | |
| NZ192129A (en) | Diastereomeric forms of 1-(4-chlorophenoxy)-1-(1-imidazolyl)-3,3-dimethyl-2-butanol pharmaceutical compositions | |
| KR850005422A (ko) | 트리아졸 유도체의 제조방법 |