IE38686B1 - 3-hydrazonomethyl rifamycin sv - Google Patents
3-hydrazonomethyl rifamycin svInfo
- Publication number
- IE38686B1 IE38686B1 IE77/73A IE7773A IE38686B1 IE 38686 B1 IE38686 B1 IE 38686B1 IE 77/73 A IE77/73 A IE 77/73A IE 7773 A IE7773 A IE 7773A IE 38686 B1 IE38686 B1 IE 38686B1
- Authority
- IE
- Ireland
- Prior art keywords
- hydrazonomethyl
- rifamycin
- us3862934a
- desacetyl
- following formula
- Prior art date
Links
- HJYYPODYNSCCOU-ODRIEIDWSA-N rifamycin SV Chemical compound OC1=C(C(O)=C2C)C3=C(O)C=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O HJYYPODYNSCCOU-ODRIEIDWSA-N 0.000 title abstract 2
- 229940109171 rifamycin sv Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2091172 | 1972-02-23 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE38686L IE38686L (en) | 1973-08-23 |
| IE38686B1 true IE38686B1 (en) | 1978-05-10 |
Family
ID=11173941
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE77/73A IE38686B1 (en) | 1972-02-23 | 1973-01-18 | 3-hydrazonomethyl rifamycin sv |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US3862934A (enExample) |
| JP (1) | JPS5128640B2 (enExample) |
| AR (1) | AR194871A1 (enExample) |
| AT (1) | AT320858B (enExample) |
| AU (1) | AU467732B2 (enExample) |
| BE (1) | BE794100A (enExample) |
| CA (1) | CA998999A (enExample) |
| CH (1) | CH555331A (enExample) |
| CS (1) | CS168630B2 (enExample) |
| DD (1) | DD104516A5 (enExample) |
| DE (1) | DE2302567C3 (enExample) |
| DK (1) | DK134486B (enExample) |
| ES (1) | ES411969A1 (enExample) |
| FR (1) | FR2181755B1 (enExample) |
| GB (1) | GB1366283A (enExample) |
| HU (1) | HU164928B (enExample) |
| IE (1) | IE38686B1 (enExample) |
| IL (1) | IL41370A0 (enExample) |
| LU (1) | LU67066A1 (enExample) |
| NL (1) | NL7301278A (enExample) |
| PH (1) | PH10548A (enExample) |
| RO (1) | RO62801A (enExample) |
| SE (1) | SE380020B (enExample) |
| SU (1) | SU465008A3 (enExample) |
| ZA (1) | ZA73302B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1523198A (en) * | 1976-05-28 | 1978-08-31 | Lepetit Spa | Thiazolo-rifamycin derivatives |
| US4179439A (en) * | 1977-07-01 | 1979-12-18 | Intreprinderea De Antibiotice Iasi | Rifamycins and method for their preparation |
| US4150023A (en) * | 1977-07-01 | 1979-04-17 | Intreprinderea De Antibiotice Iasi | Hydrosoluble rifamycins and process for their preparation |
| AU536524B2 (en) * | 1979-06-28 | 1984-05-10 | Gruppo Lepetit S.P.A. | Water soluble hydrozones of 3-formylifamyan |
| GB8408924D0 (en) * | 1984-04-06 | 1984-05-16 | Dobfar Spa | 3-azinomethyl rifamycins |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR208F (enExample) * | 1964-07-31 |
-
0
- BE BE794100D patent/BE794100A/xx unknown
-
1973
- 1973-01-16 GB GB229573A patent/GB1366283A/en not_active Expired
- 1973-01-16 ZA ZA730302A patent/ZA73302B/xx unknown
- 1973-01-18 IE IE77/73A patent/IE38686B1/xx unknown
- 1973-01-19 DE DE2302567A patent/DE2302567C3/de not_active Expired
- 1973-01-22 IL IL41370A patent/IL41370A0/xx unknown
- 1973-01-30 NL NL7301278A patent/NL7301278A/xx unknown
- 1973-02-06 AR AR246437A patent/AR194871A1/es active
- 1973-02-14 DK DK78873AA patent/DK134486B/da unknown
- 1973-02-16 US US333111A patent/US3862934A/en not_active Expired - Lifetime
- 1973-02-19 PH PH14357A patent/PH10548A/en unknown
- 1973-02-20 CS CS1210A patent/CS168630B2/cs unknown
- 1973-02-20 AT AT147773A patent/AT320858B/de not_active IP Right Cessation
- 1973-02-20 DD DD168956A patent/DD104516A5/xx unknown
- 1973-02-21 JP JP48021126A patent/JPS5128640B2/ja not_active Expired
- 1973-02-21 LU LU67066A patent/LU67066A1/xx unknown
- 1973-02-21 FR FR7306145A patent/FR2181755B1/fr not_active Expired
- 1973-02-21 RO RO7300073926A patent/RO62801A/ro unknown
- 1973-02-21 SU SU1884183A patent/SU465008A3/ru active
- 1973-02-22 CA CA164,394A patent/CA998999A/en not_active Expired
- 1973-02-22 CH CH256473A patent/CH555331A/xx not_active IP Right Cessation
- 1973-02-22 HU HULE682A patent/HU164928B/hu unknown
- 1973-02-22 SE SE7302500A patent/SE380020B/xx unknown
- 1973-02-23 ES ES411969A patent/ES411969A1/es not_active Expired
- 1973-02-23 AU AU52533/73A patent/AU467732B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE380020B (enExample) | 1975-10-27 |
| DE2302567C3 (de) | 1981-02-12 |
| DE2302567A1 (de) | 1973-08-30 |
| IL41370A0 (en) | 1973-03-30 |
| AU5253373A (en) | 1974-08-29 |
| DE2302567B2 (de) | 1980-05-29 |
| ES411969A1 (es) | 1976-01-01 |
| DK134486B (da) | 1976-11-15 |
| FR2181755A1 (enExample) | 1973-12-07 |
| GB1366283A (en) | 1974-09-11 |
| SU465008A3 (ru) | 1975-03-25 |
| CS168630B2 (enExample) | 1976-06-29 |
| DD104516A5 (enExample) | 1974-03-12 |
| HU164928B (enExample) | 1974-05-28 |
| NL7301278A (enExample) | 1973-08-27 |
| PH10548A (en) | 1977-06-07 |
| AT320858B (de) | 1975-03-10 |
| BE794100A (fr) | 1973-05-16 |
| AR194871A1 (es) | 1973-08-24 |
| DK134486C (enExample) | 1977-04-18 |
| RO62801A (fr) | 1978-02-15 |
| ZA73302B (en) | 1973-10-31 |
| AU467732B2 (en) | 1975-12-11 |
| CH555331A (de) | 1974-10-31 |
| JPS5128640B2 (enExample) | 1976-08-20 |
| IE38686L (en) | 1973-08-23 |
| CA998999A (en) | 1976-10-26 |
| FR2181755B1 (enExample) | 1976-03-05 |
| LU67066A1 (enExample) | 1973-05-03 |
| US3862934A (en) | 1975-01-28 |
| JPS4896600A (enExample) | 1973-12-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE37056B1 (en) | Pyrrolo(3,4-b)pyrazine derivatives | |
| IE36725B1 (en) | Tetrazole derivatives | |
| CA1022548A (en) | Process for the preparation of 3-iminomethyl derivatives of rifamycin sv | |
| IE36878B1 (en) | Isoindoline derivatives | |
| IE40141L (en) | Benzimidazole-2-carbamate derivatives | |
| IE37688L (en) | O-(substituted) oxime derivatives of hydroxyphthalaldehydic¹acids | |
| IE40217L (en) | Preparation of chlorinated phenyl-hydroxylamines. | |
| CA1014564A (en) | Derivatives of 1,3-benzodioxole-2-carboxylic acid | |
| IE38221L (en) | Pyrimidinoheterocyclic compounds | |
| IE38686B1 (en) | 3-hydrazonomethyl rifamycin sv | |
| IE38561B1 (en) | 1,4-dithiino 2,3-cpyrrole derivatives | |
| IE37220L (en) | Pyrrolopyridine derivatives | |
| IE38190L (en) | Diaza-oxa-bicyclodecane derivatives | |
| CA1022169A (en) | 4"-0-sulfonyl erythromycin-9-0-oxime derivatives | |
| CA1033741A (en) | Derivatives of 4-hydroxy-5-azacoumarin | |
| IE40172L (en) | Acylamino - phenyl - acetamidine anthelmintics | |
| IE39813B1 (en) | 7h-indolizino 5,6,7ij)isoquinoline derivatives | |
| CA1030536A (en) | 3,9-bis-basic-ester derivatives of 7h-benz (d,e) anthracene-7-ones | |
| CA985685A (en) | Process for the preparation of 2-amino-4,5-dihydropyridine derivatives and compounds thereby produced | |
| AU478129B2 (en) | N-hydroc arbylsulfenyl derivatives of n-alkyl-n'-aryl-formamidines | |
| CA897190A (en) | Process for the preparation of the dextrorotatory, 2,2'-(ethylenediimino)-di-1-butanol | |
| AU480953B2 (en) | Amino derivatives of 2, 2-diaryl-cylopropane | |
| AU467970B2 (en) | 3-alkenyl derivatives of rifamycin sv | |
| AU6876274A (en) | N-hydroc arbylsulfenyl derivatives of n-alkyl-n'-aryl-formamidines | |
| AU6304773A (en) | Amino derivatives of 2, 2-diaryl-cylopropane |