IE38553B1 - 2-aminomethyleneindanone analgesic agents - Google Patents
2-aminomethyleneindanone analgesic agentsInfo
- Publication number
- IE38553B1 IE38553B1 IE2160/73A IE216073A IE38553B1 IE 38553 B1 IE38553 B1 IE 38553B1 IE 2160/73 A IE2160/73 A IE 2160/73A IE 216073 A IE216073 A IE 216073A IE 38553 B1 IE38553 B1 IE 38553B1
- Authority
- IE
- Ireland
- Prior art keywords
- aminomethyleneindanone
- analgesic agents
- analgesic
- agents
- us4022836a
- Prior art date
Links
- HJOUSWJOPKLCGA-UHFFFAOYSA-N 2-(aminomethylidene)-3h-inden-1-one Chemical compound C1=CC=C2C(=O)C(=CN)CC2=C1 HJOUSWJOPKLCGA-UHFFFAOYSA-N 0.000 title abstract 2
- 239000000730 antalgic agent Substances 0.000 title 1
- 230000000202 analgesic effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/02—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton
- C07C225/14—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated
- C07C225/16—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings
- C07C225/18—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings the carbon skeleton containing also rings other than six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/312,693 US4022836A (en) | 1972-12-06 | 1972-12-06 | 2-Aminomethyleneindanone analgesic agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE38553L IE38553L (en) | 1974-06-06 |
| IE38553B1 true IE38553B1 (en) | 1978-04-12 |
Family
ID=23212586
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2160/73A IE38553B1 (en) | 1972-12-06 | 1973-11-29 | 2-aminomethyleneindanone analgesic agents |
Country Status (20)
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4117012A (en) * | 1972-12-06 | 1978-09-26 | Pfizer Inc. | 2-aminomethyleneindanone analgesic agents |
| US4164514A (en) * | 1972-12-06 | 1979-08-14 | Pfizer Inc. | 2-Aminomethyleneindanone analgesic agents |
| US4334085A (en) * | 1978-09-14 | 1982-06-08 | Standard Oil Company (Indiana) | Transamination process for Mannich products |
| NZ209534A (en) * | 1983-09-30 | 1987-01-23 | Surgikos Inc | Antimicrobial fabric for surgical drape |
| US6369289B1 (en) | 2000-07-07 | 2002-04-09 | Tyco Healthcare Group Lp | Method and manufacture of a wound dressing for covering an open wound |
| AU2002322720B2 (en) | 2001-07-25 | 2008-11-13 | Raptor Pharmaceutical Inc. | Compositions and methods for modulating blood-brain barrier transport |
| DK1889198T3 (da) | 2005-04-28 | 2015-02-09 | Proteus Digital Health Inc | Farma-informatiksystem |
| CA2663377A1 (en) | 2006-09-18 | 2008-03-27 | Raptor Pharmaceutical Inc. | Treatment of liver disorders by administration of receptor-associated protein (rap)-conjugates |
| CN104208718B (zh) | 2009-02-20 | 2017-12-29 | 2-Bbb医疗股份有限公司 | 基于谷胱甘肽的药物递送系统 |
| KR20190116576A (ko) | 2009-05-06 | 2019-10-14 | 라보라토리 스킨 케어, 인크. | 활성제-칼슘 포스페이트 입자 복합체를 포함하는 피부 전달 조성물 및 이들을 이용하는 방법 |
| US20120077778A1 (en) | 2010-09-29 | 2012-03-29 | Andrea Bourdelais | Ladder-Frame Polyether Conjugates |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3454565A (en) * | 1966-10-05 | 1969-07-08 | American Cyanamid Co | Novel indanones |
-
1972
- 1972-12-06 US US05/312,693 patent/US4022836A/en not_active Expired - Lifetime
-
1973
- 1973-01-01 AR AR251362A patent/AR207946A1/es active
- 1973-11-26 GB GB5483073A patent/GB1448026A/en not_active Expired
- 1973-11-28 ZA ZA739052A patent/ZA739052B/xx unknown
- 1973-11-29 IE IE2160/73A patent/IE38553B1/xx unknown
- 1973-11-29 IL IL43722A patent/IL43722A/en unknown
- 1973-12-03 CA CA187,227A patent/CA1002068A/en not_active Expired
- 1973-12-03 DE DE2360096A patent/DE2360096C2/de not_active Expired
- 1973-12-04 AT AT1013873A patent/AT326646B/de not_active IP Right Cessation
- 1973-12-04 FR FR7343232A patent/FR2209565B1/fr not_active Expired
- 1973-12-05 NL NLAANVRAGE7316663,A patent/NL172057C/xx not_active IP Right Cessation
- 1973-12-05 NO NO4652/73A patent/NO137858C/no unknown
- 1973-12-05 SE SE7316447A patent/SE405851B/xx unknown
- 1973-12-05 DK DK657173AA patent/DK139575B/da unknown
- 1973-12-05 PH PH15292A patent/PH10690A/en unknown
- 1973-12-05 CH CH1704473A patent/CH584677A5/xx not_active IP Right Cessation
- 1973-12-05 ES ES421167A patent/ES421167A1/es not_active Expired
- 1973-12-06 LU LU68950A patent/LU68950A1/xx unknown
- 1973-12-06 BE BE1005561A patent/BE808275A/xx unknown
- 1973-12-06 JP JP13575773A patent/JPS5542066B2/ja not_active Expired
-
1977
- 1977-01-27 US US05/763,241 patent/US4064272A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU469805B2 (en) | Enzymes | |
| IE38553B1 (en) | 2-aminomethyleneindanone analgesic agents | |
| CA972993A (en) | Ophthalmoscope | |
| CA960666A (en) | 1-aminomethyl-2,2-diaryl-cyclo-propanecarboxamides | |
| AU473444B2 (en) | Therapeutic agents | |
| CA1013742A (en) | Azabenzo-1,5-diazepines | |
| AU477308B2 (en) | 10-alkoxy-4h-benzo [4,5] cyclogepta [1,2-b] thiophen-4-ones | |
| AU476754B2 (en) | 6h-dibenzo [b,d] pyran-6-ones | |
| AU467008B2 (en) | d, d-DIARYLIMIDAZOLE-2-METHANOLS | |
| AU444851B2 (en) | Gutter-fascia construction | |
| AU5426873A (en) | n-SUBSTITUTED AMIDOXIME-O-CARBAMATES AS ANTIHYPENRTENSIVE AGENTS | |
| AU486913B2 (en) | Novel drug composition having antidlabetic activity | |
| CA913386A (en) | Alloying steels | |
| CA902041A (en) | 6-substituted-13-polycarbonalkyl-18,19-dinorpregn-4-en-3-ones | |
| AU477938B2 (en) | 1-aminomethyl-2, 2-diarylcyclopropane-carboxamide | |
| CA897168A (en) | S,s-dialkyl-amido-dithiophosphates | |
| CA916123A (en) | Maintaining catalyst activity | |
| CA902050A (en) | Adamantylalkylaminoalkyl benzamides | |
| AU488585B2 (en) | Therapeutic agents | |
| CA902078A (en) | Therapeutic agents | |
| CA905427A (en) | 2-hydrocarbyl-1,4-butanediols | |
| CA1000272A (en) | 2',3',5'-tri-o-nicotinoyl-4-thiouridine | |
| CA893174A (en) | N-(p-substituted-aminophenyl)-alkylenimine | |
| CA988037A (en) | Tractor | |
| CA904865A (en) | Benzyl cyano-acetals |