IE37956B1 - 1,4-ethano-2,3-dihydroquinoline derivatives - Google Patents
1,4-ethano-2,3-dihydroquinoline derivativesInfo
- Publication number
- IE37956B1 IE37956B1 IE1287/73A IE128773A IE37956B1 IE 37956 B1 IE37956 B1 IE 37956B1 IE 1287/73 A IE1287/73 A IE 1287/73A IE 128773 A IE128773 A IE 128773A IE 37956 B1 IE37956 B1 IE 37956B1
- Authority
- IE
- Ireland
- Prior art keywords
- ethano
- dihydroquinoline
- dihydroquinoline derivatives
- derivatives
- us3917611a
- Prior art date
Links
- RNFRFPSSWGWDKI-UHFFFAOYSA-N benzoquinuclidine Chemical class C12=CC=CC=C2N2CCC1CC2 RNFRFPSSWGWDKI-UHFFFAOYSA-N 0.000 title 1
- GVIFNHCZLSWKLY-UHFFFAOYSA-N 1-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-8-amine Chemical compound C12=CC=CC=C2C2(N)CCN1CC2 GVIFNHCZLSWKLY-UHFFFAOYSA-N 0.000 abstract 1
- AZPORFXOJFFPOK-UHFFFAOYSA-N N-methyl-1-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-8-amine Chemical compound C12=CC=CC=C2C2(NC)CCN1CC2 AZPORFXOJFFPOK-UHFFFAOYSA-N 0.000 abstract 1
- 230000000202 analgesic effect Effects 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/06—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing isoquinuclidine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/22—Bridged ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7227741A FR2194419A1 (en) | 1972-08-01 | 1972-08-01 | 4 Methyl amino 1,4 ethano 2,3 dihydro quinoline - as analgesics |
| FR7246610A FR2212139A1 (en) | 1972-12-28 | 1972-12-28 | 4 Methyl amino 1,4 ethano 2,3 dihydro quinoline - as analgesics |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE37956L IE37956L (en) | 1974-02-01 |
| IE37956B1 true IE37956B1 (en) | 1977-11-23 |
Family
ID=26217256
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1287/73A IE37956B1 (en) | 1972-08-01 | 1973-07-30 | 1,4-ethano-2,3-dihydroquinoline derivatives |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3917611A (enExample) |
| JP (1) | JPS4945099A (enExample) |
| AR (1) | AR199792A1 (enExample) |
| AT (1) | AT327907B (enExample) |
| AU (1) | AU469505B2 (enExample) |
| CA (1) | CA996559A (enExample) |
| DE (1) | DE2339024A1 (enExample) |
| GB (1) | GB1382785A (enExample) |
| HU (1) | HU166621B (enExample) |
| IE (1) | IE37956B1 (enExample) |
| LU (1) | LU68133A1 (enExample) |
| NL (1) | NL7310294A (enExample) |
| SE (1) | SE383518B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4654336A (en) * | 1985-04-22 | 1987-03-31 | Hoechst-Roussel Pharmaceuticals Inc. | Ethanobenzazepines |
| CN104447451B (zh) * | 2014-11-13 | 2017-01-18 | 广东东阳光药业有限公司 | 一种奥司他韦中间体的新制备方法 |
-
1973
- 1973-07-24 NL NL7310294A patent/NL7310294A/xx not_active Application Discontinuation
- 1973-07-30 AU AU58701/73A patent/AU469505B2/en not_active Expired
- 1973-07-30 US US383508A patent/US3917611A/en not_active Expired - Lifetime
- 1973-07-30 IE IE1287/73A patent/IE37956B1/xx unknown
- 1973-07-30 HU HURO743A patent/HU166621B/hu unknown
- 1973-07-30 JP JP48085073A patent/JPS4945099A/ja active Pending
- 1973-07-31 GB GB3641873A patent/GB1382785A/en not_active Expired
- 1973-07-31 SE SE7310535A patent/SE383518B/xx unknown
- 1973-07-31 CA CA177,780A patent/CA996559A/fr not_active Expired
- 1973-07-31 LU LU68133A patent/LU68133A1/xx unknown
- 1973-08-01 AR AR249397A patent/AR199792A1/es active
- 1973-08-01 AT AT674673A patent/AT327907B/de not_active IP Right Cessation
- 1973-08-01 DE DE2339024A patent/DE2339024A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| AU469505B2 (en) | 1976-02-12 |
| AT327907B (de) | 1976-02-25 |
| IE37956L (en) | 1974-02-01 |
| US3917611A (en) | 1975-11-04 |
| ATA674673A (de) | 1975-05-15 |
| CA996559A (fr) | 1976-09-07 |
| NL7310294A (enExample) | 1974-02-05 |
| SE383518B (sv) | 1976-03-15 |
| AR199792A1 (es) | 1974-09-30 |
| LU68133A1 (enExample) | 1974-02-11 |
| AU5870173A (en) | 1975-01-30 |
| GB1382785A (en) | 1975-02-05 |
| DE2339024A1 (de) | 1974-02-14 |
| JPS4945099A (enExample) | 1974-04-27 |
| HU166621B (enExample) | 1975-04-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU461487B2 (en) | Substituted 1, 2, 4-triazole derivatives | |
| CA1011741A (en) | 5,6,7,8-tetrahydroquinoline-8-thiocarboxamides and related compounds | |
| CA1012534A (en) | 2,6-diaminonebularine derivatives | |
| AU463690B2 (en) | 1, 3, 4-oxadiazolone derivatives | |
| IE37956B1 (en) | 1,4-ethano-2,3-dihydroquinoline derivatives | |
| CA1010031A (en) | 6,7-benzomorphan derivatives | |
| AU477308B2 (en) | 10-alkoxy-4h-benzo [4,5] cyclogepta [1,2-b] thiophen-4-ones | |
| CA984838A (en) | N,n'-diphenyl-n-(n"-alkylcarbamoyl) formamidine derivatives | |
| CA1009666A (en) | 2,5,5-trimethyl-hepta-2,6-dienal | |
| CA1020953A (en) | 2,2,3-endo-trimethyl-7-anti-amino-norbornanes | |
| CA1023358A (en) | 1-phosphoryl-5-amino-1,2,4-triazoles | |
| AU474523B2 (en) | Substituted 9,10-dihydroanthracenes | |
| AU467306B2 (en) | 15, 16-methylene-4-oestren-17 -ols | |
| AU472337B2 (en) | 11, 12-secoprostaglandins | |
| CA991573A (en) | Microbiological reduction of 1,3-dioxo-2-alkylcycloalkanes | |
| AU459270B2 (en) | 3, 2-benzoxazepine derivatives | |
| CA959054A (en) | 2,3-benzoxazepine derivatives | |
| AU5701673A (en) | 3, 4-dialkanyloxyphenyl)-l-alanines | |
| CA914679A (en) | 5-nitrofuryl-1,2,4-oxadiazine derivatives | |
| CA911998A (en) | 18-METHYL-2.alpha.,3.alpha.-EPITHIO-5.alpha.-ANDROSTANE DERIVATIVES | |
| CA904307A (en) | 5-azatricyclo (4.3.1.1 3,8) undecane and related compounds | |
| CA907031A (en) | Substituted 1,2,4-oxadiazolidine-3,5-dione | |
| CA898805A (en) | Substituted 4,1-oxazepines | |
| AU477367B2 (en) | 7h-indolo /2,3-c/ quinolines | |
| CA894287A (en) | Polyamide-polyester dispersions having improved properties |