IE37413B1 - Heterocyclic carbamates - Google Patents
Heterocyclic carbamatesInfo
- Publication number
- IE37413B1 IE37413B1 IE427/73A IE42773A IE37413B1 IE 37413 B1 IE37413 B1 IE 37413B1 IE 427/73 A IE427/73 A IE 427/73A IE 42773 A IE42773 A IE 42773A IE 37413 B1 IE37413 B1 IE 37413B1
- Authority
- IE
- Ireland
- Prior art keywords
- sulphamoyl
- sulphone
- propyl
- carbamates
- compounds
- Prior art date
Links
- -1 Heterocyclic carbamates Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 2
- CTMMSAFINBGXIF-UHFFFAOYSA-N 1-(4-cyanophenyl)-3-(4-methylphenyl)sulfonylurea Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)NC1=CC=C(C#N)C=C1 CTMMSAFINBGXIF-UHFFFAOYSA-N 0.000 abstract 1
- MVQVNTPHUGQQHK-UHFFFAOYSA-N 3-pyridinemethanol Chemical compound OCC1=CC=CN=C1 MVQVNTPHUGQQHK-UHFFFAOYSA-N 0.000 abstract 1
- VBHPTXLJMAEQHR-UHFFFAOYSA-N 4-nitro-1-(4-nitro-2-propylphenyl)sulfanyl-2-propylbenzene Chemical compound C(CC)C1=C(C=CC(=C1)[N+](=O)[O-])SC1=C(C=C(C=C1)[N+](=O)[O-])CCC VBHPTXLJMAEQHR-UHFFFAOYSA-N 0.000 abstract 1
- ULMCIKJYCADGLX-UHFFFAOYSA-N 4-sulfamoylbenzoyl azide Chemical compound NS(=O)(=O)C1=CC=C(C(=O)N=[N+]=[N-])C=C1 ULMCIKJYCADGLX-UHFFFAOYSA-N 0.000 abstract 1
- QACQFBFJQXNBCC-UHFFFAOYSA-N C(CC)C1=C(C=CC(=C1)N)S(=O)(=O)C1=C(C=C(C=C1)N)CCC Chemical compound C(CC)C1=C(C=CC(=C1)N)S(=O)(=O)C1=C(C=C(C=C1)N)CCC QACQFBFJQXNBCC-UHFFFAOYSA-N 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical class O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 abstract 1
- KBVSHAWWGLGKAI-UHFFFAOYSA-N pyridin-3-ylmethyl carbamate Chemical class NC(=O)OCC1=CC=CN=C1 KBVSHAWWGLGKAI-UHFFFAOYSA-N 0.000 abstract 1
- 230000001119 rodenticidal effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US23501572A | 1972-03-15 | 1972-03-15 | |
| US245608A US3865931A (en) | 1972-03-15 | 1972-04-19 | Pyridyl phenyl carbamate rodenticides |
| US29869272A | 1972-10-18 | 1972-10-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE37413L IE37413L (en) | 1973-09-15 |
| IE37413B1 true IE37413B1 (en) | 1977-07-20 |
Family
ID=27398675
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE427/73A IE37413B1 (en) | 1972-03-15 | 1973-03-15 | Heterocyclic carbamates |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS5716987B2 (Sortimente) |
| AR (1) | AR195706A1 (Sortimente) |
| BG (2) | BG22994A3 (Sortimente) |
| CH (1) | CH567361A5 (Sortimente) |
| DK (1) | DK132888C (Sortimente) |
| EG (1) | EG10949A (Sortimente) |
| ES (2) | ES412668A1 (Sortimente) |
| FR (1) | FR2176069B1 (Sortimente) |
| GB (1) | GB1378993A (Sortimente) |
| IE (1) | IE37413B1 (Sortimente) |
| IL (1) | IL41775A (Sortimente) |
| IT (1) | IT981360B (Sortimente) |
| LU (1) | LU67215A1 (Sortimente) |
| NL (1) | NL7303588A (Sortimente) |
| OA (1) | OA04349A (Sortimente) |
| PH (1) | PH11641A (Sortimente) |
| RO (1) | RO62362A (Sortimente) |
| SE (1) | SE391179B (Sortimente) |
| TR (1) | TR18003A (Sortimente) |
| YU (1) | YU66773A (Sortimente) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3284461A (en) * | 1964-11-27 | 1966-11-08 | Nepera Chemical Co Inc | O-pyridylalkyl-n-alkenyl urethanes and process for their production |
-
1973
- 1973-02-12 SE SE7301959A patent/SE391179B/xx unknown
- 1973-02-23 GB GB894373A patent/GB1378993A/en not_active Expired
- 1973-02-28 AR AR246849A patent/AR195706A1/es active
- 1973-03-09 PH PH14404A patent/PH11641A/en unknown
- 1973-03-11 EG EG87/73A patent/EG10949A/xx active
- 1973-03-13 DK DK136873A patent/DK132888C/da active
- 1973-03-13 IT IT21549/73A patent/IT981360B/it active
- 1973-03-14 CH CH371873A patent/CH567361A5/xx not_active IP Right Cessation
- 1973-03-14 YU YU00667/73A patent/YU66773A/xx unknown
- 1973-03-14 LU LU67215A patent/LU67215A1/xx unknown
- 1973-03-14 IL IL41775A patent/IL41775A/en unknown
- 1973-03-14 TR TR18003A patent/TR18003A/xx unknown
- 1973-03-14 NL NL7303588A patent/NL7303588A/xx not_active Application Discontinuation
- 1973-03-14 OA OA54855A patent/OA04349A/xx unknown
- 1973-03-14 FR FR7309179A patent/FR2176069B1/fr not_active Expired
- 1973-03-15 IE IE427/73A patent/IE37413B1/xx unknown
- 1973-03-15 ES ES412668A patent/ES412668A1/es not_active Expired
- 1973-03-15 RO RO197374169A patent/RO62362A/ro unknown
- 1973-03-15 BG BG023001A patent/BG22994A3/xx unknown
- 1973-03-15 BG BG024497A patent/BG23002A3/xx unknown
-
1975
- 1975-07-16 ES ES439782A patent/ES439782A1/es not_active Expired
- 1975-11-14 JP JP13710075A patent/JPS5716987B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BG23002A3 (bg) | 1977-05-20 |
| LU67215A1 (Sortimente) | 1973-09-17 |
| DK132888C (da) | 1976-07-19 |
| OA04349A (fr) | 1980-01-31 |
| FR2176069B1 (Sortimente) | 1976-11-05 |
| ES412668A1 (es) | 1976-06-01 |
| GB1378993A (en) | 1975-01-02 |
| RO62362A (fr) | 1977-12-15 |
| IL41775A (en) | 1976-06-30 |
| YU66773A (en) | 1982-06-18 |
| PH11641A (en) | 1978-05-08 |
| JPS5191265A (Sortimente) | 1976-08-10 |
| FR2176069A1 (Sortimente) | 1973-10-26 |
| BG22994A3 (bg) | 1977-05-20 |
| ES439782A1 (es) | 1977-07-01 |
| JPS5716987B2 (Sortimente) | 1982-04-08 |
| EG10949A (en) | 1976-09-30 |
| SE391179B (sv) | 1977-02-07 |
| IL41775A0 (en) | 1973-05-31 |
| AR195706A1 (es) | 1973-10-31 |
| IT981360B (it) | 1974-10-10 |
| DK132888B (da) | 1976-02-23 |
| NL7303588A (Sortimente) | 1973-09-18 |
| IE37413L (en) | 1973-09-15 |
| CH567361A5 (Sortimente) | 1975-10-15 |
| TR18003A (tr) | 1976-08-20 |
| AU5336873A (en) | 1974-09-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EG11823A (en) | Bis-50-lalkylthio-ethylimino)-n-methylcarbamic acisulphides n.n.bi(acid a-alkylthio-ethylamino)-n-methyl carbamic as herbicides d)n,n'-sulphides | |
| IE35894B1 (en) | A substituted glutaronitrile as an antifungal agent | |
| IE44062L (en) | Heterocyclic thiourea, guanidine and 1-nitro-2, 2-¹diaminoethylene derivatives | |
| IE36124B1 (en) | Amino pyridine compounds and compositions | |
| IE37399L (en) | Salicylaldoximes; metal ligands | |
| GB1377640A (en) | Pesticides | |
| IE37413B1 (en) | Heterocyclic carbamates | |
| GB1434167A (en) | Pesticidal carbamate compounds | |
| GB1226250A (Sortimente) | ||
| ES418567A1 (es) | Un procedimiento para preparar piridimidinas 5-(fenoxi sus-tituidas)-4-amino. | |
| IE32904L (en) | Nitrofuryl quinazolines | |
| AU511993B2 (en) | Production of cyanuric acid from urea | |
| IE44731L (en) | Cephalosporins. | |
| IE831840L (en) | Cardiotonic agents | |
| IE791484L (en) | 1-(2,6-dihalobenzoyl)-3-(5-substiutted-2-pyridinyl) ureas | |
| AU539805B2 (en) | 1,1,3,5-substituted biuret compound | |
| IE36759B1 (en) | Preparation of n-(1-ethyl-alpha-pyrrolidylmethyl)-2-methoxy-5-sulfonamidobenzamide | |
| IE36330L (en) | Phenyl-pyridyl allylamines. | |
| GB1509457A (en) | Pyridine derivatives | |
| IE38791L (en) | 3-pyridylmethyl n-(heterocyclic)-carbamates; rodenticides | |
| IE41466L (en) | 2, 4-dioxo-1-pyrimidinylcephalosporin derivatives | |
| IE38155L (en) | Carbamic acid derivatives, pesticides | |
| IE33020L (en) | 2-hydroxymethyl-5-sulphamoylpyridine carbamates | |
| JPS5373567A (en) | Chromenyl nicotinate compound | |
| GB1473140A (Sortimente) |