IE35616B1 - Substituted benzimidazole parasiticides - Google Patents
Substituted benzimidazole parasiticidesInfo
- Publication number
- IE35616B1 IE35616B1 IE896/71A IE89671A IE35616B1 IE 35616 B1 IE35616 B1 IE 35616B1 IE 896/71 A IE896/71 A IE 896/71A IE 89671 A IE89671 A IE 89671A IE 35616 B1 IE35616 B1 IE 35616B1
- Authority
- IE
- Ireland
- Prior art keywords
- carbon atoms
- alkyl
- aryl
- alkenyl
- substituted
- Prior art date
Links
- 230000000590 parasiticidal effect Effects 0.000 title abstract 2
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 title 1
- 239000002297 parasiticide Substances 0.000 title 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 15
- 125000000217 alkyl group Chemical group 0.000 abstract 7
- 125000003342 alkenyl group Chemical group 0.000 abstract 3
- 229910052739 hydrogen Inorganic materials 0.000 abstract 3
- 239000001257 hydrogen Substances 0.000 abstract 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract 3
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 3
- 125000003118 aryl group Chemical group 0.000 abstract 2
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- 125000003107 substituted aryl group Chemical group 0.000 abstract 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 abstract 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical class CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 abstract 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 239000005864 Sulphur Substances 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- -1 amine salts Chemical class 0.000 abstract 1
- 230000000507 anthelmentic effect Effects 0.000 abstract 1
- 230000002141 anti-parasite Effects 0.000 abstract 1
- 239000003096 antiparasitic agent Substances 0.000 abstract 1
- 125000005110 aryl thio group Chemical group 0.000 abstract 1
- 125000004104 aryloxy group Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 239000002184 metal Substances 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- 229910052757 nitrogen Inorganic materials 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 239000000825 pharmaceutical preparation Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D235/10—Radicals substituted by halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IE2345/74*A IE35618B1 (en) | 1970-07-29 | 1971-07-15 | Benzimidazole sulphonyl chlorides |
| IE2344/74*A IE35617B1 (en) | 1970-07-29 | 1971-07-15 | Substituted benzimidazoles |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB704471*[A GB1356244A (en) | 1970-07-29 | 1970-07-29 | Substituted benzimidazole parasiticides |
| GB704471 | 1971-03-16 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE35616L IE35616L (en) | 1972-01-29 |
| IE35616B1 true IE35616B1 (en) | 1976-03-31 |
Family
ID=26241125
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE896/71A IE35616B1 (en) | 1970-07-29 | 1971-07-15 | Substituted benzimidazole parasiticides |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3823154A (esLanguage) |
| AU (1) | AU3167371A (esLanguage) |
| BE (1) | BE770442A (esLanguage) |
| BR (1) | BR7104856D0 (esLanguage) |
| CH (2) | CH564302A5 (esLanguage) |
| DD (1) | DD97201A5 (esLanguage) |
| DE (1) | DE2137508A1 (esLanguage) |
| FR (1) | FR2100960B1 (esLanguage) |
| GB (1) | GB1356244A (esLanguage) |
| IE (1) | IE35616B1 (esLanguage) |
| IL (2) | IL46256A (esLanguage) |
| NL (1) | NL7110461A (esLanguage) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4420487A (en) * | 1978-04-10 | 1983-12-13 | The Purdue Frederick Company | Diuretic and antihypertensive benzimidazoles |
| CA1126280A (en) * | 1978-04-10 | 1982-06-22 | Bola V. Shetty | Benzimidazole and benzimidazolidine derivatives with diuretic and antihypertensive activity |
| DE4237597A1 (de) * | 1992-11-06 | 1994-05-11 | Bayer Ag | Substituierte Benzimidazole |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1426887A (fr) * | 1963-02-16 | 1966-02-04 | Fisons Pest Control Ltd | Composition active renfermant un benzimidazole substitué |
| FR1469504A (fr) * | 1964-10-22 | 1967-02-17 | Fisons Pest Control Ltd | Composés insecticides |
| NL6501323A (esLanguage) * | 1965-02-02 | 1966-08-03 |
-
1970
- 1970-07-29 GB GB704471*[A patent/GB1356244A/en not_active Expired
-
1971
- 1971-07-15 IE IE896/71A patent/IE35616B1/xx unknown
- 1971-07-19 IL IL46256A patent/IL46256A/xx unknown
- 1971-07-19 IL IL37336A patent/IL37336A/en unknown
- 1971-07-23 BE BE770442A patent/BE770442A/xx unknown
- 1971-07-23 US US00165696A patent/US3823154A/en not_active Expired - Lifetime
- 1971-07-26 FR FR7127217A patent/FR2100960B1/fr not_active Expired
- 1971-07-27 DE DE19712137508 patent/DE2137508A1/de active Pending
- 1971-07-27 AU AU31673/71A patent/AU3167371A/en not_active Expired
- 1971-07-28 DD DD156794A patent/DD97201A5/xx unknown
- 1971-07-28 CH CH1113771A patent/CH564302A5/xx not_active IP Right Cessation
- 1971-07-28 CH CH1573772A patent/CH553186A/fr not_active IP Right Cessation
- 1971-07-29 BR BR4856/71A patent/BR7104856D0/pt unknown
- 1971-07-29 NL NL7110461A patent/NL7110461A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL46256A (en) | 1975-10-15 |
| IE35616L (en) | 1972-01-29 |
| FR2100960B1 (esLanguage) | 1974-11-15 |
| FR2100960A1 (esLanguage) | 1972-03-24 |
| IL37336A0 (en) | 1971-10-20 |
| NL7110461A (esLanguage) | 1972-02-01 |
| AU3167371A (en) | 1973-02-01 |
| IL37336A (en) | 1975-10-15 |
| CH564302A5 (esLanguage) | 1975-07-31 |
| BR7104856D0 (pt) | 1973-03-08 |
| GB1356244A (en) | 1974-06-12 |
| CH553186A (fr) | 1974-08-30 |
| DD97201A5 (esLanguage) | 1973-04-20 |
| DE2137508A1 (de) | 1972-02-03 |
| BE770442A (fr) | 1972-01-24 |
| US3823154A (en) | 1974-07-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1209997A (en) | Antifungal compositions | |
| IE35616B1 (en) | Substituted benzimidazole parasiticides | |
| IE800541L (en) | Ergolines | |
| GB1276277A (en) | 2-chloroethane-(thiono)-phosphonic acid amido compounds, processes for their preparation, and their use for the regulation of plant growth | |
| ES364922A1 (es) | Perfeccionamientos para la preparacion de un agente herbi- cida. | |
| IE801789L (en) | Nitrosourea derivatives. | |
| GB1296802A (esLanguage) | ||
| GB1359044A (en) | Quinoline derivatives | |
| GB1433916A (en) | Thiophosphoric acid amides as nematocides insecticides and acaricides | |
| GB1252487A (esLanguage) | ||
| GB1355849A (en) | Phthalamic acid derivatives | |
| GB1244610A (en) | Dithiacycloheptylidene derivatives and pesticidal uses thereof | |
| GB1244414A (en) | Substituted carbamates and their pesticidal use | |
| GB1249268A (en) | Carboxamides and compositions containing the same | |
| GB1289085A (esLanguage) | ||
| GB1264197A (esLanguage) | ||
| GB1186911A (en) | Novel Phosphorus-Containing 2-Imino-1,3-Dithioles | |
| GB1421559A (en) | Cyclic phosphorus derivatives having pharmaceutical properties | |
| GB1321368A (en) | Organo-phosphorus compounds useful for the control of helminths in warm-blooded animals | |
| JPS5569569A (en) | Carcinostatic | |
| IE33893L (en) | Insecticidal agents; substituted benzene derivatives | |
| GB1314186A (en) | Phosphoric acid esters their manjfacture and use in pesticides | |
| GB1244124A (en) | Urea derivatives, their manufacture and use as herbicides | |
| GB1358183A (en) | Organic phosphorus pesticides | |
| IE32420L (en) | Naphthacene derivatives |