HUP9900951A3 - Process for producing tamoxifen and analogues thereof - Google Patents
Process for producing tamoxifen and analogues thereofInfo
- Publication number
- HUP9900951A3 HUP9900951A3 HU9900951A HUP9900951A HUP9900951A3 HU P9900951 A3 HUP9900951 A3 HU P9900951A3 HU 9900951 A HU9900951 A HU 9900951A HU P9900951 A HUP9900951 A HU P9900951A HU P9900951 A3 HUP9900951 A3 HU P9900951A3
- Authority
- HU
- Hungary
- Prior art keywords
- tamoxifen
- analogues
- producing
- producing tamoxifen
- Prior art date
Links
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 title 2
- 229960001603 tamoxifen Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/14—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring
- C07C217/18—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/14—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring
- C07C217/18—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
- C07C217/20—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted by halogen atoms, by trihalomethyl, nitro or nitroso groups, or by singly-bound oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GBGB9601167.1A GB9601167D0 (en) | 1996-01-20 | 1996-01-20 | Tamoxifen and analogues thereof |
GB9618775A GB2309224B (en) | 1996-01-20 | 1996-09-09 | Tamoxifen and analogues thereof |
Publications (2)
Publication Number | Publication Date |
---|---|
HUP9900951A2 HUP9900951A2 (hu) | 1999-09-28 |
HUP9900951A3 true HUP9900951A3 (en) | 2000-02-28 |
Family
ID=26308500
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
HU9900951A HUP9900951A3 (en) | 1996-01-20 | 1997-01-20 | Process for producing tamoxifen and analogues thereof |
Country Status (8)
Country | Link |
---|---|
US (1) | US6172263B1 (hu) |
EP (1) | EP0883587A1 (hu) |
JP (1) | JP2000503315A (hu) |
AU (1) | AU725286B2 (hu) |
CA (1) | CA2243330A1 (hu) |
HU (1) | HUP9900951A3 (hu) |
NO (1) | NO311346B1 (hu) |
WO (1) | WO1997026234A1 (hu) |
Families Citing this family (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP1579857A1 (en) | 2004-03-22 | 2005-09-28 | Laboratoires Besins International | Chemically stable compositions of 4-hydroxy tamoxifen |
WO2007056215A2 (en) * | 2005-11-02 | 2007-05-18 | Cytovia, Inc. | N-aryl-thienopyrimidin-4-amines and the use thereof |
EP2465498A1 (en) * | 2010-11-23 | 2012-06-20 | Faes Farma, S.A. | Diphenyl-amine derivatives: uses, process of synthesis and pharmaceutical compositions |
US11624095B2 (en) | 2017-09-27 | 2023-04-11 | Case Western Reserve University | Method of quantifying HIV reservoirs by induced transcription based sequencing |
Family Cites Families (8)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
BE637389A (hu) | 1962-09-13 | |||
ATE25515T1 (de) * | 1983-05-24 | 1987-03-15 | Bristol Myers Co | Verfahren zur umwandlung von 1,2-diphenyl-1-(4-(2-dimethylamino-ethoxy)-phen l>-1-buten-e-isomeren zu tamoxifen-hydrochlorid. |
EP0168175B1 (en) | 1984-06-12 | 1987-11-19 | National Research Development Corporation | Preparation of tamoxifen |
ATE80152T1 (de) | 1987-04-21 | 1992-09-15 | Heumann Pharma Gmbh & Co | Stabile loesungsmitteladdukte von z-1-(p-betadimethylamino-ethoxyphenyl)-1-(p-hydroxyphenyl) 2-phenylbut-1-en. |
DE3736682A1 (de) | 1987-10-29 | 1989-05-11 | Klinge Co Chem Pharm Fab | Verfahren zur herstellung von trans-1,1,2-triphenyl-but-1-en-derivaten |
WO1995011879A1 (fr) * | 1993-10-25 | 1995-05-04 | Taiho Pharmaceutical Co., Ltd. | Procede de production de sel d'addition d'acide d'isomere z de compose de triphenylethylene |
ES2115207T3 (es) * | 1994-01-03 | 1998-06-16 | Klinge Co Chem Pharm Fab | Metodo para la produccion de e-1-(4'-(2-dimetilaminoetoxi)-fenil)-1-(3'-hidroxifenil)-2-fenil-1-buteno. |
GB9601167D0 (en) | 1996-01-20 | 1996-03-20 | Univ Bradford | Tamoxifen and analogues thereof |
-
1997
- 1997-01-20 AU AU13953/97A patent/AU725286B2/en not_active Ceased
- 1997-01-20 HU HU9900951A patent/HUP9900951A3/hu unknown
- 1997-01-20 JP JP9525793A patent/JP2000503315A/ja not_active Withdrawn
- 1997-01-20 EP EP97900379A patent/EP0883587A1/en not_active Withdrawn
- 1997-01-20 CA CA002243330A patent/CA2243330A1/en not_active Abandoned
- 1997-01-20 WO PCT/GB1997/000134 patent/WO1997026234A1/en not_active Application Discontinuation
-
1998
- 1998-07-20 US US09/118,836 patent/US6172263B1/en not_active Expired - Fee Related
- 1998-07-20 NO NO19983346A patent/NO311346B1/no unknown
Also Published As
Publication number | Publication date |
---|---|
US6172263B1 (en) | 2001-01-09 |
EP0883587A1 (en) | 1998-12-16 |
NO311346B1 (no) | 2001-11-19 |
AU725286B2 (en) | 2000-10-12 |
NO983346D0 (no) | 1998-07-20 |
WO1997026234A1 (en) | 1997-07-24 |
HUP9900951A2 (hu) | 1999-09-28 |
AU1395397A (en) | 1997-08-11 |
NO983346L (no) | 1998-09-17 |
JP2000503315A (ja) | 2000-03-21 |
CA2243330A1 (en) | 1997-07-24 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
HUP9903053A3 (en) | Tramadol multiple unit formulations and process for producing them | |
HU9702508D0 (en) | Vitronectin-receptor-antagonists and process for producing them | |
CZ11498A3 (cs) | Střela a způsob její výroby | |
HUP9603179A3 (en) | Process for producing benzyl-ethers | |
HUP9700140A3 (en) | Process for producing 0-demethyl-tramadol-enantiomeres | |
HUP9801898A3 (en) | Antipsoriatic nail-lack and process for producing it | |
HU9702509D0 (en) | Vitronectin-receptor-antagonists and process for producing them | |
GB9722771D0 (en) | A karyotyper and method for producing karyotypes | |
HUP9700380A3 (en) | Process for producing 4-oxoimidazolinium-salts | |
GR3029933T3 (en) | Process for producing n-arylhydroxylamines and n-hetarylhydroxylamines | |
HU9700212D0 (en) | Process for producing alkyl-chlorides | |
HUP0003203A3 (en) | Process for producing bisindolymalimides | |
HUP9901392A3 (en) | Process for producing felodipine | |
HUP9904325A3 (en) | Process for johexol manufacture | |
HUP9900951A3 (en) | Process for producing tamoxifen and analogues thereof | |
HUP9602960A3 (en) | Process for producing carbazates | |
HU9802054D0 (en) | Process for producing pentafluorpentanol | |
EP0990639A4 (en) | PROCESS FOR PRODUCING N-CYCLOPROPYLANILINES AND INTERMEDIATES USED IN THIS PROCESS | |
SG72861A1 (en) | Process for producing 7-octen-1-al | |
HUP9802955A3 (en) | Process for producing amino-cyano-acetamide | |
EP0990658A4 (en) | PROCESS FOR PRODUCING TRIHYDROCARBYLALUMINUMS | |
HUP9700548A2 (en) | Process for producing indenes | |
GB2309224B (en) | Tamoxifen and analogues thereof | |
HU9502227D0 (en) | 4-amino-3-hydroxy-phtalimidine and process for producing that | |
GB9610666D0 (en) | Milk-shakes and process for making them |