HU196412B - Process for production of penicillin-acid-penicillakiroloximethil-esthers - Google Patents
Process for production of penicillin-acid-penicillakiroloximethil-esthers Download PDFInfo
- Publication number
- HU196412B HU196412B HU82991A HU99182A HU196412B HU 196412 B HU196412 B HU 196412B HU 82991 A HU82991 A HU 82991A HU 99182 A HU99182 A HU 99182A HU 196412 B HU196412 B HU 196412B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- compound
- penicillanic acid
- acid
- temperature
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 12
- 238000004519 manufacturing process Methods 0.000 title claims 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 38
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 5
- 239000000460 chlorine Substances 0.000 claims abstract description 5
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims abstract 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract 2
- 229910052740 iodine Chemical group 0.000 claims abstract 2
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 claims description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 12
- 239000012442 inert solvent Substances 0.000 claims description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical group CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 150000002497 iodine compounds Chemical class 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 239000002904 solvent Substances 0.000 abstract description 10
- 230000000844 anti-bacterial effect Effects 0.000 abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 4
- 239000001257 hydrogen Substances 0.000 abstract description 4
- 230000007935 neutral effect Effects 0.000 abstract description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 2
- WNPVZANXRCPJPW-UHFFFAOYSA-N 5-[isocyano-(4-methylphenyl)sulfonylmethyl]-1,2,3-trimethoxybenzene Chemical compound COC1=C(OC)C(OC)=CC(C([N+]#[C-])S(=O)(=O)C=2C=CC(C)=CC=2)=C1 WNPVZANXRCPJPW-UHFFFAOYSA-N 0.000 abstract 1
- 125000001309 chloro group Chemical group Cl* 0.000 abstract 1
- 239000011630 iodine Chemical group 0.000 abstract 1
- YCOFRPYSZKIPBQ-UHFFFAOYSA-N penicillic acid Natural products COC1=CC(=O)OC1(O)C(C)=C YCOFRPYSZKIPBQ-UHFFFAOYSA-N 0.000 abstract 1
- VOUGEZYPVGAPBB-UHFFFAOYSA-N penicillin acid Natural products OC(=O)C=C(OC)C(=O)C(C)=C VOUGEZYPVGAPBB-UHFFFAOYSA-N 0.000 abstract 1
- -1 penicillanic acid sulfone chloromethyl ester Chemical class 0.000 description 20
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- FKENQMMABCRJMK-RITPCOANSA-N sulbactam Chemical compound O=S1(=O)C(C)(C)[C@H](C(O)=O)N2C(=O)C[C@H]21 FKENQMMABCRJMK-RITPCOANSA-N 0.000 description 8
- 108090000204 Dipeptidase 1 Proteins 0.000 description 7
- 102000006635 beta-lactamase Human genes 0.000 description 7
- 238000001727 in vivo Methods 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 5
- 230000003115 biocidal effect Effects 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 150000003952 β-lactams Chemical group 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 229940088710 antibiotic agent Drugs 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 150000003457 sulfones Chemical class 0.000 description 3
- 150000005621 tetraalkylammonium salts Chemical class 0.000 description 3
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical class CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 3
- ZXUCBXRTRRIBSO-UHFFFAOYSA-L tetrabutylazanium;sulfate Chemical compound [O-]S([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC ZXUCBXRTRRIBSO-UHFFFAOYSA-L 0.000 description 3
- 229930182555 Penicillin Natural products 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical class N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- JPOXNPPZZKNXOV-UHFFFAOYSA-N bromochloromethane Chemical compound ClCBr JPOXNPPZZKNXOV-UHFFFAOYSA-N 0.000 description 2
- PJGJQVRXEUVAFT-UHFFFAOYSA-N chloroiodomethane Chemical compound ClCI PJGJQVRXEUVAFT-UHFFFAOYSA-N 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 150000003951 lactams Chemical group 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 229940049954 penicillin Drugs 0.000 description 2
- 150000002960 penicillins Chemical class 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 1
- 229930186147 Cephalosporin Chemical class 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- 239000003781 beta lactamase inhibitor Substances 0.000 description 1
- 229940126813 beta-lactamase inhibitor Drugs 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 229940126085 β‑Lactamase Inhibitor Drugs 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US24648281A | 1981-03-23 | 1981-03-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU196412B true HU196412B (en) | 1988-11-28 |
Family
ID=22930866
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU82991A HU196412B (en) | 1981-03-23 | 1982-03-22 | Process for production of penicillin-acid-penicillakiroloximethil-esthers |
Country Status (4)
| Country | Link |
|---|---|
| JP (2) | JPS57176989A (enFirst) |
| HU (1) | HU196412B (enFirst) |
| PL (1) | PL239062A1 (enFirst) |
| ZA (1) | ZA821903B (enFirst) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4751297A (en) * | 1987-03-20 | 1988-06-14 | Pfizer Inc. | Method for preparation of azetidinone-1-oxoacetate by oxidation of the corresponding 2-hydroxyacetate |
| JPH06104671B2 (ja) * | 1990-04-13 | 1994-12-21 | ファイザー・インコーポレーテッド | スルタミシリン中間体の製造方法 |
| JP2003089481A (ja) * | 2001-09-20 | 2003-03-25 | Toshiba Elevator Co Ltd | エレベーター遠隔監視システム |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA80796B (en) * | 1979-02-13 | 1981-02-25 | Leo Pharm Prod Ltd | Chemical compounds |
-
1982
- 1982-03-22 ZA ZA821903A patent/ZA821903B/xx unknown
- 1982-03-22 HU HU82991A patent/HU196412B/hu unknown
- 1982-03-23 PL PL23906282A patent/PL239062A1/xx unknown
- 1982-03-23 JP JP57046186A patent/JPS57176989A/ja active Granted
-
1987
- 1987-06-23 JP JP62156368A patent/JPS6372693A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6372693A (ja) | 1988-04-02 |
| JPS57176989A (en) | 1982-10-30 |
| PL239062A1 (en) | 1983-05-23 |
| ZA821903B (en) | 1983-01-26 |
| JPH0446958B2 (enFirst) | 1992-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE49881B1 (en) | B-lactam intermediates | |
| US4041029A (en) | Acylimine cephalosporins | |
| JPH0470315B2 (enFirst) | ||
| FR2512448A1 (fr) | Isoquinoleinium-betaines de cephalosporine et son application pharmaceutique | |
| US4966900A (en) | Cephalosporin β-lactam compound and medicinal composition | |
| US4296236A (en) | 7-(or 6-) Substituted-7-(or 6-)acylimino cephalosporin (or penicillin) compounds | |
| EP0061313B1 (en) | Bis-esters of 1,1-alkanediols with 6-beta-hydroxymethylpenicillanic acid 1,1-dioxide and beta-lactam antibiotics | |
| EP1228074B1 (en) | Method of preparing highly pure cefpodoxime proxetil | |
| US5281589A (en) | 3-fused pyridiniummethyl cephalosporins | |
| EP0158494A1 (en) | Penam derivatives and process for preparing the same | |
| JPS643196B2 (enFirst) | ||
| KR900007183B1 (ko) | 페니실린 유도체의 제조방법 | |
| HU196412B (en) | Process for production of penicillin-acid-penicillakiroloximethil-esthers | |
| EP0061284B1 (en) | Improved process for the preparation of penicillanic acid esters | |
| US5142041A (en) | Cephalosporin intermediates | |
| US4260598A (en) | Method for increasing antibacterial effectiveness of a β-lactam antibiotic | |
| US4117126A (en) | 7-(α-(4-Hydroxy-1,5-naphthyridine-3-carbonamido)-α-phenylacetamido) cephalosporin derivatives | |
| US4102882A (en) | Process to prepare novel antibiotic compounds | |
| EP0397212B1 (en) | Process for preparing cephalosporin compounds | |
| US4447602A (en) | Process to prepare 7-substituted cephalosporins or 6-substituted penicillins | |
| US4560749A (en) | Cephem-3-imidates and 3-amidines | |
| HU205611B (en) | Process for producing 1,1-dioxo-penicillanoyl-oxy-methyl-d-6-/alpha-/methylen-amino/-phenyl-acetyl-amino/-penicillanate, salts and pharmaceutical compositions contaiing them as active components | |
| KR100228189B1 (ko) | 씨-3 위치가 치환된 세펨 유도체의 제조방법 ii | |
| EP0635509A2 (en) | Novel cephalosporin antibiotics and processes for preparation thereof | |
| MC1967A1 (fr) | Compose b-lactamine,procede pour sa preparation,intermediaire pour sa synthese,et composition pharmaceutique le contenant,pour le traitement des maladies infectieuses d'origine bacterienne |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |