HU171357B - Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty - Google Patents
Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kislotyInfo
- Publication number
- HU171357B HU171357B HU75SO00001145A HUSO001145A HU171357B HU 171357 B HU171357 B HU 171357B HU 75SO00001145 A HU75SO00001145 A HU 75SO00001145A HU SO001145 A HUSO001145 A HU SO001145A HU 171357 B HU171357 B HU 171357B
- Authority
- HU
- Hungary
- Prior art keywords
- ceph
- eme
- producing
- carboxylic acid
- acid derivatives
- Prior art date
Links
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical class OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
- C07D205/09—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4
- C07D205/095—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4 and with a nitrogen atom directly attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Document Processing Apparatus (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT23070/74A IT1043958B (it) | 1974-05-22 | 1974-05-22 | Procedimento per la preparazione di cefalosporine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU171357B true HU171357B (hu) | 1977-12-28 |
Family
ID=11203454
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU75SO00001145A HU171357B (hu) | 1974-05-22 | 1975-05-20 | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS50160291A (cs) |
| AT (1) | AT340047B (cs) |
| BE (1) | BE829304A (cs) |
| CA (1) | CA1055485A (cs) |
| DE (1) | DE2522142A1 (cs) |
| DK (1) | DK220375A (cs) |
| ES (1) | ES437842A1 (cs) |
| FR (1) | FR2279753A1 (cs) |
| GB (2) | GB1472865A (cs) |
| HU (1) | HU171357B (cs) |
| IT (1) | IT1043958B (cs) |
| NL (1) | NL170286C (cs) |
| NO (1) | NO751781L (cs) |
| SE (1) | SE7505751L (cs) |
| SU (1) | SU727147A3 (cs) |
| ZA (1) | ZA753244B (cs) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1472866A (en) * | 1974-06-12 | 1977-05-11 | Farmaceutici Italia | Cephalosporins and intermediates therefor |
| GB1576219A (en) | 1976-12-31 | 1980-10-01 | Connlab Holdings Ltd | Thiazoleneazetidinone derivatives |
| NL7806860A (nl) * | 1977-07-05 | 1979-01-09 | Farmaceutici Italia | Werkwijze voor het bereiden van met nocardicine verwan- te azetidinonen. |
| US4482491A (en) * | 1981-05-01 | 1984-11-13 | Otsuka Kagaku Yakuhin Kabushiki Kaisha | Thiazolinoazetidinone derivatives and process for the preparation of the same |
| DE3366497D1 (en) * | 1982-01-22 | 1986-11-06 | Beecham Group Plc | Antibacterial agents, their preparation and use |
-
1974
- 1974-05-22 IT IT23070/74A patent/IT1043958B/it active
-
1975
- 1975-05-16 AT AT376875A patent/AT340047B/de not_active IP Right Cessation
- 1975-05-16 NL NLAANVRAGE7505800,A patent/NL170286C/xx not_active IP Right Cessation
- 1975-05-17 DE DE19752522142 patent/DE2522142A1/de not_active Withdrawn
- 1975-05-20 ZA ZA00753244A patent/ZA753244B/xx unknown
- 1975-05-20 SE SE7505751A patent/SE7505751L/xx unknown
- 1975-05-20 FR FR7515596A patent/FR2279753A1/fr active Granted
- 1975-05-20 NO NO751781A patent/NO751781L/no unknown
- 1975-05-20 CA CA227,388A patent/CA1055485A/en not_active Expired
- 1975-05-20 GB GB2141975A patent/GB1472865A/en not_active Expired
- 1975-05-20 GB GB2841076A patent/GB1472870A/en not_active Expired
- 1975-05-20 JP JP50059355A patent/JPS50160291A/ja active Pending
- 1975-05-20 DK DK220375A patent/DK220375A/da unknown
- 1975-05-20 HU HU75SO00001145A patent/HU171357B/hu unknown
- 1975-05-21 BE BE156546A patent/BE829304A/xx not_active IP Right Cessation
- 1975-05-21 ES ES437842A patent/ES437842A1/es not_active Expired
- 1975-05-21 SU SU752133714A patent/SU727147A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| GB1472870A (en) | 1977-05-11 |
| NL170286B (nl) | 1982-05-17 |
| AT340047B (de) | 1977-11-25 |
| CA1055485A (en) | 1979-05-29 |
| FR2279753A1 (fr) | 1976-02-20 |
| GB1472865A (en) | 1977-05-11 |
| DE2522142A1 (de) | 1975-12-11 |
| DK220375A (da) | 1975-11-23 |
| BE829304A (fr) | 1975-11-21 |
| FR2279753B1 (cs) | 1979-03-16 |
| ATA376875A (de) | 1977-03-15 |
| SU727147A3 (ru) | 1980-04-05 |
| IT1043958B (it) | 1980-02-29 |
| NO751781L (cs) | 1975-11-25 |
| ES437842A1 (es) | 1977-01-01 |
| SE7505751L (sv) | 1975-11-24 |
| ZA753244B (en) | 1976-05-26 |
| AU8131975A (en) | 1976-11-25 |
| NL7505800A (nl) | 1975-11-25 |
| JPS50160291A (cs) | 1975-12-25 |
| NL170286C (nl) | 1982-10-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU174973B (hu) | Sposob poluchenija proizvodnykh 16-alkil-16-gidroksi-prostanovykh kislot | |
| HU174077B (hu) | Sposob poluchenija proizvodnykh dekapeptidamidakh | |
| HU173052B (hu) | Sposob poluchenija proizvodnykh tienil-karbamida | |
| HU172448B (hu) | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty | |
| HU174153B (hu) | Sposob poluchenija proizvodnykh 2,4,6-triiodo-bis-2,4,6-triiodo-3,5-bis-skobka-karbamoil-skobka zakryta-fenil-karbamoil-metil-amino-acetamido-5-benzojjnojj kisloty | |
| HU172039B (hu) | Sposob poluchenija proizvodnykh 2-fenil-indola | |
| HU174378B (hu) | Sposob poluchenija proizvodnykh 7-beta-acilamino-7-al'fa-alkoksi-cefem-4-karbonovojj kisloty ili 6-beta-acilamino-6-al'fa-alkoksi-penam-3-karbonovojj kisloty | |
| HU170897B (hu) | Sposob poluchenija proizvodnykh 7-skobka-n-acilamino-al'fa-aril acetamido-3-cefem-4-karbonovyki kislot | |
| HU172906B (hu) | Sposob poluchenija proizvodnykh alkil-amino-glikopiranozida | |
| HU172103B (hu) | Sposob poluchenija proizvodnykh 2-skobka-zamehhennykh-skobka zakryta-3-cianamino-3-skobka-zamehhennykh amino-skobka zakryta-propionitrilov | |
| YU40266B (en) | Process for producing thienothiazepine derivatives | |
| HU174005B (hu) | Sposob poluchenija proizvodnykh analogov prostaglandina | |
| HU173386B (hu) | Sposob poluchenija makromolekuljarnykh proizvodnykh 4-skobka-nikotinamid-adenin-dinukleotid-n-6 vverkh-skobka zakryta-3-gidroksimasljanojj kisloty | |
| HU171512B (hu) | Sposob polucsenija proizvodnykh nikotinamid-adenin-dinukleotidov | |
| HU173609B (hu) | Sposob poluchenija novykh proizvodnykh salicilanilida | |
| HU172045B (hu) | Sposob poluchenija proizvodnykh 7-acilamido-3-skobka-1,2-dvojjno zamehhennykh-1,3,4-triazol-5-il-tiometil-skobka zakryta-3-cefem-4-karbonovykh kislot | |
| HU170859B (hu) | Sposob poluchenija novykh proizvodnykh 6-skobka-al'fa-ureido-fenilacetilamido-skobka zakryta-penam-3-karbonovojj kisloty | |
| HU171513B (hu) | Sposob poluchenija proizvodnykh 7-beta-acilamino-7al'fa-alkok-icef-3-em-4-karbonovojj kisloty | |
| HU171207B (hu) | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty | |
| HU172891B (hu) | Sposob poluchenija proizvodnykh 7-amino-cef-3-em-4-karbonovojj kisloty | |
| YU165781A (en) | Process for producing penzopyran derivatives | |
| HU173651B (hu) | Sposob poluchenija proizvodnykh beta-amino-7-al'fa-metoksi-cef-3-em-4-karbonovojj kisloty | |
| HU171357B (hu) | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty | |
| YU37170B (en) | Process for obtaining penicillnic acid derivatives | |
| HU172892B (hu) | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty |