GB2291067A - Detergent Composition - Google Patents
Detergent Composition Download PDFInfo
- Publication number
- GB2291067A GB2291067A GB9414330A GB9414330A GB2291067A GB 2291067 A GB2291067 A GB 2291067A GB 9414330 A GB9414330 A GB 9414330A GB 9414330 A GB9414330 A GB 9414330A GB 2291067 A GB2291067 A GB 2291067A
- Authority
- GB
- United Kingdom
- Prior art keywords
- starch
- clay
- water
- bar
- bars
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000003599 detergent Substances 0.000 title claims abstract description 33
- 239000000203 mixture Substances 0.000 title claims description 37
- 229920002472 Starch Polymers 0.000 claims abstract description 28
- 235000019698 starch Nutrition 0.000 claims abstract description 28
- 239000008107 starch Substances 0.000 claims abstract description 27
- 239000004927 clay Substances 0.000 claims abstract description 14
- 239000000344 soap Substances 0.000 claims abstract description 12
- 240000008042 Zea mays Species 0.000 claims abstract description 6
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims abstract description 6
- 240000007594 Oryza sativa Species 0.000 claims abstract description 5
- 235000007164 Oryza sativa Nutrition 0.000 claims abstract description 5
- 235000009566 rice Nutrition 0.000 claims abstract description 5
- 229920000881 Modified starch Polymers 0.000 claims abstract description 4
- 229910021647 smectite Inorganic materials 0.000 claims abstract description 4
- 240000003183 Manihot esculenta Species 0.000 claims abstract description 3
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 claims abstract description 3
- 244000061456 Solanum tuberosum Species 0.000 claims abstract description 3
- 235000002595 Solanum tuberosum Nutrition 0.000 claims abstract description 3
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 claims abstract description 3
- 235000005822 corn Nutrition 0.000 claims abstract description 3
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 claims abstract description 3
- KWLMIXQRALPRBC-UHFFFAOYSA-L hectorite Chemical compound [Li+].[OH-].[OH-].[Na+].[Mg+2].O1[Si]2([O-])O[Si]1([O-])O[Si]([O-])(O1)O[Si]1([O-])O2 KWLMIXQRALPRBC-UHFFFAOYSA-L 0.000 claims abstract description 3
- 229910000271 hectorite Inorganic materials 0.000 claims abstract description 3
- 229910052901 montmorillonite Inorganic materials 0.000 claims abstract description 3
- 229910000275 saponite Inorganic materials 0.000 claims abstract description 3
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 claims description 3
- 235000009973 maize Nutrition 0.000 claims description 3
- -1 alkylbenzene sulphonate Chemical class 0.000 abstract description 33
- 239000000440 bentonite Substances 0.000 abstract description 12
- 229910000278 bentonite Inorganic materials 0.000 abstract description 12
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 abstract description 12
- 229910021653 sulphate ion Inorganic materials 0.000 abstract description 10
- 229910019142 PO4 Inorganic materials 0.000 abstract description 5
- 125000000217 alkyl group Chemical group 0.000 abstract description 5
- 235000014113 dietary fatty acids Nutrition 0.000 abstract description 5
- 239000000194 fatty acid Substances 0.000 abstract description 5
- 229930195729 fatty acid Natural products 0.000 abstract description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 abstract description 4
- 239000010452 phosphate Substances 0.000 abstract description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 abstract description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 abstract description 2
- 240000005979 Hordeum vulgare Species 0.000 abstract 1
- 235000007340 Hordeum vulgare Nutrition 0.000 abstract 1
- 235000021307 Triticum Nutrition 0.000 abstract 1
- 244000098338 Triticum aestivum Species 0.000 abstract 1
- SBOJXQVPLKSXOG-UHFFFAOYSA-N o-amino-hydroxylamine Chemical class NON SBOJXQVPLKSXOG-UHFFFAOYSA-N 0.000 abstract 1
- 239000011368 organic material Substances 0.000 abstract 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 239000000463 material Substances 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- 235000017550 sodium carbonate Nutrition 0.000 description 8
- 235000019832 sodium triphosphate Nutrition 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 6
- 150000002191 fatty alcohols Chemical class 0.000 description 5
- 239000000945 filler Substances 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 239000002198 insoluble material Substances 0.000 description 5
- 230000007423 decrease Effects 0.000 description 4
- 238000006386 neutralization reaction Methods 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 229910021532 Calcite Inorganic materials 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 239000008367 deionised water Substances 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000002304 perfume Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 235000010265 sodium sulphite Nutrition 0.000 description 3
- 239000001117 sulphuric acid Substances 0.000 description 3
- 235000011149 sulphuric acid Nutrition 0.000 description 3
- 244000060011 Cocos nucifera Species 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000004996 alkyl benzenes Chemical class 0.000 description 2
- 229910000323 aluminium silicate Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229940096386 coconut alcohol Drugs 0.000 description 2
- BUACSMWVFUNQET-UHFFFAOYSA-H dialuminum;trisulfate;hydrate Chemical compound O.[Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O BUACSMWVFUNQET-UHFFFAOYSA-H 0.000 description 2
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical class O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- 102000005575 Cellulases Human genes 0.000 description 1
- 108010084185 Cellulases Proteins 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 102000004882 Lipase Human genes 0.000 description 1
- 108090001060 Lipase Proteins 0.000 description 1
- 239000004367 Lipase Substances 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 159000000013 aluminium salts Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- 238000007046 ethoxylation reaction Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 235000019421 lipase Nutrition 0.000 description 1
- 208000020442 loss of weight Diseases 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 239000003605 opacifier Substances 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000007686 potassium Nutrition 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 239000001120 potassium sulphate Substances 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- HELHAJAZNSDZJO-OLXYHTOASA-L sodium L-tartrate Chemical compound [Na+].[Na+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O HELHAJAZNSDZJO-OLXYHTOASA-L 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L sodium sulphate Substances [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000001433 sodium tartrate Substances 0.000 description 1
- 229960002167 sodium tartrate Drugs 0.000 description 1
- 235000011004 sodium tartrates Nutrition 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- XGMYMWYPSYIPQB-UHFFFAOYSA-J tetrasodium;2-(1,2-dicarboxylatoethoxy)butanedioate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CC(C([O-])=O)OC(C([O-])=O)CC([O-])=O XGMYMWYPSYIPQB-UHFFFAOYSA-J 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- MPSJHIAGGNGGEZ-UHFFFAOYSA-K trisodium;2-(carboxylatomethoxy)butanedioate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)COC(C([O-])=O)CC([O-])=O MPSJHIAGGNGGEZ-UHFFFAOYSA-K 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0047—Detergents in the form of bars or tablets
- C11D17/0065—Solid detergents containing builders
- C11D17/0069—Laundry bars
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9414330A GB2291067A (en) | 1994-07-15 | 1994-07-15 | Detergent Composition |
| IN304BO1995 IN185633B (enrdf_load_stackoverflow) | 1994-07-15 | 1995-07-11 | |
| MYPI9501981 MY114774A (en) | 1994-07-15 | 1995-07-13 | Detergent composition |
| BR9503298A BR9503298A (pt) | 1994-07-15 | 1995-07-13 | Composição de barra detergente reforçada |
| CN 95115045 CN1130207A (zh) | 1994-07-15 | 1995-07-14 | 洗涤剂组合物 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9414330A GB2291067A (en) | 1994-07-15 | 1994-07-15 | Detergent Composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| GB9414330D0 GB9414330D0 (en) | 1994-09-07 |
| GB2291067A true GB2291067A (en) | 1996-01-17 |
Family
ID=10758403
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB9414330A Withdrawn GB2291067A (en) | 1994-07-15 | 1994-07-15 | Detergent Composition |
Country Status (5)
| Country | Link |
|---|---|
| CN (1) | CN1130207A (enrdf_load_stackoverflow) |
| BR (1) | BR9503298A (enrdf_load_stackoverflow) |
| GB (1) | GB2291067A (enrdf_load_stackoverflow) |
| IN (1) | IN185633B (enrdf_load_stackoverflow) |
| MY (1) | MY114774A (enrdf_load_stackoverflow) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1999013044A1 (en) * | 1997-09-10 | 1999-03-18 | Albemarle Corporation | Dish-cleaning block |
| PL442564A1 (pl) * | 2022-10-18 | 2024-04-22 | Sieć Badawcza Łukasiewicz - Instytut Ciężkiej Syntezy Organicznej Blachownia | Preparat do mycia rąk i sposób stosowania preparatu do mycia rąk |
| PL442566A1 (pl) * | 2022-10-18 | 2024-04-22 | Sieć Badawcza Łukasiewicz - Instytut Ciężkiej Syntezy Organicznej Blachownia | Preparat do mycia rąk i sposób stosowania preparatu do mycia rąk |
| PL442568A1 (pl) * | 2022-10-18 | 2024-04-22 | Sieć Badawcza Łukasiewicz - Instytut Ciężkiej Syntezy Organicznej Blachownia | Preparat do mycia rąk i sposób stosowania preparatu do mycia rąk |
| PL442562A1 (pl) * | 2022-10-18 | 2024-04-22 | Sieć Badawcza Łukasiewicz - Instytut Ciężkiej Syntezy Organicznej Blachownia | Preparat do mycia rąk i sposób stosowania preparatu do mycia rąk |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2256647A (en) * | 1991-06-13 | 1992-12-16 | Unilever Plc | Detergent composition |
-
1994
- 1994-07-15 GB GB9414330A patent/GB2291067A/en not_active Withdrawn
-
1995
- 1995-07-11 IN IN304BO1995 patent/IN185633B/en unknown
- 1995-07-13 MY MYPI9501981 patent/MY114774A/en unknown
- 1995-07-13 BR BR9503298A patent/BR9503298A/pt not_active IP Right Cessation
- 1995-07-14 CN CN 95115045 patent/CN1130207A/zh active Pending
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2256647A (en) * | 1991-06-13 | 1992-12-16 | Unilever Plc | Detergent composition |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1999013044A1 (en) * | 1997-09-10 | 1999-03-18 | Albemarle Corporation | Dish-cleaning block |
| US6035869A (en) * | 1997-09-10 | 2000-03-14 | Albemarle Corporation | Dish-washing method |
| PL442564A1 (pl) * | 2022-10-18 | 2024-04-22 | Sieć Badawcza Łukasiewicz - Instytut Ciężkiej Syntezy Organicznej Blachownia | Preparat do mycia rąk i sposób stosowania preparatu do mycia rąk |
| PL442566A1 (pl) * | 2022-10-18 | 2024-04-22 | Sieć Badawcza Łukasiewicz - Instytut Ciężkiej Syntezy Organicznej Blachownia | Preparat do mycia rąk i sposób stosowania preparatu do mycia rąk |
| PL442568A1 (pl) * | 2022-10-18 | 2024-04-22 | Sieć Badawcza Łukasiewicz - Instytut Ciężkiej Syntezy Organicznej Blachownia | Preparat do mycia rąk i sposób stosowania preparatu do mycia rąk |
| PL442562A1 (pl) * | 2022-10-18 | 2024-04-22 | Sieć Badawcza Łukasiewicz - Instytut Ciężkiej Syntezy Organicznej Blachownia | Preparat do mycia rąk i sposób stosowania preparatu do mycia rąk |
| PL245687B1 (pl) * | 2022-10-18 | 2024-09-16 | Siec Badawcza Lukasiewicz Inst Ciezkiej Syntezy Organicznej Blachownia | Preparat do mycia rąk i sposób stosowania preparatu do mycia rąk |
| PL245686B1 (pl) * | 2022-10-18 | 2024-09-16 | Siec Badawcza Lukasiewicz Inst Ciezkiej Syntezy Organicznej Blachownia | Preparat do mycia rąk i sposób stosowania preparatu do mycia rąk |
| PL245689B1 (pl) * | 2022-10-18 | 2024-09-16 | Siec Badawcza Lukasiewicz Inst Ciezkiej Syntezy Organicznej Blachownia | Preparat do mycia rąk i sposób stosowania preparatu do mycia rąk |
| PL245691B1 (pl) * | 2022-10-18 | 2024-09-16 | Siec Badawcza Lukasiewicz Inst Ciezkiej Syntezy Organicznej Blachownia | Preparat do mycia rąk i sposób stosowania preparatu do mycia rąk |
Also Published As
| Publication number | Publication date |
|---|---|
| MY114774A (en) | 2003-01-31 |
| GB9414330D0 (en) | 1994-09-07 |
| IN185633B (enrdf_load_stackoverflow) | 2001-03-17 |
| BR9503298A (pt) | 1996-06-04 |
| CN1130207A (zh) | 1996-09-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2034666C (en) | Detergent composition | |
| AU622396B2 (en) | Built detergent compositions containing diethyleneglycoliminodiacetic acid | |
| US4783281A (en) | Detergent powder and process for its preparation | |
| US4243544A (en) | Production of alumino-silicate-containing detergent composition | |
| US4885101A (en) | Laundry detergents containing fabric-softening clays between 150 and 2000 microns in size | |
| US4465613A (en) | Alkyl phosphoric salt-hydrocarbon wax lather controlled detergent compositions | |
| JPH0830199B2 (ja) | 洗剤組成物 | |
| CA1309923C (en) | Detergent composition | |
| US5180515A (en) | Granular detergent compositions having low levels of potassium salt to provide improved solubility | |
| US4362642A (en) | Alkyl phosphoric acid polyvalent salts-mineral oil lather controlled detergent compositions | |
| US5229028A (en) | Liquid detergent compositions | |
| US4299717A (en) | Detergent compositions | |
| GB2291067A (en) | Detergent Composition | |
| GB2278125A (en) | Detergent composition | |
| GB2278124A (en) | Detergent composition | |
| US5209857A (en) | Fabric softening detergent compositions containing smectite clays having a lattice charge deficiency | |
| GB2276630A (en) | Non-soap detergent bar | |
| US3832309A (en) | Detergent formulations | |
| JPS6021640B2 (ja) | 液体洗剤組成物 | |
| US5039453A (en) | Detergent laundry bars having improved hardness and process for manufacture thereof | |
| CA1314189C (en) | Detergent compositions | |
| US3586632A (en) | Cleaning compositions containing curd dispersants | |
| EP0292193A1 (en) | Detergent composition | |
| JPH031359B2 (enrdf_load_stackoverflow) | ||
| US5069825A (en) | Detergent laundry bar with improved formulation and process |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| WAP | Application withdrawn, taken to be withdrawn or refused ** after publication under section 16(1) |