GB2186585A - Reactive azo dyes - Google Patents
Reactive azo dyes Download PDFInfo
- Publication number
- GB2186585A GB2186585A GB08702731A GB8702731A GB2186585A GB 2186585 A GB2186585 A GB 2186585A GB 08702731 A GB08702731 A GB 08702731A GB 8702731 A GB8702731 A GB 8702731A GB 2186585 A GB2186585 A GB 2186585A
- Authority
- GB
- United Kingdom
- Prior art keywords
- red
- amino
- dye
- alkyl
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000987 azo dye Substances 0.000 title claims abstract description 10
- 239000000975 dye Substances 0.000 claims abstract description 38
- 239000000460 chlorine Substances 0.000 claims abstract description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 8
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 8
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims abstract description 6
- 239000000203 mixture Substances 0.000 claims abstract description 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract description 5
- 238000009472 formulation Methods 0.000 claims abstract description 5
- 239000007788 liquid Substances 0.000 claims abstract description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 4
- 239000001257 hydrogen Substances 0.000 claims abstract description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 4
- 229920002678 cellulose Polymers 0.000 claims abstract description 3
- 239000001913 cellulose Substances 0.000 claims abstract description 3
- 239000000463 material Substances 0.000 claims abstract description 3
- -1 methoxy, ethoxy Chemical group 0.000 claims description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 abstract description 7
- 238000004043 dyeing Methods 0.000 abstract description 4
- 238000002425 crystallisation Methods 0.000 abstract 1
- 230000008025 crystallization Effects 0.000 abstract 1
- 229920000742 Cotton Polymers 0.000 description 7
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 6
- 229910006069 SO3H Inorganic materials 0.000 description 5
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- KZKGEEGADAWJFS-UHFFFAOYSA-N 2-amino-5-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(N)C(S(O)(=O)=O)=C1 KZKGEEGADAWJFS-UHFFFAOYSA-N 0.000 description 2
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 2
- ORLGPUVJERIKLW-UHFFFAOYSA-N 5-chlorotriazine Chemical class ClC1=CN=NN=C1 ORLGPUVJERIKLW-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 2
- BEHLMOQXOSLGHN-UHFFFAOYSA-N benzenamine sulfate Chemical class OS(=O)(=O)NC1=CC=CC=C1 BEHLMOQXOSLGHN-UHFFFAOYSA-N 0.000 description 2
- DHRYNCMOYLYSRB-UHFFFAOYSA-N butan-2-yloxy-butoxy-ethoxy-methoxy-(2-methylpropoxy)-propan-2-yloxy-propoxy-lambda7-chlorane Chemical compound COCl(OC(C)CC)(OCC(C)C)(OCCCC)(OC(C)C)(OCCC)OCC DHRYNCMOYLYSRB-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000000909 electrodialysis Methods 0.000 description 2
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- MWCADZVQNIHFGT-UHFFFAOYSA-N 1-anilinopropan-2-ol Chemical compound CC(O)CNC1=CC=CC=C1 MWCADZVQNIHFGT-UHFFFAOYSA-N 0.000 description 1
- OMQCGHBXGJBBOL-UHFFFAOYSA-N 2-amino-4-chlorobenzenesulfonic acid Chemical compound NC1=CC(Cl)=CC=C1S(O)(=O)=O OMQCGHBXGJBBOL-UHFFFAOYSA-N 0.000 description 1
- ISDHKUXEPQGCGX-UHFFFAOYSA-N 2-amino-5-bromobenzenesulfonic acid Chemical compound NC1=CC=C(Br)C=C1S(O)(=O)=O ISDHKUXEPQGCGX-UHFFFAOYSA-N 0.000 description 1
- ZCGVPUAAMCMLTM-UHFFFAOYSA-N 2-amino-5-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(Cl)C=C1S(O)(=O)=O ZCGVPUAAMCMLTM-UHFFFAOYSA-N 0.000 description 1
- CAFUHBWYTBNBEY-UHFFFAOYSA-N 2-amino-5-ethylbenzenesulfonic acid Chemical compound CCC1=CC=C(N)C(S(O)(=O)=O)=C1 CAFUHBWYTBNBEY-UHFFFAOYSA-N 0.000 description 1
- LTPSRQRIPCVMKQ-UHFFFAOYSA-N 2-amino-5-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C(S(O)(=O)=O)=C1 LTPSRQRIPCVMKQ-UHFFFAOYSA-N 0.000 description 1
- MWGATWIBSKHFMR-UHFFFAOYSA-N 2-anilinoethanol Chemical compound OCCNC1=CC=CC=C1 MWGATWIBSKHFMR-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- CORQIZCSHKRWRQ-UHFFFAOYSA-N 3-amino-4-ethylbenzenesulfonic acid Chemical compound CCC1=CC=C(S(O)(=O)=O)C=C1N CORQIZCSHKRWRQ-UHFFFAOYSA-N 0.000 description 1
- FLIOATBXVNLPLK-UHFFFAOYSA-N 3-amino-4-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(S(O)(=O)=O)C=C1N FLIOATBXVNLPLK-UHFFFAOYSA-N 0.000 description 1
- DTNODBHGOLWROS-UHFFFAOYSA-N 3-amino-4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1N DTNODBHGOLWROS-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- CVYDAAGFDZATJD-UHFFFAOYSA-N 4-amino-3-bromobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1Br CVYDAAGFDZATJD-UHFFFAOYSA-N 0.000 description 1
- NEECEUZBAHTVIN-UHFFFAOYSA-N 4-amino-3-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1Cl NEECEUZBAHTVIN-UHFFFAOYSA-N 0.000 description 1
- MRFIZCRITUQJQJ-UHFFFAOYSA-N 4-amino-3-ethylbenzenesulfonic acid Chemical compound CCC1=CC(S(O)(=O)=O)=CC=C1N MRFIZCRITUQJQJ-UHFFFAOYSA-N 0.000 description 1
- WQTCZINVPXJNEL-UHFFFAOYSA-N 4-amino-3-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC=C1N WQTCZINVPXJNEL-UHFFFAOYSA-N 0.000 description 1
- VPXCXBHLKDPWQV-UHFFFAOYSA-N 5-amino-2-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(Cl)C(S(O)(=O)=O)=C1 VPXCXBHLKDPWQV-UHFFFAOYSA-N 0.000 description 1
- INESHSIZOSSOEI-UHFFFAOYSA-N 5-amino-2-ethoxybenzenesulfonic acid Chemical compound CCOC1=CC=C(N)C=C1S(O)(=O)=O INESHSIZOSSOEI-UHFFFAOYSA-N 0.000 description 1
- YZDJEAIGUVJMCC-UHFFFAOYSA-N 5-amino-2-ethylbenzenesulfonic acid Chemical compound CCC1=CC=C(N)C=C1S(O)(=O)=O YZDJEAIGUVJMCC-UHFFFAOYSA-N 0.000 description 1
- JXZGTFLJFKLVAX-UHFFFAOYSA-N 5-amino-2-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(N)C=C1S(O)(=O)=O JXZGTFLJFKLVAX-UHFFFAOYSA-N 0.000 description 1
- BRKFTWHPLMMNHF-UHFFFAOYSA-N 5-amino-2-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C=C1S(O)(=O)=O BRKFTWHPLMMNHF-UHFFFAOYSA-N 0.000 description 1
- 102100038916 Caspase-5 Human genes 0.000 description 1
- 101100112336 Homo sapiens CASP5 gene Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 101100273286 Mus musculus Casp4 gene Proteins 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229940039407 aniline Drugs 0.000 description 1
- ONTQJDKFANPPKK-UHFFFAOYSA-L chembl3185981 Chemical compound [Na+].[Na+].CC1=CC(C)=C(S([O-])(=O)=O)C=C1N=NC1=CC(S([O-])(=O)=O)=C(C=CC=C2)C2=C1O ONTQJDKFANPPKK-UHFFFAOYSA-L 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 230000003165 hydrotropic effect Effects 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- XTTMNDFFWSZHCZ-UHFFFAOYSA-N n-(2-methoxyethyl)aniline Chemical compound COCCNC1=CC=CC=C1 XTTMNDFFWSZHCZ-UHFFFAOYSA-N 0.000 description 1
- GGARKJIWYNVMBF-UHFFFAOYSA-N n-(2-methylpropyl)aniline Chemical compound CC(C)CNC1=CC=CC=C1 GGARKJIWYNVMBF-UHFFFAOYSA-N 0.000 description 1
- LAMTXWQPHWUMLX-UHFFFAOYSA-N n-butan-2-ylaniline Chemical compound CCC(C)NC1=CC=CC=C1 LAMTXWQPHWUMLX-UHFFFAOYSA-N 0.000 description 1
- VSHTWPWTCXQLQN-UHFFFAOYSA-N n-butylaniline Chemical compound CCCCNC1=CC=CC=C1 VSHTWPWTCXQLQN-UHFFFAOYSA-N 0.000 description 1
- FRCFWPVMFJMNDP-UHFFFAOYSA-N n-propan-2-ylaniline Chemical compound CC(C)NC1=CC=CC=C1 FRCFWPVMFJMNDP-UHFFFAOYSA-N 0.000 description 1
- CDZOGLJOFWFVOZ-UHFFFAOYSA-N n-propylaniline Chemical compound CCCNC1=CC=CC=C1 CDZOGLJOFWFVOZ-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000005621 tetraalkylammonium salts Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
- C09B62/08—Azo dyes
- C09B62/085—Monoazo dyes
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06P—DYEING OR PRINTING TEXTILES; DYEING LEATHER, FURS OR SOLID MACROMOLECULAR SUBSTANCES IN ANY FORM
- D06P1/00—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed
- D06P1/38—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed using reactive dyes
- D06P1/382—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed using reactive dyes reactive group directly attached to heterocyclic group
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3603790 | 1986-02-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| GB8702731D0 GB8702731D0 (en) | 1987-03-11 |
| GB2186585A true GB2186585A (en) | 1987-08-19 |
Family
ID=6293585
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB08702731A Withdrawn GB2186585A (en) | 1986-02-07 | 1987-02-06 | Reactive azo dyes |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JPS62185759A (enrdf_load_html_response) |
| CH (1) | CH669389A5 (enrdf_load_html_response) |
| GB (1) | GB2186585A (enrdf_load_html_response) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4902786A (en) * | 1986-07-17 | 1990-02-20 | Hoechst Aktiengesellschaft | Phenylazonaphthol or naphthylazonaphthol compounds containing a fibre-reactive aminophenylamino-substituted halogen-s-triazinylamino group and a fibre-reactive group of the vinylsulfone series, suitable as dyestuffs |
| US5516897A (en) * | 1992-03-06 | 1996-05-14 | Zeneca Limited | Monoazo reactive dyes and solutions thereof |
| ES2103168A1 (es) * | 1992-08-14 | 1997-08-16 | Sandoz Ag | Monoazocolorantes reactivos con las fibras. |
| ES2103169A1 (es) * | 1992-09-17 | 1997-08-16 | Sandoz Ag | Colorantes monoazo reactivos con las fibras. |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB834304A (en) * | 1957-04-23 | 1960-05-04 | Ici Ltd | New monoazo dyestuffs containing triazine radicals |
| GB2010890A (en) * | 1977-12-23 | 1979-07-04 | Sandoz Ltd | Organic compounds |
| EP0013765A1 (de) * | 1979-01-16 | 1980-08-06 | Bayer Ag | Reaktivazofarbstoffe sowie deren Herstellung und Verwendung zum Färben von OH- und N-haltigen Materialien |
| US4560480A (en) * | 1983-05-04 | 1985-12-24 | Ciba Geigy Corporation | Process for converting sparingly soluble salts of anionic dyes and fluorescent brighteners into more soluble salts by means of cation exchange |
-
1987
- 1987-01-09 CH CH5287A patent/CH669389A5/de not_active IP Right Cessation
- 1987-02-06 JP JP62024934A patent/JPS62185759A/ja active Pending
- 1987-02-06 GB GB08702731A patent/GB2186585A/en not_active Withdrawn
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB834304A (en) * | 1957-04-23 | 1960-05-04 | Ici Ltd | New monoazo dyestuffs containing triazine radicals |
| GB2010890A (en) * | 1977-12-23 | 1979-07-04 | Sandoz Ltd | Organic compounds |
| EP0013765A1 (de) * | 1979-01-16 | 1980-08-06 | Bayer Ag | Reaktivazofarbstoffe sowie deren Herstellung und Verwendung zum Färben von OH- und N-haltigen Materialien |
| US4560480A (en) * | 1983-05-04 | 1985-12-24 | Ciba Geigy Corporation | Process for converting sparingly soluble salts of anionic dyes and fluorescent brighteners into more soluble salts by means of cation exchange |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4902786A (en) * | 1986-07-17 | 1990-02-20 | Hoechst Aktiengesellschaft | Phenylazonaphthol or naphthylazonaphthol compounds containing a fibre-reactive aminophenylamino-substituted halogen-s-triazinylamino group and a fibre-reactive group of the vinylsulfone series, suitable as dyestuffs |
| US5516897A (en) * | 1992-03-06 | 1996-05-14 | Zeneca Limited | Monoazo reactive dyes and solutions thereof |
| ES2103168A1 (es) * | 1992-08-14 | 1997-08-16 | Sandoz Ag | Monoazocolorantes reactivos con las fibras. |
| ES2103169A1 (es) * | 1992-09-17 | 1997-08-16 | Sandoz Ag | Colorantes monoazo reactivos con las fibras. |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS62185759A (ja) | 1987-08-14 |
| GB8702731D0 (en) | 1987-03-11 |
| CH669389A5 (enrdf_load_html_response) | 1989-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1087172A (en) | Dyestuffs, their preparation and use | |
| GB2034343A (en) | Reactive dyestuffs | |
| JPH05263396A (ja) | ジスアゾ染料で紙を染色する方法 | |
| EP0159292B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| US4474697A (en) | Fluorotriazine-group-containing azo dyestuffs | |
| DE2951541A1 (de) | Verbindungen mit reaktiven resten | |
| EP0101408B1 (de) | Monoazofarbstoffe, deren Herstellung und Verwendung | |
| JPH05209135A (ja) | 二官能反応性染料 | |
| US4314818A (en) | 1-Amino-7-[3'-(5"-chloro-2",4"-difluoropyrimidyl-6"-amino)-6'-sulfophenylazo]-8-hydroxy-2-sulfamoyl or substituted sulfamoyl-phenylazo naphthalene-3,6-disulfonic acids | |
| EP0036838B1 (de) | Azofarbstoffe, deren Herstellung und Verwendung | |
| EP0167785B1 (de) | Reaktivfarbstoffe | |
| GB2186585A (en) | Reactive azo dyes | |
| US3008950A (en) | Red monoazo-dyestuffs | |
| US4591634A (en) | Trisazo/azoxy dyestuff mixtures | |
| US4563518A (en) | Fibre-reactive fluorothriazine-group-containing azo dyestuffs | |
| GB2057479A (en) | Reactive Dyes | |
| US5744622A (en) | water-soluble, fiber-reactive anthraquinone compounds | |
| US3351578A (en) | Monoazo dyestuffs having a monochlorotriazine ring carrying a sulfoanthranilic acid amino substituent | |
| US3132129A (en) | Azo phthalocyanine dyestuffs | |
| US3351579A (en) | Water-soluble cationic azo dyestuffs | |
| US2252824A (en) | Production of trisazo dyestuffs | |
| EP0433764A1 (de) | Reaktivfarbstoffe mit Triazin- und Chlorbutinylanker | |
| US2153627A (en) | New monoazo dyestuffs | |
| US2814616A (en) | Monoazo dyestuffs | |
| US2001975A (en) | Dyestuffs of the naphthophenazine series |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| WAP | Application withdrawn, taken to be withdrawn or refused ** after publication under section 16(1) |