GB2007678B - Curable dially phthalate polymer and process for producingsame - Google Patents
Curable dially phthalate polymer and process for producingsameInfo
- Publication number
- GB2007678B GB2007678B GB7834490A GB7834490A GB2007678B GB 2007678 B GB2007678 B GB 2007678B GB 7834490 A GB7834490 A GB 7834490A GB 7834490 A GB7834490 A GB 7834490A GB 2007678 B GB2007678 B GB 2007678B
- Authority
- GB
- United Kingdom
- Prior art keywords
- producingsame
- curable
- phthalate polymer
- dially phthalate
- dially
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 title 1
- 229920000642 polymer Polymers 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/42—Introducing metal atoms or metal-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Paints Or Removers (AREA)
- Adhesives Or Adhesive Processes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10390277A JPS5437184A (en) | 1977-08-29 | 1977-08-29 | Novel diallylphthalate curable compound, its preparation, and adhesive and paint containing resin therefrom |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| GB2007678A GB2007678A (en) | 1979-05-23 |
| GB2007678B true GB2007678B (en) | 1982-09-22 |
Family
ID=14366346
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB7834490A Expired GB2007678B (en) | 1977-08-29 | 1978-08-24 | Curable dially phthalate polymer and process for producingsame |
Country Status (4)
| Country | Link |
|---|---|
| US (2) | US4161572A (enExample) |
| JP (1) | JPS5437184A (enExample) |
| FR (1) | FR2401939A1 (enExample) |
| GB (1) | GB2007678B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5437184A (en) * | 1977-08-29 | 1979-03-19 | Kanegafuchi Chem Ind Co Ltd | Novel diallylphthalate curable compound, its preparation, and adhesive and paint containing resin therefrom |
| JPS55129405A (en) * | 1979-03-29 | 1980-10-07 | Kanegafuchi Chem Ind Co Ltd | Silyl group-containing vinyl resin and its preparation |
| JPS55152745A (en) * | 1979-05-17 | 1980-11-28 | Kanegafuchi Chem Ind Co Ltd | Curable composition |
| JPS5755954A (en) * | 1980-09-19 | 1982-04-03 | Kanegafuchi Chem Ind Co Ltd | Composition |
| JPS5763351A (en) * | 1980-10-03 | 1982-04-16 | Kanegafuchi Chem Ind Co Ltd | Composition having improved pot life |
| JPS5927977A (ja) * | 1982-08-07 | 1984-02-14 | Kanegafuchi Chem Ind Co Ltd | プライマ−組成物 |
| JPS59124954A (ja) * | 1982-12-30 | 1984-07-19 | Kanegafuchi Chem Ind Co Ltd | 硬化性組成物 |
| GB8606634D0 (en) * | 1986-03-18 | 1986-04-23 | Dow Corning Ltd | Catalyst compositions |
| US5920842A (en) * | 1994-10-12 | 1999-07-06 | Pixel Instruments | Signal synchronization |
| US5527936A (en) * | 1995-02-17 | 1996-06-18 | E. I. Du Pont De Nemours And Company | Hydrosilylation of unsaturated compounds |
| US5530152A (en) * | 1995-02-17 | 1996-06-25 | E. I. Du Pont De Nemours And Company | Method for manufacturing organosilanes |
| US6013752A (en) * | 1997-06-04 | 2000-01-11 | Ameron International Corporation | Halogenated resin compositions |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2723987A (en) * | 1954-10-18 | 1955-11-15 | Dow Corning | Carboxy organosilicon compounds |
| US2970150A (en) * | 1957-12-17 | 1961-01-31 | Union Carbide Corp | Processes for the reaction of silanic hydrogen-bonded siloxanes with unsaturated organic compounds with a platinum catalyst |
| US3450736A (en) * | 1963-09-12 | 1969-06-17 | Mobil Oil Corp | Modified siloxane polymers and compositions containing same |
| US3296196A (en) * | 1964-06-01 | 1967-01-03 | Gen Electric | Siloxane polymers containing allylcinnamate groups |
| US3503943A (en) * | 1965-10-21 | 1970-03-31 | Exxon Research Engineering Co | Silane modified ethylene-propylene terpolymer |
| GB1090328A (enExample) * | 1965-10-23 | |||
| SU461931A1 (ru) * | 1973-12-14 | 1975-02-28 | Предприятие П/Я Р-6830 | Способ получени пропенилсиланов |
| JPS5437184A (en) * | 1977-08-29 | 1979-03-19 | Kanegafuchi Chem Ind Co Ltd | Novel diallylphthalate curable compound, its preparation, and adhesive and paint containing resin therefrom |
| CA1112392A (en) * | 1977-12-29 | 1981-11-10 | Masaaki Azuma | Curable polyester oligomer and a process for producing thereof |
| JPS591423B2 (ja) * | 1977-12-29 | 1984-01-12 | 鐘淵化学工業株式会社 | 室温硬化性組成物 |
-
1977
- 1977-08-29 JP JP10390277A patent/JPS5437184A/ja active Granted
-
1978
- 1978-08-24 GB GB7834490A patent/GB2007678B/en not_active Expired
- 1978-08-24 US US05/936,378 patent/US4161572A/en not_active Expired - Lifetime
- 1978-08-29 FR FR7824877A patent/FR2401939A1/fr active Granted
-
1979
- 1979-01-08 US US06/001,853 patent/US4282336A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2401939A1 (fr) | 1979-03-30 |
| JPS5437184A (en) | 1979-03-19 |
| GB2007678A (en) | 1979-05-23 |
| US4282336A (en) | 1981-08-04 |
| US4161572A (en) | 1979-07-17 |
| FR2401939B1 (enExample) | 1985-04-19 |
| JPS6234763B2 (enExample) | 1987-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB2006222B (en) | Curable vinyl ploymer and process for the production of the same | |
| AU510898B2 (en) | Blow molding apparatus | |
| JPS53137924A (en) | Monomer curable with irradiation | |
| JPS53123490A (en) | Waterrabsorptive polymer | |
| JPS53123491A (en) | Waterrabsorptive polymer | |
| GR63739B (en) | Process for polymerization of a-olefines | |
| BG27383A3 (en) | Hethod for extrusion of acrylic polymer fibers | |
| JPS53149291A (en) | Elastomeric threeecomponent polymer and producing process thereof | |
| HU178086B (en) | Process for preparing a binary fibre and equipment for performing the process | |
| JPS53101100A (en) | Curable allyloxyphosphazine polymer | |
| JPS53101089A (en) | Chlorinating process of ethylene polymer | |
| GB2007678B (en) | Curable dially phthalate polymer and process for producingsame | |
| JPS5390395A (en) | Novel polymer | |
| GB2001662B (en) | Polymerisation process | |
| JPS53115793A (en) | Segment polymer and producing process thereof | |
| AU521681B2 (en) | Inverter apparatus | |
| YU268578A (en) | Process for the polymerization of polyvinylchloride | |
| GB2076382B (en) | Apparatus for the production of carbon black | |
| GB2002004B (en) | Ethylene polymerisation process | |
| JPS5426900A (en) | Curable aryloxyphosphazen polymer | |
| AU525568B2 (en) | Inversion polymerisation process | |
| GB2008132B (en) | Free radical polymerisation process | |
| AU525567B2 (en) | Inversion polymerization process | |
| ZA783340B (en) | Polymer beads | |
| JPS5243895A (en) | Pasteeextrudable tetrafluoroethylene polymer and process for producing same |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PE20 | Patent expired after termination of 20 years |
Effective date: 19980823 |