GB1592005A - Polymeric colourants and preparations thereof - Google Patents
Polymeric colourants and preparations thereof Download PDFInfo
- Publication number
- GB1592005A GB1592005A GB46468/77A GB4646877A GB1592005A GB 1592005 A GB1592005 A GB 1592005A GB 46468/77 A GB46468/77 A GB 46468/77A GB 4646877 A GB4646877 A GB 4646877A GB 1592005 A GB1592005 A GB 1592005A
- Authority
- GB
- United Kingdom
- Prior art keywords
- equals
- chrom
- polymeric colorant
- polymeric
- colorant
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000002360 preparation method Methods 0.000 title description 9
- 239000003086 colorant Substances 0.000 claims description 66
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 42
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 32
- 239000001257 hydrogen Substances 0.000 claims description 30
- 229910052739 hydrogen Inorganic materials 0.000 claims description 30
- -1 alkali metal cation Chemical class 0.000 claims description 23
- 150000001412 amines Chemical class 0.000 claims description 23
- 229910052799 carbon Inorganic materials 0.000 claims description 21
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 20
- 239000007787 solid Substances 0.000 claims description 18
- 125000000129 anionic group Chemical group 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 14
- 230000002378 acidificating effect Effects 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 150000002431 hydrogen Chemical group 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- 125000003282 alkyl amino group Chemical group 0.000 claims description 7
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 7
- 150000004056 anthraquinones Chemical class 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 239000007788 liquid Substances 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 6
- 230000003381 solubilizing effect Effects 0.000 claims description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 230000003287 optical effect Effects 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 239000007791 liquid phase Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 3
- 239000012736 aqueous medium Substances 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 2
- 125000005227 alkyl sulfonate group Chemical group 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 26
- 239000000203 mixture Substances 0.000 description 21
- 239000000463 material Substances 0.000 description 18
- 239000000047 product Substances 0.000 description 18
- 230000021736 acetylation Effects 0.000 description 14
- 238000006640 acetylation reaction Methods 0.000 description 14
- 125000000217 alkyl group Chemical group 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- ABBZJHFBQXYTLU-UHFFFAOYSA-N but-3-enamide Chemical compound NC(=O)CC=C ABBZJHFBQXYTLU-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 229920001577 copolymer Polymers 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- 239000002585 base Substances 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 150000003973 alkyl amines Chemical class 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 5
- 238000001556 precipitation Methods 0.000 description 5
- 238000000108 ultra-filtration Methods 0.000 description 5
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 4
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 4
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- UYMKPFRHYYNDTL-UHFFFAOYSA-N ethenamine Chemical compound NC=C UYMKPFRHYYNDTL-UHFFFAOYSA-N 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 235000013305 food Nutrition 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 239000011550 stock solution Substances 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- XBNVWXKPFORCRI-UHFFFAOYSA-N 2h-naphtho[2,3-f]quinolin-1-one Chemical class C1=CC=CC2=CC3=C4C(=O)CC=NC4=CC=C3C=C21 XBNVWXKPFORCRI-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical group OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 2
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical group 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 235000013361 beverage Nutrition 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 238000000502 dialysis Methods 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- NLVXSWCKKBEXTG-UHFFFAOYSA-M ethenesulfonate Chemical compound [O-]S(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-M 0.000 description 2
- ZTWTYVWXUKTLCP-UHFFFAOYSA-L ethenyl-dioxido-oxo-$l^{5}-phosphane Chemical compound [O-]P([O-])(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-L 0.000 description 2
- 229940093476 ethylene glycol Drugs 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- XGIKILRODBEJIL-UHFFFAOYSA-N 1-(ethylamino)ethanol Chemical compound CCNC(C)O XGIKILRODBEJIL-UHFFFAOYSA-N 0.000 description 1
- VIQMJMDPUIBXQO-UHFFFAOYSA-N 1-amino-4-bromo-2-methylanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=C(N)C(C)=CC(Br)=C3C(=O)C2=C1 VIQMJMDPUIBXQO-UHFFFAOYSA-N 0.000 description 1
- KHUFHLFHOQVFGB-UHFFFAOYSA-N 1-aminoanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2N KHUFHLFHOQVFGB-UHFFFAOYSA-N 0.000 description 1
- ZPNQRYCVMXSMBU-UHFFFAOYSA-N 10h-naphtho[2,3-f]quinolin-9-one Chemical class C1=CC=C2C3=CC4=CCC(=O)C=C4C=C3C=CC2=N1 ZPNQRYCVMXSMBU-UHFFFAOYSA-N 0.000 description 1
- XRMDCWJNPDVAFI-UHFFFAOYSA-N 2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)[N+]1=O XRMDCWJNPDVAFI-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- KXRMREPJUITWDU-UHFFFAOYSA-N 2-amino-4,6-dimethyl-3-oxophenoxazine-1,9-dicarboxylic acid Chemical compound N1=C2C(C(O)=O)=C(N)C(=O)C(C)=C2OC2=C1C(C(O)=O)=CC=C2C KXRMREPJUITWDU-UHFFFAOYSA-N 0.000 description 1
- UPPWYHBZBLCPDK-UHFFFAOYSA-N 3'-carbethoxy-2-methyl-4-bromoanthrapyridone Chemical compound C12=CC=CC=C2C(=O)C2=C(Br)C=C(C)C3=C2C1=C(C(=O)OCC)C(=O)N3 UPPWYHBZBLCPDK-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- RVBXFOZIRRHESC-UHFFFAOYSA-N 4h-naphtho[2,3-f]quinazolin-1-one Chemical class C1=CC=CC2=CC3=C4C(=O)NC=NC4=CC=C3C=C21 RVBXFOZIRRHESC-UHFFFAOYSA-N 0.000 description 1
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 239000004255 Butylated hydroxyanisole Substances 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- BAWFJGJZGIEFAR-NNYOXOHSSA-N NAD zwitterion Chemical compound NC(=O)C1=CC=C[N+]([C@H]2[C@@H]([C@H](O)[C@@H](COP([O-])(=O)OP(O)(=O)OC[C@@H]3[C@H]([C@@H](O)[C@@H](O3)N3C4=NC=NC(N)=C4N=C3)O)O2)O)=C1 BAWFJGJZGIEFAR-NNYOXOHSSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 238000006887 Ullmann reaction Methods 0.000 description 1
- 238000003916 acid precipitation Methods 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 239000000038 blue colorant Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940125890 compound Ia Drugs 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- CVSVTCORWBXHQV-UHFFFAOYSA-N creatine Chemical compound NC(=[NH2+])N(C)CC([O-])=O CVSVTCORWBXHQV-UHFFFAOYSA-N 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000006392 deoxygenation reaction Methods 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 229940093858 ethyl acetoacetate Drugs 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 235000002864 food coloring agent Nutrition 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002500 ions Chemical group 0.000 description 1
- 238000005304 joining Methods 0.000 description 1
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- DXASQZJWWGZNSF-UHFFFAOYSA-N n,n-dimethylmethanamine;sulfur trioxide Chemical compound CN(C)C.O=S(=O)=O DXASQZJWWGZNSF-UHFFFAOYSA-N 0.000 description 1
- SJSZBOAQWPKFMU-UHFFFAOYSA-N n-(1-acetamidoethyl)acetamide Chemical compound CC(=O)NC(C)NC(C)=O SJSZBOAQWPKFMU-UHFFFAOYSA-N 0.000 description 1
- PJOOLUFQUNQIBE-UHFFFAOYSA-N n-but-1-enylacetamide Chemical compound CCC=CNC(C)=O PJOOLUFQUNQIBE-UHFFFAOYSA-N 0.000 description 1
- FMADWSNHCMZZCU-UHFFFAOYSA-N n-ethenylbutan-1-amine Chemical compound CCCCNC=C FMADWSNHCMZZCU-UHFFFAOYSA-N 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- OBJNZHVOCNPSCS-UHFFFAOYSA-N naphtho[2,3-f]quinazoline Chemical class C1=NC=C2C3=CC4=CC=CC=C4C=C3C=CC2=N1 OBJNZHVOCNPSCS-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000005373 porous glass Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000473 propyl gallate Substances 0.000 description 1
- 229960004063 propylene glycol Drugs 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000012465 retentate Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- BWYYYTVSBPRQCN-UHFFFAOYSA-M sodium;ethenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C=C BWYYYTVSBPRQCN-UHFFFAOYSA-M 0.000 description 1
- 235000014214 soft drink Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 230000007928 solubilization Effects 0.000 description 1
- 238000005063 solubilization Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 125000002128 sulfonyl halide group Chemical group 0.000 description 1
- 231100000057 systemic toxicity Toxicity 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 1
- 239000001060 yellow colorant Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B69/00—Dyes not provided for by a single group of this subclass
- C09B69/10—Polymeric dyes; Reaction products of dyes with monomers or with macromolecular compounds
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S534/00—Organic compounds -- part of the class 532-570 series
- Y10S534/03—Polymeric azo compounds or azo compounds containing polymeric moieties
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Coloring Foods And Improving Nutritive Qualities (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/743,205 US4169203A (en) | 1976-11-18 | 1976-11-18 | Water-soluble polymeric colorants containing anionic water-solubilizing groups |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1592005A true GB1592005A (en) | 1981-07-01 |
Family
ID=24987910
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB46468/77A Expired GB1592005A (en) | 1976-11-18 | 1977-11-08 | Polymeric colourants and preparations thereof |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4169203A (enExample) |
| JP (1) | JPS5366936A (enExample) |
| AU (1) | AU524581B2 (enExample) |
| BE (1) | BE860989A (enExample) |
| CA (1) | CA1124231A (enExample) |
| CH (1) | CH629841A5 (enExample) |
| DE (1) | DE2751262A1 (enExample) |
| FR (1) | FR2371488A1 (enExample) |
| GB (1) | GB1592005A (enExample) |
| IL (1) | IL53361A (enExample) |
| IT (1) | IT1092209B (enExample) |
| MX (1) | MX4611E (enExample) |
| NL (1) | NL7712713A (enExample) |
| ZA (1) | ZA776749B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4437952A (en) | 1982-01-04 | 1984-03-20 | E. I. Du Pont De Nemours & Co. | Coextruded multilayer cation exchange membranes |
| US4619990A (en) * | 1985-03-11 | 1986-10-28 | Minnesota Mining And Manufacturing Company | Polymeric dyes with pendent chromophore groups capable of undergoing thermoplastic deformation |
| CN1095861C (zh) * | 1996-09-11 | 2002-12-11 | 日本化药株式会社 | 蒽并吡啶酮化合物、水基油墨组合物和着色制品 |
| US5723060A (en) * | 1997-03-13 | 1998-03-03 | Milliken Research Corporation | Antifreeze composition |
| US6287348B1 (en) * | 1998-12-15 | 2001-09-11 | Milliken & Company | Colorants made from reactive dyes and fatty amines |
| US6649122B1 (en) | 1999-04-08 | 2003-11-18 | Larry L. Lough | Aqueous colorant system for incorporation into plastics |
| US6620858B2 (en) * | 2000-08-07 | 2003-09-16 | Eastman Chemical Company | Colorants containing copolymerizable vinyl groups and sulfonamide linkages |
| US20040063848A1 (en) * | 2002-09-12 | 2004-04-01 | 3M Innovative Properties Company | Oligomeric dyes and preparation thereof |
| DE102008041338A1 (de) | 2008-08-19 | 2010-02-25 | Evonik Röhm Gmbh | Einfärbeprozess für Poly(meth)acrylate mit Flüssigfarben auf Wasserbasis und Flüssigfarben auf Wasserbasis |
| CN102971384B (zh) | 2010-07-09 | 2016-01-20 | 赢创罗姆有限公司 | 含热稳定分散添加剂的用于聚(甲基)丙烯酸酯着色的水基液体色料 |
| CN102492309B (zh) * | 2011-11-11 | 2013-06-19 | 大连理工大学 | 悬挂型光热转换有机相变染料 |
| CN112047854B (zh) * | 2020-10-20 | 2021-07-02 | 中国科学院长春应用化学研究所 | 一种n-乙烯基烷基酰胺的制备方法 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2005317A (en) * | 1933-09-20 | 1935-06-18 | Gen Aniline Works Inc | Product of 2-acetylamino-3-chloranthraquinone |
| US2366034A (en) * | 1943-05-21 | 1944-12-26 | Du Pont | Process for production of azo dyestuff |
| US2522034A (en) * | 1946-08-07 | 1950-09-12 | Ciba Ltd | 1-hydroxy-8-acylamino anthraquinone dyestuffs |
| US2673198A (en) * | 1950-06-23 | 1954-03-23 | Sandoz Ag | Polyazo dyestuffs |
| US3278486A (en) * | 1959-02-17 | 1966-10-11 | Scripto Inc | Colored polymeric materials |
| US3340221A (en) * | 1962-12-12 | 1967-09-05 | Nat Starch Chem Corp | Polymers containing ethylenically unsaturated derivatives of orthohydroxy aromatics as reactive dye sites |
| US4000118A (en) * | 1973-11-30 | 1976-12-28 | Dawson Daniel J | Colorings |
| US3920855A (en) * | 1973-11-30 | 1975-11-18 | Dynapol Corp | Food containing non-toxic food coloring compositions and a process therefor |
| US3940503A (en) * | 1974-04-01 | 1976-02-24 | Dynapol | Coloring process and colored articles |
| US3937851A (en) * | 1974-04-15 | 1976-02-10 | Dynapol | Zoned coloration |
| US4018826A (en) * | 1974-11-04 | 1977-04-19 | Dynapol Corporation | Process for preparing polyvinylamine and salts thereof |
| US4051138A (en) * | 1975-12-08 | 1977-09-27 | Dynapol | Water-soluble amine-linked polymeric colorants |
| US4096134A (en) * | 1975-12-08 | 1978-06-20 | Dynapol | Ethylsulfonate-alkylamine copolymers as colorant backbones |
-
1976
- 1976-11-18 US US05/743,205 patent/US4169203A/en not_active Expired - Lifetime
-
1977
- 1977-11-08 GB GB46468/77A patent/GB1592005A/en not_active Expired
- 1977-11-10 AU AU30535/77A patent/AU524581B2/en not_active Expired
- 1977-11-11 ZA ZA00776749A patent/ZA776749B/xx unknown
- 1977-11-11 IL IL53361A patent/IL53361A/xx unknown
- 1977-11-15 CA CA290,897A patent/CA1124231A/en not_active Expired
- 1977-11-16 DE DE19772751262 patent/DE2751262A1/de not_active Withdrawn
- 1977-11-16 IT IT51829/77A patent/IT1092209B/it active
- 1977-11-16 FR FR7734437A patent/FR2371488A1/fr active Granted
- 1977-11-17 JP JP13837177A patent/JPS5366936A/ja active Pending
- 1977-11-17 CH CH1406377A patent/CH629841A5/de not_active IP Right Cessation
- 1977-11-17 MX MX776564U patent/MX4611E/es unknown
- 1977-11-18 NL NL7712713A patent/NL7712713A/xx not_active Application Discontinuation
- 1977-11-18 BE BE182759A patent/BE860989A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IL53361A0 (en) | 1978-01-31 |
| ZA776749B (en) | 1979-06-27 |
| FR2371488B1 (enExample) | 1982-06-11 |
| IT1092209B (it) | 1985-07-06 |
| IL53361A (en) | 1980-11-30 |
| JPS5366936A (en) | 1978-06-14 |
| CH629841A5 (de) | 1982-05-14 |
| FR2371488A1 (fr) | 1978-06-16 |
| BE860989A (fr) | 1978-03-16 |
| US4169203A (en) | 1979-09-25 |
| DE2751262A1 (de) | 1978-05-24 |
| MX4611E (es) | 1982-06-30 |
| AU3053577A (en) | 1979-05-17 |
| NL7712713A (nl) | 1978-05-22 |
| AU524581B2 (en) | 1982-09-23 |
| CA1124231A (en) | 1982-05-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4144252A (en) | Water-soluble amine-linked polymeric colorants | |
| GB1592005A (en) | Polymeric colourants and preparations thereof | |
| US4167422A (en) | Laked high molecular weight dyes | |
| EP0833203B1 (en) | Anthraquinone compounds | |
| CA1039712A (en) | Colorings | |
| US4339237A (en) | Free amine-containing polymeric dyes | |
| US20080091037A1 (en) | Phase change ink formulations, colorant formulations, and methods of forming colorants | |
| US4316918A (en) | Products including edibles colored with polymeric red colors | |
| US4107336A (en) | Edibles containing colorants having ethylsulfonate-alkylamine backbones | |
| CA1107888A (en) | High purity polymeric water-soluble colorants and their production | |
| US4250327A (en) | Polymeric yellow colorant | |
| US3963418A (en) | Yellow disazo acid dye solution | |
| EP0369643A2 (en) | Ink-jet printing inks | |
| CA1107728A (en) | Red colors | |
| US4189380A (en) | Salt addition in ultrafiltration purification of solutions of polymeric colorants | |
| US4382800A (en) | Free amine-containing polymeric dyes | |
| US4302399A (en) | Acetylation of crude reaction products containing polymeric colorants | |
| US4178422A (en) | Ethylsulfonate-alkylamine copolymers as colorant backbones | |
| US3940503A (en) | Coloring process and colored articles | |
| US3976797A (en) | Low corrosion azo colorants | |
| US4258189A (en) | Process for preparing orange polymeric colorants | |
| KR930010743B1 (ko) | 황색 아조 - 및 아족시스틸벤 염료의 저장안정성 농축 수용액의 제조방법 | |
| CA1142921A (en) | Red colors | |
| SE443985B (sv) | Poly(organofosfazener) innehallande kromofora grupper och forfarande for framstellning derav | |
| US4279662A (en) | Polymeric red colors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |