GB1471125A - Substituted phenyl hydroxy compounds and their use as acari cides - Google Patents
Substituted phenyl hydroxy compounds and their use as acari cidesInfo
- Publication number
- GB1471125A GB1471125A GB3100575A GB3100575A GB1471125A GB 1471125 A GB1471125 A GB 1471125A GB 3100575 A GB3100575 A GB 3100575A GB 3100575 A GB3100575 A GB 3100575A GB 1471125 A GB1471125 A GB 1471125A
- Authority
- GB
- United Kingdom
- Prior art keywords
- compound
- formula
- substituted phenyl
- hydroxy compounds
- cides
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000000895 acaricidal effect Effects 0.000 title abstract 3
- -1 phenyl hydroxy Chemical class 0.000 title abstract 3
- 239000000642 acaricide Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 7
- 229910052801 chlorine Inorganic materials 0.000 abstract 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 abstract 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 239000002671 adjuvant Substances 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 abstract 1
- 125000001309 chloro group Chemical group Cl* 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/10—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C323/18—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and singly-bound oxygen atoms bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
- C07C323/20—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and singly-bound oxygen atoms bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton with singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/16—Sulfones; Sulfoxides having sulfone or sulfoxide groups and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C317/22—Sulfones; Sulfoxides having sulfone or sulfoxide groups and singly-bound oxygen atoms bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP9076074A JPS5636163B2 (cg-RX-API-DMAC10.html) | 1974-08-09 | 1974-08-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1471125A true GB1471125A (en) | 1977-04-21 |
Family
ID=14007551
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB3100575A Expired GB1471125A (en) | 1974-08-09 | 1975-07-24 | Substituted phenyl hydroxy compounds and their use as acari cides |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4005148A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5636163B2 (cg-RX-API-DMAC10.html) |
| CH (1) | CH612827A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2533807A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2281356A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1471125A (cg-RX-API-DMAC10.html) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6338720Y2 (cg-RX-API-DMAC10.html) * | 1979-10-11 | 1988-10-12 | ||
| JPS57206275A (en) * | 1981-06-11 | 1982-12-17 | Fuji Electric Co Ltd | Trigger angle regulator for separately excited inverter |
| JPS5893480A (ja) * | 1981-11-28 | 1983-06-03 | Fuji Electric Co Ltd | 軸発電装置用同期調相機の始動方式 |
| JPS5899848U (ja) * | 1981-12-26 | 1983-07-07 | 富士電機株式会社 | 半導体装置 |
| JPS58224600A (ja) * | 1982-06-24 | 1983-12-26 | Mitsubishi Heavy Ind Ltd | 船舶用発電装置 |
| US5155196A (en) * | 1987-06-01 | 1992-10-13 | The Dow Chemical Company | Polymer resulting from the cure of a preformed chromene-containing mixture |
| HUE036851T2 (hu) * | 2012-04-20 | 2018-08-28 | Kumiai Chemical Industry Co | Alkilfenilszulfid-származékok és növényvédõ szerek |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH528210A (de) * | 1969-04-02 | 1972-09-30 | Ciba Geigy Ag | Verwendung ungesättigter Äther zur Bekämpfung von Ektoparasiten und Vektoren |
| BE757600A (fr) * | 1969-10-17 | 1971-04-16 | Ciba Geigy | Phenylpropargylethers ou phenylpropargylthioethers substitues servant d'agents synergiques ajoutes a des substances insecticides ouacaricides |
-
1974
- 1974-08-09 JP JP9076074A patent/JPS5636163B2/ja not_active Expired
-
1975
- 1975-07-24 GB GB3100575A patent/GB1471125A/en not_active Expired
- 1975-07-29 DE DE19752533807 patent/DE2533807A1/de not_active Ceased
- 1975-08-05 US US05/602,069 patent/US4005148A/en not_active Expired - Lifetime
- 1975-08-07 FR FR7524730A patent/FR2281356A1/fr active Granted
- 1975-08-07 CH CH1033375A patent/CH612827A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5636163B2 (cg-RX-API-DMAC10.html) | 1981-08-22 |
| JPS5119121A (cg-RX-API-DMAC10.html) | 1976-02-16 |
| US4005148A (en) | 1977-01-25 |
| FR2281356A1 (fr) | 1976-03-05 |
| FR2281356B1 (cg-RX-API-DMAC10.html) | 1979-03-30 |
| DE2533807A1 (de) | 1976-02-19 |
| CH612827A5 (cg-RX-API-DMAC10.html) | 1979-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1471125A (en) | Substituted phenyl hydroxy compounds and their use as acari cides | |
| GB1386992A (en) | Pesticidal compounds and compositions | |
| IE43662L (en) | 3-alkoxy-benzo-1,2,4-triazines | |
| GB1337860A (en) | Nitrodiphenyl ether derivatives and their use as herbicides | |
| GB1350742A (en) | Thiono-phosphoric -phosphonic- acid esters and ester amides a process for their preparation and their use as insecticides and acaricides | |
| GB1340297A (en) | Thionophosphoric phosphinic acid esters and their use as insecitcides and acaricides | |
| IE40395B1 (en) | 2,3-dihydrobenzofuranyl-7-n-methylcarbamates, their preparation and their use as insecticides | |
| JPS56140984A (en) | Substituted acetanilide compound, its preparation and herbicide containing the same as active constituent | |
| GB1506554A (en) | Substituted vinylthionophosphoric acid esters and their use as insecticides and acaricides | |
| GB1334814A (en) | N-sulphenylated carbamates their manufacture and their use as insecticides acaricides and fungicides | |
| ES8501230A1 (es) | Procedimiento para la obtencion de formulaciones acuosas homogeneas a base de alquilaril poliglicoleter | |
| ES8106487A1 (es) | Procedimiento para la obtencion de halogenoacetanilidas n- sustituidas | |
| EP0020765A4 (fr) | Remede contre le glaucome. | |
| JPS5772928A (en) | Novel 2-arylpropyl ether derivtive and thioether derviative, their preparations, insecticide, and acaricide | |
| IE41804L (en) | Substituted but-2-enoanilides, herbicides | |
| GB1395451A (en) | Diphenyl ether derivatives | |
| GB1463028A (en) | Substituted amino-s-triazines and their use in herbicidal compositions | |
| ES8105294A1 (es) | Procedimiento para la obtencion de imidazolil-enoleteres,de efecto fungicida | |
| GB1413532A (en) | Pesticidal dithiophosphoric acid esters | |
| GB1310558A (en) | Thiophosphoric acid esters | |
| GB1456896A (en) | Dithiophosphate esters having pesticidal properties | |
| GB1439631A (en) | Pesticidal thiolphosphoric acid esters | |
| GB1424705A (en) | Pesticidal dithiophoshphoric acid esters | |
| GB1337349A (en) | Pyrazoloisindolones their preparation and use as plant growth regulants | |
| GB1435660A (en) | 2-cyanophenyldit |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |