FR2373156A1 - Lampe a decharge a haute pression perfectionnee - Google Patents
Lampe a decharge a haute pression perfectionneeInfo
- Publication number
- FR2373156A1 FR2373156A1 FR7736014A FR7736014A FR2373156A1 FR 2373156 A1 FR2373156 A1 FR 2373156A1 FR 7736014 A FR7736014 A FR 7736014A FR 7736014 A FR7736014 A FR 7736014A FR 2373156 A1 FR2373156 A1 FR 2373156A1
- Authority
- FR
- France
- Prior art keywords
- casing
- tubular
- current supply
- high pressure
- supply conductor
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000004020 conductor Substances 0.000 abstract 3
- 229910052751 metal Inorganic materials 0.000 abstract 2
- 239000002184 metal Substances 0.000 abstract 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 abstract 1
- 239000000919 ceramic Substances 0.000 abstract 1
- 238000002788 crimping Methods 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 229910052708 sodium Inorganic materials 0.000 abstract 1
- 239000011734 sodium Substances 0.000 abstract 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/24—Means for obtaining or maintaining the desired pressure within the vessel
- H01J61/28—Means for producing, introducing, or replenishing gas or vapour during operation of the lamp
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/36—Seals between parts of vessels; Seals for leading-in conductors; Leading-in conductors
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/747,552 US4065691A (en) | 1976-12-06 | 1976-12-06 | Ceramic lamp having electrodes supported by crimped tubular inlead |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FR2373156A1 true FR2373156A1 (fr) | 1978-06-30 |
| FR2373156B1 FR2373156B1 (enExample) | 1981-12-24 |
Family
ID=25005592
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR7736014A Granted FR2373156A1 (fr) | 1976-12-06 | 1977-11-30 | Lampe a decharge a haute pression perfectionnee |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4065691A (enExample) |
| JP (1) | JPS5387584A (enExample) |
| BE (1) | BE861537A (enExample) |
| BR (1) | BR7708058A (enExample) |
| CA (1) | CA1055103A (enExample) |
| DE (1) | DE2754001C2 (enExample) |
| FR (1) | FR2373156A1 (enExample) |
| GB (1) | GB1587878A (enExample) |
| MX (1) | MX144571A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2435815A1 (fr) * | 1978-09-11 | 1980-04-04 | Gen Electric | Lampe a decharge de haute intensite perfectionnee |
| FR2479561A1 (fr) * | 1980-03-31 | 1981-10-02 | Gen Electric | Lampe d'eclairage a vapeur metallique alcaline |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4435669A (en) * | 1979-05-07 | 1984-03-06 | North American Philips Electric Corp. | Arc tube construction |
| AU528293B2 (en) * | 1980-02-06 | 1983-04-21 | Ngk Insulators, Ltd. | Discharge lamp tube |
| US4342939A (en) * | 1980-05-02 | 1982-08-03 | General Electric Company | Universal burning ceramic lamp |
| US4423353A (en) * | 1980-06-17 | 1983-12-27 | Matsushita Electronics Corporation | High-pressure sodium lamp |
| HU178880B (en) * | 1980-06-20 | 1982-07-28 | Egyesuelt Izzolampa | Sodium discharge lamp with aluminium oxide discharge tube and process for the production thereof |
| NL185482C (nl) * | 1980-09-05 | 1991-01-16 | Philips Nv | Hogedrukontladingslamp. |
| HU181782B (en) * | 1981-01-09 | 1983-11-28 | Egyesuelt Izzolampa | Discharge vessel for high-pressure sodium-vapour discharge lamps |
| US4559473A (en) * | 1982-06-11 | 1985-12-17 | General Electric Company | Electrode structure for high pressure sodium vapor lamps |
| US4464603A (en) * | 1982-07-26 | 1984-08-07 | General Electric Company | Ceramic seal for high pressure sodium vapor lamps |
| US4704093A (en) * | 1984-06-18 | 1987-11-03 | General Electric Company | High pressure sodium vapor lamp with improved ceramic arc tube |
| US4707636A (en) * | 1984-06-18 | 1987-11-17 | General Electric Company | High pressure sodium vapor lamp with PCA arc tube and end closures |
| US4868457A (en) * | 1985-01-14 | 1989-09-19 | General Electric Company | Ceramic lamp end closure and inlead structure |
| US4937494A (en) * | 1986-03-31 | 1990-06-26 | North American Philips Corporation | High pressure discharge lamp having an electrode lead-through with a positioning crimp |
| HU196014B (en) * | 1986-10-23 | 1988-08-29 | Tungsram Reszvenytarsasag | Current input wire of electric discharge lamp |
| JPS63139760U (enExample) * | 1987-03-06 | 1988-09-14 | ||
| US4839565A (en) * | 1987-04-03 | 1989-06-13 | General Electric Company | High pressure double wall sodium arc tube and methods of operating such |
| EP0505472A1 (en) * | 1989-12-14 | 1992-09-30 | Gte Products Corporation | Electrode feedthrough connection strap for arc discharge lamp |
| US5045756A (en) * | 1991-01-02 | 1991-09-03 | E.G.L. Corporation, Inc. | Non-conductive collar for the conductive shell of an electrical discharge device |
| DE9112690U1 (de) * | 1991-10-11 | 1991-12-05 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Hochdruckentladungslampe |
| US6100634A (en) * | 1991-12-11 | 2000-08-08 | Gte Products Corporation | Method for amalgam relocation in an arc discharge tube |
| PL180621B1 (pl) * | 1995-03-09 | 2001-03-30 | Philips Electronics Nv | Wysokocisnieniowa lampa wyladowcza PL PL |
| DE10256389A1 (de) * | 2002-12-02 | 2004-06-09 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Metallhalogenidlampe mit keramischem Entladungsgefäß |
| US7839089B2 (en) * | 2002-12-18 | 2010-11-23 | General Electric Company | Hermetical lamp sealing techniques and lamp having uniquely sealed components |
| US7215081B2 (en) * | 2002-12-18 | 2007-05-08 | General Electric Company | HID lamp having material free dosing tube seal |
| US20060001346A1 (en) * | 2004-06-30 | 2006-01-05 | Vartuli James S | System and method for design of projector lamp |
| US8035304B2 (en) * | 2008-03-06 | 2011-10-11 | General Electric Company | Ceramic high intensity discharge lamp having uniquely shaped shoulder |
| WO2014088733A1 (en) * | 2012-12-06 | 2014-06-12 | General Electric Company | Conductive layer net ignition aids |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR868638A (fr) * | 1939-09-21 | 1942-01-10 | Lorenz C Ag | Entrée de courant électrique pour condensateurs et appareils similaires |
| GB961070A (en) * | 1962-03-22 | 1964-06-17 | Gen Electric Co Ltd | Improvements in or relating to end closures for ceramic tubes |
| GB1290089A (enExample) * | 1969-08-18 | 1972-09-20 | ||
| US3821587A (en) * | 1973-03-08 | 1974-06-28 | Westinghouse Electric Corp | Ceramic discharge lamp operable in air without an outer glass envelope |
| US3882346A (en) * | 1973-11-05 | 1975-05-06 | Gen Electric | Ceramic arc tube mounting structure |
| US3911313A (en) * | 1974-05-17 | 1975-10-07 | Gte Sylvania Inc | Electrode for arc discharge lamp |
| FR2290030A1 (fr) * | 1974-10-30 | 1976-05-28 | Thorn Electrical Ind Ltd | Perfectionnements aux lampes a decharge au sodium a haute pression |
| FR2326034A1 (fr) * | 1975-09-29 | 1977-04-22 | Philips Nv | Lampe a decharge electrique |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3384798A (en) * | 1966-04-26 | 1968-05-21 | Gen Electric | High pressure saturation vapor sodium lamp containing mercury |
| DE2209805C2 (de) * | 1972-03-01 | 1983-09-29 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Metalldampfhochdruckentladungslampe |
| US3906273A (en) * | 1974-01-16 | 1975-09-16 | Bendix Corp | Two electrode spark gap apparatus |
| US3886392A (en) * | 1974-02-25 | 1975-05-27 | Gte Sylvania Inc | Method of sealing alumina arc tube |
| US3974410A (en) * | 1975-04-04 | 1976-08-10 | General Electric Company | Alumina ceramic lamp having enhanced heat conduction to the amalgam pool |
-
1976
- 1976-12-06 US US05/747,552 patent/US4065691A/en not_active Expired - Lifetime
-
1977
- 1977-11-14 GB GB47275/77A patent/GB1587878A/en not_active Expired
- 1977-11-18 CA CA291,226A patent/CA1055103A/en not_active Expired
- 1977-11-30 FR FR7736014A patent/FR2373156A1/fr active Granted
- 1977-12-01 JP JP14333577A patent/JPS5387584A/ja active Granted
- 1977-12-02 BR BR7708058A patent/BR7708058A/pt unknown
- 1977-12-03 DE DE2754001A patent/DE2754001C2/de not_active Expired
- 1977-12-06 MX MX171598A patent/MX144571A/es unknown
- 1977-12-06 BE BE183194A patent/BE861537A/xx not_active IP Right Cessation
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR868638A (fr) * | 1939-09-21 | 1942-01-10 | Lorenz C Ag | Entrée de courant électrique pour condensateurs et appareils similaires |
| GB961070A (en) * | 1962-03-22 | 1964-06-17 | Gen Electric Co Ltd | Improvements in or relating to end closures for ceramic tubes |
| GB1290089A (enExample) * | 1969-08-18 | 1972-09-20 | ||
| US3821587A (en) * | 1973-03-08 | 1974-06-28 | Westinghouse Electric Corp | Ceramic discharge lamp operable in air without an outer glass envelope |
| US3882346A (en) * | 1973-11-05 | 1975-05-06 | Gen Electric | Ceramic arc tube mounting structure |
| US3911313A (en) * | 1974-05-17 | 1975-10-07 | Gte Sylvania Inc | Electrode for arc discharge lamp |
| FR2290030A1 (fr) * | 1974-10-30 | 1976-05-28 | Thorn Electrical Ind Ltd | Perfectionnements aux lampes a decharge au sodium a haute pression |
| FR2326034A1 (fr) * | 1975-09-29 | 1977-04-22 | Philips Nv | Lampe a decharge electrique |
Non-Patent Citations (1)
| Title |
|---|
| EXBK/73 * |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2435815A1 (fr) * | 1978-09-11 | 1980-04-04 | Gen Electric | Lampe a decharge de haute intensite perfectionnee |
| FR2479561A1 (fr) * | 1980-03-31 | 1981-10-02 | Gen Electric | Lampe d'eclairage a vapeur metallique alcaline |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6212626B2 (enExample) | 1987-03-19 |
| GB1587878A (en) | 1981-04-08 |
| US4065691A (en) | 1977-12-27 |
| FR2373156B1 (enExample) | 1981-12-24 |
| DE2754001A1 (de) | 1978-06-08 |
| DE2754001C2 (de) | 1983-07-28 |
| MX144571A (es) | 1981-10-27 |
| BR7708058A (pt) | 1978-07-25 |
| BE861537A (fr) | 1978-06-06 |
| CA1055103A (en) | 1979-05-22 |
| JPS5387584A (en) | 1978-08-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FR2373156A1 (fr) | Lampe a decharge a haute pression perfectionnee | |
| US5990599A (en) | High-pressure discharge lamp having UV radiation source for enhancing ignition | |
| GB1486611A (en) | High intensity discharge lamp | |
| FR2445615A1 (fr) | Tube a arc pour lampe a decharge miniature | |
| GB1485459A (en) | Ceramic envelope lamp | |
| BE900263A (fr) | Lampe a incandescence a efficacite amelioree. | |
| US2624023A (en) | Lamp unit | |
| US6268698B1 (en) | Capacitive glow starting of high intensity discharge lamps | |
| US4061939A (en) | Low noise sodium vapor lamp for sonic pulse operation | |
| JPS6143818B2 (enExample) | ||
| GB1328827A (en) | Three-electrode arc lamps incorporating heat shielding means | |
| GB1531280A (en) | Metal halide lamps | |
| US4780649A (en) | Metal vapor lamp having low starting voltage | |
| US4433271A (en) | High pressure discharge lamp | |
| CA2613730C (en) | Starting aid for low wattage metal halide lamps | |
| US4205258A (en) | Internal shorting fuse for a high-intensity discharge lamp | |
| US3895251A (en) | Arc discharge lamp having reduced starting voltage | |
| FR2377093A1 (fr) | Lampe a decharge dans la vapeur de mercure a basse pression | |
| US4321501A (en) | Low wattage, high pressure metal vapor discharge lamp for minimizing detrimental glow time | |
| US2913615A (en) | Cathode | |
| US4891554A (en) | Arc discharge lamp having improved performance | |
| EP0175937A2 (en) | Metal vapor lamp having low starting voltage | |
| US4651056A (en) | High-pressure discharge lamp | |
| EP0530318A1 (en) | Arc discharge lamp having reduced sodium loss | |
| FR2357061A1 (fr) | Tube a arc pour lampe a decharge |