DK574676A - 2,6-dinitroanilin-derivater og deres anvendelser - Google Patents
2,6-dinitroanilin-derivater og deres anvendelserInfo
- Publication number
- DK574676A DK574676A DK574676A DK574676A DK574676A DK 574676 A DK574676 A DK 574676A DK 574676 A DK574676 A DK 574676A DK 574676 A DK574676 A DK 574676A DK 574676 A DK574676 A DK 574676A
- Authority
- DK
- Denmark
- Prior art keywords
- dinitroanilin
- derivatives
- dinitroanilin derivatives
- Prior art date
Links
- QFUSCYRJMXLNRB-UHFFFAOYSA-N 2,6-dinitroaniline Chemical class NC1=C([N+]([O-])=O)C=CC=C1[N+]([O-])=O QFUSCYRJMXLNRB-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/13—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups
- C07C205/19—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups bound to carbon atoms of six-membered aromatic rings and hydroxy groups bound to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/11—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/11—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings
- C07C205/12—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings the six-membered aromatic ring or a condensed ring system containing that ring being substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/45—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by at least one doubly—bound oxygen atom, not being part of a —CHO group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US64322675A | 1975-12-22 | 1975-12-22 | |
| US69608576A | 1976-06-14 | 1976-06-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK574676A true DK574676A (da) | 1977-06-23 |
Family
ID=27094213
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK574676A DK574676A (da) | 1975-12-22 | 1976-12-21 | 2,6-dinitroanilin-derivater og deres anvendelser |
Country Status (21)
| Country | Link |
|---|---|
| JP (1) | JPS5278841A (cs) |
| AT (1) | AT362612B (cs) |
| AU (2) | AU514612B2 (cs) |
| BE (1) | BE849681R (cs) |
| BG (2) | BG27524A3 (cs) |
| CA (1) | CA1100998A (cs) |
| CH (1) | CH618076A5 (cs) |
| DD (3) | DD134516A5 (cs) |
| DE (1) | DE2657327A1 (cs) |
| DK (1) | DK574676A (cs) |
| FI (1) | FI67209C (cs) |
| GB (1) | GB1573014A (cs) |
| IE (1) | IE44488B1 (cs) |
| IL (1) | IL51079A (cs) |
| IN (1) | IN145613B (cs) |
| IT (1) | IT1066705B (cs) |
| KE (1) | KE3135A (cs) |
| MY (1) | MY8200076A (cs) |
| OA (1) | OA05519A (cs) |
| PT (1) | PT66000B (cs) |
| SE (1) | SE442109B (cs) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE787939A (fr) * | 1971-08-25 | 1973-02-26 | American Cyanamid Co | 2,6-dinitranilines possedant des proprietes herbicides |
-
1976
- 1976-12-08 IN IN2170/CAL/76A patent/IN145613B/en unknown
- 1976-12-10 IL IL51079A patent/IL51079A/xx unknown
- 1976-12-13 CA CA267,749A patent/CA1100998A/en not_active Expired
- 1976-12-15 GB GB52441/76A patent/GB1573014A/en not_active Expired
- 1976-12-17 DE DE19762657327 patent/DE2657327A1/de not_active Withdrawn
- 1976-12-21 IE IE2801/76A patent/IE44488B1/en unknown
- 1976-12-21 PT PT66000A patent/PT66000B/pt unknown
- 1976-12-21 BE BE173489A patent/BE849681R/xx active
- 1976-12-21 CH CH1610676A patent/CH618076A5/de not_active IP Right Cessation
- 1976-12-21 IT IT52719/76A patent/IT1066705B/it active
- 1976-12-21 OA OA56021A patent/OA05519A/xx unknown
- 1976-12-21 DK DK574676A patent/DK574676A/da not_active Application Discontinuation
- 1976-12-21 SE SE7614384A patent/SE442109B/xx unknown
- 1976-12-21 AT AT949076A patent/AT362612B/de not_active IP Right Cessation
- 1976-12-22 AU AU20840/76A patent/AU514612B2/en not_active Ceased
- 1976-12-22 FI FI763684A patent/FI67209C/fi not_active IP Right Cessation
- 1976-12-22 JP JP51154802A patent/JPS5278841A/ja active Granted
- 1976-12-22 BG BG034978A patent/BG27524A3/xx unknown
- 1976-12-22 DD DD76203903A patent/DD134516A5/xx unknown
- 1976-12-22 BG BG037521A patent/BG28256A4/xx unknown
- 1976-12-22 DD DD7600196549A patent/DD130033A6/xx unknown
- 1976-12-22 DD DD76203902A patent/DD134836A5/xx unknown
-
1980
- 1980-12-24 AU AU65872/80A patent/AU531431B2/en not_active Ceased
-
1981
- 1981-06-05 KE KE3135A patent/KE3135A/xx unknown
-
1982
- 1982-12-30 MY MY76/82A patent/MY8200076A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU531431B2 (en) | 1983-08-25 |
| BE849681R (fr) | 1977-06-21 |
| FI763684A7 (cs) | 1977-06-23 |
| MY8200076A (en) | 1982-12-31 |
| FI67209C (fi) | 1985-02-11 |
| BG28256A4 (bg) | 1980-03-25 |
| IL51079A (en) | 1981-11-30 |
| CH618076A5 (cs) | 1980-07-15 |
| IN145613B (cs) | 1978-11-18 |
| SE7614384L (sv) | 1977-06-23 |
| DD134836A5 (de) | 1979-03-28 |
| IT1066705B (it) | 1985-03-12 |
| OA05519A (fr) | 1981-04-30 |
| AU514612B2 (en) | 1981-02-19 |
| JPS615469B2 (cs) | 1986-02-18 |
| CA1100998A (en) | 1981-05-12 |
| PT66000A (en) | 1977-01-01 |
| PT66000B (en) | 1978-06-16 |
| BG27524A3 (bg) | 1979-11-12 |
| IE44488B1 (en) | 1981-12-16 |
| DE2657327A1 (de) | 1977-07-07 |
| DD130033A6 (de) | 1978-03-01 |
| JPS5278841A (en) | 1977-07-02 |
| FI67209B (fi) | 1984-10-31 |
| KE3135A (en) | 1981-07-03 |
| AU2084076A (en) | 1978-06-29 |
| DD134516A5 (de) | 1979-03-07 |
| AT362612B (de) | 1981-06-10 |
| IL51079A0 (en) | 1977-02-28 |
| IE44488L (en) | 1977-06-22 |
| GB1573014A (en) | 1980-08-13 |
| ATA949076A (de) | 1980-10-15 |
| SE442109B (sv) | 1985-12-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK377678A (da) | 3,4,5-trihydroxypiperidinderivater deres fremstilling og anvendelse | |
| DK384576A (da) | Heteroarylbenzoxepin-eddikesyrederivater, deres fremstilling og anvendelser | |
| NO149384C (no) | 2`,3,6`-triklor-4-cyano-4`-benzoyl-ureido-difenyleter og deres anvendelse som insekticid | |
| DK174776A (da) | 1,1,1-triaryl-alkylaminer samt deres fremstilling og anvendelse | |
| DK534076A (da) | Pyrimido-(1,2a)-heterocycliske forbindelser samt deres fremstilling og anvendelse | |
| DK19777A (da) | Thiazolidinderivater, deres fremstilling og anvendelser | |
| DK270077A (da) | 6,7-benzomorphanderivater og fremgangsmade til deres fremstillling | |
| SE7609769L (sv) | 1,2-bensisoxazolderivat | |
| DK191375A (da) | Isoflavonderivater, deres fremstilling og anvendelse | |
| FR2297628A1 (fr) | 2,3-dihydroergolines | |
| HU172460B (hu) | Sposob poluchenija novykh proizvodnykh 5,6-digidro-3h-pirimidin-4-ona | |
| SE7607683L (sv) | 9-hydroxi-7,8,9,10-tetrahydro-6h-dibenso/b//d/-pyraner och-pyranoner | |
| FR2321470A1 (fr) | 1,1-dichloro-4-methyl-3-hydroxy-pentene-(1) et sa preparation | |
| DK523176A (da) | Substituerede tetraalkylpiperidin-4-oximer deres fremstilling og anvendelse | |
| DK441376A (da) | 4-pyrazolyl-4h-1,2,4-triazoler samt deres fremstilling og anvendelse | |
| DK51677A (da) | Benzamider, deres fremstilling og anvendelser | |
| DK414976A (da) | Benzimidazolderivater, deres fremstilling og anvendelser | |
| DK501976A (da) | Imidazolidindionderivater deres fremstilling og anvendelse | |
| DK102376A (da) | Benzimidazo-/1,2a/-quinoliner deres fremstilling og anvendelser | |
| DK252576A (da) | Substituerede 1,2,4-oxadiazolidin-3-on-forbindelser, deres fremstilling og anvendelse | |
| NL7609285A (nl) | Gesubstitueerde 2.6-diaminoantrachinonen en hun bereiding. | |
| DK574676A (da) | 2,6-dinitroanilin-derivater og deres anvendelser | |
| HU173573B (hu) | Sposob poluchenija novykh proizvodnykh 1,8-naftridina | |
| DK228577A (da) | Ferrocenderivater deres fremstilling og anvendelser | |
| DK235576A (da) | 1,2,3,4-tetrahydro-4-oxo-(-oxy-)-1-naphthylurinstoffer samt deres fremstilling og anvendelse |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AHB | Application shelved due to non-payment |