DK423780A - Saede isaer til en gynge - Google Patents
Saede isaer til en gyngeInfo
- Publication number
- DK423780A DK423780A DK423780A DK423780A DK423780A DK 423780 A DK423780 A DK 423780A DK 423780 A DK423780 A DK 423780A DK 423780 A DK423780 A DK 423780A DK 423780 A DK423780 A DK 423780A
- Authority
- DK
- Denmark
- Prior art keywords
- isaes
- saed
- swing
- saed isaes
- Prior art date
Links
- NQTSTBMCCAVWOS-UHFFFAOYSA-N 1-dimethoxyphosphoryl-3-phenoxypropan-2-one Chemical compound COP(=O)(OC)CC(=O)COC1=CC=CC=C1 NQTSTBMCCAVWOS-UHFFFAOYSA-N 0.000 title 1
- 238000000101 transmission high energy electron diffraction Methods 0.000 title 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63G—MERRY-GO-ROUNDS; SWINGS; ROCKING-HORSES; CHUTES; SWITCHBACKS; SIMILAR DEVICES FOR PUBLIC AMUSEMENT
- A63G9/00—Swings
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7934891 | 1979-10-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK423780A true DK423780A (da) | 1981-04-09 |
Family
ID=10508367
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK423780A DK423780A (da) | 1979-10-08 | 1980-10-07 | Saede isaer til en gynge |
Country Status (9)
| Country | Link |
|---|---|
| EP (1) | EP0027035A1 (da) |
| JP (1) | JPS5695086A (da) |
| AU (1) | AU6285680A (da) |
| BE (1) | BE885566A (da) |
| DE (2) | DE3037387A1 (da) |
| DK (1) | DK423780A (da) |
| ES (1) | ES260958Y (da) |
| FR (1) | FR2467006A1 (da) |
| IT (1) | IT1133045B (da) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2215351A (en) * | 1988-03-01 | 1989-09-20 | Sutcliffe Group Ltd | Swing seats |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2225737A (en) * | 1938-09-26 | 1940-12-24 | American Playground Device Co | Swing seat |
| GB1457271A (en) * | 1973-02-01 | 1976-12-01 | Wicksteed Co Ltd Charles | Swing seat |
| US3897056A (en) * | 1973-10-16 | 1975-07-29 | Turco Mfg Co | Safety strap swing seat |
| GB1535728A (en) * | 1975-03-06 | 1978-12-13 | Sutcliffe Eng Holdings | Seat for a swing |
| US4052095A (en) * | 1975-11-05 | 1977-10-04 | Buffalo Weaving And Belting Co. | Synthetic organic polymeric sling protected by vulcanized or cured elastomeric laminate at load contacting area thereof |
| GB2040697B (en) * | 1979-02-05 | 1982-12-08 | Thomas A E | Swing |
-
1980
- 1980-10-01 AU AU62856/80A patent/AU6285680A/en not_active Abandoned
- 1980-10-02 EP EP80303477A patent/EP0027035A1/en not_active Withdrawn
- 1980-10-03 DE DE19803037387 patent/DE3037387A1/de not_active Ceased
- 1980-10-03 DE DE19808026441U patent/DE8026441U1/de not_active Expired
- 1980-10-06 IT IT49827/80A patent/IT1133045B/it active
- 1980-10-07 ES ES1980260958U patent/ES260958Y/es not_active Expired
- 1980-10-07 JP JP14035880A patent/JPS5695086A/ja active Pending
- 1980-10-07 DK DK423780A patent/DK423780A/da unknown
- 1980-10-07 BE BE0/202361A patent/BE885566A/fr not_active IP Right Cessation
- 1980-10-08 FR FR8021472A patent/FR2467006A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| AU6285680A (en) | 1981-04-16 |
| ES260958U (es) | 1982-04-16 |
| DE8026441U1 (de) | 1981-02-26 |
| BE885566A (fr) | 1981-02-02 |
| DE3037387A1 (de) | 1981-04-23 |
| IT1133045B (it) | 1986-07-09 |
| JPS5695086A (en) | 1981-08-01 |
| ES260958Y (es) | 1982-11-16 |
| EP0027035A1 (en) | 1981-04-15 |
| FR2467006A1 (fr) | 1981-04-17 |
| IT8049827A0 (it) | 1980-10-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK155485C (da) | Konditionerings-slaamaskine | |
| PL205461A1 (pl) | Srodek chwastobojczy | |
| PL210379A1 (pl) | Srodek chwastobojczy | |
| SE7803890L (sv) | Guajakonsyra a | |
| IT1134339B (it) | Complesso per mulini a taburo | |
| IT7869556A0 (it) | Perfezionamenti a valvole | |
| IT7849112A0 (it) | Valvola a contraccolpo | |
| PL208435A1 (pl) | Srodek chwastobojczy | |
| AU2460677A (en) | A concrete paving-stone | |
| HK32282A (en) | A morphanthridine derivative | |
| SE7807771L (sv) | Styrdon for en tyristor | |
| PL207767A1 (pl) | Srodek chwastobojczy | |
| PL210032A1 (pl) | Srodek chwastobojczy | |
| PL204307A1 (pl) | Srodek chwastobojczy | |
| IT1192589B (it) | Aloctina a | |
| PT70851A (pt) | Jonction a rotule | |
| PL203976A1 (pl) | Srodek chwastobojczy | |
| PL207194A1 (pl) | Srodek chwastobojczy | |
| DK423780A (da) | Saede isaer til en gynge | |
| PL207278A1 (pl) | Srodek chwastobojczy | |
| SE401961B (sv) | Fodral for en grammofonskiva | |
| IT7849128A0 (it) | Molino a battente | |
| FR2475421B1 (fr) | Broyeur a machoires | |
| PL195737A1 (pl) | Srodek chwastobojczy | |
| BE867656A (fr) | Transtockeur a fourches ecartables |